diff --git a/.gitignore b/.gitignore index d5f0d56..9041ca5 100644 --- a/.gitignore +++ b/.gitignore @@ -1,4 +1,3 @@ **/calc **/.ipynb_checkpoints **/*:Zone.Identifier -_build diff --git a/msspecbook/_build/html/.buildinfo b/msspecbook/_build/html/.buildinfo new file mode 100644 index 0000000..a78a743 --- /dev/null +++ b/msspecbook/_build/html/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: 0b896abf2c995b3493312dcbe0e8b47f +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/msspecbook/_build/html/Activity01/Activity01.html b/msspecbook/_build/html/Activity01/Activity01.html new file mode 100644 index 0000000..9a9bd3a --- /dev/null +++ b/msspecbook/_build/html/Activity01/Activity01.html @@ -0,0 +1,1172 @@ + + + + + + + + + + + Activity 1: Getting started — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 1: Getting started

+ +
+ +
+
+ + + + +
+ +
+

Activity 1: Getting started#

+

MsSpec is a Fortran code with two components: Phagen (Written by R. Natoli) and Spec (written by D. Sébilleau). Phagen computes the phase shifts of the electronic wave propagating in the matter on a spherical harmonics basis. Spec uses those phase shifts to compute the multiple scattering process and simulate the intensity of different electronic spectroscopies.

+

In the most recent version of MsSpec, the program is interfaced with python (https://msspec.cnrs.fr/), allowing for much more flexibility and interplay with other simulation techniques.

+
+

Building atomic systems#

+

MsSpec works in the cluster approach. Building such a cluster for a calculation is a fundamental step. +We use the python Atomic Simulation Environment (ASE) for this.

+

ASE is a set of tools and Python modules for setting up, manipulating, running, visualizing and analyzing atomistic simulations. +Building atomic systems, structures… is pretty straightforward:

+
+
+
# To build a molecule with ASE
+from ase.build import molecule
+# To view
+from ase.visualize import view
+
+# Create a water molecule
+water = molecule('H2O')
+# Display it
+view(water)
+
+
+
+
+
+
+
+ + ASE atomic visualization + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+

Barebone script for MsSpec#

+

MsSpec can simulate different electronic spectroscopies like PED, AED, LEED, EXAFS, APECS and more will be included in the forthcoming version. However, it is really well-suited for PhotoElectron Diffraction simulation, and the python interface is only fully available for it at the moment. Since PED covers all the MsSpec features and concepts, we will focus on this technique.

+

There are typically 3 steps to follow to get a result with MsSpec:

+
    +
  1. Create a cluster

  2. +
  3. Create an ASE calculator

  4. +
  5. Run the simulation

  6. +
+
+

PED polar scan for Cu(001)#

+
1from ase.io import read
+2from msspec.calculator import MSSPEC
+3
+4
+5cluster = read('copper.cif')
+6# view the cluster
+7cluster.edit()
+8
+
+
+
+
+
+ + ASE atomic visualization + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
 9# The "emitter" atom is located in the middle of the 3rd plane
+10cluster.emitter = 10
+11
+12# Create a "calculator"
+13calc = MSSPEC(spectroscopy='PED', algorithm='inversion')
+14calc.set_atoms(cluster)
+15
+16data = calc.get_theta_scan(level='2p3/2')
+17
+18# Plot the result with the interactive GUI
+19data.view()
+20
+21# Or plot using matplotlib directly
+22from matplotlib import pyplot as plt
+23data[0].views[0].plot()
+24plt.show()
+
+
+
+../_images/fig1.png + +
+

Fig. 1 Cu(2p) polar scan for the copper cluster above#

+
+
+
+
+
+

Shaping a cluster#

+
+ +
+

Based on the previous *.cif file, create a new cluster without the deepest plane and run the same calculation for the same emitter

+
+

Note

+

As the cluster will contain fewer atoms, the emitter index will be different

+
+

What do you conclude ?

+
+
+
+
+../_images/fig2.png + +
+

Fig. 2 Comparison between 4 and 3 planes for an emitter in the 3rd plane.#

+
+
+

Not all atoms contribute equally to the total signal. Some of them can be removed to save computation time and memory.

+
+

The number of atoms used for the calculation greatly impact the calculation time and memory. Most of the time, a cluster is shaped as an hemisphere to minimize the number of atoms to take into account

+
+
+
from msspec.calculator import MSSPEC
+from msspec.utils import hemispherical_cluster, get_atom_index
+from ase.build import bulk
+from ase.visualize import view
+
+copper = bulk('Cu', cubic=True)
+cluster = hemispherical_cluster(copper, planes=3, emitter_plane=2)
+cluster.emitter = get_atom_index(cluster, 0,0,0)
+
+view(cluster)
+
+
+
+
+
+
+
+ + ASE atomic visualization + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+../_images/fig3.png + +
+

Fig. 3 Cu(2p) polar scan for the hemispherical cluster.#

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity02/Activity02.html b/msspecbook/_build/html/Activity02/Activity02.html new file mode 100644 index 0000000..93de9c4 --- /dev/null +++ b/msspecbook/_build/html/Activity02/Activity02.html @@ -0,0 +1,1557 @@ + + + + + + + + + + + Activity 2: Setting up the “experiment” — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 2: Setting up the “experiment”

+ +
+ +
+
+ + + + +
+ +
+

Activity 2: Setting up the “experiment”#

+

To model a spectroscopy experiment, some parameters need to be correctly defined. In MsSpec, parameters are grouped in different categories (detector_parameters, source_parameters, calculation_parameters…). Each category is an attribute of your calculator object and contains different parameters. +For example, to define the angle of the incoming light with respect to the sample normal direction, you will use

+
# (assuming your calculator variable is calc)
+# e.g: Incoming X-Ray light is 30° from the sample normal
+calc.source_parameters.theta = 30
+
+
+
+

Sb-induced smooth growth of Ag on Ag(111) example#

+

To see how some parameters - not related to the cluster shape - may change the results, we will look at the effect of two parameters:

+
    +
  1. The source direction

  2. +
  3. The inner potential of the sample

  4. +
+

The inner potential is material specific. It will add to the photoelectron kinetic energy inside the material. When the photoelectron escapes the sample, this internal potential is missing and this will create an energy step that will act as a refraction for the photoelectron intensity. The effect will be significant for large polar angles and for small kinetic energy of the photoelectron.

+

Let’s look at the effect of those parameters on the following example. +The idea is to use low energy photoelectron diffraction to see the substitution of Ag by Sb atoms on the surface plane.

+
+

See also

+

based on this paper from H. Cruguel et al. Phys. Rev. B 55 R16061

+
+
+

Building the cluster#

+

Let’s start by building the cluster

+
 1from ase.build import bulk
+ 2from ase.visualize import view
+ 3
+ 4from msspec.calculator import MSSPEC
+ 5from msspec.utils import hemispherical_cluster, get_atom_index, cut_plane
+ 6import numpy as np
+ 7from matplotlib import pyplot as plt
+ 8
+ 9# Create the silver cell
+10Ag = bulk('Ag', cubic=True)
+11# Orientate the cell in the [111] direction
+12Ag.rotate((1,1,1), (0,0,1), rotate_cell=True)
+13# Align the azimuth to match experimental reference
+14Ag.rotate(15, 'z', rotate_cell=True)
+15
+16# Create a cluster
+17cluster = hemispherical_cluster(Ag, diameter=20, emitter_plane=0)
+18cluster = cut_plane(cluster, z=-4.8)
+19cluster.emitter = get_atom_index(cluster, 0,0,0)
+20cluster[cluster.emitter].symbol = 'Sb'
+
+
+
+
+
+ + ASE atomic visualization + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+

Compute an azimuthal scan#

+

Now create a calculator and configure experimental parameters

+
25
+26# Define parameters
+27calc.source_parameters.theta = 0
+28calc.source_parameters.phi = 0
+29
+30calc.detector_parameters.angular_acceptance = 1
+31calc.detector_parameters.average_sampling = 'low'
+32
+33calc.muffintin_parameters.interstitial_potential = 0
+34
+
+
+

Finally, add those lines to compute the \(\phi\)-scan (in orange) and compare it to the experimental data (in blue).

+
34
+35# Compute an azimuthal scan
+36data = calc.get_phi_scan(level='4d', theta=40, phi=np.linspace(0,240,121), kinetic_energy=45)
+37
+38# Normalize data between [0,1] (to ease comparison with experimental data)
+39dset = data[0]
+40dset.cross_section -= dset.cross_section.min()
+41dset.cross_section /= dset.cross_section.max()
+42
+43# Add experimental data points in the dataset
+44x, y = np.loadtxt('data.txt').T
+45dset.add_columns(experiment=y)
+46
+47# Add points to view
+48view = dset.views[0]
+49view.select('phi', 'experiment', legend='Exp. data')
+50
+51# Popup GUI
+52data.view()
+53
+54# Remove temp. files
+55calc.shutdown()
+
+
+
+../_images/fig11.png + +
+

Fig. 4 Azimuthal (\(\phi\)) scan for Sb(4d) emitter in the top layer of Ag(111) at 45 eV kinetic energy.#

+
+
+

The agreement is not satisfactory although most of the features may be identified.

+
+ +
+

Try to change the source direction and the inner potential of Ag to better match the experiment…

+
+

Note

+

The cluster is smaller than it should for size convergence, but the calculation would take too much memory for this example

+
+
+
+
+
+../_images/fig21.png + +
+

Fig. 5 Azimuthal (\(\phi\)) scan for Sb(4d) emitter in the top layer of Ag(111) at 45 eV kinetic energy, with muffintin_parameters.interstitial_potential = 10.2 and source_parameters.theta = 22.5#

+
+
+
# Source geometry (the former SA73 beamline of the LURE synchrotron)
+# given in ref 6 of the paper...
+calc.source_parameters.theta = 22.5
+# Inner potential is generally between 10 and 20 eV for most metrials
+calc.muffintin_parameters.inner_potential = 10.2
+
+
+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity02/Untitled.html b/msspecbook/_build/html/Activity02/Untitled.html new file mode 100644 index 0000000..6dce9c3 --- /dev/null +++ b/msspecbook/_build/html/Activity02/Untitled.html @@ -0,0 +1,455 @@ + + + + + + + + + + + Activity 3: Adsorbates and the single scattering approach — My sample book + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 3: Adsorbates and the single scattering approach

+ +
+
+ +
+

Contents

+
+ +
+
+
+ + + + +
+ +
+

Activity 3: Adsorbates and the single scattering approach#

+
+

Oxygen on Rh(001)#

+

In a paper published in 1998, T. Gerber et al. used the quite high backscattering factor of Rhodium atoms to probe +the distance of Oxygen atoms adsorbed on a Rhodium surface. Some electrons coming from Oxygen atoms are ejected +toward the Rhodium surface. They are then backscattered and interfere with the direct signal comming from Oxygen atoms (see the figure below). They demonstrated both experimentally and numerically with a sinle scattering computation that this lead to a very accurate probe of adsorbed species that can be sensitive to bond length changes of the order of

+
+
+ + + + +
+ + + + + + +
+ +
+
+
+ +
+ + + +
+ + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity03/Activity03.html b/msspecbook/_build/html/Activity03/Activity03.html new file mode 100644 index 0000000..8135999 --- /dev/null +++ b/msspecbook/_build/html/Activity03/Activity03.html @@ -0,0 +1,743 @@ + + + + + + + + + + + Activity 3: Adsorbates and the single scattering approach — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 3: Adsorbates and the single scattering approach

+ +
+ +
+
+ + + + +
+ +
+

Activity 3: Adsorbates and the single scattering approach#

+

Photoelectron diffraction is widely used to study the adsorption of atoms or molecules on a crystalline surface. Photoelectrons from adsorbates are scattered by the underlying surface, carrying information about the adsorption site, bond length and/or molecule orientation…. Thanks to a simulation, such information becomes quantitative with a high degree of accuracy.

+

Calculations of the multiple scattering using matrix inversion have the great advantage of being exact, including all scattering paths. On the other hand, memory consumption soon becomes a problem as the kinetic energy and number of atoms to be considered increase. As an approximation, it is possible to only consider a single scattering from the emitter to any atom in the cluster. This approximation is extremely computationally fast and can give satisfactory results for adsorbates. We’ll see later that this approach is rather too simplistic for most cases.

+
+

Oxygen on Rh(001)#

+

In a paper published in 1998, T. Gerber et al. used the quite high backscattering factor of Rhodium atoms to probe the distance of Oxygen atoms adsorbed on a Rhodium surface. Some electrons coming from Oxygen atoms are ejected toward the Rhodium surface. They are then backscattered and interfere with the direct signal comming from Oxygen atoms (see the figure below). They demonstrated both experimentally and numerically with a sinle scattering computation that this lead to a very accurate probe of adsorbed species that can be sensitive to bond length changes of the order of \(\pm 0.02 \mathring{A}\).

+
+

See also

+

based on this paper from T. Greber et al. Phys. Rev. Lett. 81(8) p1654 (1998)

+
+
+RhO + +
+

Fig. 6 Interferences produced by the backscattering effect#

+
+
+
+

Computing the scattering factor#

+

To illustrate that photoelectrons emitted by Oxygen adsorbates towards the Rhodium surface can be backscattered, we will start by computing the scattering factor for both O and Rh atoms.

+
+ +
+

By using the Atoms class of the ase package, try to build a O-Rh chain where atoms are 4 Å apart. Here is the begining of the script. Try to complete the line of code and view your two-atoms chain.

+
from ase import Atoms
+from ase.visualize import view
+
+# Create an atomic chain O-Rh
+cluster = Atoms(... # Fill this line
+
+
+
+
+
+
+ + +Hide code cell content + +
+
from ase import Atoms
+from ase.visualize import view
+
+# Create an atomic chain O-Rh
+cluster = Atoms(['O', 'Rh'], positions = [(0,0,0), (0,0,4.)])
+
+
+
+
+
+
+
+
+ + ASE atomic visualization + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+

As previously, we create a calculator, we attach our 2 atoms cluster to this calculator and we define the first atom in the chain as the emitter

+
calc = MSSPEC(spectroscopy='PED')
+calc.set_atoms(cluster)
+cluster.emitter = 0
+
+
+
+ +
+

We use the get_scattering_factors method (see its documentation) to compute the scattering factors at 723 eV.

+

How large is the backscattering factor of Rhodium with respect to that of Oxygen ?

+
+
+
+
# Compute the scattering factor
+data = calc.get_scattering_factors(kinetic_energy=723)
+
+# Popup the results
+data.view()
+
+
+
+Scattering factors + +
+

Fig. 7 Polar representation of the scattering factor#

+
+
+
+
+
+

Interferences due to backscattering#

+

Let an Oxygen atom (in red) being adsorbed at a distance \(z_0\) of an fcc site of the Rh(111) surface.

+
+../_images/RhO_fig2a.jpg + +
+

Fig. 8 Small cluster used for the calculation.#

+
+
+

We will compute for different values of the adsorption height \(z_0\).

+
+ +
+

Complete the script below to compute the (\(\theta,\phi\)) scan of the photodiffraction of O(1s) adsorbed on a fcc site on Rh(111) surface.

+
 1from msspec.calculator import MSSPEC
+ 2from ase.build import fcc111, add_adsorbate
+ 3import numpy as np
+ 4
+ 5data = None
+ 6all_z = ... # -> Define a list of z values for the adsorbate
+ 7
+ 8for ... # -> Complete this for-loop over z values
+ 9    # construct the cluster
+10    cluster = fcc111('Rh', size = (2,2,1))
+11    cluster.pop(3)
+12    add_adsorbate(... # -> Put the oxygen atom on the fcc site
+13    cluster.emitter = ... # -> Oxygen is the last atom we added, so the indice is...
+14
+15    # Define a calculator for single scattering calculations
+16    calc = MSSPEC(spectroscopy='PED', algorithm='expansion')
+17    calc.calculation_parameters.scattering_order = 1
+18    calc.set_atoms(cluster)
+19
+20    # Compute
+21    data = calc.get_theta_phi_scan(level='1s', kinetic_energy=723, data=data)
+22
+23data.view()
+
+
+

As proposed in the comments, add a loop to vary the adsorption height of Oxygen between 1.10 and 1.65 Å. +What is the bond length difference between to intensity maxima ?

+
+
+
+
 1from msspec.calculator import MSSPEC
+ 2from ase.build import fcc111, add_adsorbate
+ 3import numpy as np
+ 4
+ 5data = None
+ 6all_z = np.arange(1.10, 1.65, 0.05)
+ 7
+ 8for zi, z0 in enumerate(all_z):
+ 9    # construct the cluster
+10    cluster = fcc111('Rh', size = (2,2,1))
+11    cluster.pop(3)
+12    add_adsorbate(cluster, 'O', z0, position='fcc')
+13    cluster.emitter = len(cluster) - 1
+14
+15    # Define a calculator for single scattering calculations
+16    calc = MSSPEC(spectroscopy='PED', algorithm='expansion')
+17    calc.calculation_parameters.scattering_order = 1
+18    calc.set_atoms(cluster)
+19
+20    # Compute
+21    data = calc.get_theta_phi_scan(level='1s', kinetic_energy=723, data=data)
+22    dset = data[-1]
+23    dset.title = "{:d}) z = {:.2f} angstroms".format(zi, z0)
+24
+25data.view()
+
+
+
+Scattering factors + +
+

Fig. 9 Stereographic projections of O(1s) emission at \(E_0\) = 723 eV for an oxygen atom +on top of a fcc site of 3 Rh atoms at various altitudes \(z_0\)#

+
+
+

You can see on the stereographic projection 3 bright circles representing fringes of constructive interference between the direct O(1s) photoelectron wave and that backscattered by the Rhodium atoms. The center of these annular shapes changes from bright to dark due to the variation of the Oxygen atom height above the surface which changes the path difference.

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity04/Activity04.html b/msspecbook/_build/html/Activity04/Activity04.html new file mode 100644 index 0000000..2ae9904 --- /dev/null +++ b/msspecbook/_build/html/Activity04/Activity04.html @@ -0,0 +1,552 @@ + + + + + + + + + + + Activity 4: From single scattering to multiple scattering — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 4: From single scattering to multiple scattering

+ +
+
+ +
+
+
+ + + + +
+ +
+

Activity 4: From single scattering to multiple scattering#

+
+Ni chain + +
+

Fig. 10 Polar scan of a Ni chain of 2-5 atoms for single and mutliple (5th order) scattering.#

+
+
+
+

See also

+

based on this paper from M.-L. Xu et al. +Phys. Rev. B 39 p8275 (1989)

+
+
 1# coding: utf-8
+ 2
+ 3# import all we need and start by msspec
+ 4from msspec.calculator import MSSPEC
+ 5
+ 6# we will build a simple atomic chain
+ 7from ase  import Atom, Atoms
+ 8
+ 9# we need some numpy functions
+10import numpy as np
+11
+12
+13symbol = 'Ni'            # The kind of atom for the chain
+14orders = (1, 5)          # We will run the calculation for single scattering
+15                         # and multiple scattering (5th diffusion order)
+16chain_lengths = (2,3,5)  # We will run the calculation for differnt lengths
+17                         # of the atomic chain
+18a = 3.499 * np.sqrt(2)/2 # The distance bewteen 2 atoms
+19
+20# Define an empty variable to store all the results
+21all_data = None
+22
+23# 2 for nested loops over the chain length and the order of diffusion
+24for chain_length in chain_lengths:
+25    for order in orders:
+26        # We build the atomic chain by
+27        #    1- stacking each atom one by one along the z axis
+28        chain = Atoms([Atom(symbol, position = (0., 0., i*a)) for i in
+29                       range(chain_length)])
+30        #    2- rotating the chain by 45 degrees with respect to the y axis
+31        #chain.rotate('y', np.radians(45.))
+32        chain.rotate(45., 'y')
+33        #    3- setting a custom Muffin-tin radius of 1.5 angstroms for all
+34        #       atoms (needed if you want to enlarge the distance between
+35        #       the atoms while keeping the radius constant)
+36        #[atom.set('mt_radius', 1.5) for atom in chain]
+37        #    4- defining the absorber to be the first atom in the chain at
+38        #       x = y = z = 0
+39        chain.absorber = 0
+40
+41        # We define a new PED calculator
+42        calc = MSSPEC(spectroscopy = 'PED')
+43        calc.set_atoms(chain)
+44        # Here is how to tweak the scattering order
+45        calc.calculation_parameters.scattering_order = order
+46        # This line below is where we actually run the calculation
+47        all_data = calc.get_theta_scan(level='3s', #kinetic_energy=1000.,
+48                            theta=np.arange(0., 80.), data=all_data)
+49
+50        # OPTIONAL, to improve the display of the data we will change the dataset
+51        # default title as well as the plot title
+52        t = "order {:d}, n = {:d}".format(order, chain_length) # A useful title
+53        dset = all_data[-1]         # get the last dataset
+54        dset.title = t              # change its title
+55        # get its last view (there is only one defined for each dataset)
+56        v = dset.views()[-1]
+57        v.set_plot_options(title=t) # change the title of the figure
+58
+59
+60
+61# OPTIONAL, set the same scale for all plots
+62# 1. iterate over all computed cross_sections to find the absolute minimum and
+63# maximum of the data
+64min_cs = max_cs = 0
+65for dset in all_data:
+66    min_cs = min(min_cs, np.min(dset.cross_section))
+67    max_cs = max(max_cs, np.max(dset.cross_section))
+68
+69# 2. for each view in each dataset, change the scale accordingly
+70for dset in all_data:
+71    v = dset.views()[-1]
+72    v.set_plot_options(ylim=[min_cs, max_cs])
+73
+74# Pop up the graphical window
+75all_data.view()
+76# You can end your script with the line below to remove the temporary
+77# folder needed for the calculation
+78calc.shutdown()
+
+
+
+ +
+

Some questions to answer

+
+
+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity05/Activity05.html b/msspecbook/_build/html/Activity05/Activity05.html new file mode 100644 index 0000000..5296ebb --- /dev/null +++ b/msspecbook/_build/html/Activity05/Activity05.html @@ -0,0 +1,1196 @@ + + + + + + + + + + + Activity 5: Multiple scattering in the forward scattering regime — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 5: Multiple scattering in the forward scattering regime

+ +
+ +
+
+ + + + +
+ +
+

Activity 5: Multiple scattering in the forward scattering regime#

+

In photoelectron diffraction, it is well known that for high photoelectron kinetic energy (typically > 900 eV), the scattering factor is strongly peaked in the forward direction. It means that photoelectrons are almost not deviated after a scattering event.

+

Peaks of intentisity are then usually observed for dense atomic directions of the sample. This is the forward scattering approximation.

+

For such high kinetic energy, multiple scattering is needed to accurately describe the measured intensity, but the matrix inversion algorithm cannot be used since the memory needed for storing the matrix itself would be generally too large. The matrix will contain +\((N \times (L_{max}+1)^2)^2\) elements of complex type with double precision (64 bits) where \(N\) is the number of atoms and \(L_{max}\) is the number of spherical harmonics used to expand the electron wave around each atomic center. As the kinetic energy increases, the mean free path (MFP) of the photoelectron is larger and the number of atoms in the cluster has to be greater. Lmax also increases with the kinetic energy.

+
+ +
+

Try to evaluate how much memory you would need for this matrix for a hemispherical cluster of copper 15 angströms thick (1 MFP) for \(L_{max} = 25\) ?

+
+
+
+
+ + +Hide code cell content + +
+
import numpy as np
+
+# lattice constant of fcc copper
+a = 3.6
+# radius of the cluster
+r = 15
+# volume of the cluster
+V = .5 * (4/3) * np.pi * r**3
+# volume of the cell
+v = a**3
+# number of atoms in the unit cell
+n = 4
+# number of atoms in the cluster
+N = int(V/v * n)
+
+Lmax = 25
+M = (N * (Lmax+1)**2 )**2 * 2 * 64 / 8
+print(f"{N:d} atoms, {M/1e12:.3f} TB")
+
+
+
+
+
606 atoms, 2.685 TB
+
+
+
+
+
+

This is too much memory. We will use another algorithm available in MsSpec: The Rehr-Albers series expansion. We already used that algorithm in activity 3 for the single scattering approach. But this time, we will explore a bit more the effect of the scattering order > 1

+
+

PED of the 1T-TiSe2 surface#

+

Let us try to model the Ti2p XPD pattern of the transition metal dichalcogenide 1T-TiSe2.

+
+

See also

+

based on this paper from M.V. Kuznetsov et al. +Surf. Sci. 606 p1760–70 (2012)

+
+
+

Creating the TiSe2 cluster#

+

Start by creating a small cluster of 1T-TiSe2 using the mx2 function of ase.build and the hemispherical_cluster function of msspec.utils.

+
+TiSe2 + +
+

Fig. 11 Structure of 1T-TiSe2 (\(a_0=b_0=3.535\) Å, \(c_0=6.004\) Å, \(d=3.450\) Å, \(D=2.554\) Å)#

+
+
+
+ +
+

Complete the code snipet provided below to create a small TiSe2 cluster with Ti emitter in the 2nd plane:

+
 1from ase.build import mx2
+ 2from ase.visualize import view
+ 3from msspec.calculator import MSSPEC
+ 4from msspec.utils import hemispherical_cluster, get_atom_index
+ 5
+ 6# Some usefull constants (a, c, d, D) for defining the structure
+ 7a=...
+ 8
+ 9# Create the TiSe2 trilayer
+10# use ase help for this function
+11TiSe2 = mx2(formula=...)
+12
+13# The preious cell is 2D, let's define the c-axis to take into account 
+14# the Van der Waals gap between trilayers
+15TiSe2.cell[2] = [0, 0, ...]
+16
+17# To be aligned like in the paper
+18TiSe2.rotate(60, 'z', rotate_cell=True)
+19
+20# Since the material is multi-elements, "tag" each inequivalent atom 
+21# of the unit cell with a number. The "Ti" atom is tagged 0 and "Se" 
+22# atoms are 1 and 2.
+23for i in range(3): 
+24    TiSe2[i].tag = i
+25
+26cluster = hemispherical_cluster(TiSe2, emitter_tag=..., emitter_plane=..., planes=5)
+27cluster.emitter = get_atom_index(cluster, 0, 0, 0)
+28
+29view(cluster)
+30
+
+
+
+
+
+
+ + +Hide code cell content + +
+
from ase.build import mx2
+from ase.visualize import view
+from msspec.calculator import MSSPEC
+from msspec.utils import hemispherical_cluster, get_atom_index
+
+# Some usefull constants (a, c, d, D) for defining the structure
+a=3.535;c=6.004;d=3.450;D=2.554
+
+# Create the TiSe2 trilayer
+# use ase help for this function
+TiSe2 = mx2(formula='TiSe2', kind='1T', a=a, thickness=d, size=(1, 1, 1), vacuum=None)
+
+# The preious cell is 2D, let's define the c-axis to take into account 
+# the Van der Waals gap between trilayers
+TiSe2.cell[2] = [0, 0, c]
+
+# To be aligned like in the paper
+TiSe2.rotate(60, 'z', rotate_cell=True)
+
+# Since the material is multi-elements, "tag" each inequivalent atom 
+# of the unit cell with a number. The "Ti" atom is tagged 0 and "Se" 
+# atoms are 1 and 2.
+for i in range(3): 
+    TiSe2[i].tag = i
+
+cluster = hemispherical_cluster(TiSe2, emitter_tag=0, emitter_plane=1, planes=5)
+cluster.emitter = get_atom_index(cluster, 0, 0, 0)
+
+
+
+
+
+
+
+
+ + ASE atomic visualization + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+
+
+
+

Effect of the scattering order#

+

Use the line belows to create a calculator and compute a \(\theta\)-\(\phi\) scan of the Ti(2p)

+
# Create a calculator with Rehr-Albers series expansion algorithm
+calc = MSSPEC(spectroscopy='PED', algorithm='expansion')
+calc.set_atoms(cluster)
+
+data = None
+for ndif in range(1,4):    
+    calc.calculation_parameters.scattering_order = ndif
+    data = calc.get_theta_phi_scan(level='2p', kinetic_energy=1030, data=data)
+
+data.view()
+
+
+
+ +
+

Compute a scan for an emitter in the first trilayer and in the second trilayer for scattering orders from 1 (single scattering) to 3 in order to complete the figure below. +What do you conclude about the value of the calc.calculation_parameters.scattering_order ?

+
+../_images/results.jpg + +
+

Fig. 12 \(\theta\)-\(\phi\) scan of Ti(2p) at 1030 eV kinetic energy for an emitter in the first trilayer (left column) and in the second trilayer (right column). Each row correspond to a growing value for the calc.calculation_parameters.scattering_order parameter (from 1 to 5).#

+
+
+
+
+
+
+../_images/results_completed.jpg + +
+

Fig. 13 \(\theta\)-\(\phi\) scan of Ti(2p) at 1030 eV kinetic energy for an emitter in the first trilayer (left column) and in the second trilayer (right column). Each row correspond to a growing value for the calc.calculation_parameters.scattering_order parameter (from 1 to 5).#

+
+
+

The deeper the emitter, the greater the scattering order should be for the intensity to converge. +Typically, in the forward scattering regime, the scattering order corresponds to the number of planes above the emitter.

+
+
+
+
+ + + + +
+ + + + + + + + +
+ + + + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity06/Activity06.html b/msspecbook/_build/html/Activity06/Activity06.html new file mode 100644 index 0000000..cf802b9 --- /dev/null +++ b/msspecbook/_build/html/Activity06/Activity06.html @@ -0,0 +1,453 @@ + + + + + + + + + + + Activity 6: Effect of the temperature — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 6: Effect of the temperature

+ +
+
+ +
+
+
+ + + + +
+ +
+

Activity 6: Effect of the temperature#

+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity07/Activity07.html b/msspecbook/_build/html/Activity07/Activity07.html new file mode 100644 index 0000000..7d8a0c3 --- /dev/null +++ b/msspecbook/_build/html/Activity07/Activity07.html @@ -0,0 +1,453 @@ + + + + + + + + + + + Activity 7: Large clusters and path filtering — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 7: Large clusters and path filtering

+ +
+
+ +
+
+
+ + + + +
+ +
+

Activity 7: Large clusters and path filtering#

+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity08/Activity08.html b/msspecbook/_build/html/Activity08/Activity08.html new file mode 100644 index 0000000..eecfa88 --- /dev/null +++ b/msspecbook/_build/html/Activity08/Activity08.html @@ -0,0 +1,453 @@ + + + + + + + + + + + Activity 8: Inequivalent emitters and the XPD of a substrate — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 8: Inequivalent emitters and the XPD of a substrate

+ +
+
+ +
+
+
+ + + + +
+ +
+

Activity 8: Inequivalent emitters and the XPD of a substrate#

+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity09/Activity09.html b/msspecbook/_build/html/Activity09/Activity09.html new file mode 100644 index 0000000..c4f1d25 --- /dev/null +++ b/msspecbook/_build/html/Activity09/Activity09.html @@ -0,0 +1,453 @@ + + + + + + + + + + + Activity 9: Comparing simulation and experiment with R-factors — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 9: Comparing simulation and experiment with R-factors

+ +
+
+ +
+
+
+ + + + +
+ +
+

Activity 9: Comparing simulation and experiment with R-factors#

+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity10/Activity10.html b/msspecbook/_build/html/Activity10/Activity10.html new file mode 100644 index 0000000..bc077b5 --- /dev/null +++ b/msspecbook/_build/html/Activity10/Activity10.html @@ -0,0 +1,453 @@ + + + + + + + + + + + Activity 10: Auger Electron Diffraction — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 10: Auger Electron Diffraction

+ +
+
+ +
+
+
+ + + + +
+ +
+

Activity 10: Auger Electron Diffraction#

+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/Activity11/Activity11.html b/msspecbook/_build/html/Activity11/Activity11.html new file mode 100644 index 0000000..9e08c32 --- /dev/null +++ b/msspecbook/_build/html/Activity11/Activity11.html @@ -0,0 +1,453 @@ + + + + + + + + + + + Activity 11: Spectral radius and convergence — MsSpec Tour + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + +
+ + + + + + + + + + +
+
+
+
+
+ +
+ +
+ + + + + +
+
+ + + +
+ + + + + + + + + + + + + +
+ +
+ + + +
+ +
+
+ +
+
+ +
+ +
+ +
+ + +
+ +
+ +
+ + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+ + + +
+

Activity 11: Spectral radius and convergence

+ +
+
+ +
+
+
+ + + + +
+ +
+

Activity 11: Spectral radius and convergence#

+
+ + + + +
+ + + + + + + + +
+ + + + +
+ + + +
+
+
+ + + + + + + + \ No newline at end of file diff --git a/msspecbook/_build/html/_images/28b8d4113ee5a8f5a9668740424342a75008f1210aeb53cb8bda82b692e85cef.png b/msspecbook/_build/html/_images/28b8d4113ee5a8f5a9668740424342a75008f1210aeb53cb8bda82b692e85cef.png new file mode 100644 index 0000000..486d80c Binary files /dev/null and b/msspecbook/_build/html/_images/28b8d4113ee5a8f5a9668740424342a75008f1210aeb53cb8bda82b692e85cef.png differ diff --git a/msspecbook/_build/html/_images/4aba63cb77359fa4461d31cebd3b9090c7ee08ffddf627ba2816d1070fec799d.png b/msspecbook/_build/html/_images/4aba63cb77359fa4461d31cebd3b9090c7ee08ffddf627ba2816d1070fec799d.png new file mode 100644 index 0000000..973b5e2 Binary files /dev/null and b/msspecbook/_build/html/_images/4aba63cb77359fa4461d31cebd3b9090c7ee08ffddf627ba2816d1070fec799d.png differ diff --git a/msspecbook/_build/html/_images/62018c65f5ece35be4c73db28cd73782f95d82814a21e9bbbccf8e5f10892e88.png b/msspecbook/_build/html/_images/62018c65f5ece35be4c73db28cd73782f95d82814a21e9bbbccf8e5f10892e88.png new file mode 100644 index 0000000..fd83d20 Binary files /dev/null and b/msspecbook/_build/html/_images/62018c65f5ece35be4c73db28cd73782f95d82814a21e9bbbccf8e5f10892e88.png differ diff --git a/msspecbook/_build/html/_images/Ni_fig1.png b/msspecbook/_build/html/_images/Ni_fig1.png new file mode 100644 index 0000000..9064059 Binary files /dev/null and b/msspecbook/_build/html/_images/Ni_fig1.png differ diff --git a/msspecbook/_build/html/_images/RhO_fig0.jpg b/msspecbook/_build/html/_images/RhO_fig0.jpg new file mode 100644 index 0000000..e044564 Binary files /dev/null and b/msspecbook/_build/html/_images/RhO_fig0.jpg differ diff --git a/msspecbook/_build/html/_images/RhO_fig1.jpg b/msspecbook/_build/html/_images/RhO_fig1.jpg new file mode 100644 index 0000000..fe4211f Binary files /dev/null and b/msspecbook/_build/html/_images/RhO_fig1.jpg differ diff --git a/msspecbook/_build/html/_images/RhO_fig2a.jpg b/msspecbook/_build/html/_images/RhO_fig2a.jpg new file mode 100644 index 0000000..32b0af2 Binary files /dev/null and b/msspecbook/_build/html/_images/RhO_fig2a.jpg differ diff --git a/msspecbook/_build/html/_images/RhO_fig2b.gif b/msspecbook/_build/html/_images/RhO_fig2b.gif new file mode 100644 index 0000000..4c46e2d Binary files /dev/null and b/msspecbook/_build/html/_images/RhO_fig2b.gif differ diff --git a/msspecbook/_build/html/_images/TiSe2_cell.jpg b/msspecbook/_build/html/_images/TiSe2_cell.jpg new file mode 100644 index 0000000..b88e3c8 Binary files /dev/null and b/msspecbook/_build/html/_images/TiSe2_cell.jpg differ diff --git a/msspecbook/_build/html/_images/c41b3ebd197c86356db9547ef36fb025674245e1513f2a90ee96a2c22b5ea157.png b/msspecbook/_build/html/_images/c41b3ebd197c86356db9547ef36fb025674245e1513f2a90ee96a2c22b5ea157.png new file mode 100644 index 0000000..8cfb8e0 Binary files /dev/null and b/msspecbook/_build/html/_images/c41b3ebd197c86356db9547ef36fb025674245e1513f2a90ee96a2c22b5ea157.png differ diff --git a/msspecbook/_build/html/_images/e5c5ae7cdb98360092845880434b4ec3679a98ce9ac01766fdf027d777e9c94f.png b/msspecbook/_build/html/_images/e5c5ae7cdb98360092845880434b4ec3679a98ce9ac01766fdf027d777e9c94f.png new file mode 100644 index 0000000..119c6b5 Binary files /dev/null and b/msspecbook/_build/html/_images/e5c5ae7cdb98360092845880434b4ec3679a98ce9ac01766fdf027d777e9c94f.png differ diff --git a/msspecbook/_build/html/_images/fig1.png b/msspecbook/_build/html/_images/fig1.png new file mode 100644 index 0000000..23ae04a Binary files /dev/null and b/msspecbook/_build/html/_images/fig1.png differ diff --git a/msspecbook/_build/html/_images/fig11.png b/msspecbook/_build/html/_images/fig11.png new file mode 100644 index 0000000..c67eaea Binary files /dev/null and b/msspecbook/_build/html/_images/fig11.png differ diff --git a/msspecbook/_build/html/_images/fig2.png b/msspecbook/_build/html/_images/fig2.png new file mode 100644 index 0000000..00ed7d2 Binary files /dev/null and b/msspecbook/_build/html/_images/fig2.png differ diff --git a/msspecbook/_build/html/_images/fig21.png b/msspecbook/_build/html/_images/fig21.png new file mode 100644 index 0000000..b771bbc Binary files /dev/null and b/msspecbook/_build/html/_images/fig21.png differ diff --git a/msspecbook/_build/html/_images/fig3.png b/msspecbook/_build/html/_images/fig3.png new file mode 100644 index 0000000..b8583e8 Binary files /dev/null and b/msspecbook/_build/html/_images/fig3.png differ diff --git a/msspecbook/_build/html/_images/results.jpg b/msspecbook/_build/html/_images/results.jpg new file mode 100644 index 0000000..a56b1be Binary files /dev/null and b/msspecbook/_build/html/_images/results.jpg differ diff --git a/msspecbook/_build/html/_images/results_completed.jpg b/msspecbook/_build/html/_images/results_completed.jpg new file mode 100644 index 0000000..e787dbe Binary files /dev/null and b/msspecbook/_build/html/_images/results_completed.jpg differ diff --git a/msspecbook/_build/html/_sources/Activity01/Activity01.ipynb b/msspecbook/_build/html/_sources/Activity01/Activity01.ipynb new file mode 100644 index 0000000..037a7c2 --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity01/Activity01.ipynb @@ -0,0 +1,953 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "7e31b322-df55-44ed-9f29-6f6efa71eafe", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "# Activity 1: Getting started\n", + "\n", + "MsSpec is a Fortran code with two components: Phagen (Written by R. Natoli) and Spec (written by D. Sébilleau). Phagen computes the phase shifts of the electronic wave propagating in the matter on a spherical harmonics basis. Spec uses those phase shifts to compute the multiple scattering process and simulate the intensity of different electronic spectroscopies.\n", + "\n", + "In the most recent version of MsSpec, the program is interfaced with python (https://msspec.cnrs.fr/), allowing for much more flexibility and interplay with other simulation techniques.\n", + "\n", + "## Building atomic systems\n", + "\n", + "MsSpec works in the *cluster* approach. Building such a cluster for a calculation is a fundamental step.\n", + "We use the [python Atomic Simulation Environment (ASE)](https://wiki.fysik.dtu.dk/ase/) for this.\n", + "\n", + "ASE is a set of tools and Python modules for setting up, manipulating, running, visualizing and analyzing atomistic simulations.\n", + "Building atomic systems, structures... is pretty straightforward:" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "id": "07a04c8c-a268-481a-8f1b-14878ed771b5", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-output" + ] + }, + "outputs": [ + { + "data": { + "text/plain": [ + "" + ] + }, + "execution_count": 1, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "# To build a molecule with ASE\n", + "from ase.build import molecule\n", + "# To view\n", + "from ase.visualize import view\n", + "\n", + "# Create a water molecule\n", + "water = molecule('H2O')\n", + "# Display it\n", + "view(water)" + ] + }, + { + "cell_type": "code", + "execution_count": 2, + "id": "e09c7d97-eb35-49a7-b74a-9fb21a9a3aaf", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-input" + ] + }, + "outputs": [ + { + "data": { + "text/html": [ + "\n", + " \n", + " ASE atomic visualization\n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + "\n", + "\n" + ], + "text/plain": [ + "" + ] + }, + "execution_count": 2, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "view(water, viewer='x3d')" + ] + }, + { + "cell_type": "markdown", + "id": "94b690a2-52f0-43e4-953d-6e7519ac4e9c", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "## Barebone script for MsSpec\n", + "\n", + "MsSpec can simulate different electronic spectroscopies like PED, AED, LEED, EXAFS, APECS and more will be included in the forthcoming version. However, it is really well-suited for PhotoElectron Diffraction simulation, and the python interface is only fully available for it at the moment. Since PED covers all the MsSpec features and concepts, we will focus on this technique.\n", + "\n", + "There are typically 3 steps to follow to get a result with MsSpec:\n", + "\n", + "1. Create a *cluster*\n", + "2. Create an ASE *calculator*\n", + "3. Run the simulation\n", + "\n", + "### PED polar scan for Cu(001)" + ] + }, + { + "cell_type": "markdown", + "id": "da96a735-a028-4fe8-89ac-96f707323ae9", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "```{literalinclude} cu.py\n", + ":end-before: The \"emitter\"\n", + ":linenos:\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "id": "6ddd72a9-8f32-484f-9a3e-9ab3a85945a4", + "metadata": { + "editable": true, + "scrolled": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-input" + ] + }, + "outputs": [ + { + "data": { + "text/html": [ + "\n", + " \n", + " ASE atomic visualization\n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + "\n", + "\n" + ], + "text/plain": [ + "" + ] + }, + "execution_count": 1, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "from ase.io import read\n", + "from ase.visualize import view\n", + "from msspec.calculator import MSSPEC\n", + "\n", + "\n", + "cluster = read('copper.cif')\n", + "# view the cluster\n", + "view(cluster, viewer='x3d')" + ] + }, + { + "cell_type": "markdown", + "id": "a51b9284-ce53-48e2-bd4b-65fe3998cc33", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "```{literalinclude} cu.py\n", + ":start-at: The \"emitter\"\n", + ":lineno-match:\n", + "```\n", + ":::{figure-md} Cu-XPD\n", + "\n", + "\n", + "Cu(2p) polar scan for the copper cluster above\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "85c7dcac-9f0e-4a56-8077-c96f89865dcb", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "## Shaping a cluster" + ] + }, + { + "cell_type": "markdown", + "id": "ff63b7cb-5e31-44f8-b81b-d05bf0c775c0", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "Based on the previous *.cif file, create a new cluster without the deepest plane and run the same calculation for the same emitter\n", + "\n", + "```{note}\n", + "As the cluster will contain fewer atoms, the emitter index will be different\n", + "```\n", + "\n", + "What do you conclude ?\n", + ":::\n", + "\n", + "::::" + ] + }, + { + "cell_type": "markdown", + "id": "1590cc49-8788-4a7b-a051-74ce1168e744", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "```{toggle}\n", + "\n", + ":::{figure-md} Cu-4planes3planes\n", + "\n", + "\n", + "Comparison between 4 and 3 planes for an emitter in the 3{sup}`rd` plane.\n", + ":::\n", + "\n", + "Not all atoms contribute equally to the total signal. Some of them can be removed to save computation time and memory.\n", + "```" + ] + }, + { + "cell_type": "markdown", + "id": "102bfad0-f8ed-44ab-990f-9fb2eb5662b0", + "metadata": { + "editable": true, + "scrolled": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "hide-input" + ] + }, + "source": [ + "The number of atoms used for the calculation greatly impact the calculation time and memory. Most of the time, a cluster is shaped as an hemisphere to minimize the number of atoms to take into account" + ] + }, + { + "cell_type": "code", + "execution_count": 7, + "id": "f7ecc1d0-097d-4199-822a-c564e9e94337", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-output" + ] + }, + "outputs": [ + { + "data": { + "text/plain": [ + "" + ] + }, + "execution_count": 7, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "from msspec.calculator import MSSPEC\n", + "from msspec.utils import hemispherical_cluster, get_atom_index\n", + "from ase.build import bulk\n", + "from ase.visualize import view\n", + "\n", + "copper = bulk('Cu', cubic=True)\n", + "cluster = hemispherical_cluster(copper, planes=3, emitter_plane=2)\n", + "cluster.emitter = get_atom_index(cluster, 0,0,0)\n", + "\n", + "view(cluster)" + ] + }, + { + "cell_type": "code", + "execution_count": 8, + "id": "076f617d-599f-483d-b22c-38cebf41b28a", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-input" + ] + }, + "outputs": [ + { + "data": { + "text/html": [ + "\n", + " \n", + " ASE atomic visualization\n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + "\n", + "\n" + ], + "text/plain": [ + "" + ] + }, + "execution_count": 8, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "view(cluster, viewer='x3d')" + ] + }, + { + "cell_type": "markdown", + "id": "4a71c734-8c73-49a2-9f27-12157841405c", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + ":::{figure-md} Cu-hemi\n", + "\n", + "\n", + "Cu(2p) polar scan for the hemispherical cluster.\n", + ":::" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "e86ab1b3-fcf3-46e7-9cc7-f5e80becea9d", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity02/Activity02.ipynb b/msspecbook/_build/html/_sources/Activity02/Activity02.ipynb new file mode 100644 index 0000000..5fdeb7d --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity02/Activity02.ipynb @@ -0,0 +1,1207 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "88b65284-bdd1-4140-af28-526e77b9b4b6", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "# Activity 2: Setting up the \"experiment\"\n", + "\n", + "To model a spectroscopy experiment, some parameters need to be correctly defined. In MsSpec, parameters are grouped in different categories (`detector_parameters`, `source_parameters`, `calculation_parameters`...). Each category is an attribute of your calculator object and contains different parameters.\n", + "For example, to define the angle of the incoming light with respect to the sample normal direction, you will use\n", + "\n", + "```\n", + "# (assuming your calculator variable is calc)\n", + "# e.g: Incoming X-Ray light is 30° from the sample normal\n", + "calc.source_parameters.theta = 30\n", + "```\n", + "\n", + "\n", + "## Sb-induced smooth growth of Ag on Ag(111) example\n", + "\n", + "To see how some parameters - not related to the cluster shape - may change the results, we will look at the effect of two parameters:\n", + "\n", + "1. The source direction\n", + "2. The inner potential of the sample\n", + "\n", + "The inner potential is material specific. It will add to the photoelectron kinetic energy inside the material. When the photoelectron escapes the sample, this internal potential is missing and this will create an energy step that will act as a refraction for the photoelectron intensity. The effect will be significant for large polar angles and for small kinetic energy of the photoelectron.\n", + "\n", + "Let's look at the effect of those parameters on the following example.\n", + "The idea is to use low energy photoelectron diffraction to see the substitution of Ag by Sb atoms on the surface plane.\n", + "\n", + ":::{seealso}\n", + "based on this paper from H. Cruguel *et al.* [Phys. Rev. B **55** R16061](https://doi.org/10.1103/PhysRevB.55.R16061)\n", + ":::\n", + "\n", + "### Building the cluster\n", + "\n", + "Let's start by building the cluster" + ] + }, + { + "cell_type": "markdown", + "id": "e7e10211-80ea-49e3-99a4-c57fc3b39539", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "```{literalinclude} SbAg.py\n", + ":end-at: symbol = 'Sb' \n", + ":lineno-match:\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": 1, + "id": "0b0a420f-7074-443b-8cb4-1f609f5b123e", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-input" + ] + }, + "outputs": [ + { + "data": { + "text/html": [ + "\n", + " \n", + " ASE atomic visualization\n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + "\n", + "\n" + ], + "text/plain": [ + "" + ] + }, + "execution_count": 1, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "from ase.build import bulk\n", + "from ase.visualize import view\n", + "\n", + "from msspec.calculator import MSSPEC\n", + "from msspec.utils import hemispherical_cluster, get_atom_index, cut_plane\n", + "import numpy as np\n", + "from matplotlib import pyplot as plt\n", + "\n", + "# Create the silver cell\n", + "Ag = bulk('Ag', cubic=True)\n", + "# Orientate the cell in the [111] direction\n", + "Ag.rotate((1,1,1), (0,0,1), rotate_cell=True)\n", + "# Align the azimuth to match experimental reference\n", + "Ag.rotate(15, 'z', rotate_cell=True)\n", + "\n", + "# Create a cluster\n", + "cluster = hemispherical_cluster(Ag, diameter=20, emitter_plane=0)\n", + "cluster = cut_plane(cluster, z=-4.8)\n", + "cluster.emitter = get_atom_index(cluster, 0,0,0)\n", + "cluster[cluster.emitter].symbol = 'Sb'\n", + "\n", + "view(cluster, viewer='x3d')" + ] + }, + { + "cell_type": "markdown", + "id": "ae74eedc-5ea4-4782-a49a-dcc2feac6c7c", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "### Compute an azimuthal scan\n", + "\n", + "Now create a calculator and configure experimental parameters" + ] + }, + { + "cell_type": "markdown", + "id": "a4fed04e-e209-4cdd-822d-dc03a0f65caa", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "```{literalinclude} SbAg.py\n", + ":start-after: set_atoms\n", + ":end-before: Compute\n", + ":lineno-match:\n", + ":emphasize-lines: 3,9\n", + "```" + ] + }, + { + "cell_type": "markdown", + "id": "c36f5501-ddc7-41d2-b846-57d34e077d96", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "Finally, add those lines to compute the $\\phi$-scan (in orange) and compare it to the experimental data (in blue).\n", + "\n", + "```{literalinclude} SbAg.py\n", + ":start-after: interstitial_potential\n", + ":lineno-match:\n", + "```" + ] + }, + { + "cell_type": "markdown", + "id": "41723719-be45-4fa8-a824-4ccc4c6dd6c0", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + ":::{figure-md} SbAg-fig1\n", + "\n", + "\n", + "Azimuthal ($\\phi$) scan for Sb(4d) emitter in the top layer of Ag(111) at 45 eV kinetic energy.\n", + ":::\n", + "\n", + "The agreement is not satisfactory although most of the features may be identified." + ] + }, + { + "cell_type": "markdown", + "id": "0332a072-90b0-4d3e-8ee9-06cd16bb2608", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "Try to change the source direction and the inner potential of Ag to better match the experiment...\n", + "\n", + "```{note}\n", + "The cluster is smaller than it should for size convergence, but the calculation would take too much memory for this example\n", + "```\n", + ":::\n", + "\n", + "::::" + ] + }, + { + "cell_type": "markdown", + "id": "f5c46ea1-1dc9-4e31-a74c-856ef3451b99", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "```{toggle}\n", + "\n", + ":::{figure-md} SbAg-fig2\n", + "\n", + "\n", + "Azimuthal ($\\phi$) scan for Sb(4d) emitter in the top layer of Ag(111) at 45 eV kinetic energy, with `muffintin_parameters.interstitial_potential` = 10.2 and `source_parameters.theta` = 22.5\n", + ":::\n", + "\n", + ":::{code} python\n", + "# Source geometry (the former SA73 beamline of the LURE synchrotron)\n", + "# given in ref 6 of the paper...\n", + "calc.source_parameters.theta = 22.5\n", + "# Inner potential is generally between 10 and 20 eV for most metrials\n", + "calc.muffintin_parameters.inner_potential = 10.2\n", + ":::\n", + "\n", + "```" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity02/Untitled.ipynb b/msspecbook/_build/html/_sources/Activity02/Untitled.ipynb new file mode 100644 index 0000000..6cf81c4 --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity02/Untitled.ipynb @@ -0,0 +1,58 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "19e5b61a-39cf-48d3-8ed0-552300d82883", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "# Activity 3: Adsorbates and the single scattering approach\n", + "\n" + ] + }, + { + "cell_type": "markdown", + "id": "6a0ec68c-8762-40de-8db5-0291fd84c820", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "## Oxygen on Rh(001)\n", + "\n", + "In a paper published in 1998, T. Gerber et al. used the quite high backscattering factor of Rhodium atoms to probe\n", + "the distance of Oxygen atoms adsorbed on a Rhodium surface. Some electrons coming from Oxygen atoms are ejected \n", + "toward the Rhodium surface. They are then backscattered and interfere with the direct signal comming from Oxygen atoms (see the figure below). They demonstrated both experimentally and numerically with a sinle scattering computation that this lead to a very accurate probe of adsorbed species that can be sensitive to bond length changes of the order of " + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.13" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity03/Activity03.ipynb b/msspecbook/_build/html/_sources/Activity03/Activity03.ipynb new file mode 100644 index 0000000..8ac9334 --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity03/Activity03.ipynb @@ -0,0 +1,416 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "2aebc88d-0bb4-4d56-b7f6-977a66814229", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "# Activity 3: Adsorbates and the single scattering approach\n", + "\n", + "Photoelectron diffraction is widely used to study the adsorption of atoms or molecules on a crystalline surface. Photoelectrons from adsorbates are scattered by the underlying surface, carrying information about the adsorption site, bond length and/or molecule orientation…. Thanks to a simulation, such information becomes quantitative with a high degree of accuracy.\n", + "\n", + "Calculations of the multiple scattering using matrix inversion have the great advantage of being exact, including all scattering paths. On the other hand, memory consumption soon becomes a problem as the kinetic energy and number of atoms to be considered increase. As an approximation, it is possible to only consider a single scattering from the emitter to any atom in the cluster. This approximation is extremely computationally fast and can give satisfactory results for adsorbates. We’ll see later that this approach is rather too simplistic for most cases.\n", + "\n", + "## Oxygen on Rh(001)\n", + "In a paper published in 1998, T. Gerber *et al.* used the quite high backscattering factor of Rhodium atoms to probe the distance of Oxygen atoms adsorbed on a Rhodium surface. Some electrons coming from Oxygen atoms are ejected toward the Rhodium surface. They are then backscattered and interfere with the direct signal comming from Oxygen atoms (see the figure below). They demonstrated both experimentally and numerically with a sinle scattering computation that this lead to a very accurate probe of adsorbed species that can be sensitive to bond length changes of the order of {math}`\\pm 0.02 \\mathring{A}`.\n", + "\n", + ":::{seealso}\n", + "based on this paper from T. Greber *et al.* [Phys. Rev. Lett. **81**(8) p1654 (1998)](https://doi.org/10.1103/PhysRevLett.81.1654)\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "a4cd32cd-b480-44b5-af38-b38e5979ce00", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + ":::{figure-md} RhO-fig\n", + "\"RhO\"\n", + "\n", + "Interferences produced by the backscattering effect\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "4f6bcc08-a54c-424a-a20c-cbdd0ce13ae2", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "### Computing the scattering factor\n", + "\n", + "To illustrate that photoelectrons emitted by Oxygen adsorbates towards the Rhodium surface can be backscattered, we will start by computing the scattering factor for both O and Rh atoms.\n", + "\n", + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "By using the `Atoms` class of the `ase` package, try to build a O-Rh chain where atoms are 4 Å apart. Here is the begining of the script. Try to complete the line of code and view your two-atoms chain.\n", + "\n", + "```python\n", + "from ase import Atoms\n", + "from ase.visualize import view\n", + "\n", + "# Create an atomic chain O-Rh\n", + "cluster = Atoms(... # Fill this line\n", + "```\n", + ":::\n", + "\n", + "::::" + ] + }, + { + "cell_type": "code", + "execution_count": 5, + "id": "55929980-7394-4a60-b554-376adce57dbf", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "hide-cell" + ] + }, + "outputs": [], + "source": [ + "from ase import Atoms\n", + "from ase.visualize import view\n", + "\n", + "# Create an atomic chain O-Rh\n", + "cluster = Atoms(['O', 'Rh'], positions = [(0,0,0), (0,0,4.)])" + ] + }, + { + "cell_type": "code", + "execution_count": 6, + "id": "2f296e2c-2a34-4266-98a8-362ede072659", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-input" + ] + }, + "outputs": [ + { + "data": { + "text/html": [ + "\n", + " \n", + " ASE atomic visualization\n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + "\n", + "\n" + ], + "text/plain": [ + "" + ] + }, + "execution_count": 6, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "view(cluster, viewer='x3d')" + ] + }, + { + "cell_type": "markdown", + "id": "736d6d08-930e-4b4f-a3fd-599ef8463035", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "As previously, we create a calculator, we attach our 2 atoms cluster to this calculator and we define the first atom in the chain as the emitter\n", + "\n", + ":::{literalinclude} RhO_sf.py\n", + ":start-at: calc =\n", + ":end-at: emitter =\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "21763c63-9bd1-4e80-944a-9cf313894b89", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "We use the `get_scattering_factors` method [(see its documentation)](https://msspec.cnrs.fr/modules/calculator.html#calculator._PED.get_scattering_factors) to compute the scattering factors at 723 eV.\n", + "\n", + "How large is the backscattering factor of Rhodium with respect to that of Oxygen ?\n", + ":::\n", + "\n", + "::::" + ] + }, + { + "cell_type": "markdown", + "id": "14d39e21-eee0-411b-8347-25e932075c83", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "```{toggle}\n", + "\n", + ":::{literalinclude} RhO_sf.py\n", + ":start-at: Compute\n", + ":::\n", + "\n", + ":::{figure-md} SF-fig\n", + "\"Scattering\n", + "\n", + "Polar representation of the scattering factor\n", + ":::\n", + "\n", + "```" + ] + }, + { + "cell_type": "markdown", + "id": "e7da60a3-b4e3-45ec-9d0e-62cb592f0687", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "### Interferences due to backscattering\n", + "\n", + "Let an Oxygen atom (in red) being adsorbed at a distance $z_0$ of an *fcc* site of the Rh(111) surface." + ] + }, + { + "cell_type": "markdown", + "id": "68048f33-318d-400e-a815-769660f2b6c5", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-input" + ] + }, + "source": [ + ":::{figure-md} Rho-fig2a\n", + "\n", + "\n", + "Small cluster used for the calculation.\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "d6145250-5548-49a6-8b50-0bb7c5b454da", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "We will compute for different values of the adsorption height $z_0$.\n", + "\n", + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "Complete the script below to compute the ($\\theta,\\phi$) scan of the photodiffraction of O(1s) adsorbed on a *fcc* site on Rh(111) surface.\n", + "\n", + "```{literalinclude} RhO_tofill.py\n", + ":lineno-match:\n", + ":emphasize-lines: 6,8,12,13\n", + "```\n", + "\n", + "As proposed in the comments, add a loop to vary the adsorption height of Oxygen between 1.10 and 1.65 Å.\n", + "What is the bond length difference between to intensity maxima ?\n", + ":::\n", + "\n", + "::::" + ] + }, + { + "cell_type": "markdown", + "id": "4ff0c14f-b2f6-47c6-91f4-9edc7ee7260d", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "```{toggle}\n", + "\n", + ":::{literalinclude} RhO_completed.py\n", + ":lineno-match:\n", + ":emphasize-lines: 6,8,12,13\n", + ":::\n", + "\n", + ":::{figure-md} stereo-fig\n", + "\"Scattering\n", + "\n", + "Stereographic projections of O(1s) emission at {math}`E_0` = 723 eV for an oxygen atom \n", + "on top of a fcc site of 3 Rh atoms at various altitudes {math}`z_0`\n", + ":::\n", + "\n", + "\n", + "You can see on the stereographic projection 3 bright circles representing fringes of constructive interference between the direct O(1s) photoelectron wave and that backscattered by the Rhodium atoms. The center of these annular shapes changes from bright to dark due to the variation of the Oxygen atom height above the surface which changes the path difference.\n", + "\n", + "```" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "3621c545-3e3a-439c-ab91-a76202cf2644", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity04/Activity04.ipynb b/msspecbook/_build/html/_sources/Activity04/Activity04.ipynb new file mode 100644 index 0000000..60c8d46 --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity04/Activity04.ipynb @@ -0,0 +1,92 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "d053c16f-22ca-44ce-a58d-03e73c1a5554", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "# Activity 4: From single scattering to multiple scattering" + ] + }, + { + "cell_type": "markdown", + "id": "12b10290-0b9b-497a-baba-e7ecb6543788", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + ":::{figure-md} Ni-fig1\n", + "\"Ni\n", + "\n", + "Polar scan of a Ni chain of 2-5 atoms for single and mutliple (5{sup}`th` order) scattering.\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "4988e7d3-2ba3-470f-9676-8116348c30a1", + "metadata": {}, + "source": [ + ":::{seealso}\n", + "based on this paper from M.-L. Xu *et al.*\n", + "[Phys. Rev. B **39** p8275 (1989)](https://doi.org/10.1103/PhysRevB.39.8275) \n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "b2aa92f1-3170-47f6-87c2-e7abffcbdb12", + "metadata": {}, + "source": [ + ":::{literalinclude} Ni_chain.py\n", + ":lineno-match:\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "bbd682d1-d142-4ac5-872d-0b57f3deecb9", + "metadata": {}, + "source": [ + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "Some questions to answer\n", + ":::\n", + "\n", + "::::" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity05/Activity05.ipynb b/msspecbook/_build/html/_sources/Activity05/Activity05.ipynb new file mode 100644 index 0000000..8baa29d --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity05/Activity05.ipynb @@ -0,0 +1,885 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "ff0fc2d9-b53e-4d29-883b-6d6303d76eb2", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "# Activity 5: Multiple scattering in the forward scattering regime" + ] + }, + { + "cell_type": "markdown", + "id": "7f10b898-4fc8-40fd-a477-05e736a5a255", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "In photoelectron diffraction, it is well known that for high photoelectron kinetic energy (typically > 900 eV), the scattering factor is strongly peaked in the forward direction. It means that photoelectrons are almost not deviated after a scattering event.\n", + "\n", + "Peaks of intentisity are then usually observed for dense atomic directions of the sample. This is the **forward scattering approximation**.\n", + "\n", + "For such high kinetic energy, multiple scattering is needed to accurately describe the measured intensity, but the matrix inversion algorithm cannot be used since the memory needed for storing the matrix itself would be generally too large. The matrix will contain\n", + "$(N \\times (L_{max}+1)^2)^2$ elements of complex type with double precision (64 bits) where $N$ is the number of atoms and $L_{max}$ is the number of spherical harmonics used to expand the electron wave around each atomic center. As the kinetic energy increases, the mean free path (MFP) of the photoelectron is larger and the number of atoms in the cluster has to be greater. Lmax also increases with the kinetic energy." + ] + }, + { + "cell_type": "markdown", + "id": "cc78443a-1d06-408a-91eb-33a56fe25ba3", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "Try to evaluate how much memory you would need for this matrix for a hemispherical cluster of copper 15 angströms thick (1 MFP) for $L_{max} = 25$ ?\n", + ":::\n", + "\n", + "::::" + ] + }, + { + "cell_type": "code", + "execution_count": 11, + "id": "e6f5b739-bcbf-4a2f-9c51-5e409079392a", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "hide-cell" + ] + }, + "outputs": [ + { + "name": "stdout", + "output_type": "stream", + "text": [ + "606 atoms, 2.685 TB\n" + ] + } + ], + "source": [ + "import numpy as np\n", + "\n", + "# lattice constant of fcc copper\n", + "a = 3.6\n", + "# radius of the cluster\n", + "r = 15\n", + "# volume of the cluster\n", + "V = .5 * (4/3) * np.pi * r**3\n", + "# volume of the cell\n", + "v = a**3\n", + "# number of atoms in the unit cell\n", + "n = 4\n", + "# number of atoms in the cluster\n", + "N = int(V/v * n)\n", + "\n", + "Lmax = 25\n", + "M = (N * (Lmax+1)**2 )**2 * 2 * 64 / 8\n", + "print(f\"{N:d} atoms, {M/1e12:.3f} TB\")" + ] + }, + { + "cell_type": "markdown", + "id": "f53ecd7a-9202-40ec-a472-c5a2146587c9", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "This is too much memory. We will use another algorithm available in MsSpec: The *Rehr-Albers series expansion*. We already used that algorithm in activity 3 for the single scattering approach. But this time, we will explore a bit more the effect of the scattering order > 1" + ] + }, + { + "cell_type": "markdown", + "id": "f7e215cd-3468-4316-901d-27731ec3e61d", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "## PED of the 1T-TiSe2 surface" + ] + }, + { + "cell_type": "markdown", + "id": "ed46b9b8-cd37-4531-9686-5c1d804e868e", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "Let us try to model the Ti2p XPD pattern of the transition metal dichalcogenide 1T-TiSe2.\n", + "\n", + ":::{seealso}\n", + "based on this paper from M.V. Kuznetsov *et al.*\n", + "[Surf. Sci. **606** p1760–70 (2012)](https://doi.org/10.1016/j.susc.2012.06.008)\n", + ":::\n", + "\n", + "### Creating the TiSe{sub}`2` cluster\n", + "\n", + "Start by creating a small cluster of 1T-TiSe2 using the `mx2` function of `ase.build` and the `hemispherical_cluster` function of `msspec.utils`." + ] + }, + { + "attachments": {}, + "cell_type": "markdown", + "id": "65562913-1336-476c-8dd7-0ade7a8a1b8b", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + ":::{figure-md} TiSe2-fig\n", + "\"TiSe2\"\n", + "\n", + "Structure of 1T-TiSe2 ($a_0=b_0=3.535$ Å, $c_0=6.004$ Å, $d=3.450$ Å, $D=2.554$ Å)\n", + ":::" + ] + }, + { + "cell_type": "markdown", + "id": "849041c9-513f-4593-a4dd-fb3a495094fa", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "Complete the code snipet provided below to create a small TiSe{sub}`2` cluster with Ti emitter in the 2{sup}`nd` plane:\n", + "\n", + "```{literalinclude} TiSe2_1_tofill.py\n", + ":start-at: from\n", + ":end-before: Create a calculator\n", + ":lineno-match:\n", + "```\n", + "\n", + ":::\n", + "\n", + "::::" + ] + }, + { + "cell_type": "code", + "execution_count": 14, + "id": "b65b569e-242b-4fe9-9c87-ea90d80d9b44", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "hide-cell" + ] + }, + "outputs": [], + "source": [ + "from ase.build import mx2\n", + "from ase.visualize import view\n", + "from msspec.calculator import MSSPEC\n", + "from msspec.utils import hemispherical_cluster, get_atom_index\n", + "\n", + "# Some usefull constants (a, c, d, D) for defining the structure\n", + "a=3.535;c=6.004;d=3.450;D=2.554\n", + "\n", + "# Create the TiSe2 trilayer\n", + "# use ase help for this function\n", + "TiSe2 = mx2(formula='TiSe2', kind='1T', a=a, thickness=d, size=(1, 1, 1), vacuum=None)\n", + "\n", + "# The preious cell is 2D, let's define the c-axis to take into account \n", + "# the Van der Waals gap between trilayers\n", + "TiSe2.cell[2] = [0, 0, c]\n", + "\n", + "# To be aligned like in the paper\n", + "TiSe2.rotate(60, 'z', rotate_cell=True)\n", + "\n", + "# Since the material is multi-elements, \"tag\" each inequivalent atom \n", + "# of the unit cell with a number. The \"Ti\" atom is tagged 0 and \"Se\" \n", + "# atoms are 1 and 2.\n", + "for i in range(3): \n", + " TiSe2[i].tag = i\n", + "\n", + "cluster = hemispherical_cluster(TiSe2, emitter_tag=0, emitter_plane=1, planes=5)\n", + "cluster.emitter = get_atom_index(cluster, 0, 0, 0)" + ] + }, + { + "cell_type": "code", + "execution_count": 15, + "id": "515064d0-3751-4fae-af0c-c4b15ea221b3", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "remove-input" + ] + }, + "outputs": [ + { + "data": { + "text/html": [ + "\n", + " \n", + " ASE atomic visualization\n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + " \n", + "\n", + "\n", + "\n", + " \n", + " \n", + "\n", + "\n" + ], + "text/plain": [ + "" + ] + }, + "execution_count": 15, + "metadata": {}, + "output_type": "execute_result" + } + ], + "source": [ + "view(cluster, viewer='x3d')" + ] + }, + { + "cell_type": "markdown", + "id": "3b029e1b-6871-42ac-9cdd-65c583404e3d", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "### Effect of the scattering order\n", + "\n", + "Use the line belows to create a calculator and compute a $\\theta$-$\\phi$ scan of the Ti(2p)\n", + "\n", + "```{literalinclude} TiSe2_1_tofill.py\n", + " :start-at: Create a\n", + "```" + ] + }, + { + "cell_type": "markdown", + "id": "8169ad09-36b4-4f0a-b737-378e2f78b3df", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [] + }, + "source": [ + "::::{tab-set}\n", + "\n", + ":::{tab-item} Quiz\n", + "Compute a scan for an emitter in the first trilayer and in the second trilayer for scattering orders from 1 (single scattering) to 3 in order to complete the figure below.\n", + "What do you conclude about the value of the `calc.calculation_parameters.scattering_order` ?\n", + "\n", + "```{figure-md} results-fig\n", + "\n", + "\n", + "$\\theta$-$\\phi$ scan of Ti(2p) at 1030 eV kinetic energy for an emitter in the first trilayer (left column) and in the second trilayer (right column). Each row correspond to a growing value for the `calc.calculation_parameters.scattering_order` parameter (from 1 to 5).\n", + "```\n", + "\n", + ":::\n", + "\n", + "::::" + ] + }, + { + "cell_type": "markdown", + "id": "4fb402ae-e094-4d6c-833f-5f106fd72035", + "metadata": { + "editable": true, + "slideshow": { + "slide_type": "" + }, + "tags": [ + "hide-cell" + ] + }, + "source": [ + "```{toggle}\n", + "\n", + ":::{figure-md} results-completed-fig\n", + "\n", + "\n", + "$\\theta$-$\\phi$ scan of Ti(2p) at 1030 eV kinetic energy for an emitter in the first trilayer (left column) and in the second trilayer (right column). Each row correspond to a growing value for the `calc.calculation_parameters.scattering_order` parameter (from 1 to 5).\n", + ":::\n", + "\n", + "The deeper the emitter, the greater the scattering order should be for the intensity to converge.\n", + "Typically, in the forward scattering regime, the scattering order corresponds to the number of planes above the emitter.\n", + "\n", + "```" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity06/Activity06.ipynb b/msspecbook/_build/html/_sources/Activity06/Activity06.ipynb new file mode 100644 index 0000000..b4aa3ad --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity06/Activity06.ipynb @@ -0,0 +1,33 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "c0a860db-0f72-4785-81f4-831e48b3a49f", + "metadata": {}, + "source": [ + "# Activity 6: Effect of the temperature" + ] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity07/Activity07.ipynb b/msspecbook/_build/html/_sources/Activity07/Activity07.ipynb new file mode 100644 index 0000000..f4d738f --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity07/Activity07.ipynb @@ -0,0 +1,41 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "42cfa8b1-20d2-47e4-a1f0-161c4517df2c", + "metadata": {}, + "source": [ + "# Activity 7: Large clusters and path filtering" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "e0df9191-52b9-4a42-9232-7fed2b63cc3a", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity08/Activity08.ipynb b/msspecbook/_build/html/_sources/Activity08/Activity08.ipynb new file mode 100644 index 0000000..e530123 --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity08/Activity08.ipynb @@ -0,0 +1,41 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "2ff5929f-c066-496f-b078-0bbc2ab49428", + "metadata": {}, + "source": [ + "# Activity 8: Inequivalent emitters and the XPD of a substrate" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "1df76138-c957-4da2-bcc8-ec977c209b81", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity09/Activity09.ipynb b/msspecbook/_build/html/_sources/Activity09/Activity09.ipynb new file mode 100644 index 0000000..93676fa --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity09/Activity09.ipynb @@ -0,0 +1,41 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "aa43e0e7-0c18-4750-9e2b-3a48f106d2ca", + "metadata": {}, + "source": [ + "# Activity 9: Comparing simulation and experiment with R-factors" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "b9b32bbf-7635-4e14-b246-468f2e74bb17", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity10/Activity10.ipynb b/msspecbook/_build/html/_sources/Activity10/Activity10.ipynb new file mode 100644 index 0000000..aa0fbfb --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity10/Activity10.ipynb @@ -0,0 +1,41 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "38d3e621-e866-43e1-9c92-f473d1e755c0", + "metadata": {}, + "source": [ + "# Activity 10: Auger Electron Diffraction" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "526d98f6-5a18-4ed9-9870-29b08b54e073", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/Activity11/Activity11.ipynb b/msspecbook/_build/html/_sources/Activity11/Activity11.ipynb new file mode 100644 index 0000000..4e4a614 --- /dev/null +++ b/msspecbook/_build/html/_sources/Activity11/Activity11.ipynb @@ -0,0 +1,41 @@ +{ + "cells": [ + { + "cell_type": "markdown", + "id": "140adc62-2a15-4806-b6e1-1a0a0b7054e2", + "metadata": {}, + "source": [ + "# Activity 11: Spectral radius and convergence" + ] + }, + { + "cell_type": "code", + "execution_count": null, + "id": "8adb2f68-32bc-4e45-95b6-bd9fb7f96439", + "metadata": {}, + "outputs": [], + "source": [] + } + ], + "metadata": { + "kernelspec": { + "display_name": "Python 3 (ipykernel)", + "language": "python", + "name": "python3" + }, + "language_info": { + "codemirror_mode": { + "name": "ipython", + "version": 3 + }, + "file_extension": ".py", + "mimetype": "text/x-python", + "name": "python", + "nbconvert_exporter": "python", + "pygments_lexer": "ipython3", + "version": "3.11.3" + } + }, + "nbformat": 4, + "nbformat_minor": 5 +} diff --git a/msspecbook/_build/html/_sources/backmatter.md b/msspecbook/_build/html/_sources/backmatter.md new file mode 100644 index 0000000..b548787 --- /dev/null +++ b/msspecbook/_build/html/_sources/backmatter.md @@ -0,0 +1,7 @@ +# Final word + +## How to install MsSpec + +## Future developpements + +## Our work diff --git a/msspecbook/_build/html/_sources/intro.md b/msspecbook/_build/html/_sources/intro.md new file mode 100644 index 0000000..86fdb5a --- /dev/null +++ b/msspecbook/_build/html/_sources/intro.md @@ -0,0 +1,10 @@ +# Welcome to this small MsSpec tour + +Through various activities of growing difficulty, you will explore the features offered by the MsSpec +software for modelling various electron spectroscopies using the multiple scattering theory. + +We will focus on photoelectron diffraction, since the technique brings together all the +concepts needed to learn how to perform simulation with MsSpec. + +```{tableofcontents} +``` diff --git a/msspecbook/_build/html/_sphinx_design_static/design-tabs.js b/msspecbook/_build/html/_sphinx_design_static/design-tabs.js new file mode 100644 index 0000000..b25bd6a --- /dev/null +++ b/msspecbook/_build/html/_sphinx_design_static/design-tabs.js @@ -0,0 +1,101 @@ +// @ts-check + +// Extra JS capability for selected tabs to be synced +// The selection is stored in local storage so that it persists across page loads. + +/** + * @type {Record} + */ +let sd_id_to_elements = {}; +const storageKeyPrefix = "sphinx-design-tab-id-"; + +/** + * Create a key for a tab element. + * @param {HTMLElement} el - The tab element. + * @returns {[string, string, string] | null} - The key. + * + */ +function create_key(el) { + let syncId = el.getAttribute("data-sync-id"); + let syncGroup = el.getAttribute("data-sync-group"); + if (!syncId || !syncGroup) return null; + return [syncGroup, syncId, syncGroup + "--" + syncId]; +} + +/** + * Initialize the tab selection. + * + */ +function ready() { + // Find all tabs with sync data + + /** @type {string[]} */ + let groups = []; + + document.querySelectorAll(".sd-tab-label").forEach((label) => { + if (label instanceof HTMLElement) { + let data = create_key(label); + if (data) { + let [group, id, key] = data; + + // add click event listener + // @ts-ignore + label.onclick = onSDLabelClick; + + // store map of key to elements + if (!sd_id_to_elements[key]) { + sd_id_to_elements[key] = []; + } + sd_id_to_elements[key].push(label); + + if (groups.indexOf(group) === -1) { + groups.push(group); + // Check if a specific tab has been selected via URL parameter + const tabParam = new URLSearchParams(window.location.search).get( + group + ); + if (tabParam) { + console.log( + "sphinx-design: Selecting tab id for group '" + + group + + "' from URL parameter: " + + tabParam + ); + window.sessionStorage.setItem(storageKeyPrefix + group, tabParam); + } + } + + // Check is a specific tab has been selected previously + let previousId = window.sessionStorage.getItem( + storageKeyPrefix + group + ); + if (previousId === id) { + // console.log( + // "sphinx-design: Selecting tab from session storage: " + id + // ); + // @ts-ignore + label.previousElementSibling.checked = true; + } + } + } + }); +} + +/** + * Activate other tabs with the same sync id. + * + * @this {HTMLElement} - The element that was clicked. + */ +function onSDLabelClick() { + let data = create_key(this); + if (!data) return; + let [group, id, key] = data; + for (const label of sd_id_to_elements[key]) { + if (label === this) continue; + // @ts-ignore + label.previousElementSibling.checked = true; + } + window.sessionStorage.setItem(storageKeyPrefix + group, id); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/msspecbook/_build/html/_sphinx_design_static/sphinx-design.min.css b/msspecbook/_build/html/_sphinx_design_static/sphinx-design.min.css new file mode 100644 index 0000000..860c36d --- /dev/null +++ b/msspecbook/_build/html/_sphinx_design_static/sphinx-design.min.css @@ -0,0 +1 @@ +.sd-bg-primary{background-color:var(--sd-color-primary) !important}.sd-bg-text-primary{color:var(--sd-color-primary-text) !important}button.sd-bg-primary:focus,button.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}a.sd-bg-primary:focus,a.sd-bg-primary:hover{background-color:var(--sd-color-primary-highlight) !important}.sd-bg-secondary{background-color:var(--sd-color-secondary) !important}.sd-bg-text-secondary{color:var(--sd-color-secondary-text) !important}button.sd-bg-secondary:focus,button.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}a.sd-bg-secondary:focus,a.sd-bg-secondary:hover{background-color:var(--sd-color-secondary-highlight) !important}.sd-bg-success{background-color:var(--sd-color-success) !important}.sd-bg-text-success{color:var(--sd-color-success-text) !important}button.sd-bg-success:focus,button.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}a.sd-bg-success:focus,a.sd-bg-success:hover{background-color:var(--sd-color-success-highlight) !important}.sd-bg-info{background-color:var(--sd-color-info) !important}.sd-bg-text-info{color:var(--sd-color-info-text) !important}button.sd-bg-info:focus,button.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}a.sd-bg-info:focus,a.sd-bg-info:hover{background-color:var(--sd-color-info-highlight) !important}.sd-bg-warning{background-color:var(--sd-color-warning) !important}.sd-bg-text-warning{color:var(--sd-color-warning-text) !important}button.sd-bg-warning:focus,button.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}a.sd-bg-warning:focus,a.sd-bg-warning:hover{background-color:var(--sd-color-warning-highlight) !important}.sd-bg-danger{background-color:var(--sd-color-danger) !important}.sd-bg-text-danger{color:var(--sd-color-danger-text) !important}button.sd-bg-danger:focus,button.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}a.sd-bg-danger:focus,a.sd-bg-danger:hover{background-color:var(--sd-color-danger-highlight) !important}.sd-bg-light{background-color:var(--sd-color-light) !important}.sd-bg-text-light{color:var(--sd-color-light-text) !important}button.sd-bg-light:focus,button.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}a.sd-bg-light:focus,a.sd-bg-light:hover{background-color:var(--sd-color-light-highlight) !important}.sd-bg-muted{background-color:var(--sd-color-muted) !important}.sd-bg-text-muted{color:var(--sd-color-muted-text) !important}button.sd-bg-muted:focus,button.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}a.sd-bg-muted:focus,a.sd-bg-muted:hover{background-color:var(--sd-color-muted-highlight) !important}.sd-bg-dark{background-color:var(--sd-color-dark) !important}.sd-bg-text-dark{color:var(--sd-color-dark-text) !important}button.sd-bg-dark:focus,button.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}a.sd-bg-dark:focus,a.sd-bg-dark:hover{background-color:var(--sd-color-dark-highlight) !important}.sd-bg-black{background-color:var(--sd-color-black) !important}.sd-bg-text-black{color:var(--sd-color-black-text) !important}button.sd-bg-black:focus,button.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}a.sd-bg-black:focus,a.sd-bg-black:hover{background-color:var(--sd-color-black-highlight) !important}.sd-bg-white{background-color:var(--sd-color-white) !important}.sd-bg-text-white{color:var(--sd-color-white-text) !important}button.sd-bg-white:focus,button.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}a.sd-bg-white:focus,a.sd-bg-white:hover{background-color:var(--sd-color-white-highlight) !important}.sd-text-primary,.sd-text-primary>p{color:var(--sd-color-primary) !important}a.sd-text-primary:focus,a.sd-text-primary:hover{color:var(--sd-color-primary-highlight) !important}.sd-text-secondary,.sd-text-secondary>p{color:var(--sd-color-secondary) !important}a.sd-text-secondary:focus,a.sd-text-secondary:hover{color:var(--sd-color-secondary-highlight) !important}.sd-text-success,.sd-text-success>p{color:var(--sd-color-success) !important}a.sd-text-success:focus,a.sd-text-success:hover{color:var(--sd-color-success-highlight) !important}.sd-text-info,.sd-text-info>p{color:var(--sd-color-info) !important}a.sd-text-info:focus,a.sd-text-info:hover{color:var(--sd-color-info-highlight) !important}.sd-text-warning,.sd-text-warning>p{color:var(--sd-color-warning) !important}a.sd-text-warning:focus,a.sd-text-warning:hover{color:var(--sd-color-warning-highlight) !important}.sd-text-danger,.sd-text-danger>p{color:var(--sd-color-danger) !important}a.sd-text-danger:focus,a.sd-text-danger:hover{color:var(--sd-color-danger-highlight) !important}.sd-text-light,.sd-text-light>p{color:var(--sd-color-light) !important}a.sd-text-light:focus,a.sd-text-light:hover{color:var(--sd-color-light-highlight) !important}.sd-text-muted,.sd-text-muted>p{color:var(--sd-color-muted) !important}a.sd-text-muted:focus,a.sd-text-muted:hover{color:var(--sd-color-muted-highlight) !important}.sd-text-dark,.sd-text-dark>p{color:var(--sd-color-dark) !important}a.sd-text-dark:focus,a.sd-text-dark:hover{color:var(--sd-color-dark-highlight) !important}.sd-text-black,.sd-text-black>p{color:var(--sd-color-black) !important}a.sd-text-black:focus,a.sd-text-black:hover{color:var(--sd-color-black-highlight) !important}.sd-text-white,.sd-text-white>p{color:var(--sd-color-white) !important}a.sd-text-white:focus,a.sd-text-white:hover{color:var(--sd-color-white-highlight) !important}.sd-outline-primary{border-color:var(--sd-color-primary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-primary:focus,a.sd-outline-primary:hover{border-color:var(--sd-color-primary-highlight) !important}.sd-outline-secondary{border-color:var(--sd-color-secondary) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-secondary:focus,a.sd-outline-secondary:hover{border-color:var(--sd-color-secondary-highlight) !important}.sd-outline-success{border-color:var(--sd-color-success) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-success:focus,a.sd-outline-success:hover{border-color:var(--sd-color-success-highlight) !important}.sd-outline-info{border-color:var(--sd-color-info) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-info:focus,a.sd-outline-info:hover{border-color:var(--sd-color-info-highlight) !important}.sd-outline-warning{border-color:var(--sd-color-warning) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-warning:focus,a.sd-outline-warning:hover{border-color:var(--sd-color-warning-highlight) !important}.sd-outline-danger{border-color:var(--sd-color-danger) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-danger:focus,a.sd-outline-danger:hover{border-color:var(--sd-color-danger-highlight) !important}.sd-outline-light{border-color:var(--sd-color-light) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-light:focus,a.sd-outline-light:hover{border-color:var(--sd-color-light-highlight) !important}.sd-outline-muted{border-color:var(--sd-color-muted) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-muted:focus,a.sd-outline-muted:hover{border-color:var(--sd-color-muted-highlight) !important}.sd-outline-dark{border-color:var(--sd-color-dark) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-dark:focus,a.sd-outline-dark:hover{border-color:var(--sd-color-dark-highlight) !important}.sd-outline-black{border-color:var(--sd-color-black) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-black:focus,a.sd-outline-black:hover{border-color:var(--sd-color-black-highlight) !important}.sd-outline-white{border-color:var(--sd-color-white) !important;border-style:solid !important;border-width:1px !important}a.sd-outline-white:focus,a.sd-outline-white:hover{border-color:var(--sd-color-white-highlight) !important}.sd-bg-transparent{background-color:transparent !important}.sd-outline-transparent{border-color:transparent !important}.sd-text-transparent{color:transparent !important}.sd-p-0{padding:0 !important}.sd-pt-0,.sd-py-0{padding-top:0 !important}.sd-pr-0,.sd-px-0{padding-right:0 !important}.sd-pb-0,.sd-py-0{padding-bottom:0 !important}.sd-pl-0,.sd-px-0{padding-left:0 !important}.sd-p-1{padding:.25rem !important}.sd-pt-1,.sd-py-1{padding-top:.25rem !important}.sd-pr-1,.sd-px-1{padding-right:.25rem !important}.sd-pb-1,.sd-py-1{padding-bottom:.25rem !important}.sd-pl-1,.sd-px-1{padding-left:.25rem !important}.sd-p-2{padding:.5rem !important}.sd-pt-2,.sd-py-2{padding-top:.5rem !important}.sd-pr-2,.sd-px-2{padding-right:.5rem !important}.sd-pb-2,.sd-py-2{padding-bottom:.5rem !important}.sd-pl-2,.sd-px-2{padding-left:.5rem !important}.sd-p-3{padding:1rem !important}.sd-pt-3,.sd-py-3{padding-top:1rem !important}.sd-pr-3,.sd-px-3{padding-right:1rem !important}.sd-pb-3,.sd-py-3{padding-bottom:1rem !important}.sd-pl-3,.sd-px-3{padding-left:1rem !important}.sd-p-4{padding:1.5rem !important}.sd-pt-4,.sd-py-4{padding-top:1.5rem !important}.sd-pr-4,.sd-px-4{padding-right:1.5rem !important}.sd-pb-4,.sd-py-4{padding-bottom:1.5rem !important}.sd-pl-4,.sd-px-4{padding-left:1.5rem !important}.sd-p-5{padding:3rem !important}.sd-pt-5,.sd-py-5{padding-top:3rem !important}.sd-pr-5,.sd-px-5{padding-right:3rem !important}.sd-pb-5,.sd-py-5{padding-bottom:3rem !important}.sd-pl-5,.sd-px-5{padding-left:3rem !important}.sd-m-auto{margin:auto !important}.sd-mt-auto,.sd-my-auto{margin-top:auto !important}.sd-mr-auto,.sd-mx-auto{margin-right:auto !important}.sd-mb-auto,.sd-my-auto{margin-bottom:auto !important}.sd-ml-auto,.sd-mx-auto{margin-left:auto !important}.sd-m-0{margin:0 !important}.sd-mt-0,.sd-my-0{margin-top:0 !important}.sd-mr-0,.sd-mx-0{margin-right:0 !important}.sd-mb-0,.sd-my-0{margin-bottom:0 !important}.sd-ml-0,.sd-mx-0{margin-left:0 !important}.sd-m-1{margin:.25rem !important}.sd-mt-1,.sd-my-1{margin-top:.25rem !important}.sd-mr-1,.sd-mx-1{margin-right:.25rem !important}.sd-mb-1,.sd-my-1{margin-bottom:.25rem !important}.sd-ml-1,.sd-mx-1{margin-left:.25rem !important}.sd-m-2{margin:.5rem !important}.sd-mt-2,.sd-my-2{margin-top:.5rem !important}.sd-mr-2,.sd-mx-2{margin-right:.5rem !important}.sd-mb-2,.sd-my-2{margin-bottom:.5rem !important}.sd-ml-2,.sd-mx-2{margin-left:.5rem !important}.sd-m-3{margin:1rem !important}.sd-mt-3,.sd-my-3{margin-top:1rem !important}.sd-mr-3,.sd-mx-3{margin-right:1rem !important}.sd-mb-3,.sd-my-3{margin-bottom:1rem !important}.sd-ml-3,.sd-mx-3{margin-left:1rem !important}.sd-m-4{margin:1.5rem !important}.sd-mt-4,.sd-my-4{margin-top:1.5rem !important}.sd-mr-4,.sd-mx-4{margin-right:1.5rem !important}.sd-mb-4,.sd-my-4{margin-bottom:1.5rem !important}.sd-ml-4,.sd-mx-4{margin-left:1.5rem !important}.sd-m-5{margin:3rem !important}.sd-mt-5,.sd-my-5{margin-top:3rem !important}.sd-mr-5,.sd-mx-5{margin-right:3rem !important}.sd-mb-5,.sd-my-5{margin-bottom:3rem !important}.sd-ml-5,.sd-mx-5{margin-left:3rem !important}.sd-w-25{width:25% !important}.sd-w-50{width:50% !important}.sd-w-75{width:75% !important}.sd-w-100{width:100% !important}.sd-w-auto{width:auto !important}.sd-h-25{height:25% !important}.sd-h-50{height:50% !important}.sd-h-75{height:75% !important}.sd-h-100{height:100% !important}.sd-h-auto{height:auto !important}.sd-d-none{display:none !important}.sd-d-inline{display:inline !important}.sd-d-inline-block{display:inline-block !important}.sd-d-block{display:block !important}.sd-d-grid{display:grid !important}.sd-d-flex-row{display:-ms-flexbox !important;display:flex !important;flex-direction:row !important}.sd-d-flex-column{display:-ms-flexbox !important;display:flex !important;flex-direction:column !important}.sd-d-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}@media(min-width: 576px){.sd-d-sm-none{display:none !important}.sd-d-sm-inline{display:inline !important}.sd-d-sm-inline-block{display:inline-block !important}.sd-d-sm-block{display:block !important}.sd-d-sm-grid{display:grid !important}.sd-d-sm-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-sm-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 768px){.sd-d-md-none{display:none !important}.sd-d-md-inline{display:inline !important}.sd-d-md-inline-block{display:inline-block !important}.sd-d-md-block{display:block !important}.sd-d-md-grid{display:grid !important}.sd-d-md-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-md-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 992px){.sd-d-lg-none{display:none !important}.sd-d-lg-inline{display:inline !important}.sd-d-lg-inline-block{display:inline-block !important}.sd-d-lg-block{display:block !important}.sd-d-lg-grid{display:grid !important}.sd-d-lg-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-lg-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}@media(min-width: 1200px){.sd-d-xl-none{display:none !important}.sd-d-xl-inline{display:inline !important}.sd-d-xl-inline-block{display:inline-block !important}.sd-d-xl-block{display:block !important}.sd-d-xl-grid{display:grid !important}.sd-d-xl-flex{display:-ms-flexbox !important;display:flex !important}.sd-d-xl-inline-flex{display:-ms-inline-flexbox !important;display:inline-flex !important}}.sd-align-major-start{justify-content:flex-start !important}.sd-align-major-end{justify-content:flex-end !important}.sd-align-major-center{justify-content:center !important}.sd-align-major-justify{justify-content:space-between !important}.sd-align-major-spaced{justify-content:space-evenly !important}.sd-align-minor-start{align-items:flex-start !important}.sd-align-minor-end{align-items:flex-end !important}.sd-align-minor-center{align-items:center !important}.sd-align-minor-stretch{align-items:stretch !important}.sd-text-justify{text-align:justify !important}.sd-text-left{text-align:left !important}.sd-text-right{text-align:right !important}.sd-text-center{text-align:center !important}.sd-font-weight-light{font-weight:300 !important}.sd-font-weight-lighter{font-weight:lighter !important}.sd-font-weight-normal{font-weight:400 !important}.sd-font-weight-bold{font-weight:700 !important}.sd-font-weight-bolder{font-weight:bolder !important}.sd-font-italic{font-style:italic !important}.sd-text-decoration-none{text-decoration:none !important}.sd-text-lowercase{text-transform:lowercase !important}.sd-text-uppercase{text-transform:uppercase !important}.sd-text-capitalize{text-transform:capitalize !important}.sd-text-wrap{white-space:normal !important}.sd-text-nowrap{white-space:nowrap !important}.sd-text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.sd-fs-1,.sd-fs-1>p{font-size:calc(1.375rem + 1.5vw) !important;line-height:unset !important}.sd-fs-2,.sd-fs-2>p{font-size:calc(1.325rem + 0.9vw) !important;line-height:unset !important}.sd-fs-3,.sd-fs-3>p{font-size:calc(1.3rem + 0.6vw) !important;line-height:unset !important}.sd-fs-4,.sd-fs-4>p{font-size:calc(1.275rem + 0.3vw) !important;line-height:unset !important}.sd-fs-5,.sd-fs-5>p{font-size:1.25rem !important;line-height:unset !important}.sd-fs-6,.sd-fs-6>p{font-size:1rem !important;line-height:unset !important}.sd-border-0{border:0 solid !important}.sd-border-top-0{border-top:0 solid !important}.sd-border-bottom-0{border-bottom:0 solid !important}.sd-border-right-0{border-right:0 solid !important}.sd-border-left-0{border-left:0 solid !important}.sd-border-1{border:1px solid !important}.sd-border-top-1{border-top:1px solid !important}.sd-border-bottom-1{border-bottom:1px solid !important}.sd-border-right-1{border-right:1px solid !important}.sd-border-left-1{border-left:1px solid !important}.sd-border-2{border:2px solid !important}.sd-border-top-2{border-top:2px solid !important}.sd-border-bottom-2{border-bottom:2px solid !important}.sd-border-right-2{border-right:2px solid !important}.sd-border-left-2{border-left:2px solid !important}.sd-border-3{border:3px solid !important}.sd-border-top-3{border-top:3px solid !important}.sd-border-bottom-3{border-bottom:3px solid !important}.sd-border-right-3{border-right:3px solid !important}.sd-border-left-3{border-left:3px solid !important}.sd-border-4{border:4px solid !important}.sd-border-top-4{border-top:4px solid !important}.sd-border-bottom-4{border-bottom:4px solid !important}.sd-border-right-4{border-right:4px solid !important}.sd-border-left-4{border-left:4px solid !important}.sd-border-5{border:5px solid !important}.sd-border-top-5{border-top:5px solid !important}.sd-border-bottom-5{border-bottom:5px solid !important}.sd-border-right-5{border-right:5px solid !important}.sd-border-left-5{border-left:5px solid !important}.sd-rounded-0{border-radius:0 !important}.sd-rounded-1{border-radius:.2rem !important}.sd-rounded-2{border-radius:.3rem !important}.sd-rounded-3{border-radius:.5rem !important}.sd-rounded-pill{border-radius:50rem !important}.sd-rounded-circle{border-radius:50% !important}.shadow-none{box-shadow:none !important}.sd-shadow-sm{box-shadow:0 .125rem .25rem var(--sd-color-shadow) !important}.sd-shadow-md{box-shadow:0 .5rem 1rem var(--sd-color-shadow) !important}.sd-shadow-lg{box-shadow:0 1rem 3rem var(--sd-color-shadow) !important}@keyframes sd-slide-from-left{0%{transform:translateX(-100%)}100%{transform:translateX(0)}}@keyframes sd-slide-from-right{0%{transform:translateX(200%)}100%{transform:translateX(0)}}@keyframes sd-grow100{0%{transform:scale(0);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50{0%{transform:scale(0.5);opacity:.5}100%{transform:scale(1);opacity:1}}@keyframes sd-grow50-rot20{0%{transform:scale(0.5) rotateZ(-20deg);opacity:.5}75%{transform:scale(1) rotateZ(5deg);opacity:1}95%{transform:scale(1) rotateZ(-1deg);opacity:1}100%{transform:scale(1) rotateZ(0);opacity:1}}.sd-animate-slide-from-left{animation:1s ease-out 0s 1 normal none running sd-slide-from-left}.sd-animate-slide-from-right{animation:1s ease-out 0s 1 normal none running sd-slide-from-right}.sd-animate-grow100{animation:1s ease-out 0s 1 normal none running sd-grow100}.sd-animate-grow50{animation:1s ease-out 0s 1 normal none running sd-grow50}.sd-animate-grow50-rot20{animation:1s ease-out 0s 1 normal none running sd-grow50-rot20}.sd-badge{display:inline-block;padding:.35em .65em;font-size:.75em;font-weight:700;line-height:1;text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:.25rem}.sd-badge:empty{display:none}a.sd-badge{text-decoration:none}.sd-btn .sd-badge{position:relative;top:-1px}.sd-btn{background-color:transparent;border:1px solid transparent;border-radius:.25rem;cursor:pointer;display:inline-block;font-weight:400;font-size:1rem;line-height:1.5;padding:.375rem .75rem;text-align:center;text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;vertical-align:middle;user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none}.sd-btn:hover{text-decoration:none}@media(prefers-reduced-motion: reduce){.sd-btn{transition:none}}.sd-btn-primary,.sd-btn-outline-primary:hover,.sd-btn-outline-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-primary:hover,.sd-btn-primary:focus{color:var(--sd-color-primary-text) !important;background-color:var(--sd-color-primary-highlight) !important;border-color:var(--sd-color-primary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-primary{color:var(--sd-color-primary) !important;border-color:var(--sd-color-primary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary,.sd-btn-outline-secondary:hover,.sd-btn-outline-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-secondary:hover,.sd-btn-secondary:focus{color:var(--sd-color-secondary-text) !important;background-color:var(--sd-color-secondary-highlight) !important;border-color:var(--sd-color-secondary-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-secondary{color:var(--sd-color-secondary) !important;border-color:var(--sd-color-secondary) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success,.sd-btn-outline-success:hover,.sd-btn-outline-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-success:hover,.sd-btn-success:focus{color:var(--sd-color-success-text) !important;background-color:var(--sd-color-success-highlight) !important;border-color:var(--sd-color-success-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-success{color:var(--sd-color-success) !important;border-color:var(--sd-color-success) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info,.sd-btn-outline-info:hover,.sd-btn-outline-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-info:hover,.sd-btn-info:focus{color:var(--sd-color-info-text) !important;background-color:var(--sd-color-info-highlight) !important;border-color:var(--sd-color-info-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-info{color:var(--sd-color-info) !important;border-color:var(--sd-color-info) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning,.sd-btn-outline-warning:hover,.sd-btn-outline-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-warning:hover,.sd-btn-warning:focus{color:var(--sd-color-warning-text) !important;background-color:var(--sd-color-warning-highlight) !important;border-color:var(--sd-color-warning-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-warning{color:var(--sd-color-warning) !important;border-color:var(--sd-color-warning) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger,.sd-btn-outline-danger:hover,.sd-btn-outline-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-danger:hover,.sd-btn-danger:focus{color:var(--sd-color-danger-text) !important;background-color:var(--sd-color-danger-highlight) !important;border-color:var(--sd-color-danger-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-danger{color:var(--sd-color-danger) !important;border-color:var(--sd-color-danger) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light,.sd-btn-outline-light:hover,.sd-btn-outline-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-light:hover,.sd-btn-light:focus{color:var(--sd-color-light-text) !important;background-color:var(--sd-color-light-highlight) !important;border-color:var(--sd-color-light-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-light{color:var(--sd-color-light) !important;border-color:var(--sd-color-light) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted,.sd-btn-outline-muted:hover,.sd-btn-outline-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-muted:hover,.sd-btn-muted:focus{color:var(--sd-color-muted-text) !important;background-color:var(--sd-color-muted-highlight) !important;border-color:var(--sd-color-muted-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-muted{color:var(--sd-color-muted) !important;border-color:var(--sd-color-muted) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark,.sd-btn-outline-dark:hover,.sd-btn-outline-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-dark:hover,.sd-btn-dark:focus{color:var(--sd-color-dark-text) !important;background-color:var(--sd-color-dark-highlight) !important;border-color:var(--sd-color-dark-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-dark{color:var(--sd-color-dark) !important;border-color:var(--sd-color-dark) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black,.sd-btn-outline-black:hover,.sd-btn-outline-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-black:hover,.sd-btn-black:focus{color:var(--sd-color-black-text) !important;background-color:var(--sd-color-black-highlight) !important;border-color:var(--sd-color-black-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-black{color:var(--sd-color-black) !important;border-color:var(--sd-color-black) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white,.sd-btn-outline-white:hover,.sd-btn-outline-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-btn-white:hover,.sd-btn-white:focus{color:var(--sd-color-white-text) !important;background-color:var(--sd-color-white-highlight) !important;border-color:var(--sd-color-white-highlight) !important;border-width:1px !important;border-style:solid !important}.sd-btn-outline-white{color:var(--sd-color-white) !important;border-color:var(--sd-color-white) !important;border-width:1px !important;border-style:solid !important}.sd-stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.sd-hide-link-text{font-size:0}.sd-octicon,.sd-material-icon{display:inline-block;fill:currentColor;vertical-align:middle}.sd-avatar-xs{border-radius:50%;object-fit:cover;object-position:center;width:1rem;height:1rem}.sd-avatar-sm{border-radius:50%;object-fit:cover;object-position:center;width:3rem;height:3rem}.sd-avatar-md{border-radius:50%;object-fit:cover;object-position:center;width:5rem;height:5rem}.sd-avatar-lg{border-radius:50%;object-fit:cover;object-position:center;width:7rem;height:7rem}.sd-avatar-xl{border-radius:50%;object-fit:cover;object-position:center;width:10rem;height:10rem}.sd-avatar-inherit{border-radius:50%;object-fit:cover;object-position:center;width:inherit;height:inherit}.sd-avatar-initial{border-radius:50%;object-fit:cover;object-position:center;width:initial;height:initial}.sd-card{background-clip:border-box;background-color:var(--sd-color-card-background);border:1px solid var(--sd-color-card-border);border-radius:.25rem;color:var(--sd-color-card-text);display:-ms-flexbox;display:flex;-ms-flex-direction:column;flex-direction:column;min-width:0;position:relative;word-wrap:break-word}.sd-card>hr{margin-left:0;margin-right:0}.sd-card-hover:hover{border-color:var(--sd-color-card-border-hover);transform:scale(1.01)}.sd-card-body{-ms-flex:1 1 auto;flex:1 1 auto;padding:1rem 1rem}.sd-card-title{margin-bottom:.5rem}.sd-card-subtitle{margin-top:-0.25rem;margin-bottom:0}.sd-card-text:last-child{margin-bottom:0}.sd-card-link:hover{text-decoration:none}.sd-card-link+.card-link{margin-left:1rem}.sd-card-header{padding:.5rem 1rem;margin-bottom:0;background-color:var(--sd-color-card-header);border-bottom:1px solid var(--sd-color-card-border)}.sd-card-header:first-child{border-radius:calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0}.sd-card-footer{padding:.5rem 1rem;background-color:var(--sd-color-card-footer);border-top:1px solid var(--sd-color-card-border)}.sd-card-footer:last-child{border-radius:0 0 calc(0.25rem - 1px) calc(0.25rem - 1px)}.sd-card-header-tabs{margin-right:-0.5rem;margin-bottom:-0.5rem;margin-left:-0.5rem;border-bottom:0}.sd-card-header-pills{margin-right:-0.5rem;margin-left:-0.5rem}.sd-card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:1rem;border-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom,.sd-card-img-top{width:100%}.sd-card-img,.sd-card-img-top{border-top-left-radius:calc(0.25rem - 1px);border-top-right-radius:calc(0.25rem - 1px)}.sd-card-img,.sd-card-img-bottom{border-bottom-left-radius:calc(0.25rem - 1px);border-bottom-right-radius:calc(0.25rem - 1px)}.sd-cards-carousel{width:100%;display:flex;flex-wrap:nowrap;-ms-flex-direction:row;flex-direction:row;overflow-x:hidden;scroll-snap-type:x mandatory}.sd-cards-carousel.sd-show-scrollbar{overflow-x:auto}.sd-cards-carousel:hover,.sd-cards-carousel:focus{overflow-x:auto}.sd-cards-carousel>.sd-card{flex-shrink:0;scroll-snap-align:start}.sd-cards-carousel>.sd-card:not(:last-child){margin-right:3px}.sd-card-cols-1>.sd-card{width:90%}.sd-card-cols-2>.sd-card{width:45%}.sd-card-cols-3>.sd-card{width:30%}.sd-card-cols-4>.sd-card{width:22.5%}.sd-card-cols-5>.sd-card{width:18%}.sd-card-cols-6>.sd-card{width:15%}.sd-card-cols-7>.sd-card{width:12.8571428571%}.sd-card-cols-8>.sd-card{width:11.25%}.sd-card-cols-9>.sd-card{width:10%}.sd-card-cols-10>.sd-card{width:9%}.sd-card-cols-11>.sd-card{width:8.1818181818%}.sd-card-cols-12>.sd-card{width:7.5%}.sd-container,.sd-container-fluid,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container-xl{margin-left:auto;margin-right:auto;padding-left:var(--sd-gutter-x, 0.75rem);padding-right:var(--sd-gutter-x, 0.75rem);width:100%}@media(min-width: 576px){.sd-container-sm,.sd-container{max-width:540px}}@media(min-width: 768px){.sd-container-md,.sd-container-sm,.sd-container{max-width:720px}}@media(min-width: 992px){.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:960px}}@media(min-width: 1200px){.sd-container-xl,.sd-container-lg,.sd-container-md,.sd-container-sm,.sd-container{max-width:1140px}}.sd-row{--sd-gutter-x: 1.5rem;--sd-gutter-y: 0;display:-ms-flexbox;display:flex;-ms-flex-wrap:wrap;flex-wrap:wrap;margin-top:calc(var(--sd-gutter-y) * -1);margin-right:calc(var(--sd-gutter-x) * -0.5);margin-left:calc(var(--sd-gutter-x) * -0.5)}.sd-row>*{box-sizing:border-box;flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--sd-gutter-x) * 0.5);padding-left:calc(var(--sd-gutter-x) * 0.5);margin-top:var(--sd-gutter-y)}.sd-col{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-auto>*{flex:0 0 auto;width:auto}.sd-row-cols-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}@media(min-width: 576px){.sd-col-sm{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-sm-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-sm-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-sm-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-sm-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-sm-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-sm-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-sm-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-sm-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-sm-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-sm-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-sm-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-sm-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-sm-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 768px){.sd-col-md{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-md-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-md-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-md-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-md-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-md-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-md-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-md-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-md-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-md-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-md-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-md-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-md-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-md-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 992px){.sd-col-lg{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-lg-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-lg-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-lg-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-lg-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-lg-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-lg-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-lg-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-lg-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-lg-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-lg-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-lg-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-lg-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-lg-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}@media(min-width: 1200px){.sd-col-xl{flex:1 0 0%;-ms-flex:1 0 0%}.sd-row-cols-xl-auto{flex:1 0 auto;-ms-flex:1 0 auto;width:100%}.sd-row-cols-xl-1>*{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-row-cols-xl-2>*{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-row-cols-xl-3>*{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-row-cols-xl-4>*{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-row-cols-xl-5>*{flex:0 0 auto;-ms-flex:0 0 auto;width:20%}.sd-row-cols-xl-6>*{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-row-cols-xl-7>*{flex:0 0 auto;-ms-flex:0 0 auto;width:14.2857142857%}.sd-row-cols-xl-8>*{flex:0 0 auto;-ms-flex:0 0 auto;width:12.5%}.sd-row-cols-xl-9>*{flex:0 0 auto;-ms-flex:0 0 auto;width:11.1111111111%}.sd-row-cols-xl-10>*{flex:0 0 auto;-ms-flex:0 0 auto;width:10%}.sd-row-cols-xl-11>*{flex:0 0 auto;-ms-flex:0 0 auto;width:9.0909090909%}.sd-row-cols-xl-12>*{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}}.sd-col-auto{flex:0 0 auto;-ms-flex:0 0 auto;width:auto}.sd-col-1{flex:0 0 auto;-ms-flex:0 0 auto;width:8.3333333333%}.sd-col-2{flex:0 0 auto;-ms-flex:0 0 auto;width:16.6666666667%}.sd-col-3{flex:0 0 auto;-ms-flex:0 0 auto;width:25%}.sd-col-4{flex:0 0 auto;-ms-flex:0 0 auto;width:33.3333333333%}.sd-col-5{flex:0 0 auto;-ms-flex:0 0 auto;width:41.6666666667%}.sd-col-6{flex:0 0 auto;-ms-flex:0 0 auto;width:50%}.sd-col-7{flex:0 0 auto;-ms-flex:0 0 auto;width:58.3333333333%}.sd-col-8{flex:0 0 auto;-ms-flex:0 0 auto;width:66.6666666667%}.sd-col-9{flex:0 0 auto;-ms-flex:0 0 auto;width:75%}.sd-col-10{flex:0 0 auto;-ms-flex:0 0 auto;width:83.3333333333%}.sd-col-11{flex:0 0 auto;-ms-flex:0 0 auto;width:91.6666666667%}.sd-col-12{flex:0 0 auto;-ms-flex:0 0 auto;width:100%}.sd-g-0,.sd-gy-0{--sd-gutter-y: 0}.sd-g-0,.sd-gx-0{--sd-gutter-x: 0}.sd-g-1,.sd-gy-1{--sd-gutter-y: 0.25rem}.sd-g-1,.sd-gx-1{--sd-gutter-x: 0.25rem}.sd-g-2,.sd-gy-2{--sd-gutter-y: 0.5rem}.sd-g-2,.sd-gx-2{--sd-gutter-x: 0.5rem}.sd-g-3,.sd-gy-3{--sd-gutter-y: 1rem}.sd-g-3,.sd-gx-3{--sd-gutter-x: 1rem}.sd-g-4,.sd-gy-4{--sd-gutter-y: 1.5rem}.sd-g-4,.sd-gx-4{--sd-gutter-x: 1.5rem}.sd-g-5,.sd-gy-5{--sd-gutter-y: 3rem}.sd-g-5,.sd-gx-5{--sd-gutter-x: 3rem}@media(min-width: 576px){.sd-col-sm-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-sm-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-sm-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-sm-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-sm-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-sm-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-sm-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-sm-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-sm-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-sm-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-sm-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-sm-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-sm-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-sm-0,.sd-gy-sm-0{--sd-gutter-y: 0}.sd-g-sm-0,.sd-gx-sm-0{--sd-gutter-x: 0}.sd-g-sm-1,.sd-gy-sm-1{--sd-gutter-y: 0.25rem}.sd-g-sm-1,.sd-gx-sm-1{--sd-gutter-x: 0.25rem}.sd-g-sm-2,.sd-gy-sm-2{--sd-gutter-y: 0.5rem}.sd-g-sm-2,.sd-gx-sm-2{--sd-gutter-x: 0.5rem}.sd-g-sm-3,.sd-gy-sm-3{--sd-gutter-y: 1rem}.sd-g-sm-3,.sd-gx-sm-3{--sd-gutter-x: 1rem}.sd-g-sm-4,.sd-gy-sm-4{--sd-gutter-y: 1.5rem}.sd-g-sm-4,.sd-gx-sm-4{--sd-gutter-x: 1.5rem}.sd-g-sm-5,.sd-gy-sm-5{--sd-gutter-y: 3rem}.sd-g-sm-5,.sd-gx-sm-5{--sd-gutter-x: 3rem}}@media(min-width: 768px){.sd-col-md-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-md-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-md-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-md-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-md-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-md-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-md-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-md-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-md-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-md-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-md-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-md-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-md-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-md-0,.sd-gy-md-0{--sd-gutter-y: 0}.sd-g-md-0,.sd-gx-md-0{--sd-gutter-x: 0}.sd-g-md-1,.sd-gy-md-1{--sd-gutter-y: 0.25rem}.sd-g-md-1,.sd-gx-md-1{--sd-gutter-x: 0.25rem}.sd-g-md-2,.sd-gy-md-2{--sd-gutter-y: 0.5rem}.sd-g-md-2,.sd-gx-md-2{--sd-gutter-x: 0.5rem}.sd-g-md-3,.sd-gy-md-3{--sd-gutter-y: 1rem}.sd-g-md-3,.sd-gx-md-3{--sd-gutter-x: 1rem}.sd-g-md-4,.sd-gy-md-4{--sd-gutter-y: 1.5rem}.sd-g-md-4,.sd-gx-md-4{--sd-gutter-x: 1.5rem}.sd-g-md-5,.sd-gy-md-5{--sd-gutter-y: 3rem}.sd-g-md-5,.sd-gx-md-5{--sd-gutter-x: 3rem}}@media(min-width: 992px){.sd-col-lg-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-lg-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-lg-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-lg-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-lg-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-lg-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-lg-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-lg-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-lg-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-lg-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-lg-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-lg-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-lg-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-lg-0,.sd-gy-lg-0{--sd-gutter-y: 0}.sd-g-lg-0,.sd-gx-lg-0{--sd-gutter-x: 0}.sd-g-lg-1,.sd-gy-lg-1{--sd-gutter-y: 0.25rem}.sd-g-lg-1,.sd-gx-lg-1{--sd-gutter-x: 0.25rem}.sd-g-lg-2,.sd-gy-lg-2{--sd-gutter-y: 0.5rem}.sd-g-lg-2,.sd-gx-lg-2{--sd-gutter-x: 0.5rem}.sd-g-lg-3,.sd-gy-lg-3{--sd-gutter-y: 1rem}.sd-g-lg-3,.sd-gx-lg-3{--sd-gutter-x: 1rem}.sd-g-lg-4,.sd-gy-lg-4{--sd-gutter-y: 1.5rem}.sd-g-lg-4,.sd-gx-lg-4{--sd-gutter-x: 1.5rem}.sd-g-lg-5,.sd-gy-lg-5{--sd-gutter-y: 3rem}.sd-g-lg-5,.sd-gx-lg-5{--sd-gutter-x: 3rem}}@media(min-width: 1200px){.sd-col-xl-auto{-ms-flex:0 0 auto;flex:0 0 auto;width:auto}.sd-col-xl-1{-ms-flex:0 0 auto;flex:0 0 auto;width:8.3333333333%}.sd-col-xl-2{-ms-flex:0 0 auto;flex:0 0 auto;width:16.6666666667%}.sd-col-xl-3{-ms-flex:0 0 auto;flex:0 0 auto;width:25%}.sd-col-xl-4{-ms-flex:0 0 auto;flex:0 0 auto;width:33.3333333333%}.sd-col-xl-5{-ms-flex:0 0 auto;flex:0 0 auto;width:41.6666666667%}.sd-col-xl-6{-ms-flex:0 0 auto;flex:0 0 auto;width:50%}.sd-col-xl-7{-ms-flex:0 0 auto;flex:0 0 auto;width:58.3333333333%}.sd-col-xl-8{-ms-flex:0 0 auto;flex:0 0 auto;width:66.6666666667%}.sd-col-xl-9{-ms-flex:0 0 auto;flex:0 0 auto;width:75%}.sd-col-xl-10{-ms-flex:0 0 auto;flex:0 0 auto;width:83.3333333333%}.sd-col-xl-11{-ms-flex:0 0 auto;flex:0 0 auto;width:91.6666666667%}.sd-col-xl-12{-ms-flex:0 0 auto;flex:0 0 auto;width:100%}.sd-g-xl-0,.sd-gy-xl-0{--sd-gutter-y: 0}.sd-g-xl-0,.sd-gx-xl-0{--sd-gutter-x: 0}.sd-g-xl-1,.sd-gy-xl-1{--sd-gutter-y: 0.25rem}.sd-g-xl-1,.sd-gx-xl-1{--sd-gutter-x: 0.25rem}.sd-g-xl-2,.sd-gy-xl-2{--sd-gutter-y: 0.5rem}.sd-g-xl-2,.sd-gx-xl-2{--sd-gutter-x: 0.5rem}.sd-g-xl-3,.sd-gy-xl-3{--sd-gutter-y: 1rem}.sd-g-xl-3,.sd-gx-xl-3{--sd-gutter-x: 1rem}.sd-g-xl-4,.sd-gy-xl-4{--sd-gutter-y: 1.5rem}.sd-g-xl-4,.sd-gx-xl-4{--sd-gutter-x: 1.5rem}.sd-g-xl-5,.sd-gy-xl-5{--sd-gutter-y: 3rem}.sd-g-xl-5,.sd-gx-xl-5{--sd-gutter-x: 3rem}}.sd-flex-row-reverse{flex-direction:row-reverse !important}details.sd-dropdown{position:relative;font-size:var(--sd-fontsize-dropdown)}details.sd-dropdown:hover{cursor:pointer}details.sd-dropdown .sd-summary-content{cursor:default}details.sd-dropdown summary.sd-summary-title{padding:.5em .6em .5em 1em;font-size:var(--sd-fontsize-dropdown-title);font-weight:var(--sd-fontweight-dropdown-title);user-select:none;-moz-user-select:none;-ms-user-select:none;-webkit-user-select:none;list-style:none;display:inline-flex;justify-content:space-between}details.sd-dropdown summary.sd-summary-title::-webkit-details-marker{display:none}details.sd-dropdown summary.sd-summary-title:focus{outline:none}details.sd-dropdown summary.sd-summary-title .sd-summary-icon{margin-right:.6em;display:inline-flex;align-items:center}details.sd-dropdown summary.sd-summary-title .sd-summary-icon svg{opacity:.8}details.sd-dropdown summary.sd-summary-title .sd-summary-text{flex-grow:1;line-height:1.5;padding-right:.5rem}details.sd-dropdown summary.sd-summary-title .sd-summary-state-marker{pointer-events:none;display:inline-flex;align-items:center}details.sd-dropdown summary.sd-summary-title .sd-summary-state-marker svg{opacity:.6}details.sd-dropdown summary.sd-summary-title:hover .sd-summary-state-marker svg{opacity:1;transform:scale(1.1)}details.sd-dropdown[open] summary .sd-octicon.no-title{visibility:hidden}details.sd-dropdown .sd-summary-chevron-right{transition:.25s}details.sd-dropdown[open]>.sd-summary-title .sd-summary-chevron-right{transform:rotate(90deg)}details.sd-dropdown[open]>.sd-summary-title .sd-summary-chevron-down{transform:rotate(180deg)}details.sd-dropdown:not([open]).sd-card{border:none}details.sd-dropdown:not([open])>.sd-card-header{border:1px solid var(--sd-color-card-border);border-radius:.25rem}details.sd-dropdown.sd-fade-in[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out;animation:sd-fade-in .5s ease-in-out}details.sd-dropdown.sd-fade-in-slide-down[open] summary~*{-moz-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;-webkit-animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out;animation:sd-fade-in .5s ease-in-out,sd-slide-down .5s ease-in-out}.sd-col>.sd-dropdown{width:100%}.sd-summary-content>.sd-tab-set:first-child{margin-top:0}@keyframes sd-fade-in{0%{opacity:0}100%{opacity:1}}@keyframes sd-slide-down{0%{transform:translate(0, -10px)}100%{transform:translate(0, 0)}}.sd-tab-set{border-radius:.125rem;display:flex;flex-wrap:wrap;margin:1em 0;position:relative}.sd-tab-set>input{opacity:0;position:absolute}.sd-tab-set>input:checked+label{border-color:var(--sd-color-tabs-underline-active);color:var(--sd-color-tabs-label-active)}.sd-tab-set>input:checked+label+.sd-tab-content{display:block}.sd-tab-set>input:not(:checked)+label:hover{color:var(--sd-color-tabs-label-hover);border-color:var(--sd-color-tabs-underline-hover)}.sd-tab-set>input:focus+label{outline-style:auto}.sd-tab-set>input:not(.focus-visible)+label{outline:none;-webkit-tap-highlight-color:transparent}.sd-tab-set>label{border-bottom:.125rem solid transparent;margin-bottom:0;color:var(--sd-color-tabs-label-inactive);border-color:var(--sd-color-tabs-underline-inactive);cursor:pointer;font-size:var(--sd-fontsize-tabs-label);font-weight:700;padding:1em 1.25em .5em;transition:color 250ms;width:auto;z-index:1}html .sd-tab-set>label:hover{color:var(--sd-color-tabs-label-active)}.sd-col>.sd-tab-set{width:100%}.sd-tab-content{box-shadow:0 -0.0625rem var(--sd-color-tabs-overline),0 .0625rem var(--sd-color-tabs-underline);display:none;order:99;padding-bottom:.75rem;padding-top:.75rem;width:100%}.sd-tab-content>:first-child{margin-top:0 !important}.sd-tab-content>:last-child{margin-bottom:0 !important}.sd-tab-content>.sd-tab-set{margin:0}.sd-sphinx-override,.sd-sphinx-override *{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sd-sphinx-override p{margin-top:0}:root{--sd-color-primary: #0071bc;--sd-color-secondary: #6c757d;--sd-color-success: #28a745;--sd-color-info: #17a2b8;--sd-color-warning: #f0b37e;--sd-color-danger: #dc3545;--sd-color-light: #f8f9fa;--sd-color-muted: #6c757d;--sd-color-dark: #212529;--sd-color-black: black;--sd-color-white: white;--sd-color-primary-highlight: #0060a0;--sd-color-secondary-highlight: #5c636a;--sd-color-success-highlight: #228e3b;--sd-color-info-highlight: #148a9c;--sd-color-warning-highlight: #cc986b;--sd-color-danger-highlight: #bb2d3b;--sd-color-light-highlight: #d3d4d5;--sd-color-muted-highlight: #5c636a;--sd-color-dark-highlight: #1c1f23;--sd-color-black-highlight: black;--sd-color-white-highlight: #d9d9d9;--sd-color-primary-bg: rgba(0, 113, 188, 0.2);--sd-color-secondary-bg: rgba(108, 117, 125, 0.2);--sd-color-success-bg: rgba(40, 167, 69, 0.2);--sd-color-info-bg: rgba(23, 162, 184, 0.2);--sd-color-warning-bg: rgba(240, 179, 126, 0.2);--sd-color-danger-bg: rgba(220, 53, 69, 0.2);--sd-color-light-bg: rgba(248, 249, 250, 0.2);--sd-color-muted-bg: rgba(108, 117, 125, 0.2);--sd-color-dark-bg: rgba(33, 37, 41, 0.2);--sd-color-black-bg: rgba(0, 0, 0, 0.2);--sd-color-white-bg: rgba(255, 255, 255, 0.2);--sd-color-primary-text: #fff;--sd-color-secondary-text: #fff;--sd-color-success-text: #fff;--sd-color-info-text: #fff;--sd-color-warning-text: #212529;--sd-color-danger-text: #fff;--sd-color-light-text: #212529;--sd-color-muted-text: #fff;--sd-color-dark-text: #fff;--sd-color-black-text: #fff;--sd-color-white-text: #212529;--sd-color-shadow: rgba(0, 0, 0, 0.15);--sd-color-card-border: rgba(0, 0, 0, 0.125);--sd-color-card-border-hover: hsla(231, 99%, 66%, 1);--sd-color-card-background: transparent;--sd-color-card-text: inherit;--sd-color-card-header: transparent;--sd-color-card-footer: transparent;--sd-color-tabs-label-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-hover: hsla(231, 99%, 66%, 1);--sd-color-tabs-label-inactive: hsl(0, 0%, 66%);--sd-color-tabs-underline-active: hsla(231, 99%, 66%, 1);--sd-color-tabs-underline-hover: rgba(178, 206, 245, 0.62);--sd-color-tabs-underline-inactive: transparent;--sd-color-tabs-overline: rgb(222, 222, 222);--sd-color-tabs-underline: rgb(222, 222, 222);--sd-fontsize-tabs-label: 1rem;--sd-fontsize-dropdown: inherit;--sd-fontsize-dropdown-title: 1rem;--sd-fontweight-dropdown-title: 700} diff --git a/msspecbook/_build/html/_static/basic.css b/msspecbook/_build/html/_static/basic.css new file mode 100644 index 0000000..2af6139 --- /dev/null +++ b/msspecbook/_build/html/_static/basic.css @@ -0,0 +1,925 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +div.section::after { + display: block; + content: ''; + clear: left; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 270px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li p.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 360px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} + +a:visited { + color: #551A8B; +} + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, figure.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, figure.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, figure.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, figure.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar, +aside.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px; + background-color: #ffe; + width: 40%; + float: right; + clear: right; + overflow-x: auto; +} + +p.sidebar-title { + font-weight: bold; +} + +nav.contents, +aside.topic, +div.admonition, div.topic, blockquote { + clear: left; +} + +/* -- topics ---------------------------------------------------------------- */ + +nav.contents, +aside.topic, +div.topic { + border: 1px solid #ccc; + padding: 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- content of sidebars/topics/admonitions -------------------------------- */ + +div.sidebar > :last-child, +aside.sidebar > :last-child, +nav.contents > :last-child, +aside.topic > :last-child, +div.topic > :last-child, +div.admonition > :last-child { + margin-bottom: 0; +} + +div.sidebar::after, +aside.sidebar::after, +nav.contents::after, +aside.topic::after, +div.topic::after, +div.admonition::after, +blockquote::after { + display: block; + content: ''; + clear: both; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + margin-top: 10px; + margin-bottom: 10px; + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > :first-child, +td > :first-child { + margin-top: 0px; +} + +th > :last-child, +td > :last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure, figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption, figcaption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number, +figcaption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text, +figcaption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist { + margin: 1em 0; +} + +table.hlist td { + vertical-align: top; +} + +/* -- object description styles --------------------------------------------- */ + +.sig { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; +} + +.sig-name, code.descname { + background-color: transparent; + font-weight: bold; +} + +.sig-name { + font-size: 1.1em; +} + +code.descname { + font-size: 1.2em; +} + +.sig-prename, code.descclassname { + background-color: transparent; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.sig-param.n { + font-style: italic; +} + +/* C++ specific styling */ + +.sig-inline.c-texpr, +.sig-inline.cpp-texpr { + font-family: unset; +} + +.sig.c .k, .sig.c .kt, +.sig.cpp .k, .sig.cpp .kt { + color: #0033B3; +} + +.sig.c .m, +.sig.cpp .m { + color: #1750EB; +} + +.sig.c .s, .sig.c .sc, +.sig.cpp .s, .sig.cpp .sc { + color: #067D17; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +:not(li) > ol > li:first-child > :first-child, +:not(li) > ul > li:first-child > :first-child { + margin-top: 0px; +} + +:not(li) > ol > li:last-child > :last-child, +:not(li) > ul > li:last-child > :last-child { + margin-bottom: 0px; +} + +ol.simple ol p, +ol.simple ul p, +ul.simple ol p, +ul.simple ul p { + margin-top: 0; +} + +ol.simple > li:not(:first-child) > p, +ul.simple > li:not(:first-child) > p { + margin-top: 0; +} + +ol.simple p, +ul.simple p { + margin-bottom: 0; +} + +aside.footnote > span, +div.citation > span { + float: left; +} +aside.footnote > span:last-of-type, +div.citation > span:last-of-type { + padding-right: 0.5em; +} +aside.footnote > p { + margin-left: 2em; +} +div.citation > p { + margin-left: 4em; +} +aside.footnote > p:last-of-type, +div.citation > p:last-of-type { + margin-bottom: 0em; +} +aside.footnote > p:last-of-type:after, +div.citation > p:last-of-type:after { + content: ""; + clear: both; +} + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > :first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +.sig dd { + margin-top: 0px; + margin-bottom: 0px; +} + +.sig dl { + margin-top: 0px; + margin-bottom: 0px; +} + +dl > dd:last-child, +dl > dd:last-child > :last-child { + margin-bottom: 0; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0 0.5em; + content: ":"; + display: inline-block; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +.translated { + background-color: rgba(207, 255, 207, 0.2) +} + +.untranslated { + background-color: rgba(255, 207, 207, 0.2) +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +pre, div[class*="highlight-"] { + clear: both; +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; + white-space: nowrap; +} + +div[class*="highlight-"] { + margin: 1em 0; +} + +td.linenos pre { + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + display: block; +} + +table.highlighttable tbody { + display: block; +} + +table.highlighttable tr { + display: flex; +} + +table.highlighttable td { + margin: 0; + padding: 0; +} + +table.highlighttable td.linenos { + padding-right: 0.5em; +} + +table.highlighttable td.code { + flex: 1; + overflow: hidden; +} + +.highlight .hll { + display: block; +} + +div.highlight pre, +table.highlighttable pre { + margin: 0; +} + +div.code-block-caption + div { + margin-top: 0; +} + +div.code-block-caption { + margin-top: 1em; + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +table.highlighttable td.linenos, +span.linenos, +div.highlight span.gp { /* gp: Generic.Prompt */ + user-select: none; + -webkit-user-select: text; /* Safari fallback only */ + -webkit-user-select: none; /* Chrome/Safari */ + -moz-user-select: none; /* Firefox */ + -ms-user-select: none; /* IE10+ */ +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + margin: 1em 0; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: absolute; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/msspecbook/_build/html/_static/check-solid.svg b/msspecbook/_build/html/_static/check-solid.svg new file mode 100644 index 0000000..92fad4b --- /dev/null +++ b/msspecbook/_build/html/_static/check-solid.svg @@ -0,0 +1,4 @@ + + + + diff --git a/msspecbook/_build/html/_static/clipboard.min.js b/msspecbook/_build/html/_static/clipboard.min.js new file mode 100644 index 0000000..54b3c46 --- /dev/null +++ b/msspecbook/_build/html/_static/clipboard.min.js @@ -0,0 +1,7 @@ +/*! + * clipboard.js v2.0.8 + * https://clipboardjs.com/ + * + * Licensed MIT © Zeno Rocha + */ +!function(t,e){"object"==typeof exports&&"object"==typeof module?module.exports=e():"function"==typeof define&&define.amd?define([],e):"object"==typeof exports?exports.ClipboardJS=e():t.ClipboardJS=e()}(this,function(){return n={686:function(t,e,n){"use strict";n.d(e,{default:function(){return o}});var e=n(279),i=n.n(e),e=n(370),u=n.n(e),e=n(817),c=n.n(e);function a(t){try{return document.execCommand(t)}catch(t){return}}var f=function(t){t=c()(t);return a("cut"),t};var l=function(t){var e,n,o,r=1 + + + + diff --git a/msspecbook/_build/html/_static/copybutton.css b/msspecbook/_build/html/_static/copybutton.css new file mode 100644 index 0000000..f1916ec --- /dev/null +++ b/msspecbook/_build/html/_static/copybutton.css @@ -0,0 +1,94 @@ +/* Copy buttons */ +button.copybtn { + position: absolute; + display: flex; + top: .3em; + right: .3em; + width: 1.7em; + height: 1.7em; + opacity: 0; + transition: opacity 0.3s, border .3s, background-color .3s; + user-select: none; + padding: 0; + border: none; + outline: none; + border-radius: 0.4em; + /* The colors that GitHub uses */ + border: #1b1f2426 1px solid; + background-color: #f6f8fa; + color: #57606a; +} + +button.copybtn.success { + border-color: #22863a; + color: #22863a; +} + +button.copybtn svg { + stroke: currentColor; + width: 1.5em; + height: 1.5em; + padding: 0.1em; +} + +div.highlight { + position: relative; +} + +/* Show the copybutton */ +.highlight:hover button.copybtn, button.copybtn.success { + opacity: 1; +} + +.highlight button.copybtn:hover { + background-color: rgb(235, 235, 235); +} + +.highlight button.copybtn:active { + background-color: rgb(187, 187, 187); +} + +/** + * A minimal CSS-only tooltip copied from: + * https://codepen.io/mildrenben/pen/rVBrpK + * + * To use, write HTML like the following: + * + *

Short

+ */ + .o-tooltip--left { + position: relative; + } + + .o-tooltip--left:after { + opacity: 0; + visibility: hidden; + position: absolute; + content: attr(data-tooltip); + padding: .2em; + font-size: .8em; + left: -.2em; + background: grey; + color: white; + white-space: nowrap; + z-index: 2; + border-radius: 2px; + transform: translateX(-102%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); +} + +.o-tooltip--left:hover:after { + display: block; + opacity: 1; + visibility: visible; + transform: translateX(-100%) translateY(0); + transition: opacity 0.2s cubic-bezier(0.64, 0.09, 0.08, 1), transform 0.2s cubic-bezier(0.64, 0.09, 0.08, 1); + transition-delay: .5s; +} + +/* By default the copy button shouldn't show up when printing a page */ +@media print { + button.copybtn { + display: none; + } +} diff --git a/msspecbook/_build/html/_static/copybutton.js b/msspecbook/_build/html/_static/copybutton.js new file mode 100644 index 0000000..2ea7ff3 --- /dev/null +++ b/msspecbook/_build/html/_static/copybutton.js @@ -0,0 +1,248 @@ +// Localization support +const messages = { + 'en': { + 'copy': 'Copy', + 'copy_to_clipboard': 'Copy to clipboard', + 'copy_success': 'Copied!', + 'copy_failure': 'Failed to copy', + }, + 'es' : { + 'copy': 'Copiar', + 'copy_to_clipboard': 'Copiar al portapapeles', + 'copy_success': '¡Copiado!', + 'copy_failure': 'Error al copiar', + }, + 'de' : { + 'copy': 'Kopieren', + 'copy_to_clipboard': 'In die Zwischenablage kopieren', + 'copy_success': 'Kopiert!', + 'copy_failure': 'Fehler beim Kopieren', + }, + 'fr' : { + 'copy': 'Copier', + 'copy_to_clipboard': 'Copier dans le presse-papier', + 'copy_success': 'Copié !', + 'copy_failure': 'Échec de la copie', + }, + 'ru': { + 'copy': 'Скопировать', + 'copy_to_clipboard': 'Скопировать в буфер', + 'copy_success': 'Скопировано!', + 'copy_failure': 'Не удалось скопировать', + }, + 'zh-CN': { + 'copy': '复制', + 'copy_to_clipboard': '复制到剪贴板', + 'copy_success': '复制成功!', + 'copy_failure': '复制失败', + }, + 'it' : { + 'copy': 'Copiare', + 'copy_to_clipboard': 'Copiato negli appunti', + 'copy_success': 'Copiato!', + 'copy_failure': 'Errore durante la copia', + } +} + +let locale = 'en' +if( document.documentElement.lang !== undefined + && messages[document.documentElement.lang] !== undefined ) { + locale = document.documentElement.lang +} + +let doc_url_root = DOCUMENTATION_OPTIONS.URL_ROOT; +if (doc_url_root == '#') { + doc_url_root = ''; +} + +/** + * SVG files for our copy buttons + */ +let iconCheck = ` + ${messages[locale]['copy_success']} + + +` + +// If the user specified their own SVG use that, otherwise use the default +let iconCopy = ``; +if (!iconCopy) { + iconCopy = ` + ${messages[locale]['copy_to_clipboard']} + + + +` +} + +/** + * Set up copy/paste for code blocks + */ + +const runWhenDOMLoaded = cb => { + if (document.readyState != 'loading') { + cb() + } else if (document.addEventListener) { + document.addEventListener('DOMContentLoaded', cb) + } else { + document.attachEvent('onreadystatechange', function() { + if (document.readyState == 'complete') cb() + }) + } +} + +const codeCellId = index => `codecell${index}` + +// Clears selected text since ClipboardJS will select the text when copying +const clearSelection = () => { + if (window.getSelection) { + window.getSelection().removeAllRanges() + } else if (document.selection) { + document.selection.empty() + } +} + +// Changes tooltip text for a moment, then changes it back +// We want the timeout of our `success` class to be a bit shorter than the +// tooltip and icon change, so that we can hide the icon before changing back. +var timeoutIcon = 2000; +var timeoutSuccessClass = 1500; + +const temporarilyChangeTooltip = (el, oldText, newText) => { + el.setAttribute('data-tooltip', newText) + el.classList.add('success') + // Remove success a little bit sooner than we change the tooltip + // So that we can use CSS to hide the copybutton first + setTimeout(() => el.classList.remove('success'), timeoutSuccessClass) + setTimeout(() => el.setAttribute('data-tooltip', oldText), timeoutIcon) +} + +// Changes the copy button icon for two seconds, then changes it back +const temporarilyChangeIcon = (el) => { + el.innerHTML = iconCheck; + setTimeout(() => {el.innerHTML = iconCopy}, timeoutIcon) +} + +const addCopyButtonToCodeCells = () => { + // If ClipboardJS hasn't loaded, wait a bit and try again. This + // happens because we load ClipboardJS asynchronously. + if (window.ClipboardJS === undefined) { + setTimeout(addCopyButtonToCodeCells, 250) + return + } + + // Add copybuttons to all of our code cells + const COPYBUTTON_SELECTOR = 'div.highlight pre'; + const codeCells = document.querySelectorAll(COPYBUTTON_SELECTOR) + codeCells.forEach((codeCell, index) => { + const id = codeCellId(index) + codeCell.setAttribute('id', id) + + const clipboardButton = id => + `` + codeCell.insertAdjacentHTML('afterend', clipboardButton(id)) + }) + +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} + + +var copyTargetText = (trigger) => { + var target = document.querySelector(trigger.attributes['data-clipboard-target'].value); + + // get filtered text + let exclude = '.linenos'; + + let text = filterText(target, exclude); + return formatCopyText(text, '', false, true, true, true, '', '') +} + + // Initialize with a callback so we can modify the text before copy + const clipboard = new ClipboardJS('.copybtn', {text: copyTargetText}) + + // Update UI with error/success messages + clipboard.on('success', event => { + clearSelection() + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_success']) + temporarilyChangeIcon(event.trigger) + }) + + clipboard.on('error', event => { + temporarilyChangeTooltip(event.trigger, messages[locale]['copy'], messages[locale]['copy_failure']) + }) +} + +runWhenDOMLoaded(addCopyButtonToCodeCells) \ No newline at end of file diff --git a/msspecbook/_build/html/_static/copybutton_funcs.js b/msspecbook/_build/html/_static/copybutton_funcs.js new file mode 100644 index 0000000..dbe1aaa --- /dev/null +++ b/msspecbook/_build/html/_static/copybutton_funcs.js @@ -0,0 +1,73 @@ +function escapeRegExp(string) { + return string.replace(/[.*+?^${}()|[\]\\]/g, '\\$&'); // $& means the whole matched string +} + +/** + * Removes excluded text from a Node. + * + * @param {Node} target Node to filter. + * @param {string} exclude CSS selector of nodes to exclude. + * @returns {DOMString} Text from `target` with text removed. + */ +export function filterText(target, exclude) { + const clone = target.cloneNode(true); // clone as to not modify the live DOM + if (exclude) { + // remove excluded nodes + clone.querySelectorAll(exclude).forEach(node => node.remove()); + } + return clone.innerText; +} + +// Callback when a copy button is clicked. Will be passed the node that was clicked +// should then grab the text and replace pieces of text that shouldn't be used in output +export function formatCopyText(textContent, copybuttonPromptText, isRegexp = false, onlyCopyPromptLines = true, removePrompts = true, copyEmptyLines = true, lineContinuationChar = "", hereDocDelim = "") { + var regexp; + var match; + + // Do we check for line continuation characters and "HERE-documents"? + var useLineCont = !!lineContinuationChar + var useHereDoc = !!hereDocDelim + + // create regexp to capture prompt and remaining line + if (isRegexp) { + regexp = new RegExp('^(' + copybuttonPromptText + ')(.*)') + } else { + regexp = new RegExp('^(' + escapeRegExp(copybuttonPromptText) + ')(.*)') + } + + const outputLines = []; + var promptFound = false; + var gotLineCont = false; + var gotHereDoc = false; + const lineGotPrompt = []; + for (const line of textContent.split('\n')) { + match = line.match(regexp) + if (match || gotLineCont || gotHereDoc) { + promptFound = regexp.test(line) + lineGotPrompt.push(promptFound) + if (removePrompts && promptFound) { + outputLines.push(match[2]) + } else { + outputLines.push(line) + } + gotLineCont = line.endsWith(lineContinuationChar) & useLineCont + if (line.includes(hereDocDelim) & useHereDoc) + gotHereDoc = !gotHereDoc + } else if (!onlyCopyPromptLines) { + outputLines.push(line) + } else if (copyEmptyLines && line.trim() === '') { + outputLines.push(line) + } + } + + // If no lines with the prompt were found then just use original lines + if (lineGotPrompt.some(v => v === true)) { + textContent = outputLines.join('\n'); + } + + // Remove a trailing newline to avoid auto-running when pasting + if (textContent.endsWith("\n")) { + textContent = textContent.slice(0, -1) + } + return textContent +} diff --git a/msspecbook/_build/html/_static/design-tabs.js b/msspecbook/_build/html/_static/design-tabs.js new file mode 100644 index 0000000..b25bd6a --- /dev/null +++ b/msspecbook/_build/html/_static/design-tabs.js @@ -0,0 +1,101 @@ +// @ts-check + +// Extra JS capability for selected tabs to be synced +// The selection is stored in local storage so that it persists across page loads. + +/** + * @type {Record} + */ +let sd_id_to_elements = {}; +const storageKeyPrefix = "sphinx-design-tab-id-"; + +/** + * Create a key for a tab element. + * @param {HTMLElement} el - The tab element. + * @returns {[string, string, string] | null} - The key. + * + */ +function create_key(el) { + let syncId = el.getAttribute("data-sync-id"); + let syncGroup = el.getAttribute("data-sync-group"); + if (!syncId || !syncGroup) return null; + return [syncGroup, syncId, syncGroup + "--" + syncId]; +} + +/** + * Initialize the tab selection. + * + */ +function ready() { + // Find all tabs with sync data + + /** @type {string[]} */ + let groups = []; + + document.querySelectorAll(".sd-tab-label").forEach((label) => { + if (label instanceof HTMLElement) { + let data = create_key(label); + if (data) { + let [group, id, key] = data; + + // add click event listener + // @ts-ignore + label.onclick = onSDLabelClick; + + // store map of key to elements + if (!sd_id_to_elements[key]) { + sd_id_to_elements[key] = []; + } + sd_id_to_elements[key].push(label); + + if (groups.indexOf(group) === -1) { + groups.push(group); + // Check if a specific tab has been selected via URL parameter + const tabParam = new URLSearchParams(window.location.search).get( + group + ); + if (tabParam) { + console.log( + "sphinx-design: Selecting tab id for group '" + + group + + "' from URL parameter: " + + tabParam + ); + window.sessionStorage.setItem(storageKeyPrefix + group, tabParam); + } + } + + // Check is a specific tab has been selected previously + let previousId = window.sessionStorage.getItem( + storageKeyPrefix + group + ); + if (previousId === id) { + // console.log( + // "sphinx-design: Selecting tab from session storage: " + id + // ); + // @ts-ignore + label.previousElementSibling.checked = true; + } + } + } + }); +} + +/** + * Activate other tabs with the same sync id. + * + * @this {HTMLElement} - The element that was clicked. + */ +function onSDLabelClick() { + let data = create_key(this); + if (!data) return; + let [group, id, key] = data; + for (const label of sd_id_to_elements[key]) { + if (label === this) continue; + // @ts-ignore + label.previousElementSibling.checked = true; + } + window.sessionStorage.setItem(storageKeyPrefix + group, id); +} + +document.addEventListener("DOMContentLoaded", ready, false); diff --git a/msspecbook/_build/html/_static/doctools.js b/msspecbook/_build/html/_static/doctools.js new file mode 100644 index 0000000..4d67807 --- /dev/null +++ b/msspecbook/_build/html/_static/doctools.js @@ -0,0 +1,156 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Base JavaScript utilities for all Sphinx HTML documentation. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ +"use strict"; + +const BLACKLISTED_KEY_CONTROL_ELEMENTS = new Set([ + "TEXTAREA", + "INPUT", + "SELECT", + "BUTTON", +]); + +const _ready = (callback) => { + if (document.readyState !== "loading") { + callback(); + } else { + document.addEventListener("DOMContentLoaded", callback); + } +}; + +/** + * Small JavaScript module for the documentation. + */ +const Documentation = { + init: () => { + Documentation.initDomainIndexTable(); + Documentation.initOnKeyListeners(); + }, + + /** + * i18n support + */ + TRANSLATIONS: {}, + PLURAL_EXPR: (n) => (n === 1 ? 0 : 1), + LOCALE: "unknown", + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext: (string) => { + const translated = Documentation.TRANSLATIONS[string]; + switch (typeof translated) { + case "undefined": + return string; // no translation + case "string": + return translated; // translation exists + default: + return translated[0]; // (singular, plural) translation tuple exists + } + }, + + ngettext: (singular, plural, n) => { + const translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated !== "undefined") + return translated[Documentation.PLURAL_EXPR(n)]; + return n === 1 ? singular : plural; + }, + + addTranslations: (catalog) => { + Object.assign(Documentation.TRANSLATIONS, catalog.messages); + Documentation.PLURAL_EXPR = new Function( + "n", + `return (${catalog.plural_expr})` + ); + Documentation.LOCALE = catalog.locale; + }, + + /** + * helper function to focus on search bar + */ + focusSearchBar: () => { + document.querySelectorAll("input[name=q]")[0]?.focus(); + }, + + /** + * Initialise the domain index toggle buttons + */ + initDomainIndexTable: () => { + const toggler = (el) => { + const idNumber = el.id.substr(7); + const toggledRows = document.querySelectorAll(`tr.cg-${idNumber}`); + if (el.src.substr(-9) === "minus.png") { + el.src = `${el.src.substr(0, el.src.length - 9)}plus.png`; + toggledRows.forEach((el) => (el.style.display = "none")); + } else { + el.src = `${el.src.substr(0, el.src.length - 8)}minus.png`; + toggledRows.forEach((el) => (el.style.display = "")); + } + }; + + const togglerElements = document.querySelectorAll("img.toggler"); + togglerElements.forEach((el) => + el.addEventListener("click", (event) => toggler(event.currentTarget)) + ); + togglerElements.forEach((el) => (el.style.display = "")); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) togglerElements.forEach(toggler); + }, + + initOnKeyListeners: () => { + // only install a listener if it is really needed + if ( + !DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS && + !DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS + ) + return; + + document.addEventListener("keydown", (event) => { + // bail for input elements + if (BLACKLISTED_KEY_CONTROL_ELEMENTS.has(document.activeElement.tagName)) return; + // bail with special keys + if (event.altKey || event.ctrlKey || event.metaKey) return; + + if (!event.shiftKey) { + switch (event.key) { + case "ArrowLeft": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const prevLink = document.querySelector('link[rel="prev"]'); + if (prevLink && prevLink.href) { + window.location.href = prevLink.href; + event.preventDefault(); + } + break; + case "ArrowRight": + if (!DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) break; + + const nextLink = document.querySelector('link[rel="next"]'); + if (nextLink && nextLink.href) { + window.location.href = nextLink.href; + event.preventDefault(); + } + break; + } + } + + // some keyboard layouts may need Shift to get / + switch (event.key) { + case "/": + if (!DOCUMENTATION_OPTIONS.ENABLE_SEARCH_SHORTCUTS) break; + Documentation.focusSearchBar(); + event.preventDefault(); + } + }); + }, +}; + +// quick alias for translations +const _ = Documentation.gettext; + +_ready(Documentation.init); diff --git a/msspecbook/_build/html/_static/documentation_options.js b/msspecbook/_build/html/_static/documentation_options.js new file mode 100644 index 0000000..dab586c --- /dev/null +++ b/msspecbook/_build/html/_static/documentation_options.js @@ -0,0 +1,13 @@ +const DOCUMENTATION_OPTIONS = { + VERSION: '', + LANGUAGE: 'en', + COLLAPSE_INDEX: false, + BUILDER: 'html', + FILE_SUFFIX: '.html', + LINK_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '', + NAVIGATION_WITH_KEYS: false, + SHOW_SEARCH_SUMMARY: true, + ENABLE_SEARCH_SHORTCUTS: true, +}; \ No newline at end of file diff --git a/msspecbook/_build/html/_static/file.png b/msspecbook/_build/html/_static/file.png new file mode 100644 index 0000000..a858a41 Binary files /dev/null and b/msspecbook/_build/html/_static/file.png differ diff --git a/msspecbook/_build/html/_static/images/logo_binder.svg b/msspecbook/_build/html/_static/images/logo_binder.svg new file mode 100644 index 0000000..45fecf7 --- /dev/null +++ b/msspecbook/_build/html/_static/images/logo_binder.svg @@ -0,0 +1,19 @@ + + + + +logo + + + + + + + + diff --git a/msspecbook/_build/html/_static/images/logo_colab.png b/msspecbook/_build/html/_static/images/logo_colab.png new file mode 100644 index 0000000..b7560ec Binary files /dev/null and b/msspecbook/_build/html/_static/images/logo_colab.png differ diff --git a/msspecbook/_build/html/_static/images/logo_deepnote.svg b/msspecbook/_build/html/_static/images/logo_deepnote.svg new file mode 100644 index 0000000..fa77ebf --- /dev/null +++ b/msspecbook/_build/html/_static/images/logo_deepnote.svg @@ -0,0 +1 @@ + diff --git a/msspecbook/_build/html/_static/images/logo_jupyterhub.svg b/msspecbook/_build/html/_static/images/logo_jupyterhub.svg new file mode 100644 index 0000000..60cfe9f --- /dev/null +++ b/msspecbook/_build/html/_static/images/logo_jupyterhub.svg @@ -0,0 +1 @@ +logo_jupyterhubHub diff --git a/msspecbook/_build/html/_static/language_data.js b/msspecbook/_build/html/_static/language_data.js new file mode 100644 index 0000000..367b8ed --- /dev/null +++ b/msspecbook/_build/html/_static/language_data.js @@ -0,0 +1,199 @@ +/* + * language_data.js + * ~~~~~~~~~~~~~~~~ + * + * This script contains the language-specific data used by searchtools.js, + * namely the list of stopwords, stemmer, scorer and splitter. + * + * :copyright: Copyright 2007-2024 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +var stopwords = ["a", "and", "are", "as", "at", "be", "but", "by", "for", "if", "in", "into", "is", "it", "near", "no", "not", "of", "on", "or", "such", "that", "the", "their", "then", "there", "these", "they", "this", "to", "was", "will", "with"]; + + +/* Non-minified version is copied as a separate JS file, if available */ + +/** + * Porter Stemmer + */ +var Stemmer = function() { + + var step2list = { + ational: 'ate', + tional: 'tion', + enci: 'ence', + anci: 'ance', + izer: 'ize', + bli: 'ble', + alli: 'al', + entli: 'ent', + eli: 'e', + ousli: 'ous', + ization: 'ize', + ation: 'ate', + ator: 'ate', + alism: 'al', + iveness: 'ive', + fulness: 'ful', + ousness: 'ous', + aliti: 'al', + iviti: 'ive', + biliti: 'ble', + logi: 'log' + }; + + var step3list = { + icate: 'ic', + ative: '', + alize: 'al', + iciti: 'ic', + ical: 'ic', + ful: '', + ness: '' + }; + + var c = "[^aeiou]"; // consonant + var v = "[aeiouy]"; // vowel + var C = c + "[^aeiouy]*"; // consonant sequence + var V = v + "[aeiou]*"; // vowel sequence + + var mgr0 = "^(" + C + ")?" + V + C; // [C]VC... is m>0 + var meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$"; // [C]VC[V] is m=1 + var mgr1 = "^(" + C + ")?" + V + C + V + C; // [C]VCVC... is m>1 + var s_v = "^(" + C + ")?" + v; // vowel in stem + + this.stemWord = function (w) { + var stem; + var suffix; + var firstch; + var origword = w; + + if (w.length < 3) + return w; + + var re; + var re2; + var re3; + var re4; + + firstch = w.substr(0,1); + if (firstch == "y") + w = firstch.toUpperCase() + w.substr(1); + + // Step 1a + re = /^(.+?)(ss|i)es$/; + re2 = /^(.+?)([^s])s$/; + + if (re.test(w)) + w = w.replace(re,"$1$2"); + else if (re2.test(w)) + w = w.replace(re2,"$1$2"); + + // Step 1b + re = /^(.+?)eed$/; + re2 = /^(.+?)(ed|ing)$/; + if (re.test(w)) { + var fp = re.exec(w); + re = new RegExp(mgr0); + if (re.test(fp[1])) { + re = /.$/; + w = w.replace(re,""); + } + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1]; + re2 = new RegExp(s_v); + if (re2.test(stem)) { + w = stem; + re2 = /(at|bl|iz)$/; + re3 = new RegExp("([^aeiouylsz])\\1$"); + re4 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re2.test(w)) + w = w + "e"; + else if (re3.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + else if (re4.test(w)) + w = w + "e"; + } + } + + // Step 1c + re = /^(.+?)y$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(s_v); + if (re.test(stem)) + w = stem + "i"; + } + + // Step 2 + re = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step2list[suffix]; + } + + // Step 3 + re = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step3list[suffix]; + } + + // Step 4 + re = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/; + re2 = /^(.+?)(s|t)(ion)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + if (re.test(stem)) + w = stem; + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1] + fp[2]; + re2 = new RegExp(mgr1); + if (re2.test(stem)) + w = stem; + } + + // Step 5 + re = /^(.+?)e$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + re2 = new RegExp(meq1); + re3 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re.test(stem) || (re2.test(stem) && !(re3.test(stem)))) + w = stem; + } + re = /ll$/; + re2 = new RegExp(mgr1); + if (re.test(w) && re2.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + + // and turn initial Y back to y + if (firstch == "y") + w = firstch.toLowerCase() + w.substr(1); + return w; + } +} + diff --git a/msspecbook/_build/html/_static/locales/ar/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ar/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..15541a6 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ar/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ar/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ar/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..066f20f --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ar/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ar\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "بواسطة" + +msgid "By" +msgstr "بواسطة" + +msgid "Contents" +msgstr "محتويات" + +msgid "Copyright" +msgstr "حقوق النشر" + +msgid "Download notebook file" +msgstr "تنزيل ملف دفتر الملاحظات" + +msgid "Download source file" +msgstr "تنزيل ملف المصدر" + +msgid "Download this page" +msgstr "قم بتنزيل هذه الصفحة" + +msgid "Edit this page" +msgstr "قم بتحرير هذه الصفحة" + +msgid "Fullscreen mode" +msgstr "وضع ملء الشاشة" + +msgid "Last updated on" +msgstr "آخر تحديث في" + +msgid "Launch" +msgstr "إطلاق" + +msgid "Open an issue" +msgstr "افتح قضية" + +msgid "Print to PDF" +msgstr "طباعة إلى PDF" + +msgid "Source repository" +msgstr "مستودع المصدر" + +msgid "Sphinx Book Theme" +msgstr "موضوع كتاب أبو الهول" + +msgid "Theme by the" +msgstr "موضوع بواسطة" + +msgid "Toggle navigation" +msgstr "تبديل التنقل" + +msgid "next page" +msgstr "الصفحة التالية" + +msgid "open issue" +msgstr "قضية مفتوحة" + +msgid "previous page" +msgstr "الصفحة السابقة" + +msgid "repository" +msgstr "مخزن" + +msgid "suggest edit" +msgstr "أقترح تحرير" diff --git a/msspecbook/_build/html/_static/locales/bg/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/bg/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..da95120 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/bg/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/bg/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/bg/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..0f22f49 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/bg/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: bg\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "По" + +msgid "By" +msgstr "От" + +msgid "Contents" +msgstr "Съдържание" + +msgid "Copyright" +msgstr "Авторско право" + +msgid "Download notebook file" +msgstr "Изтеглете файла на бележника" + +msgid "Download source file" +msgstr "Изтеглете изходния файл" + +msgid "Download this page" +msgstr "Изтеглете тази страница" + +msgid "Edit this page" +msgstr "Редактирайте тази страница" + +msgid "Fullscreen mode" +msgstr "Режим на цял екран" + +msgid "Last updated on" +msgstr "Последна актуализация на" + +msgid "Launch" +msgstr "Стартиране" + +msgid "Open an issue" +msgstr "Отворете проблем" + +msgid "Print to PDF" +msgstr "Печат в PDF" + +msgid "Source repository" +msgstr "Хранилище на източника" + +msgid "Sphinx Book Theme" +msgstr "Тема на книгата Sphinx" + +msgid "Theme by the" +msgstr "Тема от" + +msgid "Toggle navigation" +msgstr "Превключване на навигацията" + +msgid "next page" +msgstr "Следваща страница" + +msgid "open issue" +msgstr "отворен брой" + +msgid "previous page" +msgstr "предишна страница" + +msgid "repository" +msgstr "хранилище" + +msgid "suggest edit" +msgstr "предложи редактиране" diff --git a/msspecbook/_build/html/_static/locales/bn/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/bn/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..6b96639 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/bn/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/bn/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/bn/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..7202a5f --- /dev/null +++ b/msspecbook/_build/html/_static/locales/bn/LC_MESSAGES/booktheme.po @@ -0,0 +1,63 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: bn\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "দ্বারা" + +msgid "By" +msgstr "দ্বারা" + +msgid "Copyright" +msgstr "কপিরাইট" + +msgid "Download notebook file" +msgstr "নোটবুক ফাইল ডাউনলোড করুন" + +msgid "Download source file" +msgstr "উত্স ফাইল ডাউনলোড করুন" + +msgid "Download this page" +msgstr "এই পৃষ্ঠাটি ডাউনলোড করুন" + +msgid "Edit this page" +msgstr "এই পৃষ্ঠাটি সম্পাদনা করুন" + +msgid "Last updated on" +msgstr "সর্বশেষ আপডেট" + +msgid "Launch" +msgstr "শুরু করা" + +msgid "Open an issue" +msgstr "একটি সমস্যা খুলুন" + +msgid "Print to PDF" +msgstr "পিডিএফ প্রিন্ট করুন" + +msgid "Source repository" +msgstr "উত্স সংগ্রহস্থল" + +msgid "Sphinx Book Theme" +msgstr "স্পিনিক্স বুক থিম" + +msgid "Theme by the" +msgstr "থিম দ্বারা" + +msgid "Toggle navigation" +msgstr "নেভিগেশন টগল করুন" + +msgid "next page" +msgstr "পরবর্তী পৃষ্ঠা" + +msgid "open issue" +msgstr "খোলা সমস্যা" + +msgid "previous page" +msgstr "আগের পৃষ্ঠা" diff --git a/msspecbook/_build/html/_static/locales/ca/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ca/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..a4dd30e Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ca/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ca/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ca/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..a325041 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ca/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ca\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Per la" + +msgid "By" +msgstr "Per" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download notebook file" +msgstr "Descarregar fitxer de quadern" + +msgid "Download source file" +msgstr "Baixeu el fitxer font" + +msgid "Download this page" +msgstr "Descarregueu aquesta pàgina" + +msgid "Edit this page" +msgstr "Editeu aquesta pàgina" + +msgid "Last updated on" +msgstr "Darrera actualització el" + +msgid "Launch" +msgstr "Llançament" + +msgid "Open an issue" +msgstr "Obriu un número" + +msgid "Print to PDF" +msgstr "Imprimeix a PDF" + +msgid "Source repository" +msgstr "Dipòsit de fonts" + +msgid "Sphinx Book Theme" +msgstr "Tema del llibre Esfinx" + +msgid "Theme by the" +msgstr "Tema del" + +msgid "Toggle navigation" +msgstr "Commuta la navegació" + +msgid "next page" +msgstr "pàgina següent" + +msgid "open issue" +msgstr "número obert" + +msgid "previous page" +msgstr "Pàgina anterior" + +msgid "suggest edit" +msgstr "suggerir edició" diff --git a/msspecbook/_build/html/_static/locales/cs/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/cs/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..c39e01a Binary files /dev/null and b/msspecbook/_build/html/_static/locales/cs/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/cs/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/cs/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..97e52e8 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/cs/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: cs\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Podle" + +msgid "By" +msgstr "Podle" + +msgid "Contents" +msgstr "Obsah" + +msgid "Copyright" +msgstr "autorská práva" + +msgid "Download notebook file" +msgstr "Stáhnout soubor poznámkového bloku" + +msgid "Download source file" +msgstr "Stáhněte si zdrojový soubor" + +msgid "Download this page" +msgstr "Stáhněte si tuto stránku" + +msgid "Edit this page" +msgstr "Upravit tuto stránku" + +msgid "Fullscreen mode" +msgstr "Režim celé obrazovky" + +msgid "Last updated on" +msgstr "Naposledy aktualizováno" + +msgid "Launch" +msgstr "Zahájení" + +msgid "Open an issue" +msgstr "Otevřete problém" + +msgid "Print to PDF" +msgstr "Tisk do PDF" + +msgid "Source repository" +msgstr "Zdrojové úložiště" + +msgid "Sphinx Book Theme" +msgstr "Téma knihy Sfinga" + +msgid "Theme by the" +msgstr "Téma od" + +msgid "Toggle navigation" +msgstr "Přepnout navigaci" + +msgid "next page" +msgstr "další strana" + +msgid "open issue" +msgstr "otevřené číslo" + +msgid "previous page" +msgstr "předchozí stránka" + +msgid "repository" +msgstr "úložiště" + +msgid "suggest edit" +msgstr "navrhnout úpravy" diff --git a/msspecbook/_build/html/_static/locales/da/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/da/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..f43157d Binary files /dev/null and b/msspecbook/_build/html/_static/locales/da/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/da/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/da/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..084b4e5 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/da/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: da\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Ved" + +msgid "By" +msgstr "Ved" + +msgid "Contents" +msgstr "Indhold" + +msgid "Copyright" +msgstr "ophavsret" + +msgid "Download notebook file" +msgstr "Download notesbog-fil" + +msgid "Download source file" +msgstr "Download kildefil" + +msgid "Download this page" +msgstr "Download denne side" + +msgid "Edit this page" +msgstr "Rediger denne side" + +msgid "Fullscreen mode" +msgstr "Fuldskærmstilstand" + +msgid "Last updated on" +msgstr "Sidst opdateret den" + +msgid "Launch" +msgstr "Start" + +msgid "Open an issue" +msgstr "Åbn et problem" + +msgid "Print to PDF" +msgstr "Udskriv til PDF" + +msgid "Source repository" +msgstr "Kildelager" + +msgid "Sphinx Book Theme" +msgstr "Sphinx bogtema" + +msgid "Theme by the" +msgstr "Tema af" + +msgid "Toggle navigation" +msgstr "Skift navigation" + +msgid "next page" +msgstr "Næste side" + +msgid "open issue" +msgstr "åbent nummer" + +msgid "previous page" +msgstr "forrige side" + +msgid "repository" +msgstr "lager" + +msgid "suggest edit" +msgstr "foreslå redigering" diff --git a/msspecbook/_build/html/_static/locales/de/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/de/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..648b565 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/de/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/de/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/de/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..1ed1dc1 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/de/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: de\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Bis zum" + +msgid "By" +msgstr "Durch" + +msgid "Contents" +msgstr "Inhalt" + +msgid "Copyright" +msgstr "Urheberrechte ©" + +msgid "Download notebook file" +msgstr "Notebook-Datei herunterladen" + +msgid "Download source file" +msgstr "Quelldatei herunterladen" + +msgid "Download this page" +msgstr "Laden Sie diese Seite herunter" + +msgid "Edit this page" +msgstr "Bearbeite diese Seite" + +msgid "Fullscreen mode" +msgstr "Vollbildmodus" + +msgid "Last updated on" +msgstr "Zuletzt aktualisiert am" + +msgid "Launch" +msgstr "Starten" + +msgid "Open an issue" +msgstr "Öffnen Sie ein Problem" + +msgid "Print to PDF" +msgstr "In PDF drucken" + +msgid "Source repository" +msgstr "Quell-Repository" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-Buch-Thema" + +msgid "Theme by the" +msgstr "Thema von der" + +msgid "Toggle navigation" +msgstr "Navigation umschalten" + +msgid "next page" +msgstr "Nächste Seite" + +msgid "open issue" +msgstr "offenes Thema" + +msgid "previous page" +msgstr "vorherige Seite" + +msgid "repository" +msgstr "Repository" + +msgid "suggest edit" +msgstr "vorschlagen zu bearbeiten" diff --git a/msspecbook/_build/html/_static/locales/el/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/el/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..fca6e93 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/el/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/el/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/el/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..27d1274 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/el/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: el\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Από το" + +msgid "By" +msgstr "Με" + +msgid "Contents" +msgstr "Περιεχόμενα" + +msgid "Copyright" +msgstr "Πνευματική ιδιοκτησία" + +msgid "Download notebook file" +msgstr "Λήψη αρχείου σημειωματάριου" + +msgid "Download source file" +msgstr "Λήψη αρχείου προέλευσης" + +msgid "Download this page" +msgstr "Λήψη αυτής της σελίδας" + +msgid "Edit this page" +msgstr "Επεξεργαστείτε αυτήν τη σελίδα" + +msgid "Fullscreen mode" +msgstr "ΛΕΙΤΟΥΡΓΙΑ ΠΛΗΡΟΥΣ ΟΘΟΝΗΣ" + +msgid "Last updated on" +msgstr "Τελευταία ενημέρωση στις" + +msgid "Launch" +msgstr "Εκτόξευση" + +msgid "Open an issue" +msgstr "Ανοίξτε ένα ζήτημα" + +msgid "Print to PDF" +msgstr "Εκτύπωση σε PDF" + +msgid "Source repository" +msgstr "Αποθήκη πηγής" + +msgid "Sphinx Book Theme" +msgstr "Θέμα βιβλίου Sphinx" + +msgid "Theme by the" +msgstr "Θέμα από το" + +msgid "Toggle navigation" +msgstr "Εναλλαγή πλοήγησης" + +msgid "next page" +msgstr "επόμενη σελίδα" + +msgid "open issue" +msgstr "ανοιχτό ζήτημα" + +msgid "previous page" +msgstr "προηγούμενη σελίδα" + +msgid "repository" +msgstr "αποθήκη" + +msgid "suggest edit" +msgstr "προτείνω επεξεργασία" diff --git a/msspecbook/_build/html/_static/locales/eo/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/eo/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..d1072bb Binary files /dev/null and b/msspecbook/_build/html/_static/locales/eo/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/eo/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/eo/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..1fda1bc --- /dev/null +++ b/msspecbook/_build/html/_static/locales/eo/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: eo\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Per la" + +msgid "By" +msgstr "De" + +msgid "Contents" +msgstr "Enhavo" + +msgid "Copyright" +msgstr "Kopirajto" + +msgid "Download notebook file" +msgstr "Elŝutu kajeran dosieron" + +msgid "Download source file" +msgstr "Elŝutu fontodosieron" + +msgid "Download this page" +msgstr "Elŝutu ĉi tiun paĝon" + +msgid "Edit this page" +msgstr "Redaktu ĉi tiun paĝon" + +msgid "Fullscreen mode" +msgstr "Plenekrana reĝimo" + +msgid "Last updated on" +msgstr "Laste ĝisdatigita la" + +msgid "Launch" +msgstr "Lanĉo" + +msgid "Open an issue" +msgstr "Malfermu numeron" + +msgid "Print to PDF" +msgstr "Presi al PDF" + +msgid "Source repository" +msgstr "Fonto-deponejo" + +msgid "Sphinx Book Theme" +msgstr "Sfinksa Libro-Temo" + +msgid "Theme by the" +msgstr "Temo de la" + +msgid "Toggle navigation" +msgstr "Ŝalti navigadon" + +msgid "next page" +msgstr "sekva paĝo" + +msgid "open issue" +msgstr "malferma numero" + +msgid "previous page" +msgstr "antaŭa paĝo" + +msgid "repository" +msgstr "deponejo" + +msgid "suggest edit" +msgstr "sugesti redaktadon" diff --git a/msspecbook/_build/html/_static/locales/es/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/es/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..ba2ee4d Binary files /dev/null and b/msspecbook/_build/html/_static/locales/es/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/es/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/es/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..c91b41b --- /dev/null +++ b/msspecbook/_build/html/_static/locales/es/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: es\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Por el" + +msgid "By" +msgstr "Por" + +msgid "Contents" +msgstr "Contenido" + +msgid "Copyright" +msgstr "Derechos de autor" + +msgid "Download notebook file" +msgstr "Descargar archivo de cuaderno" + +msgid "Download source file" +msgstr "Descargar archivo fuente" + +msgid "Download this page" +msgstr "Descarga esta pagina" + +msgid "Edit this page" +msgstr "Edita esta página" + +msgid "Fullscreen mode" +msgstr "Modo de pantalla completa" + +msgid "Last updated on" +msgstr "Ultima actualización en" + +msgid "Launch" +msgstr "Lanzamiento" + +msgid "Open an issue" +msgstr "Abrir un problema" + +msgid "Print to PDF" +msgstr "Imprimir en PDF" + +msgid "Source repository" +msgstr "Repositorio de origen" + +msgid "Sphinx Book Theme" +msgstr "Tema del libro de la esfinge" + +msgid "Theme by the" +msgstr "Tema por el" + +msgid "Toggle navigation" +msgstr "Navegación de palanca" + +msgid "next page" +msgstr "siguiente página" + +msgid "open issue" +msgstr "Tema abierto" + +msgid "previous page" +msgstr "pagina anterior" + +msgid "repository" +msgstr "repositorio" + +msgid "suggest edit" +msgstr "sugerir editar" diff --git a/msspecbook/_build/html/_static/locales/et/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/et/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..983b823 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/et/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/et/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/et/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..2fd1ea2 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/et/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: et\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Autor" + +msgid "By" +msgstr "Kõrval" + +msgid "Contents" +msgstr "Sisu" + +msgid "Copyright" +msgstr "Autoriõigus" + +msgid "Download notebook file" +msgstr "Laadige sülearvuti fail alla" + +msgid "Download source file" +msgstr "Laadige alla lähtefail" + +msgid "Download this page" +msgstr "Laadige see leht alla" + +msgid "Edit this page" +msgstr "Muutke seda lehte" + +msgid "Fullscreen mode" +msgstr "Täisekraanirežiim" + +msgid "Last updated on" +msgstr "Viimati uuendatud" + +msgid "Launch" +msgstr "Käivitage" + +msgid "Open an issue" +msgstr "Avage probleem" + +msgid "Print to PDF" +msgstr "Prindi PDF-i" + +msgid "Source repository" +msgstr "Allikahoidla" + +msgid "Sphinx Book Theme" +msgstr "Sfinksiraamatu teema" + +msgid "Theme by the" +msgstr "Teema" + +msgid "Toggle navigation" +msgstr "Lülita navigeerimine sisse" + +msgid "next page" +msgstr "järgmine leht" + +msgid "open issue" +msgstr "avatud küsimus" + +msgid "previous page" +msgstr "eelmine leht" + +msgid "repository" +msgstr "hoidla" + +msgid "suggest edit" +msgstr "soovita muuta" diff --git a/msspecbook/_build/html/_static/locales/fi/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/fi/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..d8ac054 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/fi/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/fi/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/fi/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..2843f2c --- /dev/null +++ b/msspecbook/_build/html/_static/locales/fi/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: fi\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Mukaan" + +msgid "By" +msgstr "Tekijä" + +msgid "Contents" +msgstr "Sisällys" + +msgid "Copyright" +msgstr "Tekijänoikeus" + +msgid "Download notebook file" +msgstr "Lataa muistikirjatiedosto" + +msgid "Download source file" +msgstr "Lataa lähdetiedosto" + +msgid "Download this page" +msgstr "Lataa tämä sivu" + +msgid "Edit this page" +msgstr "Muokkaa tätä sivua" + +msgid "Fullscreen mode" +msgstr "Koko näytön tila" + +msgid "Last updated on" +msgstr "Viimeksi päivitetty" + +msgid "Launch" +msgstr "Tuoda markkinoille" + +msgid "Open an issue" +msgstr "Avaa ongelma" + +msgid "Print to PDF" +msgstr "Tulosta PDF-tiedostoon" + +msgid "Source repository" +msgstr "Lähteen arkisto" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-kirjan teema" + +msgid "Theme by the" +msgstr "Teeman tekijä" + +msgid "Toggle navigation" +msgstr "Vaihda navigointia" + +msgid "next page" +msgstr "seuraava sivu" + +msgid "open issue" +msgstr "avoin ongelma" + +msgid "previous page" +msgstr "Edellinen sivu" + +msgid "repository" +msgstr "arkisto" + +msgid "suggest edit" +msgstr "ehdottaa muokkausta" diff --git a/msspecbook/_build/html/_static/locales/fr/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/fr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..f663d39 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/fr/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/fr/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/fr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..351cddd --- /dev/null +++ b/msspecbook/_build/html/_static/locales/fr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: fr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Par le" + +msgid "By" +msgstr "Par" + +msgid "Contents" +msgstr "Contenu" + +msgid "Copyright" +msgstr "droits d'auteur" + +msgid "Download notebook file" +msgstr "Télécharger le fichier notebook" + +msgid "Download source file" +msgstr "Télécharger le fichier source" + +msgid "Download this page" +msgstr "Téléchargez cette page" + +msgid "Edit this page" +msgstr "Modifier cette page" + +msgid "Fullscreen mode" +msgstr "Mode plein écran" + +msgid "Last updated on" +msgstr "Dernière mise à jour le" + +msgid "Launch" +msgstr "lancement" + +msgid "Open an issue" +msgstr "Ouvrez un problème" + +msgid "Print to PDF" +msgstr "Imprimer au format PDF" + +msgid "Source repository" +msgstr "Dépôt source" + +msgid "Sphinx Book Theme" +msgstr "Thème du livre Sphinx" + +msgid "Theme by the" +msgstr "Thème par le" + +msgid "Toggle navigation" +msgstr "Basculer la navigation" + +msgid "next page" +msgstr "page suivante" + +msgid "open issue" +msgstr "signaler un problème" + +msgid "previous page" +msgstr "page précédente" + +msgid "repository" +msgstr "dépôt" + +msgid "suggest edit" +msgstr "suggestion de modification" diff --git a/msspecbook/_build/html/_static/locales/hr/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/hr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..eca4a1a Binary files /dev/null and b/msspecbook/_build/html/_static/locales/hr/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/hr/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/hr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..3c1cf07 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/hr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: hr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Od strane" + +msgid "By" +msgstr "Po" + +msgid "Contents" +msgstr "Sadržaj" + +msgid "Copyright" +msgstr "Autorska prava" + +msgid "Download notebook file" +msgstr "Preuzmi datoteku bilježnice" + +msgid "Download source file" +msgstr "Preuzmi izvornu datoteku" + +msgid "Download this page" +msgstr "Preuzmite ovu stranicu" + +msgid "Edit this page" +msgstr "Uredite ovu stranicu" + +msgid "Fullscreen mode" +msgstr "Način preko cijelog zaslona" + +msgid "Last updated on" +msgstr "Posljednje ažuriranje:" + +msgid "Launch" +msgstr "Pokrenite" + +msgid "Open an issue" +msgstr "Otvorite izdanje" + +msgid "Print to PDF" +msgstr "Ispis u PDF" + +msgid "Source repository" +msgstr "Izvorno spremište" + +msgid "Sphinx Book Theme" +msgstr "Tema knjige Sphinx" + +msgid "Theme by the" +msgstr "Tema autora" + +msgid "Toggle navigation" +msgstr "Uključi / isključi navigaciju" + +msgid "next page" +msgstr "sljedeća stranica" + +msgid "open issue" +msgstr "otvoreno izdanje" + +msgid "previous page" +msgstr "Prethodna stranica" + +msgid "repository" +msgstr "spremište" + +msgid "suggest edit" +msgstr "predloži uređivanje" diff --git a/msspecbook/_build/html/_static/locales/id/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/id/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..d07a06a Binary files /dev/null and b/msspecbook/_build/html/_static/locales/id/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/id/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/id/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..809498c --- /dev/null +++ b/msspecbook/_build/html/_static/locales/id/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: id\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Oleh" + +msgid "By" +msgstr "Oleh" + +msgid "Contents" +msgstr "Isi" + +msgid "Copyright" +msgstr "hak cipta" + +msgid "Download notebook file" +msgstr "Unduh file notebook" + +msgid "Download source file" +msgstr "Unduh file sumber" + +msgid "Download this page" +msgstr "Unduh halaman ini" + +msgid "Edit this page" +msgstr "Edit halaman ini" + +msgid "Fullscreen mode" +msgstr "Mode layar penuh" + +msgid "Last updated on" +msgstr "Terakhir diperbarui saat" + +msgid "Launch" +msgstr "Meluncurkan" + +msgid "Open an issue" +msgstr "Buka masalah" + +msgid "Print to PDF" +msgstr "Cetak ke PDF" + +msgid "Source repository" +msgstr "Repositori sumber" + +msgid "Sphinx Book Theme" +msgstr "Tema Buku Sphinx" + +msgid "Theme by the" +msgstr "Tema oleh" + +msgid "Toggle navigation" +msgstr "Alihkan navigasi" + +msgid "next page" +msgstr "halaman selanjutnya" + +msgid "open issue" +msgstr "masalah terbuka" + +msgid "previous page" +msgstr "halaman sebelumnya" + +msgid "repository" +msgstr "gudang" + +msgid "suggest edit" +msgstr "menyarankan edit" diff --git a/msspecbook/_build/html/_static/locales/it/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/it/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..53ba476 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/it/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/it/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/it/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..fbc8d03 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/it/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: it\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Dal" + +msgid "By" +msgstr "Di" + +msgid "Contents" +msgstr "Contenuti" + +msgid "Copyright" +msgstr "Diritto d'autore" + +msgid "Download notebook file" +msgstr "Scarica il file del taccuino" + +msgid "Download source file" +msgstr "Scarica il file sorgente" + +msgid "Download this page" +msgstr "Scarica questa pagina" + +msgid "Edit this page" +msgstr "Modifica questa pagina" + +msgid "Fullscreen mode" +msgstr "Modalità schermo intero" + +msgid "Last updated on" +msgstr "Ultimo aggiornamento il" + +msgid "Launch" +msgstr "Lanciare" + +msgid "Open an issue" +msgstr "Apri un problema" + +msgid "Print to PDF" +msgstr "Stampa in PDF" + +msgid "Source repository" +msgstr "Repository di origine" + +msgid "Sphinx Book Theme" +msgstr "Tema del libro della Sfinge" + +msgid "Theme by the" +msgstr "Tema di" + +msgid "Toggle navigation" +msgstr "Attiva / disattiva la navigazione" + +msgid "next page" +msgstr "pagina successiva" + +msgid "open issue" +msgstr "questione aperta" + +msgid "previous page" +msgstr "pagina precedente" + +msgid "repository" +msgstr "repository" + +msgid "suggest edit" +msgstr "suggerisci modifica" diff --git a/msspecbook/_build/html/_static/locales/iw/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/iw/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..a45c657 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/iw/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/iw/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/iw/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..a82f351 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/iw/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: iw\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "דרך" + +msgid "By" +msgstr "על ידי" + +msgid "Contents" +msgstr "תוכן" + +msgid "Copyright" +msgstr "זכויות יוצרים" + +msgid "Download notebook file" +msgstr "הורד קובץ מחברת" + +msgid "Download source file" +msgstr "הורד את קובץ המקור" + +msgid "Download this page" +msgstr "הורד דף זה" + +msgid "Edit this page" +msgstr "ערוך דף זה" + +msgid "Fullscreen mode" +msgstr "מצב מסך מלא" + +msgid "Last updated on" +msgstr "עודכן לאחרונה ב" + +msgid "Launch" +msgstr "לְהַשִׁיק" + +msgid "Open an issue" +msgstr "פתח גיליון" + +msgid "Print to PDF" +msgstr "הדפס לקובץ PDF" + +msgid "Source repository" +msgstr "מאגר המקורות" + +msgid "Sphinx Book Theme" +msgstr "נושא ספר ספינקס" + +msgid "Theme by the" +msgstr "נושא מאת" + +msgid "Toggle navigation" +msgstr "החלף ניווט" + +msgid "next page" +msgstr "עמוד הבא" + +msgid "open issue" +msgstr "בעיה פתוחה" + +msgid "previous page" +msgstr "עמוד קודם" + +msgid "repository" +msgstr "מאגר" + +msgid "suggest edit" +msgstr "מציע לערוך" diff --git a/msspecbook/_build/html/_static/locales/ja/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ja/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..1cefd29 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ja/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ja/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ja/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..3caab09 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ja/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ja\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "によって" + +msgid "By" +msgstr "著者" + +msgid "Contents" +msgstr "目次" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download notebook file" +msgstr "ノートブックファイルをダウンロード" + +msgid "Download source file" +msgstr "ソースファイルをダウンロード" + +msgid "Download this page" +msgstr "このページをダウンロード" + +msgid "Edit this page" +msgstr "このページを編集" + +msgid "Fullscreen mode" +msgstr "全画面モード" + +msgid "Last updated on" +msgstr "最終更新日" + +msgid "Launch" +msgstr "起動" + +msgid "Open an issue" +msgstr "問題を報告" + +msgid "Print to PDF" +msgstr "PDFに印刷" + +msgid "Source repository" +msgstr "ソースリポジトリ" + +msgid "Sphinx Book Theme" +msgstr "スフィンクスの本のテーマ" + +msgid "Theme by the" +msgstr "のテーマ" + +msgid "Toggle navigation" +msgstr "ナビゲーションを切り替え" + +msgid "next page" +msgstr "次のページ" + +msgid "open issue" +msgstr "未解決の問題" + +msgid "previous page" +msgstr "前のページ" + +msgid "repository" +msgstr "リポジトリ" + +msgid "suggest edit" +msgstr "編集を提案する" diff --git a/msspecbook/_build/html/_static/locales/ko/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ko/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..06c7ec9 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ko/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ko/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ko/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..2db12a1 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ko/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ko\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "에 의해" + +msgid "By" +msgstr "으로" + +msgid "Contents" +msgstr "내용" + +msgid "Copyright" +msgstr "저작권" + +msgid "Download notebook file" +msgstr "노트북 파일 다운로드" + +msgid "Download source file" +msgstr "소스 파일 다운로드" + +msgid "Download this page" +msgstr "이 페이지 다운로드" + +msgid "Edit this page" +msgstr "이 페이지 편집" + +msgid "Fullscreen mode" +msgstr "전체 화면으로보기" + +msgid "Last updated on" +msgstr "마지막 업데이트" + +msgid "Launch" +msgstr "시작하다" + +msgid "Open an issue" +msgstr "이슈 열기" + +msgid "Print to PDF" +msgstr "PDF로 인쇄" + +msgid "Source repository" +msgstr "소스 저장소" + +msgid "Sphinx Book Theme" +msgstr "스핑크스 도서 테마" + +msgid "Theme by the" +msgstr "테마별" + +msgid "Toggle navigation" +msgstr "탐색 전환" + +msgid "next page" +msgstr "다음 페이지" + +msgid "open issue" +msgstr "열린 문제" + +msgid "previous page" +msgstr "이전 페이지" + +msgid "repository" +msgstr "저장소" + +msgid "suggest edit" +msgstr "편집 제안" diff --git a/msspecbook/_build/html/_static/locales/lt/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/lt/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..4468ba0 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/lt/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/lt/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/lt/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..07b6468 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/lt/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: lt\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Prie" + +msgid "By" +msgstr "Iki" + +msgid "Contents" +msgstr "Turinys" + +msgid "Copyright" +msgstr "Autorių teisės" + +msgid "Download notebook file" +msgstr "Atsisiųsti nešiojamojo kompiuterio failą" + +msgid "Download source file" +msgstr "Atsisiųsti šaltinio failą" + +msgid "Download this page" +msgstr "Atsisiųskite šį puslapį" + +msgid "Edit this page" +msgstr "Redaguoti šį puslapį" + +msgid "Fullscreen mode" +msgstr "Pilno ekrano režimas" + +msgid "Last updated on" +msgstr "Paskutinį kartą atnaujinta" + +msgid "Launch" +msgstr "Paleiskite" + +msgid "Open an issue" +msgstr "Atidarykite problemą" + +msgid "Print to PDF" +msgstr "Spausdinti į PDF" + +msgid "Source repository" +msgstr "Šaltinio saugykla" + +msgid "Sphinx Book Theme" +msgstr "Sfinkso knygos tema" + +msgid "Theme by the" +msgstr "Tema" + +msgid "Toggle navigation" +msgstr "Perjungti naršymą" + +msgid "next page" +msgstr "Kitas puslapis" + +msgid "open issue" +msgstr "atviras klausimas" + +msgid "previous page" +msgstr "Ankstesnis puslapis" + +msgid "repository" +msgstr "saugykla" + +msgid "suggest edit" +msgstr "pasiūlyti redaguoti" diff --git a/msspecbook/_build/html/_static/locales/lv/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/lv/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..74aa4d8 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/lv/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/lv/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/lv/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..b741c28 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/lv/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: lv\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Ar" + +msgid "By" +msgstr "Autors" + +msgid "Contents" +msgstr "Saturs" + +msgid "Copyright" +msgstr "Autortiesības" + +msgid "Download notebook file" +msgstr "Lejupielādēt piezīmju grāmatiņu" + +msgid "Download source file" +msgstr "Lejupielādēt avota failu" + +msgid "Download this page" +msgstr "Lejupielādējiet šo lapu" + +msgid "Edit this page" +msgstr "Rediģēt šo lapu" + +msgid "Fullscreen mode" +msgstr "Pilnekrāna režīms" + +msgid "Last updated on" +msgstr "Pēdējoreiz atjaunināts" + +msgid "Launch" +msgstr "Uzsākt" + +msgid "Open an issue" +msgstr "Atveriet problēmu" + +msgid "Print to PDF" +msgstr "Drukāt PDF formātā" + +msgid "Source repository" +msgstr "Avota krātuve" + +msgid "Sphinx Book Theme" +msgstr "Sfinksa grāmatas tēma" + +msgid "Theme by the" +msgstr "Autora tēma" + +msgid "Toggle navigation" +msgstr "Pārslēgt navigāciju" + +msgid "next page" +msgstr "nākamā lapaspuse" + +msgid "open issue" +msgstr "atklāts jautājums" + +msgid "previous page" +msgstr "iepriekšējā lapa" + +msgid "repository" +msgstr "krātuve" + +msgid "suggest edit" +msgstr "ieteikt rediģēt" diff --git a/msspecbook/_build/html/_static/locales/ml/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ml/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..2736e8f Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ml/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ml/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ml/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..bdad3de --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ml/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ml\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "എഴുതിയത്" + +msgid "By" +msgstr "എഴുതിയത്" + +msgid "Copyright" +msgstr "പകർപ്പവകാശം" + +msgid "Download notebook file" +msgstr "നോട്ട്ബുക്ക് ഫയൽ ഡൺലോഡ് ചെയ്യുക" + +msgid "Download source file" +msgstr "ഉറവിട ഫയൽ ഡൗൺലോഡുചെയ്യുക" + +msgid "Download this page" +msgstr "ഈ പേജ് ഡൗൺലോഡുചെയ്യുക" + +msgid "Edit this page" +msgstr "ഈ പേജ് എഡിറ്റുചെയ്യുക" + +msgid "Last updated on" +msgstr "അവസാനം അപ്‌ഡേറ്റുചെയ്‌തത്" + +msgid "Launch" +msgstr "സമാരംഭിക്കുക" + +msgid "Open an issue" +msgstr "ഒരു പ്രശ്നം തുറക്കുക" + +msgid "Print to PDF" +msgstr "PDF- ലേക്ക് പ്രിന്റുചെയ്യുക" + +msgid "Source repository" +msgstr "ഉറവിട ശേഖരം" + +msgid "Sphinx Book Theme" +msgstr "സ്ഫിങ്ക്സ് പുസ്തക തീം" + +msgid "Theme by the" +msgstr "പ്രമേയം" + +msgid "Toggle navigation" +msgstr "നാവിഗേഷൻ ടോഗിൾ ചെയ്യുക" + +msgid "next page" +msgstr "അടുത്ത പേജ്" + +msgid "open issue" +msgstr "തുറന്ന പ്രശ്നം" + +msgid "previous page" +msgstr "മുൻപത്തെ താൾ" + +msgid "suggest edit" +msgstr "എഡിറ്റുചെയ്യാൻ നിർദ്ദേശിക്കുക" diff --git a/msspecbook/_build/html/_static/locales/mr/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/mr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..fe53010 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/mr/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/mr/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/mr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..61bfad4 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/mr/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: mr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "द्वारा" + +msgid "By" +msgstr "द्वारा" + +msgid "Copyright" +msgstr "कॉपीराइट" + +msgid "Download notebook file" +msgstr "नोटबुक फाईल डाउनलोड करा" + +msgid "Download source file" +msgstr "स्त्रोत फाइल डाउनलोड करा" + +msgid "Download this page" +msgstr "हे पृष्ठ डाउनलोड करा" + +msgid "Edit this page" +msgstr "हे पृष्ठ संपादित करा" + +msgid "Last updated on" +msgstr "अखेरचे अद्यतनित" + +msgid "Launch" +msgstr "लाँच करा" + +msgid "Open an issue" +msgstr "एक मुद्दा उघडा" + +msgid "Print to PDF" +msgstr "पीडीएफवर मुद्रित करा" + +msgid "Source repository" +msgstr "स्त्रोत भांडार" + +msgid "Sphinx Book Theme" +msgstr "स्फिंक्स बुक थीम" + +msgid "Theme by the" +msgstr "द्वारा थीम" + +msgid "Toggle navigation" +msgstr "नेव्हिगेशन टॉगल करा" + +msgid "next page" +msgstr "पुढील पृष्ठ" + +msgid "open issue" +msgstr "खुला मुद्दा" + +msgid "previous page" +msgstr "मागील पान" + +msgid "suggest edit" +msgstr "संपादन सुचवा" diff --git a/msspecbook/_build/html/_static/locales/ms/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ms/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..f02603f Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ms/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ms/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ms/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..ade6515 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ms/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ms\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Oleh" + +msgid "By" +msgstr "Oleh" + +msgid "Copyright" +msgstr "hak cipta" + +msgid "Download notebook file" +msgstr "Muat turun fail buku nota" + +msgid "Download source file" +msgstr "Muat turun fail sumber" + +msgid "Download this page" +msgstr "Muat turun halaman ini" + +msgid "Edit this page" +msgstr "Edit halaman ini" + +msgid "Last updated on" +msgstr "Terakhir dikemas kini pada" + +msgid "Launch" +msgstr "Lancarkan" + +msgid "Open an issue" +msgstr "Buka masalah" + +msgid "Print to PDF" +msgstr "Cetak ke PDF" + +msgid "Source repository" +msgstr "Repositori sumber" + +msgid "Sphinx Book Theme" +msgstr "Tema Buku Sphinx" + +msgid "Theme by the" +msgstr "Tema oleh" + +msgid "Toggle navigation" +msgstr "Togol navigasi" + +msgid "next page" +msgstr "muka surat seterusnya" + +msgid "open issue" +msgstr "isu terbuka" + +msgid "previous page" +msgstr "halaman sebelumnya" + +msgid "suggest edit" +msgstr "cadangkan edit" diff --git a/msspecbook/_build/html/_static/locales/nl/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/nl/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..e59e7ec Binary files /dev/null and b/msspecbook/_build/html/_static/locales/nl/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/nl/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/nl/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..e114611 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/nl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: nl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Door de" + +msgid "By" +msgstr "Door" + +msgid "Contents" +msgstr "Inhoud" + +msgid "Copyright" +msgstr "auteursrechten" + +msgid "Download notebook file" +msgstr "Download notebookbestand" + +msgid "Download source file" +msgstr "Download het bronbestand" + +msgid "Download this page" +msgstr "Download deze pagina" + +msgid "Edit this page" +msgstr "bewerk deze pagina" + +msgid "Fullscreen mode" +msgstr "Volledig scherm" + +msgid "Last updated on" +msgstr "Laatst geupdate op" + +msgid "Launch" +msgstr "Lancering" + +msgid "Open an issue" +msgstr "Open een probleem" + +msgid "Print to PDF" +msgstr "Afdrukken naar pdf" + +msgid "Source repository" +msgstr "Bronopslagplaats" + +msgid "Sphinx Book Theme" +msgstr "Sphinx-boekthema" + +msgid "Theme by the" +msgstr "Thema door de" + +msgid "Toggle navigation" +msgstr "Schakel navigatie" + +msgid "next page" +msgstr "volgende bladzijde" + +msgid "open issue" +msgstr "open probleem" + +msgid "previous page" +msgstr "vorige pagina" + +msgid "repository" +msgstr "repository" + +msgid "suggest edit" +msgstr "suggereren bewerken" diff --git a/msspecbook/_build/html/_static/locales/no/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/no/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..6cd15c8 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/no/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/no/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/no/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..53fa9fc --- /dev/null +++ b/msspecbook/_build/html/_static/locales/no/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: no\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Ved" + +msgid "By" +msgstr "Av" + +msgid "Contents" +msgstr "Innhold" + +msgid "Copyright" +msgstr "opphavsrett" + +msgid "Download notebook file" +msgstr "Last ned notatbokfilen" + +msgid "Download source file" +msgstr "Last ned kildefilen" + +msgid "Download this page" +msgstr "Last ned denne siden" + +msgid "Edit this page" +msgstr "Rediger denne siden" + +msgid "Fullscreen mode" +msgstr "Fullskjerm-modus" + +msgid "Last updated on" +msgstr "Sist oppdatert den" + +msgid "Launch" +msgstr "Start" + +msgid "Open an issue" +msgstr "Åpne et problem" + +msgid "Print to PDF" +msgstr "Skriv ut til PDF" + +msgid "Source repository" +msgstr "Kildedepot" + +msgid "Sphinx Book Theme" +msgstr "Sphinx boktema" + +msgid "Theme by the" +msgstr "Tema av" + +msgid "Toggle navigation" +msgstr "Bytt navigasjon" + +msgid "next page" +msgstr "neste side" + +msgid "open issue" +msgstr "åpent nummer" + +msgid "previous page" +msgstr "forrige side" + +msgid "repository" +msgstr "oppbevaringssted" + +msgid "suggest edit" +msgstr "foreslå redigering" diff --git a/msspecbook/_build/html/_static/locales/pl/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/pl/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..9ebb584 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/pl/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/pl/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/pl/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..a482215 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/pl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: pl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Przez" + +msgid "By" +msgstr "Przez" + +msgid "Contents" +msgstr "Zawartość" + +msgid "Copyright" +msgstr "prawa autorskie" + +msgid "Download notebook file" +msgstr "Pobierz plik notatnika" + +msgid "Download source file" +msgstr "Pobierz plik źródłowy" + +msgid "Download this page" +msgstr "Pobierz tę stronę" + +msgid "Edit this page" +msgstr "Edytuj tę strone" + +msgid "Fullscreen mode" +msgstr "Pełny ekran" + +msgid "Last updated on" +msgstr "Ostatnia aktualizacja" + +msgid "Launch" +msgstr "Uruchomić" + +msgid "Open an issue" +msgstr "Otwórz problem" + +msgid "Print to PDF" +msgstr "Drukuj do PDF" + +msgid "Source repository" +msgstr "Repozytorium źródłowe" + +msgid "Sphinx Book Theme" +msgstr "Motyw książki Sphinx" + +msgid "Theme by the" +msgstr "Motyw autorstwa" + +msgid "Toggle navigation" +msgstr "Przełącz nawigację" + +msgid "next page" +msgstr "Następna strona" + +msgid "open issue" +msgstr "otwarty problem" + +msgid "previous page" +msgstr "Poprzednia strona" + +msgid "repository" +msgstr "magazyn" + +msgid "suggest edit" +msgstr "zaproponuj edycję" diff --git a/msspecbook/_build/html/_static/locales/pt/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/pt/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..d0ddb87 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/pt/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/pt/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/pt/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..bbc872d --- /dev/null +++ b/msspecbook/_build/html/_static/locales/pt/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: pt\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Pelo" + +msgid "By" +msgstr "De" + +msgid "Contents" +msgstr "Conteúdo" + +msgid "Copyright" +msgstr "direito autoral" + +msgid "Download notebook file" +msgstr "Baixar arquivo de notebook" + +msgid "Download source file" +msgstr "Baixar arquivo fonte" + +msgid "Download this page" +msgstr "Baixe esta página" + +msgid "Edit this page" +msgstr "Edite essa página" + +msgid "Fullscreen mode" +msgstr "Modo tela cheia" + +msgid "Last updated on" +msgstr "Última atualização em" + +msgid "Launch" +msgstr "Lançamento" + +msgid "Open an issue" +msgstr "Abra um problema" + +msgid "Print to PDF" +msgstr "Imprimir em PDF" + +msgid "Source repository" +msgstr "Repositório fonte" + +msgid "Sphinx Book Theme" +msgstr "Tema do livro Sphinx" + +msgid "Theme by the" +msgstr "Tema por" + +msgid "Toggle navigation" +msgstr "Alternar de navegação" + +msgid "next page" +msgstr "próxima página" + +msgid "open issue" +msgstr "questão aberta" + +msgid "previous page" +msgstr "página anterior" + +msgid "repository" +msgstr "repositório" + +msgid "suggest edit" +msgstr "sugerir edição" diff --git a/msspecbook/_build/html/_static/locales/ro/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ro/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..3c36ab1 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ro/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ro/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ro/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..b9b8b4f --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ro/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ro\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Langa" + +msgid "By" +msgstr "De" + +msgid "Contents" +msgstr "Cuprins" + +msgid "Copyright" +msgstr "Drepturi de autor" + +msgid "Download notebook file" +msgstr "Descărcați fișierul notebook" + +msgid "Download source file" +msgstr "Descărcați fișierul sursă" + +msgid "Download this page" +msgstr "Descarcă această pagină" + +msgid "Edit this page" +msgstr "Editați această pagină" + +msgid "Fullscreen mode" +msgstr "Modul ecran întreg" + +msgid "Last updated on" +msgstr "Ultima actualizare la" + +msgid "Launch" +msgstr "Lansa" + +msgid "Open an issue" +msgstr "Deschideți o problemă" + +msgid "Print to PDF" +msgstr "Imprimați în PDF" + +msgid "Source repository" +msgstr "Depozit sursă" + +msgid "Sphinx Book Theme" +msgstr "Tema Sphinx Book" + +msgid "Theme by the" +msgstr "Tema de" + +msgid "Toggle navigation" +msgstr "Comutare navigare" + +msgid "next page" +msgstr "pagina următoare" + +msgid "open issue" +msgstr "problema deschisă" + +msgid "previous page" +msgstr "pagina anterioară" + +msgid "repository" +msgstr "repertoriu" + +msgid "suggest edit" +msgstr "sugerează editare" diff --git a/msspecbook/_build/html/_static/locales/ru/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ru/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..5ea2e5c Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ru/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ru/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ru/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..e0f3555 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ru/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ru\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Посредством" + +msgid "By" +msgstr "Автор:" + +msgid "Contents" +msgstr "Содержание" + +msgid "Copyright" +msgstr "авторское право" + +msgid "Download notebook file" +msgstr "Скачать файл записной книжки" + +msgid "Download source file" +msgstr "Скачать исходный файл" + +msgid "Download this page" +msgstr "Загрузите эту страницу" + +msgid "Edit this page" +msgstr "Редактировать эту страницу" + +msgid "Fullscreen mode" +msgstr "Полноэкранный режим" + +msgid "Last updated on" +msgstr "Последнее обновление" + +msgid "Launch" +msgstr "Запуск" + +msgid "Open an issue" +msgstr "Открыть вопрос" + +msgid "Print to PDF" +msgstr "Распечатать в PDF" + +msgid "Source repository" +msgstr "Исходный репозиторий" + +msgid "Sphinx Book Theme" +msgstr "Тема книги Сфинкс" + +msgid "Theme by the" +msgstr "Тема от" + +msgid "Toggle navigation" +msgstr "Переключить навигацию" + +msgid "next page" +msgstr "Следующая страница" + +msgid "open issue" +msgstr "открытый вопрос" + +msgid "previous page" +msgstr "Предыдущая страница" + +msgid "repository" +msgstr "хранилище" + +msgid "suggest edit" +msgstr "предложить редактировать" diff --git a/msspecbook/_build/html/_static/locales/sk/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/sk/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..59bd0dd Binary files /dev/null and b/msspecbook/_build/html/_static/locales/sk/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/sk/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/sk/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..4b5225a --- /dev/null +++ b/msspecbook/_build/html/_static/locales/sk/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sk\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Podľa" + +msgid "By" +msgstr "Autor:" + +msgid "Contents" +msgstr "Obsah" + +msgid "Copyright" +msgstr "Autorské práva" + +msgid "Download notebook file" +msgstr "Stiahnite si zošit" + +msgid "Download source file" +msgstr "Stiahnite si zdrojový súbor" + +msgid "Download this page" +msgstr "Stiahnite si túto stránku" + +msgid "Edit this page" +msgstr "Upraviť túto stránku" + +msgid "Fullscreen mode" +msgstr "Režim celej obrazovky" + +msgid "Last updated on" +msgstr "Posledná aktualizácia dňa" + +msgid "Launch" +msgstr "Spustiť" + +msgid "Open an issue" +msgstr "Otvorte problém" + +msgid "Print to PDF" +msgstr "Tlač do PDF" + +msgid "Source repository" +msgstr "Zdrojové úložisko" + +msgid "Sphinx Book Theme" +msgstr "Téma knihy Sfinga" + +msgid "Theme by the" +msgstr "Téma od" + +msgid "Toggle navigation" +msgstr "Prepnúť navigáciu" + +msgid "next page" +msgstr "ďalšia strana" + +msgid "open issue" +msgstr "otvorené vydanie" + +msgid "previous page" +msgstr "predchádzajúca strana" + +msgid "repository" +msgstr "Úložisko" + +msgid "suggest edit" +msgstr "navrhnúť úpravu" diff --git a/msspecbook/_build/html/_static/locales/sl/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/sl/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..87bf26d Binary files /dev/null and b/msspecbook/_build/html/_static/locales/sl/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/sl/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/sl/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..45592e7 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/sl/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Avtor" + +msgid "By" +msgstr "Avtor" + +msgid "Contents" +msgstr "Vsebina" + +msgid "Copyright" +msgstr "avtorske pravice" + +msgid "Download notebook file" +msgstr "Prenesite datoteko zvezka" + +msgid "Download source file" +msgstr "Prenesite izvorno datoteko" + +msgid "Download this page" +msgstr "Prenesite to stran" + +msgid "Edit this page" +msgstr "Uredite to stran" + +msgid "Fullscreen mode" +msgstr "Celozaslonski način" + +msgid "Last updated on" +msgstr "Nazadnje posodobljeno dne" + +msgid "Launch" +msgstr "Kosilo" + +msgid "Open an issue" +msgstr "Odprite številko" + +msgid "Print to PDF" +msgstr "Natisni v PDF" + +msgid "Source repository" +msgstr "Izvorno skladišče" + +msgid "Sphinx Book Theme" +msgstr "Tema knjige Sphinx" + +msgid "Theme by the" +msgstr "Tema avtorja" + +msgid "Toggle navigation" +msgstr "Preklopi navigacijo" + +msgid "next page" +msgstr "Naslednja stran" + +msgid "open issue" +msgstr "odprto vprašanje" + +msgid "previous page" +msgstr "Prejšnja stran" + +msgid "repository" +msgstr "odlagališče" + +msgid "suggest edit" +msgstr "predlagajte urejanje" diff --git a/msspecbook/_build/html/_static/locales/sr/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/sr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..ec740f4 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/sr/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/sr/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/sr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..4ddf693 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/sr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Од" + +msgid "By" +msgstr "Од стране" + +msgid "Contents" +msgstr "Садржај" + +msgid "Copyright" +msgstr "Ауторско право" + +msgid "Download notebook file" +msgstr "Преузмите датотеку бележнице" + +msgid "Download source file" +msgstr "Преузми изворну датотеку" + +msgid "Download this page" +msgstr "Преузмите ову страницу" + +msgid "Edit this page" +msgstr "Уредите ову страницу" + +msgid "Fullscreen mode" +msgstr "Режим целог екрана" + +msgid "Last updated on" +msgstr "Последње ажурирање" + +msgid "Launch" +msgstr "Лансирање" + +msgid "Open an issue" +msgstr "Отворите издање" + +msgid "Print to PDF" +msgstr "Испис у ПДФ" + +msgid "Source repository" +msgstr "Изворно спремиште" + +msgid "Sphinx Book Theme" +msgstr "Тема књиге Спхинк" + +msgid "Theme by the" +msgstr "Тхеме би" + +msgid "Toggle navigation" +msgstr "Укључи / искључи навигацију" + +msgid "next page" +msgstr "Следећа страна" + +msgid "open issue" +msgstr "отворено издање" + +msgid "previous page" +msgstr "Претходна страница" + +msgid "repository" +msgstr "спремиште" + +msgid "suggest edit" +msgstr "предложи уређивање" diff --git a/msspecbook/_build/html/_static/locales/sv/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/sv/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..b07dc76 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/sv/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/sv/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/sv/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..a5587a5 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/sv/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: sv\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Av den" + +msgid "By" +msgstr "Av" + +msgid "Contents" +msgstr "Innehåll" + +msgid "Copyright" +msgstr "Upphovsrätt" + +msgid "Download notebook file" +msgstr "Ladda ner notebook-fil" + +msgid "Download source file" +msgstr "Ladda ner källfil" + +msgid "Download this page" +msgstr "Ladda ner den här sidan" + +msgid "Edit this page" +msgstr "Redigera den här sidan" + +msgid "Fullscreen mode" +msgstr "Fullskärmsläge" + +msgid "Last updated on" +msgstr "Senast uppdaterad den" + +msgid "Launch" +msgstr "Öppna" + +msgid "Open an issue" +msgstr "Öppna en problemrapport" + +msgid "Print to PDF" +msgstr "Skriv ut till PDF" + +msgid "Source repository" +msgstr "Källkodsrepositorium" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Boktema" + +msgid "Theme by the" +msgstr "Tema av" + +msgid "Toggle navigation" +msgstr "Växla navigering" + +msgid "next page" +msgstr "nästa sida" + +msgid "open issue" +msgstr "öppna problemrapport" + +msgid "previous page" +msgstr "föregående sida" + +msgid "repository" +msgstr "repositorium" + +msgid "suggest edit" +msgstr "föreslå ändring" diff --git a/msspecbook/_build/html/_static/locales/ta/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ta/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..29f52e1 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ta/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ta/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ta/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..fb871e2 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ta/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ta\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "மூலம்" + +msgid "By" +msgstr "வழங்கியவர்" + +msgid "Copyright" +msgstr "பதிப்புரிமை" + +msgid "Download notebook file" +msgstr "நோட்புக் கோப்பைப் பதிவிறக்கவும்" + +msgid "Download source file" +msgstr "மூல கோப்பைப் பதிவிறக்குக" + +msgid "Download this page" +msgstr "இந்தப் பக்கத்தைப் பதிவிறக்கவும்" + +msgid "Edit this page" +msgstr "இந்தப் பக்கத்தைத் திருத்தவும்" + +msgid "Last updated on" +msgstr "கடைசியாக புதுப்பிக்கப்பட்டது" + +msgid "Launch" +msgstr "தொடங்க" + +msgid "Open an issue" +msgstr "சிக்கலைத் திறக்கவும்" + +msgid "Print to PDF" +msgstr "PDF இல் அச்சிடுக" + +msgid "Source repository" +msgstr "மூல களஞ்சியம்" + +msgid "Sphinx Book Theme" +msgstr "ஸ்பிங்க்ஸ் புத்தக தீம்" + +msgid "Theme by the" +msgstr "வழங்கிய தீம்" + +msgid "Toggle navigation" +msgstr "வழிசெலுத்தலை நிலைமாற்று" + +msgid "next page" +msgstr "அடுத்த பக்கம்" + +msgid "open issue" +msgstr "திறந்த பிரச்சினை" + +msgid "previous page" +msgstr "முந்தைய பக்கம்" + +msgid "suggest edit" +msgstr "திருத்த பரிந்துரைக்கவும்" diff --git a/msspecbook/_build/html/_static/locales/te/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/te/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..0a5f4b4 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/te/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/te/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/te/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..22ab77c --- /dev/null +++ b/msspecbook/_build/html/_static/locales/te/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: te\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "ద్వారా" + +msgid "By" +msgstr "ద్వారా" + +msgid "Copyright" +msgstr "కాపీరైట్" + +msgid "Download notebook file" +msgstr "నోట్బుక్ ఫైల్ను డౌన్లోడ్ చేయండి" + +msgid "Download source file" +msgstr "మూల ఫైల్‌ను డౌన్‌లోడ్ చేయండి" + +msgid "Download this page" +msgstr "ఈ పేజీని డౌన్‌లోడ్ చేయండి" + +msgid "Edit this page" +msgstr "ఈ పేజీని సవరించండి" + +msgid "Last updated on" +msgstr "చివరిగా నవీకరించబడింది" + +msgid "Launch" +msgstr "ప్రారంభించండి" + +msgid "Open an issue" +msgstr "సమస్యను తెరవండి" + +msgid "Print to PDF" +msgstr "PDF కి ముద్రించండి" + +msgid "Source repository" +msgstr "మూల రిపోజిటరీ" + +msgid "Sphinx Book Theme" +msgstr "సింహిక పుస్తక థీమ్" + +msgid "Theme by the" +msgstr "ద్వారా థీమ్" + +msgid "Toggle navigation" +msgstr "నావిగేషన్‌ను టోగుల్ చేయండి" + +msgid "next page" +msgstr "తరువాతి పేజీ" + +msgid "open issue" +msgstr "ఓపెన్ ఇష్యూ" + +msgid "previous page" +msgstr "ముందు పేజి" + +msgid "suggest edit" +msgstr "సవరించమని సూచించండి" diff --git a/msspecbook/_build/html/_static/locales/tg/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/tg/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..b21c6c6 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/tg/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/tg/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/tg/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..e499352 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/tg/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tg\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Бо" + +msgid "By" +msgstr "Бо" + +msgid "Contents" +msgstr "Мундариҷа" + +msgid "Copyright" +msgstr "Ҳуқуқи муаллиф" + +msgid "Download notebook file" +msgstr "Файли дафтарро зеркашӣ кунед" + +msgid "Download source file" +msgstr "Файли манбаъро зеркашӣ кунед" + +msgid "Download this page" +msgstr "Ин саҳифаро зеркашӣ кунед" + +msgid "Edit this page" +msgstr "Ин саҳифаро таҳрир кунед" + +msgid "Fullscreen mode" +msgstr "Ҳолати экрани пурра" + +msgid "Last updated on" +msgstr "Last навсозӣ дар" + +msgid "Launch" +msgstr "Оғоз" + +msgid "Open an issue" +msgstr "Масъаларо кушоед" + +msgid "Print to PDF" +msgstr "Чоп ба PDF" + +msgid "Source repository" +msgstr "Анбори манбаъ" + +msgid "Sphinx Book Theme" +msgstr "Сфинкс Мавзӯи китоб" + +msgid "Theme by the" +msgstr "Мавзӯъи аз" + +msgid "Toggle navigation" +msgstr "Гузаришро иваз кунед" + +msgid "next page" +msgstr "саҳифаи оянда" + +msgid "open issue" +msgstr "барориши кушод" + +msgid "previous page" +msgstr "саҳифаи қаблӣ" + +msgid "repository" +msgstr "анбор" + +msgid "suggest edit" +msgstr "пешниҳод вироиш" diff --git a/msspecbook/_build/html/_static/locales/th/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/th/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..abede98 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/th/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/th/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/th/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..6f0103e --- /dev/null +++ b/msspecbook/_build/html/_static/locales/th/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: th\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "โดย" + +msgid "By" +msgstr "โดย" + +msgid "Contents" +msgstr "สารบัญ" + +msgid "Copyright" +msgstr "ลิขสิทธิ์" + +msgid "Download notebook file" +msgstr "ดาวน์โหลดไฟล์สมุดบันทึก" + +msgid "Download source file" +msgstr "ดาวน์โหลดไฟล์ต้นฉบับ" + +msgid "Download this page" +msgstr "ดาวน์โหลดหน้านี้" + +msgid "Edit this page" +msgstr "แก้ไขหน้านี้" + +msgid "Fullscreen mode" +msgstr "โหมดเต็มหน้าจอ" + +msgid "Last updated on" +msgstr "ปรับปรุงล่าสุดเมื่อ" + +msgid "Launch" +msgstr "เปิด" + +msgid "Open an issue" +msgstr "เปิดปัญหา" + +msgid "Print to PDF" +msgstr "พิมพ์เป็น PDF" + +msgid "Source repository" +msgstr "ที่เก็บซอร์ส" + +msgid "Sphinx Book Theme" +msgstr "ธีมหนังสือสฟิงซ์" + +msgid "Theme by the" +msgstr "ธีมโดย" + +msgid "Toggle navigation" +msgstr "ไม่ต้องสลับช่องทาง" + +msgid "next page" +msgstr "หน้าต่อไป" + +msgid "open issue" +msgstr "เปิดปัญหา" + +msgid "previous page" +msgstr "หน้าที่แล้ว" + +msgid "repository" +msgstr "ที่เก็บ" + +msgid "suggest edit" +msgstr "แนะนำแก้ไข" diff --git a/msspecbook/_build/html/_static/locales/tl/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/tl/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..8df1b73 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/tl/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/tl/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/tl/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..dbeb256 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/tl/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tl\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Sa pamamagitan ng" + +msgid "By" +msgstr "Ni" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download notebook file" +msgstr "Mag-download ng file ng notebook" + +msgid "Download source file" +msgstr "Mag-download ng file ng pinagmulan" + +msgid "Download this page" +msgstr "I-download ang pahinang ito" + +msgid "Edit this page" +msgstr "I-edit ang pahinang ito" + +msgid "Last updated on" +msgstr "Huling na-update noong" + +msgid "Launch" +msgstr "Ilunsad" + +msgid "Open an issue" +msgstr "Magbukas ng isyu" + +msgid "Print to PDF" +msgstr "I-print sa PDF" + +msgid "Source repository" +msgstr "Pinagmulan ng imbakan" + +msgid "Sphinx Book Theme" +msgstr "Tema ng Sphinx Book" + +msgid "Theme by the" +msgstr "Tema ng" + +msgid "Toggle navigation" +msgstr "I-toggle ang pag-navigate" + +msgid "next page" +msgstr "Susunod na pahina" + +msgid "open issue" +msgstr "bukas na isyu" + +msgid "previous page" +msgstr "Nakaraang pahina" + +msgid "suggest edit" +msgstr "iminumungkahi i-edit" diff --git a/msspecbook/_build/html/_static/locales/tr/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/tr/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..029ae18 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/tr/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/tr/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/tr/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..610c1ab --- /dev/null +++ b/msspecbook/_build/html/_static/locales/tr/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: tr\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Tarafından" + +msgid "By" +msgstr "Tarafından" + +msgid "Contents" +msgstr "İçindekiler" + +msgid "Copyright" +msgstr "Telif hakkı" + +msgid "Download notebook file" +msgstr "Defter dosyasını indirin" + +msgid "Download source file" +msgstr "Kaynak dosyayı indirin" + +msgid "Download this page" +msgstr "Bu sayfayı indirin" + +msgid "Edit this page" +msgstr "Bu sayfayı düzenle" + +msgid "Fullscreen mode" +msgstr "Tam ekran modu" + +msgid "Last updated on" +msgstr "Son güncelleme tarihi" + +msgid "Launch" +msgstr "Başlatmak" + +msgid "Open an issue" +msgstr "Bir sorunu açın" + +msgid "Print to PDF" +msgstr "PDF olarak yazdır" + +msgid "Source repository" +msgstr "Kaynak kod deposu" + +msgid "Sphinx Book Theme" +msgstr "Sfenks Kitap Teması" + +msgid "Theme by the" +msgstr "Tarafından tema" + +msgid "Toggle navigation" +msgstr "Gezinmeyi değiştir" + +msgid "next page" +msgstr "sonraki Sayfa" + +msgid "open issue" +msgstr "Açık konu" + +msgid "previous page" +msgstr "önceki sayfa" + +msgid "repository" +msgstr "depo" + +msgid "suggest edit" +msgstr "düzenleme öner" diff --git a/msspecbook/_build/html/_static/locales/uk/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/uk/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..16ab789 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/uk/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/uk/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/uk/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..8ae61c4 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/uk/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: uk\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "По" + +msgid "By" +msgstr "Автор" + +msgid "Contents" +msgstr "Зміст" + +msgid "Copyright" +msgstr "Авторське право" + +msgid "Download notebook file" +msgstr "Завантажте файл блокнота" + +msgid "Download source file" +msgstr "Завантажити вихідний файл" + +msgid "Download this page" +msgstr "Завантажте цю сторінку" + +msgid "Edit this page" +msgstr "Редагувати цю сторінку" + +msgid "Fullscreen mode" +msgstr "Повноекранний режим" + +msgid "Last updated on" +msgstr "Останнє оновлення:" + +msgid "Launch" +msgstr "Запуск" + +msgid "Open an issue" +msgstr "Відкрийте випуск" + +msgid "Print to PDF" +msgstr "Друк у форматі PDF" + +msgid "Source repository" +msgstr "Джерело сховища" + +msgid "Sphinx Book Theme" +msgstr "Тема книги \"Сфінкс\"" + +msgid "Theme by the" +msgstr "Тема від" + +msgid "Toggle navigation" +msgstr "Переключити навігацію" + +msgid "next page" +msgstr "Наступна сторінка" + +msgid "open issue" +msgstr "відкритий випуск" + +msgid "previous page" +msgstr "Попередня сторінка" + +msgid "repository" +msgstr "сховище" + +msgid "suggest edit" +msgstr "запропонувати редагувати" diff --git a/msspecbook/_build/html/_static/locales/ur/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/ur/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..de8c84b Binary files /dev/null and b/msspecbook/_build/html/_static/locales/ur/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/ur/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/ur/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..63018ea --- /dev/null +++ b/msspecbook/_build/html/_static/locales/ur/LC_MESSAGES/booktheme.po @@ -0,0 +1,66 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: ur\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "کی طرف" + +msgid "By" +msgstr "بذریعہ" + +msgid "Copyright" +msgstr "کاپی رائٹ" + +msgid "Download notebook file" +msgstr "نوٹ بک فائل ڈاؤن لوڈ کریں" + +msgid "Download source file" +msgstr "سورس فائل ڈاؤن لوڈ کریں" + +msgid "Download this page" +msgstr "اس صفحے کو ڈاؤن لوڈ کریں" + +msgid "Edit this page" +msgstr "اس صفحے میں ترمیم کریں" + +msgid "Last updated on" +msgstr "آخری بار تازہ کاری ہوئی" + +msgid "Launch" +msgstr "لانچ کریں" + +msgid "Open an issue" +msgstr "ایک مسئلہ کھولیں" + +msgid "Print to PDF" +msgstr "پی ڈی ایف پرنٹ کریں" + +msgid "Source repository" +msgstr "ماخذ ذخیرہ" + +msgid "Sphinx Book Theme" +msgstr "سپنکس بک تھیم" + +msgid "Theme by the" +msgstr "کے ذریعہ تھیم" + +msgid "Toggle navigation" +msgstr "نیویگیشن ٹوگل کریں" + +msgid "next page" +msgstr "اگلا صفحہ" + +msgid "open issue" +msgstr "کھلا مسئلہ" + +msgid "previous page" +msgstr "سابقہ ​​صفحہ" + +msgid "suggest edit" +msgstr "ترمیم کی تجویز کریں" diff --git a/msspecbook/_build/html/_static/locales/vi/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/vi/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..2bb3255 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/vi/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/vi/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/vi/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..ac91b0f --- /dev/null +++ b/msspecbook/_build/html/_static/locales/vi/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: vi\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "Bằng" + +msgid "By" +msgstr "Bởi" + +msgid "Contents" +msgstr "Nội dung" + +msgid "Copyright" +msgstr "Bản quyền" + +msgid "Download notebook file" +msgstr "Tải xuống tệp sổ tay" + +msgid "Download source file" +msgstr "Tải xuống tệp nguồn" + +msgid "Download this page" +msgstr "Tải xuống trang này" + +msgid "Edit this page" +msgstr "chỉnh sửa trang này" + +msgid "Fullscreen mode" +msgstr "Chế độ toàn màn hình" + +msgid "Last updated on" +msgstr "Cập nhật lần cuối vào" + +msgid "Launch" +msgstr "Phóng" + +msgid "Open an issue" +msgstr "Mở một vấn đề" + +msgid "Print to PDF" +msgstr "In sang PDF" + +msgid "Source repository" +msgstr "Kho nguồn" + +msgid "Sphinx Book Theme" +msgstr "Chủ đề sách nhân sư" + +msgid "Theme by the" +msgstr "Chủ đề của" + +msgid "Toggle navigation" +msgstr "Chuyển đổi điều hướng thành" + +msgid "next page" +msgstr "Trang tiếp theo" + +msgid "open issue" +msgstr "vấn đề mở" + +msgid "previous page" +msgstr "trang trước" + +msgid "repository" +msgstr "kho" + +msgid "suggest edit" +msgstr "đề nghị chỉnh sửa" diff --git a/msspecbook/_build/html/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..0e3235d Binary files /dev/null and b/msspecbook/_build/html/_static/locales/zh_CN/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/zh_CN/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/zh_CN/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..ff1c938 --- /dev/null +++ b/msspecbook/_build/html/_static/locales/zh_CN/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: zh_CN\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "作者:" + +msgid "By" +msgstr "作者:" + +msgid "Contents" +msgstr "目录" + +msgid "Copyright" +msgstr "版权" + +msgid "Download notebook file" +msgstr "下载笔记本文件" + +msgid "Download source file" +msgstr "下载源文件" + +msgid "Download this page" +msgstr "下载此页面" + +msgid "Edit this page" +msgstr "编辑此页面" + +msgid "Fullscreen mode" +msgstr "全屏模式" + +msgid "Last updated on" +msgstr "上次更新时间:" + +msgid "Launch" +msgstr "启动" + +msgid "Open an issue" +msgstr "创建议题" + +msgid "Print to PDF" +msgstr "列印成 PDF" + +msgid "Source repository" +msgstr "源码库" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Book 主题" + +msgid "Theme by the" +msgstr "主题作者:" + +msgid "Toggle navigation" +msgstr "显示或隐藏导航栏" + +msgid "next page" +msgstr "下一页" + +msgid "open issue" +msgstr "创建议题" + +msgid "previous page" +msgstr "上一页" + +msgid "repository" +msgstr "仓库" + +msgid "suggest edit" +msgstr "提出修改建议" diff --git a/msspecbook/_build/html/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo b/msspecbook/_build/html/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo new file mode 100644 index 0000000..9116fa9 Binary files /dev/null and b/msspecbook/_build/html/_static/locales/zh_TW/LC_MESSAGES/booktheme.mo differ diff --git a/msspecbook/_build/html/_static/locales/zh_TW/LC_MESSAGES/booktheme.po b/msspecbook/_build/html/_static/locales/zh_TW/LC_MESSAGES/booktheme.po new file mode 100644 index 0000000..f2b300f --- /dev/null +++ b/msspecbook/_build/html/_static/locales/zh_TW/LC_MESSAGES/booktheme.po @@ -0,0 +1,75 @@ + +msgid "" +msgstr "" +"Project-Id-Version: Sphinx-Book-Theme\n" +"MIME-Version: 1.0\n" +"Content-Type: text/plain; charset=UTF-8\n" +"Content-Transfer-Encoding: 8bit\n" +"Language: zh_TW\n" +"Plural-Forms: nplurals=2; plural=(n != 1);\n" + +msgid "By the" +msgstr "作者:" + +msgid "By" +msgstr "作者:" + +msgid "Contents" +msgstr "目錄" + +msgid "Copyright" +msgstr "Copyright" + +msgid "Download notebook file" +msgstr "下載 Notebook 檔案" + +msgid "Download source file" +msgstr "下載原始檔" + +msgid "Download this page" +msgstr "下載此頁面" + +msgid "Edit this page" +msgstr "編輯此頁面" + +msgid "Fullscreen mode" +msgstr "全螢幕模式" + +msgid "Last updated on" +msgstr "最後更新時間:" + +msgid "Launch" +msgstr "啟動" + +msgid "Open an issue" +msgstr "開啟議題" + +msgid "Print to PDF" +msgstr "列印成 PDF" + +msgid "Source repository" +msgstr "來源儲存庫" + +msgid "Sphinx Book Theme" +msgstr "Sphinx Book 佈景主題" + +msgid "Theme by the" +msgstr "佈景主題作者:" + +msgid "Toggle navigation" +msgstr "顯示或隱藏導覽列" + +msgid "next page" +msgstr "下一頁" + +msgid "open issue" +msgstr "公開的問題" + +msgid "previous page" +msgstr "上一頁" + +msgid "repository" +msgstr "儲存庫" + +msgid "suggest edit" +msgstr "提出修改建議" diff --git a/msspecbook/_build/html/_static/logo.jpg b/msspecbook/_build/html/_static/logo.jpg new file mode 100644 index 0000000..3202c73 Binary files /dev/null and b/msspecbook/_build/html/_static/logo.jpg differ diff --git a/msspecbook/_build/html/_static/logo.png b/msspecbook/_build/html/_static/logo.png new file mode 100644 index 0000000..06d56f4 Binary files /dev/null and b/msspecbook/_build/html/_static/logo.png differ diff --git a/msspecbook/_build/html/_static/minus.png b/msspecbook/_build/html/_static/minus.png new file mode 100644 index 0000000..d96755f Binary files /dev/null and b/msspecbook/_build/html/_static/minus.png differ diff --git a/msspecbook/_build/html/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css b/msspecbook/_build/html/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css new file mode 100644 index 0000000..3356631 --- /dev/null +++ b/msspecbook/_build/html/_static/mystnb.4510f1fc1dee50b3e5859aac5469c37c29e427902b24a333a5f9fcb2f0b3ac41.css @@ -0,0 +1,2342 @@ +/* Variables */ +:root { + --mystnb-source-bg-color: #f7f7f7; + --mystnb-stdout-bg-color: #fcfcfc; + --mystnb-stderr-bg-color: #fdd; + --mystnb-traceback-bg-color: #fcfcfc; + --mystnb-source-border-color: #ccc; + --mystnb-source-margin-color: green; + --mystnb-stdout-border-color: #f7f7f7; + --mystnb-stderr-border-color: #f7f7f7; + --mystnb-traceback-border-color: #ffd6d6; + --mystnb-hide-prompt-opacity: 70%; + --mystnb-source-border-radius: .4em; + --mystnb-source-border-width: 1px; +} + +/* Whole cell */ +div.container.cell { + padding-left: 0; + margin-bottom: 1em; +} + +/* Removing all background formatting so we can control at the div level */ +.cell_input div.highlight, +.cell_output pre, +.cell_input pre, +.cell_output .output { + border: none; + box-shadow: none; +} + +.cell_output .output pre, +.cell_input pre { + margin: 0px; +} + +/* Input cells */ +div.cell div.cell_input, +div.cell details.above-input>summary { + padding-left: 0em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + background-color: var(--mystnb-source-bg-color); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; + border-radius: var(--mystnb-source-border-radius); +} + +div.cell_input>div, +div.cell_output div.output>div.highlight { + margin: 0em !important; + border: none !important; +} + +/* All cell outputs */ +.cell_output { + padding-left: 1em; + padding-right: 0em; + margin-top: 1em; +} + +/* Text outputs from cells */ +.cell_output .output.text_plain, +.cell_output .output.traceback, +.cell_output .output.stream, +.cell_output .output.stderr { + margin-top: 1em; + margin-bottom: 0em; + box-shadow: none; +} + +.cell_output .output.text_plain, +.cell_output .output.stream { + background: var(--mystnb-stdout-bg-color); + border: 1px solid var(--mystnb-stdout-border-color); +} + +.cell_output .output.stderr { + background: var(--mystnb-stderr-bg-color); + border: 1px solid var(--mystnb-stderr-border-color); +} + +.cell_output .output.traceback { + background: var(--mystnb-traceback-bg-color); + border: 1px solid var(--mystnb-traceback-border-color); +} + +/* Collapsible cell content */ +div.cell details.above-input div.cell_input { + border-top-left-radius: 0; + border-top-right-radius: 0; + border-top: var(--mystnb-source-border-width) var(--mystnb-source-border-color) dashed; +} + +div.cell div.cell_input.above-output-prompt { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; +} + +div.cell details.above-input>summary { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; + border-bottom: var(--mystnb-source-border-width) var(--mystnb-source-border-color) dashed; + padding-left: 1em; + margin-bottom: 0; +} + +div.cell details.above-output>summary { + background-color: var(--mystnb-source-bg-color); + padding-left: 1em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + border-radius: var(--mystnb-source-border-radius); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; +} + +div.cell details.below-input>summary { + background-color: var(--mystnb-source-bg-color); + padding-left: 1em; + padding-right: 0em; + border: var(--mystnb-source-border-width) var(--mystnb-source-border-color) solid; + border-top: none; + border-bottom-left-radius: var(--mystnb-source-border-radius); + border-bottom-right-radius: var(--mystnb-source-border-radius); + border-left-color: var(--mystnb-source-margin-color); + border-left-width: medium; +} + +div.cell details.hide>summary>span { + opacity: var(--mystnb-hide-prompt-opacity); +} + +div.cell details.hide[open]>summary>span.collapsed { + display: none; +} + +div.cell details.hide:not([open])>summary>span.expanded { + display: none; +} + +@keyframes collapsed-fade-in { + 0% { + opacity: 0; + } + + 100% { + opacity: 1; + } +} +div.cell details.hide[open]>summary~* { + -moz-animation: collapsed-fade-in 0.3s ease-in-out; + -webkit-animation: collapsed-fade-in 0.3s ease-in-out; + animation: collapsed-fade-in 0.3s ease-in-out; +} + +/* Math align to the left */ +.cell_output .MathJax_Display { + text-align: left !important; +} + +/* Pandas tables. Pulled from the Jupyter / nbsphinx CSS */ +div.cell_output table { + border: none; + border-collapse: collapse; + border-spacing: 0; + color: black; + font-size: 1em; + table-layout: fixed; +} + +div.cell_output thead { + border-bottom: 1px solid black; + vertical-align: bottom; +} + +div.cell_output tr, +div.cell_output th, +div.cell_output td { + text-align: right; + vertical-align: middle; + padding: 0.5em 0.5em; + line-height: normal; + white-space: normal; + max-width: none; + border: none; +} + +div.cell_output th { + font-weight: bold; +} + +div.cell_output tbody tr:nth-child(odd) { + background: #f5f5f5; +} + +div.cell_output tbody tr:hover { + background: rgba(66, 165, 245, 0.2); +} + +/** source code line numbers **/ +span.linenos { + opacity: 0.5; +} + +/* Inline text from `paste` operation */ + +span.pasted-text { + font-weight: bold; +} + +span.pasted-inline img { + max-height: 2em; +} + +tbody span.pasted-inline img { + max-height: none; +} + +/* Font colors for translated ANSI escape sequences +Color values are copied from Jupyter Notebook +https://github.com/jupyter/notebook/blob/52581f8eda9b319eb0390ac77fe5903c38f81e3e/notebook/static/notebook/less/ansicolors.less#L14-L21 +Background colors from +https://nbsphinx.readthedocs.io/en/latest/code-cells.html#ANSI-Colors +*/ +div.highlight .-Color-Bold { + font-weight: bold; +} + +div.highlight .-Color[class*=-Black] { + color: #3E424D +} + +div.highlight .-Color[class*=-Red] { + color: #E75C58 +} + +div.highlight .-Color[class*=-Green] { + color: #00A250 +} + +div.highlight .-Color[class*=-Yellow] { + color: #DDB62B +} + +div.highlight .-Color[class*=-Blue] { + color: #208FFB +} + +div.highlight .-Color[class*=-Magenta] { + color: #D160C4 +} + +div.highlight .-Color[class*=-Cyan] { + color: #60C6C8 +} + +div.highlight .-Color[class*=-White] { + color: #C5C1B4 +} + +div.highlight .-Color[class*=-BGBlack] { + background-color: #3E424D +} + +div.highlight .-Color[class*=-BGRed] { + background-color: #E75C58 +} + +div.highlight .-Color[class*=-BGGreen] { + background-color: #00A250 +} + +div.highlight .-Color[class*=-BGYellow] { + background-color: #DDB62B +} + +div.highlight .-Color[class*=-BGBlue] { + background-color: #208FFB +} + +div.highlight .-Color[class*=-BGMagenta] { + background-color: #D160C4 +} + +div.highlight .-Color[class*=-BGCyan] { + background-color: #60C6C8 +} + +div.highlight .-Color[class*=-BGWhite] { + background-color: #C5C1B4 +} + +/* Font colors for 8-bit ANSI */ + +div.highlight .-Color[class*=-C0] { + color: #000000 +} + +div.highlight .-Color[class*=-BGC0] { + background-color: #000000 +} + +div.highlight .-Color[class*=-C1] { + color: #800000 +} + +div.highlight .-Color[class*=-BGC1] { + background-color: #800000 +} + +div.highlight .-Color[class*=-C2] { + color: #008000 +} + +div.highlight .-Color[class*=-BGC2] { + background-color: #008000 +} + +div.highlight .-Color[class*=-C3] { + color: #808000 +} + +div.highlight .-Color[class*=-BGC3] { + background-color: #808000 +} + +div.highlight .-Color[class*=-C4] { + color: #000080 +} + +div.highlight .-Color[class*=-BGC4] { + background-color: #000080 +} + +div.highlight .-Color[class*=-C5] { + color: #800080 +} + +div.highlight .-Color[class*=-BGC5] { + background-color: #800080 +} + +div.highlight .-Color[class*=-C6] { + color: #008080 +} + +div.highlight .-Color[class*=-BGC6] { + background-color: #008080 +} + +div.highlight .-Color[class*=-C7] { + color: #C0C0C0 +} + +div.highlight .-Color[class*=-BGC7] { + background-color: #C0C0C0 +} + +div.highlight .-Color[class*=-C8] { + color: #808080 +} + +div.highlight .-Color[class*=-BGC8] { + background-color: #808080 +} + +div.highlight .-Color[class*=-C9] { + color: #FF0000 +} + +div.highlight .-Color[class*=-BGC9] { + background-color: #FF0000 +} + +div.highlight .-Color[class*=-C10] { + color: #00FF00 +} + +div.highlight .-Color[class*=-BGC10] { + background-color: #00FF00 +} + +div.highlight .-Color[class*=-C11] { + color: #FFFF00 +} + +div.highlight .-Color[class*=-BGC11] { + background-color: #FFFF00 +} + +div.highlight .-Color[class*=-C12] { + color: #0000FF +} + +div.highlight .-Color[class*=-BGC12] { + background-color: #0000FF +} + +div.highlight .-Color[class*=-C13] { + color: #FF00FF +} + +div.highlight .-Color[class*=-BGC13] { + background-color: #FF00FF +} + +div.highlight .-Color[class*=-C14] { + color: #00FFFF +} + +div.highlight .-Color[class*=-BGC14] { + background-color: #00FFFF +} + +div.highlight .-Color[class*=-C15] { + color: #FFFFFF +} + +div.highlight .-Color[class*=-BGC15] { + background-color: #FFFFFF +} + +div.highlight .-Color[class*=-C16] { + color: #000000 +} + +div.highlight .-Color[class*=-BGC16] { + background-color: #000000 +} + +div.highlight .-Color[class*=-C17] { + color: #00005F +} + +div.highlight .-Color[class*=-BGC17] { + background-color: #00005F +} + +div.highlight .-Color[class*=-C18] { + color: #000087 +} + +div.highlight .-Color[class*=-BGC18] { + background-color: #000087 +} + +div.highlight .-Color[class*=-C19] { + color: #0000AF +} + +div.highlight .-Color[class*=-BGC19] { + background-color: #0000AF +} + +div.highlight .-Color[class*=-C20] { + color: #0000D7 +} + +div.highlight .-Color[class*=-BGC20] { + background-color: #0000D7 +} + +div.highlight .-Color[class*=-C21] { + color: #0000FF +} + +div.highlight .-Color[class*=-BGC21] { + background-color: #0000FF +} + +div.highlight .-Color[class*=-C22] { + color: #005F00 +} + +div.highlight .-Color[class*=-BGC22] { + background-color: #005F00 +} + +div.highlight .-Color[class*=-C23] { + color: #005F5F +} + +div.highlight .-Color[class*=-BGC23] { + background-color: #005F5F +} + +div.highlight .-Color[class*=-C24] { + color: #005F87 +} + +div.highlight .-Color[class*=-BGC24] { + background-color: #005F87 +} + +div.highlight .-Color[class*=-C25] { + color: #005FAF +} + +div.highlight .-Color[class*=-BGC25] { + background-color: #005FAF +} + +div.highlight .-Color[class*=-C26] { + color: #005FD7 +} + +div.highlight .-Color[class*=-BGC26] { + background-color: #005FD7 +} + +div.highlight .-Color[class*=-C27] { + color: #005FFF +} + +div.highlight .-Color[class*=-BGC27] { + background-color: #005FFF +} + +div.highlight .-Color[class*=-C28] { + color: #008700 +} + +div.highlight .-Color[class*=-BGC28] { + background-color: #008700 +} + +div.highlight .-Color[class*=-C29] { + color: #00875F +} + +div.highlight .-Color[class*=-BGC29] { + background-color: #00875F +} + +div.highlight .-Color[class*=-C30] { + color: #008787 +} + +div.highlight .-Color[class*=-BGC30] { + background-color: #008787 +} + +div.highlight .-Color[class*=-C31] { + color: #0087AF +} + +div.highlight .-Color[class*=-BGC31] { + background-color: #0087AF +} + +div.highlight .-Color[class*=-C32] { + color: #0087D7 +} + +div.highlight .-Color[class*=-BGC32] { + background-color: #0087D7 +} + +div.highlight .-Color[class*=-C33] { + color: #0087FF +} + +div.highlight .-Color[class*=-BGC33] { + background-color: #0087FF +} + +div.highlight .-Color[class*=-C34] { + color: #00AF00 +} + +div.highlight .-Color[class*=-BGC34] { + background-color: #00AF00 +} + +div.highlight .-Color[class*=-C35] { + color: #00AF5F +} + +div.highlight .-Color[class*=-BGC35] { + background-color: #00AF5F +} + +div.highlight .-Color[class*=-C36] { + color: #00AF87 +} + +div.highlight .-Color[class*=-BGC36] { + background-color: #00AF87 +} + +div.highlight .-Color[class*=-C37] { + color: #00AFAF +} + +div.highlight .-Color[class*=-BGC37] { + background-color: #00AFAF +} + +div.highlight .-Color[class*=-C38] { + color: #00AFD7 +} + +div.highlight .-Color[class*=-BGC38] { + background-color: #00AFD7 +} + +div.highlight .-Color[class*=-C39] { + color: #00AFFF +} + +div.highlight .-Color[class*=-BGC39] { + background-color: #00AFFF +} + +div.highlight .-Color[class*=-C40] { + color: #00D700 +} + +div.highlight .-Color[class*=-BGC40] { + background-color: #00D700 +} + +div.highlight .-Color[class*=-C41] { + color: #00D75F +} + +div.highlight .-Color[class*=-BGC41] { + background-color: #00D75F +} + +div.highlight .-Color[class*=-C42] { + color: #00D787 +} + +div.highlight .-Color[class*=-BGC42] { + background-color: #00D787 +} + +div.highlight .-Color[class*=-C43] { + color: #00D7AF +} + +div.highlight .-Color[class*=-BGC43] { + background-color: #00D7AF +} + +div.highlight .-Color[class*=-C44] { + color: #00D7D7 +} + +div.highlight .-Color[class*=-BGC44] { + background-color: #00D7D7 +} + +div.highlight .-Color[class*=-C45] { + color: #00D7FF +} + +div.highlight .-Color[class*=-BGC45] { + background-color: #00D7FF +} + +div.highlight .-Color[class*=-C46] { + color: #00FF00 +} + +div.highlight .-Color[class*=-BGC46] { + background-color: #00FF00 +} + +div.highlight .-Color[class*=-C47] { + color: #00FF5F +} + +div.highlight .-Color[class*=-BGC47] { + background-color: #00FF5F +} + +div.highlight .-Color[class*=-C48] { + color: #00FF87 +} + +div.highlight .-Color[class*=-BGC48] { + background-color: #00FF87 +} + +div.highlight .-Color[class*=-C49] { + color: #00FFAF +} + +div.highlight .-Color[class*=-BGC49] { + background-color: #00FFAF +} + +div.highlight .-Color[class*=-C50] { + color: #00FFD7 +} + +div.highlight .-Color[class*=-BGC50] { + background-color: #00FFD7 +} + +div.highlight .-Color[class*=-C51] { + color: #00FFFF +} + +div.highlight .-Color[class*=-BGC51] { + background-color: #00FFFF +} + +div.highlight .-Color[class*=-C52] { + color: #5F0000 +} + +div.highlight .-Color[class*=-BGC52] { + background-color: #5F0000 +} + +div.highlight .-Color[class*=-C53] { + color: #5F005F +} + +div.highlight .-Color[class*=-BGC53] { + background-color: #5F005F +} + +div.highlight .-Color[class*=-C54] { + color: #5F0087 +} + +div.highlight .-Color[class*=-BGC54] { + background-color: #5F0087 +} + +div.highlight .-Color[class*=-C55] { + color: #5F00AF +} + +div.highlight .-Color[class*=-BGC55] { + background-color: #5F00AF +} + +div.highlight .-Color[class*=-C56] { + color: #5F00D7 +} + +div.highlight .-Color[class*=-BGC56] { + background-color: #5F00D7 +} + +div.highlight .-Color[class*=-C57] { + color: #5F00FF +} + +div.highlight .-Color[class*=-BGC57] { + background-color: #5F00FF +} + +div.highlight .-Color[class*=-C58] { + color: #5F5F00 +} + +div.highlight .-Color[class*=-BGC58] { + background-color: #5F5F00 +} + +div.highlight .-Color[class*=-C59] { + color: #5F5F5F +} + +div.highlight .-Color[class*=-BGC59] { + background-color: #5F5F5F +} + +div.highlight .-Color[class*=-C60] { + color: #5F5F87 +} + +div.highlight .-Color[class*=-BGC60] { + background-color: #5F5F87 +} + +div.highlight .-Color[class*=-C61] { + color: #5F5FAF +} + +div.highlight .-Color[class*=-BGC61] { + background-color: #5F5FAF +} + +div.highlight .-Color[class*=-C62] { + color: #5F5FD7 +} + +div.highlight .-Color[class*=-BGC62] { + background-color: #5F5FD7 +} + +div.highlight .-Color[class*=-C63] { + color: #5F5FFF +} + +div.highlight .-Color[class*=-BGC63] { + background-color: #5F5FFF +} + +div.highlight .-Color[class*=-C64] { + color: #5F8700 +} + +div.highlight .-Color[class*=-BGC64] { + background-color: #5F8700 +} + +div.highlight .-Color[class*=-C65] { + color: #5F875F +} + +div.highlight .-Color[class*=-BGC65] { + background-color: #5F875F +} + +div.highlight .-Color[class*=-C66] { + color: #5F8787 +} + +div.highlight .-Color[class*=-BGC66] { + background-color: #5F8787 +} + +div.highlight .-Color[class*=-C67] { + color: #5F87AF +} + +div.highlight .-Color[class*=-BGC67] { + background-color: #5F87AF +} + +div.highlight .-Color[class*=-C68] { + color: #5F87D7 +} + +div.highlight .-Color[class*=-BGC68] { + background-color: #5F87D7 +} + +div.highlight .-Color[class*=-C69] { + color: #5F87FF +} + +div.highlight .-Color[class*=-BGC69] { + background-color: #5F87FF +} + +div.highlight .-Color[class*=-C70] { + color: #5FAF00 +} + +div.highlight .-Color[class*=-BGC70] { + background-color: #5FAF00 +} + +div.highlight .-Color[class*=-C71] { + color: #5FAF5F +} + +div.highlight .-Color[class*=-BGC71] { + background-color: #5FAF5F +} + +div.highlight .-Color[class*=-C72] { + color: #5FAF87 +} + +div.highlight .-Color[class*=-BGC72] { + background-color: #5FAF87 +} + +div.highlight .-Color[class*=-C73] { + color: #5FAFAF +} + +div.highlight .-Color[class*=-BGC73] { + background-color: #5FAFAF +} + +div.highlight .-Color[class*=-C74] { + color: #5FAFD7 +} + +div.highlight .-Color[class*=-BGC74] { + background-color: #5FAFD7 +} + +div.highlight .-Color[class*=-C75] { + color: #5FAFFF +} + +div.highlight .-Color[class*=-BGC75] { + background-color: #5FAFFF +} + +div.highlight .-Color[class*=-C76] { + color: #5FD700 +} + +div.highlight .-Color[class*=-BGC76] { + background-color: #5FD700 +} + +div.highlight .-Color[class*=-C77] { + color: #5FD75F +} + +div.highlight .-Color[class*=-BGC77] { + background-color: #5FD75F +} + +div.highlight .-Color[class*=-C78] { + color: #5FD787 +} + +div.highlight .-Color[class*=-BGC78] { + background-color: #5FD787 +} + +div.highlight .-Color[class*=-C79] { + color: #5FD7AF +} + +div.highlight .-Color[class*=-BGC79] { + background-color: #5FD7AF +} + +div.highlight .-Color[class*=-C80] { + color: #5FD7D7 +} + +div.highlight .-Color[class*=-BGC80] { + background-color: #5FD7D7 +} + +div.highlight .-Color[class*=-C81] { + color: #5FD7FF +} + +div.highlight .-Color[class*=-BGC81] { + background-color: #5FD7FF +} + +div.highlight .-Color[class*=-C82] { + color: #5FFF00 +} + +div.highlight .-Color[class*=-BGC82] { + background-color: #5FFF00 +} + +div.highlight .-Color[class*=-C83] { + color: #5FFF5F +} + +div.highlight .-Color[class*=-BGC83] { + background-color: #5FFF5F +} + +div.highlight .-Color[class*=-C84] { + color: #5FFF87 +} + +div.highlight .-Color[class*=-BGC84] { + background-color: #5FFF87 +} + +div.highlight .-Color[class*=-C85] { + color: #5FFFAF +} + +div.highlight .-Color[class*=-BGC85] { + background-color: #5FFFAF +} + +div.highlight .-Color[class*=-C86] { + color: #5FFFD7 +} + +div.highlight .-Color[class*=-BGC86] { + background-color: #5FFFD7 +} + +div.highlight .-Color[class*=-C87] { + color: #5FFFFF +} + +div.highlight .-Color[class*=-BGC87] { + background-color: #5FFFFF +} + +div.highlight .-Color[class*=-C88] { + color: #870000 +} + +div.highlight .-Color[class*=-BGC88] { + background-color: #870000 +} + +div.highlight .-Color[class*=-C89] { + color: #87005F +} + +div.highlight .-Color[class*=-BGC89] { + background-color: #87005F +} + +div.highlight .-Color[class*=-C90] { + color: #870087 +} + +div.highlight .-Color[class*=-BGC90] { + background-color: #870087 +} + +div.highlight .-Color[class*=-C91] { + color: #8700AF +} + +div.highlight .-Color[class*=-BGC91] { + background-color: #8700AF +} + +div.highlight .-Color[class*=-C92] { + color: #8700D7 +} + +div.highlight .-Color[class*=-BGC92] { + background-color: #8700D7 +} + +div.highlight .-Color[class*=-C93] { + color: #8700FF +} + +div.highlight .-Color[class*=-BGC93] { + background-color: #8700FF +} + +div.highlight .-Color[class*=-C94] { + color: #875F00 +} + +div.highlight .-Color[class*=-BGC94] { + background-color: #875F00 +} + +div.highlight .-Color[class*=-C95] { + color: #875F5F +} + +div.highlight .-Color[class*=-BGC95] { + background-color: #875F5F +} + +div.highlight .-Color[class*=-C96] { + color: #875F87 +} + +div.highlight .-Color[class*=-BGC96] { + background-color: #875F87 +} + +div.highlight .-Color[class*=-C97] { + color: #875FAF +} + +div.highlight .-Color[class*=-BGC97] { + background-color: #875FAF +} + +div.highlight .-Color[class*=-C98] { + color: #875FD7 +} + +div.highlight .-Color[class*=-BGC98] { + background-color: #875FD7 +} + +div.highlight .-Color[class*=-C99] { + color: #875FFF +} + +div.highlight .-Color[class*=-BGC99] { + background-color: #875FFF +} + +div.highlight .-Color[class*=-C100] { + color: #878700 +} + +div.highlight .-Color[class*=-BGC100] { + background-color: #878700 +} + +div.highlight .-Color[class*=-C101] { + color: #87875F +} + +div.highlight .-Color[class*=-BGC101] { + background-color: #87875F +} + +div.highlight .-Color[class*=-C102] { + color: #878787 +} + +div.highlight .-Color[class*=-BGC102] { + background-color: #878787 +} + +div.highlight .-Color[class*=-C103] { + color: #8787AF +} + +div.highlight .-Color[class*=-BGC103] { + background-color: #8787AF +} + +div.highlight .-Color[class*=-C104] { + color: #8787D7 +} + +div.highlight .-Color[class*=-BGC104] { + background-color: #8787D7 +} + +div.highlight .-Color[class*=-C105] { + color: #8787FF +} + +div.highlight .-Color[class*=-BGC105] { + background-color: #8787FF +} + +div.highlight .-Color[class*=-C106] { + color: #87AF00 +} + +div.highlight .-Color[class*=-BGC106] { + background-color: #87AF00 +} + +div.highlight .-Color[class*=-C107] { + color: #87AF5F +} + +div.highlight .-Color[class*=-BGC107] { + background-color: #87AF5F +} + +div.highlight .-Color[class*=-C108] { + color: #87AF87 +} + +div.highlight .-Color[class*=-BGC108] { + background-color: #87AF87 +} + +div.highlight .-Color[class*=-C109] { + color: #87AFAF +} + +div.highlight .-Color[class*=-BGC109] { + background-color: #87AFAF +} + +div.highlight .-Color[class*=-C110] { + color: #87AFD7 +} + +div.highlight .-Color[class*=-BGC110] { + background-color: #87AFD7 +} + +div.highlight .-Color[class*=-C111] { + color: #87AFFF +} + +div.highlight .-Color[class*=-BGC111] { + background-color: #87AFFF +} + +div.highlight .-Color[class*=-C112] { + color: #87D700 +} + +div.highlight .-Color[class*=-BGC112] { + background-color: #87D700 +} + +div.highlight .-Color[class*=-C113] { + color: #87D75F +} + +div.highlight .-Color[class*=-BGC113] { + background-color: #87D75F +} + +div.highlight .-Color[class*=-C114] { + color: #87D787 +} + +div.highlight .-Color[class*=-BGC114] { + background-color: #87D787 +} + +div.highlight .-Color[class*=-C115] { + color: #87D7AF +} + +div.highlight .-Color[class*=-BGC115] { + background-color: #87D7AF +} + +div.highlight .-Color[class*=-C116] { + color: #87D7D7 +} + +div.highlight .-Color[class*=-BGC116] { + background-color: #87D7D7 +} + +div.highlight .-Color[class*=-C117] { + color: #87D7FF +} + +div.highlight .-Color[class*=-BGC117] { + background-color: #87D7FF +} + +div.highlight .-Color[class*=-C118] { + color: #87FF00 +} + +div.highlight .-Color[class*=-BGC118] { + background-color: #87FF00 +} + +div.highlight .-Color[class*=-C119] { + color: #87FF5F +} + +div.highlight .-Color[class*=-BGC119] { + background-color: #87FF5F +} + +div.highlight .-Color[class*=-C120] { + color: #87FF87 +} + +div.highlight .-Color[class*=-BGC120] { + background-color: #87FF87 +} + +div.highlight .-Color[class*=-C121] { + color: #87FFAF +} + +div.highlight .-Color[class*=-BGC121] { + background-color: #87FFAF +} + +div.highlight .-Color[class*=-C122] { + color: #87FFD7 +} + +div.highlight .-Color[class*=-BGC122] { + background-color: #87FFD7 +} + +div.highlight .-Color[class*=-C123] { + color: #87FFFF +} + +div.highlight .-Color[class*=-BGC123] { + background-color: #87FFFF +} + +div.highlight .-Color[class*=-C124] { + color: #AF0000 +} + +div.highlight .-Color[class*=-BGC124] { + background-color: #AF0000 +} + +div.highlight .-Color[class*=-C125] { + color: #AF005F +} + +div.highlight .-Color[class*=-BGC125] { + background-color: #AF005F +} + +div.highlight .-Color[class*=-C126] { + color: #AF0087 +} + +div.highlight .-Color[class*=-BGC126] { + background-color: #AF0087 +} + +div.highlight .-Color[class*=-C127] { + color: #AF00AF +} + +div.highlight .-Color[class*=-BGC127] { + background-color: #AF00AF +} + +div.highlight .-Color[class*=-C128] { + color: #AF00D7 +} + +div.highlight .-Color[class*=-BGC128] { + background-color: #AF00D7 +} + +div.highlight .-Color[class*=-C129] { + color: #AF00FF +} + +div.highlight .-Color[class*=-BGC129] { + background-color: #AF00FF +} + +div.highlight .-Color[class*=-C130] { + color: #AF5F00 +} + +div.highlight .-Color[class*=-BGC130] { + background-color: #AF5F00 +} + +div.highlight .-Color[class*=-C131] { + color: #AF5F5F +} + +div.highlight .-Color[class*=-BGC131] { + background-color: #AF5F5F +} + +div.highlight .-Color[class*=-C132] { + color: #AF5F87 +} + +div.highlight .-Color[class*=-BGC132] { + background-color: #AF5F87 +} + +div.highlight .-Color[class*=-C133] { + color: #AF5FAF +} + +div.highlight .-Color[class*=-BGC133] { + background-color: #AF5FAF +} + +div.highlight .-Color[class*=-C134] { + color: #AF5FD7 +} + +div.highlight .-Color[class*=-BGC134] { + background-color: #AF5FD7 +} + +div.highlight .-Color[class*=-C135] { + color: #AF5FFF +} + +div.highlight .-Color[class*=-BGC135] { + background-color: #AF5FFF +} + +div.highlight .-Color[class*=-C136] { + color: #AF8700 +} + +div.highlight .-Color[class*=-BGC136] { + background-color: #AF8700 +} + +div.highlight .-Color[class*=-C137] { + color: #AF875F +} + +div.highlight .-Color[class*=-BGC137] { + background-color: #AF875F +} + +div.highlight .-Color[class*=-C138] { + color: #AF8787 +} + +div.highlight .-Color[class*=-BGC138] { + background-color: #AF8787 +} + +div.highlight .-Color[class*=-C139] { + color: #AF87AF +} + +div.highlight .-Color[class*=-BGC139] { + background-color: #AF87AF +} + +div.highlight .-Color[class*=-C140] { + color: #AF87D7 +} + +div.highlight .-Color[class*=-BGC140] { + background-color: #AF87D7 +} + +div.highlight .-Color[class*=-C141] { + color: #AF87FF +} + +div.highlight .-Color[class*=-BGC141] { + background-color: #AF87FF +} + +div.highlight .-Color[class*=-C142] { + color: #AFAF00 +} + +div.highlight .-Color[class*=-BGC142] { + background-color: #AFAF00 +} + +div.highlight .-Color[class*=-C143] { + color: #AFAF5F +} + +div.highlight .-Color[class*=-BGC143] { + background-color: #AFAF5F +} + +div.highlight .-Color[class*=-C144] { + color: #AFAF87 +} + +div.highlight .-Color[class*=-BGC144] { + background-color: #AFAF87 +} + +div.highlight .-Color[class*=-C145] { + color: #AFAFAF +} + +div.highlight .-Color[class*=-BGC145] { + background-color: #AFAFAF +} + +div.highlight .-Color[class*=-C146] { + color: #AFAFD7 +} + +div.highlight .-Color[class*=-BGC146] { + background-color: #AFAFD7 +} + +div.highlight .-Color[class*=-C147] { + color: #AFAFFF +} + +div.highlight .-Color[class*=-BGC147] { + background-color: #AFAFFF +} + +div.highlight .-Color[class*=-C148] { + color: #AFD700 +} + +div.highlight .-Color[class*=-BGC148] { + background-color: #AFD700 +} + +div.highlight .-Color[class*=-C149] { + color: #AFD75F +} + +div.highlight .-Color[class*=-BGC149] { + background-color: #AFD75F +} + +div.highlight .-Color[class*=-C150] { + color: #AFD787 +} + +div.highlight .-Color[class*=-BGC150] { + background-color: #AFD787 +} + +div.highlight .-Color[class*=-C151] { + color: #AFD7AF +} + +div.highlight .-Color[class*=-BGC151] { + background-color: #AFD7AF +} + +div.highlight .-Color[class*=-C152] { + color: #AFD7D7 +} + +div.highlight .-Color[class*=-BGC152] { + background-color: #AFD7D7 +} + +div.highlight .-Color[class*=-C153] { + color: #AFD7FF +} + +div.highlight .-Color[class*=-BGC153] { + background-color: #AFD7FF +} + +div.highlight .-Color[class*=-C154] { + color: #AFFF00 +} + +div.highlight .-Color[class*=-BGC154] { + background-color: #AFFF00 +} + +div.highlight .-Color[class*=-C155] { + color: #AFFF5F +} + +div.highlight .-Color[class*=-BGC155] { + background-color: #AFFF5F +} + +div.highlight .-Color[class*=-C156] { + color: #AFFF87 +} + +div.highlight .-Color[class*=-BGC156] { + background-color: #AFFF87 +} + +div.highlight .-Color[class*=-C157] { + color: #AFFFAF +} + +div.highlight .-Color[class*=-BGC157] { + background-color: #AFFFAF +} + +div.highlight .-Color[class*=-C158] { + color: #AFFFD7 +} + +div.highlight .-Color[class*=-BGC158] { + background-color: #AFFFD7 +} + +div.highlight .-Color[class*=-C159] { + color: #AFFFFF +} + +div.highlight .-Color[class*=-BGC159] { + background-color: #AFFFFF +} + +div.highlight .-Color[class*=-C160] { + color: #D70000 +} + +div.highlight .-Color[class*=-BGC160] { + background-color: #D70000 +} + +div.highlight .-Color[class*=-C161] { + color: #D7005F +} + +div.highlight .-Color[class*=-BGC161] { + background-color: #D7005F +} + +div.highlight .-Color[class*=-C162] { + color: #D70087 +} + +div.highlight .-Color[class*=-BGC162] { + background-color: #D70087 +} + +div.highlight .-Color[class*=-C163] { + color: #D700AF +} + +div.highlight .-Color[class*=-BGC163] { + background-color: #D700AF +} + +div.highlight .-Color[class*=-C164] { + color: #D700D7 +} + +div.highlight .-Color[class*=-BGC164] { + background-color: #D700D7 +} + +div.highlight .-Color[class*=-C165] { + color: #D700FF +} + +div.highlight .-Color[class*=-BGC165] { + background-color: #D700FF +} + +div.highlight .-Color[class*=-C166] { + color: #D75F00 +} + +div.highlight .-Color[class*=-BGC166] { + background-color: #D75F00 +} + +div.highlight .-Color[class*=-C167] { + color: #D75F5F +} + +div.highlight .-Color[class*=-BGC167] { + background-color: #D75F5F +} + +div.highlight .-Color[class*=-C168] { + color: #D75F87 +} + +div.highlight .-Color[class*=-BGC168] { + background-color: #D75F87 +} + +div.highlight .-Color[class*=-C169] { + color: #D75FAF +} + +div.highlight .-Color[class*=-BGC169] { + background-color: #D75FAF +} + +div.highlight .-Color[class*=-C170] { + color: #D75FD7 +} + +div.highlight .-Color[class*=-BGC170] { + background-color: #D75FD7 +} + +div.highlight .-Color[class*=-C171] { + color: #D75FFF +} + +div.highlight .-Color[class*=-BGC171] { + background-color: #D75FFF +} + +div.highlight .-Color[class*=-C172] { + color: #D78700 +} + +div.highlight .-Color[class*=-BGC172] { + background-color: #D78700 +} + +div.highlight .-Color[class*=-C173] { + color: #D7875F +} + +div.highlight .-Color[class*=-BGC173] { + background-color: #D7875F +} + +div.highlight .-Color[class*=-C174] { + color: #D78787 +} + +div.highlight .-Color[class*=-BGC174] { + background-color: #D78787 +} + +div.highlight .-Color[class*=-C175] { + color: #D787AF +} + +div.highlight .-Color[class*=-BGC175] { + background-color: #D787AF +} + +div.highlight .-Color[class*=-C176] { + color: #D787D7 +} + +div.highlight .-Color[class*=-BGC176] { + background-color: #D787D7 +} + +div.highlight .-Color[class*=-C177] { + color: #D787FF +} + +div.highlight .-Color[class*=-BGC177] { + background-color: #D787FF +} + +div.highlight .-Color[class*=-C178] { + color: #D7AF00 +} + +div.highlight .-Color[class*=-BGC178] { + background-color: #D7AF00 +} + +div.highlight .-Color[class*=-C179] { + color: #D7AF5F +} + +div.highlight .-Color[class*=-BGC179] { + background-color: #D7AF5F +} + +div.highlight .-Color[class*=-C180] { + color: #D7AF87 +} + +div.highlight .-Color[class*=-BGC180] { + background-color: #D7AF87 +} + +div.highlight .-Color[class*=-C181] { + color: #D7AFAF +} + +div.highlight .-Color[class*=-BGC181] { + background-color: #D7AFAF +} + +div.highlight .-Color[class*=-C182] { + color: #D7AFD7 +} + +div.highlight .-Color[class*=-BGC182] { + background-color: #D7AFD7 +} + +div.highlight .-Color[class*=-C183] { + color: #D7AFFF +} + +div.highlight .-Color[class*=-BGC183] { + background-color: #D7AFFF +} + +div.highlight .-Color[class*=-C184] { + color: #D7D700 +} + +div.highlight .-Color[class*=-BGC184] { + background-color: #D7D700 +} + +div.highlight .-Color[class*=-C185] { + color: #D7D75F +} + +div.highlight .-Color[class*=-BGC185] { + background-color: #D7D75F +} + +div.highlight .-Color[class*=-C186] { + color: #D7D787 +} + +div.highlight .-Color[class*=-BGC186] { + background-color: #D7D787 +} + +div.highlight .-Color[class*=-C187] { + color: #D7D7AF +} + +div.highlight .-Color[class*=-BGC187] { + background-color: #D7D7AF +} + +div.highlight .-Color[class*=-C188] { + color: #D7D7D7 +} + +div.highlight .-Color[class*=-BGC188] { + background-color: #D7D7D7 +} + +div.highlight .-Color[class*=-C189] { + color: #D7D7FF +} + +div.highlight .-Color[class*=-BGC189] { + background-color: #D7D7FF +} + +div.highlight .-Color[class*=-C190] { + color: #D7FF00 +} + +div.highlight .-Color[class*=-BGC190] { + background-color: #D7FF00 +} + +div.highlight .-Color[class*=-C191] { + color: #D7FF5F +} + +div.highlight .-Color[class*=-BGC191] { + background-color: #D7FF5F +} + +div.highlight .-Color[class*=-C192] { + color: #D7FF87 +} + +div.highlight .-Color[class*=-BGC192] { + background-color: #D7FF87 +} + +div.highlight .-Color[class*=-C193] { + color: #D7FFAF +} + +div.highlight .-Color[class*=-BGC193] { + background-color: #D7FFAF +} + +div.highlight .-Color[class*=-C194] { + color: #D7FFD7 +} + +div.highlight .-Color[class*=-BGC194] { + background-color: #D7FFD7 +} + +div.highlight .-Color[class*=-C195] { + color: #D7FFFF +} + +div.highlight .-Color[class*=-BGC195] { + background-color: #D7FFFF +} + +div.highlight .-Color[class*=-C196] { + color: #FF0000 +} + +div.highlight .-Color[class*=-BGC196] { + background-color: #FF0000 +} + +div.highlight .-Color[class*=-C197] { + color: #FF005F +} + +div.highlight .-Color[class*=-BGC197] { + background-color: #FF005F +} + +div.highlight .-Color[class*=-C198] { + color: #FF0087 +} + +div.highlight .-Color[class*=-BGC198] { + background-color: #FF0087 +} + +div.highlight .-Color[class*=-C199] { + color: #FF00AF +} + +div.highlight .-Color[class*=-BGC199] { + background-color: #FF00AF +} + +div.highlight .-Color[class*=-C200] { + color: #FF00D7 +} + +div.highlight .-Color[class*=-BGC200] { + background-color: #FF00D7 +} + +div.highlight .-Color[class*=-C201] { + color: #FF00FF +} + +div.highlight .-Color[class*=-BGC201] { + background-color: #FF00FF +} + +div.highlight .-Color[class*=-C202] { + color: #FF5F00 +} + +div.highlight .-Color[class*=-BGC202] { + background-color: #FF5F00 +} + +div.highlight .-Color[class*=-C203] { + color: #FF5F5F +} + +div.highlight .-Color[class*=-BGC203] { + background-color: #FF5F5F +} + +div.highlight .-Color[class*=-C204] { + color: #FF5F87 +} + +div.highlight .-Color[class*=-BGC204] { + background-color: #FF5F87 +} + +div.highlight .-Color[class*=-C205] { + color: #FF5FAF +} + +div.highlight .-Color[class*=-BGC205] { + background-color: #FF5FAF +} + +div.highlight .-Color[class*=-C206] { + color: #FF5FD7 +} + +div.highlight .-Color[class*=-BGC206] { + background-color: #FF5FD7 +} + +div.highlight .-Color[class*=-C207] { + color: #FF5FFF +} + +div.highlight .-Color[class*=-BGC207] { + background-color: #FF5FFF +} + +div.highlight .-Color[class*=-C208] { + color: #FF8700 +} + +div.highlight .-Color[class*=-BGC208] { + background-color: #FF8700 +} + +div.highlight .-Color[class*=-C209] { + color: #FF875F +} + +div.highlight .-Color[class*=-BGC209] { + background-color: #FF875F +} + +div.highlight .-Color[class*=-C210] { + color: #FF8787 +} + +div.highlight .-Color[class*=-BGC210] { + background-color: #FF8787 +} + +div.highlight .-Color[class*=-C211] { + color: #FF87AF +} + +div.highlight .-Color[class*=-BGC211] { + background-color: #FF87AF +} + +div.highlight .-Color[class*=-C212] { + color: #FF87D7 +} + +div.highlight .-Color[class*=-BGC212] { + background-color: #FF87D7 +} + +div.highlight .-Color[class*=-C213] { + color: #FF87FF +} + +div.highlight .-Color[class*=-BGC213] { + background-color: #FF87FF +} + +div.highlight .-Color[class*=-C214] { + color: #FFAF00 +} + +div.highlight .-Color[class*=-BGC214] { + background-color: #FFAF00 +} + +div.highlight .-Color[class*=-C215] { + color: #FFAF5F +} + +div.highlight .-Color[class*=-BGC215] { + background-color: #FFAF5F +} + +div.highlight .-Color[class*=-C216] { + color: #FFAF87 +} + +div.highlight .-Color[class*=-BGC216] { + background-color: #FFAF87 +} + +div.highlight .-Color[class*=-C217] { + color: #FFAFAF +} + +div.highlight .-Color[class*=-BGC217] { + background-color: #FFAFAF +} + +div.highlight .-Color[class*=-C218] { + color: #FFAFD7 +} + +div.highlight .-Color[class*=-BGC218] { + background-color: #FFAFD7 +} + +div.highlight .-Color[class*=-C219] { + color: #FFAFFF +} + +div.highlight .-Color[class*=-BGC219] { + background-color: #FFAFFF +} + +div.highlight .-Color[class*=-C220] { + color: #FFD700 +} + +div.highlight .-Color[class*=-BGC220] { + background-color: #FFD700 +} + +div.highlight .-Color[class*=-C221] { + color: #FFD75F +} + +div.highlight .-Color[class*=-BGC221] { + background-color: #FFD75F +} + +div.highlight .-Color[class*=-C222] { + color: #FFD787 +} + +div.highlight .-Color[class*=-BGC222] { + background-color: #FFD787 +} + +div.highlight .-Color[class*=-C223] { + color: #FFD7AF +} + +div.highlight .-Color[class*=-BGC223] { + background-color: #FFD7AF +} + +div.highlight .-Color[class*=-C224] { + color: #FFD7D7 +} + +div.highlight .-Color[class*=-BGC224] { + background-color: #FFD7D7 +} + +div.highlight .-Color[class*=-C225] { + color: #FFD7FF +} + +div.highlight .-Color[class*=-BGC225] { + background-color: #FFD7FF +} + +div.highlight .-Color[class*=-C226] { + color: #FFFF00 +} + +div.highlight .-Color[class*=-BGC226] { + background-color: #FFFF00 +} + +div.highlight .-Color[class*=-C227] { + color: #FFFF5F +} + +div.highlight .-Color[class*=-BGC227] { + background-color: #FFFF5F +} + +div.highlight .-Color[class*=-C228] { + color: #FFFF87 +} + +div.highlight .-Color[class*=-BGC228] { + background-color: #FFFF87 +} + +div.highlight .-Color[class*=-C229] { + color: #FFFFAF +} + +div.highlight .-Color[class*=-BGC229] { + background-color: #FFFFAF +} + +div.highlight .-Color[class*=-C230] { + color: #FFFFD7 +} + +div.highlight .-Color[class*=-BGC230] { + background-color: #FFFFD7 +} + +div.highlight .-Color[class*=-C231] { + color: #FFFFFF +} + +div.highlight .-Color[class*=-BGC231] { + background-color: #FFFFFF +} + +div.highlight .-Color[class*=-C232] { + color: #080808 +} + +div.highlight .-Color[class*=-BGC232] { + background-color: #080808 +} + +div.highlight .-Color[class*=-C233] { + color: #121212 +} + +div.highlight .-Color[class*=-BGC233] { + background-color: #121212 +} + +div.highlight .-Color[class*=-C234] { + color: #1C1C1C +} + +div.highlight .-Color[class*=-BGC234] { + background-color: #1C1C1C +} + +div.highlight .-Color[class*=-C235] { + color: #262626 +} + +div.highlight .-Color[class*=-BGC235] { + background-color: #262626 +} + +div.highlight .-Color[class*=-C236] { + color: #303030 +} + +div.highlight .-Color[class*=-BGC236] { + background-color: #303030 +} + +div.highlight .-Color[class*=-C237] { + color: #3A3A3A +} + +div.highlight .-Color[class*=-BGC237] { + background-color: #3A3A3A +} + +div.highlight .-Color[class*=-C238] { + color: #444444 +} + +div.highlight .-Color[class*=-BGC238] { + background-color: #444444 +} + +div.highlight .-Color[class*=-C239] { + color: #4E4E4E +} + +div.highlight .-Color[class*=-BGC239] { + background-color: #4E4E4E +} + +div.highlight .-Color[class*=-C240] { + color: #585858 +} + +div.highlight .-Color[class*=-BGC240] { + background-color: #585858 +} + +div.highlight .-Color[class*=-C241] { + color: #626262 +} + +div.highlight .-Color[class*=-BGC241] { + background-color: #626262 +} + +div.highlight .-Color[class*=-C242] { + color: #6C6C6C +} + +div.highlight .-Color[class*=-BGC242] { + background-color: #6C6C6C +} + +div.highlight .-Color[class*=-C243] { + color: #767676 +} + +div.highlight .-Color[class*=-BGC243] { + background-color: #767676 +} + +div.highlight .-Color[class*=-C244] { + color: #808080 +} + +div.highlight .-Color[class*=-BGC244] { + background-color: #808080 +} + +div.highlight .-Color[class*=-C245] { + color: #8A8A8A +} + +div.highlight .-Color[class*=-BGC245] { + background-color: #8A8A8A +} + +div.highlight .-Color[class*=-C246] { + color: #949494 +} + +div.highlight .-Color[class*=-BGC246] { + background-color: #949494 +} + +div.highlight .-Color[class*=-C247] { + color: #9E9E9E +} + +div.highlight .-Color[class*=-BGC247] { + background-color: #9E9E9E +} + +div.highlight .-Color[class*=-C248] { + color: #A8A8A8 +} + +div.highlight .-Color[class*=-BGC248] { + background-color: #A8A8A8 +} + +div.highlight .-Color[class*=-C249] { + color: #B2B2B2 +} + +div.highlight .-Color[class*=-BGC249] { + background-color: #B2B2B2 +} + +div.highlight .-Color[class*=-C250] { + color: #BCBCBC +} + +div.highlight .-Color[class*=-BGC250] { + background-color: #BCBCBC +} + +div.highlight .-Color[class*=-C251] { + color: #C6C6C6 +} + +div.highlight .-Color[class*=-BGC251] { + background-color: #C6C6C6 +} + +div.highlight .-Color[class*=-C252] { + color: #D0D0D0 +} + +div.highlight .-Color[class*=-BGC252] { + background-color: #D0D0D0 +} + +div.highlight .-Color[class*=-C253] { + color: #DADADA +} + +div.highlight .-Color[class*=-BGC253] { + background-color: #DADADA +} + +div.highlight .-Color[class*=-C254] { + color: #E4E4E4 +} + +div.highlight .-Color[class*=-BGC254] { + background-color: #E4E4E4 +} + +div.highlight .-Color[class*=-C255] { + color: #EEEEEE +} + +div.highlight .-Color[class*=-BGC255] { + background-color: #EEEEEE +} diff --git a/msspecbook/_build/html/_static/play-solid.svg b/msspecbook/_build/html/_static/play-solid.svg new file mode 100644 index 0000000..bcd81f7 --- /dev/null +++ b/msspecbook/_build/html/_static/play-solid.svg @@ -0,0 +1 @@ + \ No newline at end of file diff --git a/msspecbook/_build/html/_static/plus.png b/msspecbook/_build/html/_static/plus.png new file mode 100644 index 0000000..7107cec Binary files /dev/null and b/msspecbook/_build/html/_static/plus.png differ diff --git a/msspecbook/_build/html/_static/pygments.css b/msspecbook/_build/html/_static/pygments.css new file mode 100644 index 0000000..d7dd577 --- /dev/null +++ b/msspecbook/_build/html/_static/pygments.css @@ -0,0 +1,152 @@ +html[data-theme="light"] .highlight pre { line-height: 125%; } +html[data-theme="light"] .highlight td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="light"] .highlight .hll { background-color: #fae4c2 } +html[data-theme="light"] .highlight { background: #fefefe; color: #080808 } +html[data-theme="light"] .highlight .c { color: #515151 } /* Comment */ +html[data-theme="light"] .highlight .err { color: #A12236 } /* Error */ +html[data-theme="light"] .highlight .k { color: #6730C5 } /* Keyword */ +html[data-theme="light"] .highlight .l { color: #7F4707 } /* Literal */ +html[data-theme="light"] .highlight .n { color: #080808 } /* Name */ +html[data-theme="light"] .highlight .o { color: #00622F } /* Operator */ +html[data-theme="light"] .highlight .p { color: #080808 } /* Punctuation */ +html[data-theme="light"] .highlight .ch { color: #515151 } /* Comment.Hashbang */ +html[data-theme="light"] .highlight .cm { color: #515151 } /* Comment.Multiline */ +html[data-theme="light"] .highlight .cp { color: #515151 } /* Comment.Preproc */ +html[data-theme="light"] .highlight .cpf { color: #515151 } /* Comment.PreprocFile */ +html[data-theme="light"] .highlight .c1 { color: #515151 } /* Comment.Single */ +html[data-theme="light"] .highlight .cs { color: #515151 } /* Comment.Special */ +html[data-theme="light"] .highlight .gd { color: #005B82 } /* Generic.Deleted */ +html[data-theme="light"] .highlight .ge { font-style: italic } /* Generic.Emph */ +html[data-theme="light"] .highlight .gh { color: #005B82 } /* Generic.Heading */ +html[data-theme="light"] .highlight .gs { font-weight: bold } /* Generic.Strong */ +html[data-theme="light"] .highlight .gu { color: #005B82 } /* Generic.Subheading */ +html[data-theme="light"] .highlight .kc { color: #6730C5 } /* Keyword.Constant */ +html[data-theme="light"] .highlight .kd { color: #6730C5 } /* Keyword.Declaration */ +html[data-theme="light"] .highlight .kn { color: #6730C5 } /* Keyword.Namespace */ +html[data-theme="light"] .highlight .kp { color: #6730C5 } /* Keyword.Pseudo */ +html[data-theme="light"] .highlight .kr { color: #6730C5 } /* Keyword.Reserved */ +html[data-theme="light"] .highlight .kt { color: #7F4707 } /* Keyword.Type */ +html[data-theme="light"] .highlight .ld { color: #7F4707 } /* Literal.Date */ +html[data-theme="light"] .highlight .m { color: #7F4707 } /* Literal.Number */ +html[data-theme="light"] .highlight .s { color: #00622F } /* Literal.String */ +html[data-theme="light"] .highlight .na { color: #912583 } /* Name.Attribute */ +html[data-theme="light"] .highlight .nb { color: #7F4707 } /* Name.Builtin */ +html[data-theme="light"] .highlight .nc { color: #005B82 } /* Name.Class */ +html[data-theme="light"] .highlight .no { color: #005B82 } /* Name.Constant */ +html[data-theme="light"] .highlight .nd { color: #7F4707 } /* Name.Decorator */ +html[data-theme="light"] .highlight .ni { color: #00622F } /* Name.Entity */ +html[data-theme="light"] .highlight .ne { color: #6730C5 } /* Name.Exception */ +html[data-theme="light"] .highlight .nf { color: #005B82 } /* Name.Function */ +html[data-theme="light"] .highlight .nl { color: #7F4707 } /* Name.Label */ +html[data-theme="light"] .highlight .nn { color: #080808 } /* Name.Namespace */ +html[data-theme="light"] .highlight .nx { color: #080808 } /* Name.Other */ +html[data-theme="light"] .highlight .py { color: #005B82 } /* Name.Property */ +html[data-theme="light"] .highlight .nt { color: #005B82 } /* Name.Tag */ +html[data-theme="light"] .highlight .nv { color: #A12236 } /* Name.Variable */ +html[data-theme="light"] .highlight .ow { color: #6730C5 } /* Operator.Word */ +html[data-theme="light"] .highlight .pm { color: #080808 } /* Punctuation.Marker */ +html[data-theme="light"] .highlight .w { color: #080808 } /* Text.Whitespace */ +html[data-theme="light"] .highlight .mb { color: #7F4707 } /* Literal.Number.Bin */ +html[data-theme="light"] .highlight .mf { color: #7F4707 } /* Literal.Number.Float */ +html[data-theme="light"] .highlight .mh { color: #7F4707 } /* Literal.Number.Hex */ +html[data-theme="light"] .highlight .mi { color: #7F4707 } /* Literal.Number.Integer */ +html[data-theme="light"] .highlight .mo { color: #7F4707 } /* Literal.Number.Oct */ +html[data-theme="light"] .highlight .sa { color: #00622F } /* Literal.String.Affix */ +html[data-theme="light"] .highlight .sb { color: #00622F } /* Literal.String.Backtick */ +html[data-theme="light"] .highlight .sc { color: #00622F } /* Literal.String.Char */ +html[data-theme="light"] .highlight .dl { color: #00622F } /* Literal.String.Delimiter */ +html[data-theme="light"] .highlight .sd { color: #00622F } /* Literal.String.Doc */ +html[data-theme="light"] .highlight .s2 { color: #00622F } /* Literal.String.Double */ +html[data-theme="light"] .highlight .se { color: #00622F } /* Literal.String.Escape */ +html[data-theme="light"] .highlight .sh { color: #00622F } /* Literal.String.Heredoc */ +html[data-theme="light"] .highlight .si { color: #00622F } /* Literal.String.Interpol */ +html[data-theme="light"] .highlight .sx { color: #00622F } /* Literal.String.Other */ +html[data-theme="light"] .highlight .sr { color: #A12236 } /* Literal.String.Regex */ +html[data-theme="light"] .highlight .s1 { color: #00622F } /* Literal.String.Single */ +html[data-theme="light"] .highlight .ss { color: #005B82 } /* Literal.String.Symbol */ +html[data-theme="light"] .highlight .bp { color: #7F4707 } /* Name.Builtin.Pseudo */ +html[data-theme="light"] .highlight .fm { color: #005B82 } /* Name.Function.Magic */ +html[data-theme="light"] .highlight .vc { color: #A12236 } /* Name.Variable.Class */ +html[data-theme="light"] .highlight .vg { color: #A12236 } /* Name.Variable.Global */ +html[data-theme="light"] .highlight .vi { color: #A12236 } /* Name.Variable.Instance */ +html[data-theme="light"] .highlight .vm { color: #7F4707 } /* Name.Variable.Magic */ +html[data-theme="light"] .highlight .il { color: #7F4707 } /* Literal.Number.Integer.Long */ +html[data-theme="dark"] .highlight pre { line-height: 125%; } +html[data-theme="dark"] .highlight td.linenos .normal { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight span.linenos { color: inherit; background-color: transparent; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight td.linenos .special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; } +html[data-theme="dark"] .highlight .hll { background-color: #ffd9002e } +html[data-theme="dark"] .highlight { background: #2b2b2b; color: #F8F8F2 } +html[data-theme="dark"] .highlight .c { color: #FFD900 } /* Comment */ +html[data-theme="dark"] .highlight .err { color: #FFA07A } /* Error */ +html[data-theme="dark"] .highlight .k { color: #DCC6E0 } /* Keyword */ +html[data-theme="dark"] .highlight .l { color: #FFD900 } /* Literal */ +html[data-theme="dark"] .highlight .n { color: #F8F8F2 } /* Name */ +html[data-theme="dark"] .highlight .o { color: #ABE338 } /* Operator */ +html[data-theme="dark"] .highlight .p { color: #F8F8F2 } /* Punctuation */ +html[data-theme="dark"] .highlight .ch { color: #FFD900 } /* Comment.Hashbang */ +html[data-theme="dark"] .highlight .cm { color: #FFD900 } /* Comment.Multiline */ +html[data-theme="dark"] .highlight .cp { color: #FFD900 } /* Comment.Preproc */ +html[data-theme="dark"] .highlight .cpf { color: #FFD900 } /* Comment.PreprocFile */ +html[data-theme="dark"] .highlight .c1 { color: #FFD900 } /* Comment.Single */ +html[data-theme="dark"] .highlight .cs { color: #FFD900 } /* Comment.Special */ +html[data-theme="dark"] .highlight .gd { color: #00E0E0 } /* Generic.Deleted */ +html[data-theme="dark"] .highlight .ge { font-style: italic } /* Generic.Emph */ +html[data-theme="dark"] .highlight .gh { color: #00E0E0 } /* Generic.Heading */ +html[data-theme="dark"] .highlight .gs { font-weight: bold } /* Generic.Strong */ +html[data-theme="dark"] .highlight .gu { color: #00E0E0 } /* Generic.Subheading */ +html[data-theme="dark"] .highlight .kc { color: #DCC6E0 } /* Keyword.Constant */ +html[data-theme="dark"] .highlight .kd { color: #DCC6E0 } /* Keyword.Declaration */ +html[data-theme="dark"] .highlight .kn { color: #DCC6E0 } /* Keyword.Namespace */ +html[data-theme="dark"] .highlight .kp { color: #DCC6E0 } /* Keyword.Pseudo */ +html[data-theme="dark"] .highlight .kr { color: #DCC6E0 } /* Keyword.Reserved */ +html[data-theme="dark"] .highlight .kt { color: #FFD900 } /* Keyword.Type */ +html[data-theme="dark"] .highlight .ld { color: #FFD900 } /* Literal.Date */ +html[data-theme="dark"] .highlight .m { color: #FFD900 } /* Literal.Number */ +html[data-theme="dark"] .highlight .s { color: #ABE338 } /* Literal.String */ +html[data-theme="dark"] .highlight .na { color: #FFD900 } /* Name.Attribute */ +html[data-theme="dark"] .highlight .nb { color: #FFD900 } /* Name.Builtin */ +html[data-theme="dark"] .highlight .nc { color: #00E0E0 } /* Name.Class */ +html[data-theme="dark"] .highlight .no { color: #00E0E0 } /* Name.Constant */ +html[data-theme="dark"] .highlight .nd { color: #FFD900 } /* Name.Decorator */ +html[data-theme="dark"] .highlight .ni { color: #ABE338 } /* Name.Entity */ +html[data-theme="dark"] .highlight .ne { color: #DCC6E0 } /* Name.Exception */ +html[data-theme="dark"] .highlight .nf { color: #00E0E0 } /* Name.Function */ +html[data-theme="dark"] .highlight .nl { color: #FFD900 } /* Name.Label */ +html[data-theme="dark"] .highlight .nn { color: #F8F8F2 } /* Name.Namespace */ +html[data-theme="dark"] .highlight .nx { color: #F8F8F2 } /* Name.Other */ +html[data-theme="dark"] .highlight .py { color: #00E0E0 } /* Name.Property */ +html[data-theme="dark"] .highlight .nt { color: #00E0E0 } /* Name.Tag */ +html[data-theme="dark"] .highlight .nv { color: #FFA07A } /* Name.Variable */ +html[data-theme="dark"] .highlight .ow { color: #DCC6E0 } /* Operator.Word */ +html[data-theme="dark"] .highlight .pm { color: #F8F8F2 } /* Punctuation.Marker */ +html[data-theme="dark"] .highlight .w { color: #F8F8F2 } /* Text.Whitespace */ +html[data-theme="dark"] .highlight .mb { color: #FFD900 } /* Literal.Number.Bin */ +html[data-theme="dark"] .highlight .mf { color: #FFD900 } /* Literal.Number.Float */ +html[data-theme="dark"] .highlight .mh { color: #FFD900 } /* Literal.Number.Hex */ +html[data-theme="dark"] .highlight .mi { color: #FFD900 } /* Literal.Number.Integer */ +html[data-theme="dark"] .highlight .mo { color: #FFD900 } /* Literal.Number.Oct */ +html[data-theme="dark"] .highlight .sa { color: #ABE338 } /* Literal.String.Affix */ +html[data-theme="dark"] .highlight .sb { color: #ABE338 } /* Literal.String.Backtick */ +html[data-theme="dark"] .highlight .sc { color: #ABE338 } /* Literal.String.Char */ +html[data-theme="dark"] .highlight .dl { color: #ABE338 } /* Literal.String.Delimiter */ +html[data-theme="dark"] .highlight .sd { color: #ABE338 } /* Literal.String.Doc */ +html[data-theme="dark"] .highlight .s2 { color: #ABE338 } /* Literal.String.Double */ +html[data-theme="dark"] .highlight .se { color: #ABE338 } /* Literal.String.Escape */ +html[data-theme="dark"] .highlight .sh { color: #ABE338 } /* Literal.String.Heredoc */ +html[data-theme="dark"] .highlight .si { color: #ABE338 } /* Literal.String.Interpol */ +html[data-theme="dark"] .highlight .sx { color: #ABE338 } /* Literal.String.Other */ +html[data-theme="dark"] .highlight .sr { color: #FFA07A } /* Literal.String.Regex */ +html[data-theme="dark"] .highlight .s1 { color: #ABE338 } /* Literal.String.Single */ +html[data-theme="dark"] .highlight .ss { color: #00E0E0 } /* Literal.String.Symbol */ +html[data-theme="dark"] .highlight .bp { color: #FFD900 } /* Name.Builtin.Pseudo */ +html[data-theme="dark"] .highlight .fm { color: #00E0E0 } /* Name.Function.Magic */ +html[data-theme="dark"] .highlight .vc { color: #FFA07A } /* Name.Variable.Class */ +html[data-theme="dark"] .highlight .vg { color: #FFA07A } /* Name.Variable.Global */ +html[data-theme="dark"] .highlight .vi { color: #FFA07A } /* Name.Variable.Instance */ +html[data-theme="dark"] .highlight .vm { color: #FFD900 } /* Name.Variable.Magic */ +html[data-theme="dark"] .highlight .il { color: #FFD900 } /* Literal.Number.Integer.Long */ \ No newline at end of file diff --git a/msspecbook/_build/html/_static/sbt-webpack-macros.html b/msspecbook/_build/html/_static/sbt-webpack-macros.html new file mode 100644 index 0000000..6cbf559 --- /dev/null +++ b/msspecbook/_build/html/_static/sbt-webpack-macros.html @@ -0,0 +1,11 @@ + +{% macro head_pre_bootstrap() %} + +{% endmacro %} + +{% macro body_post() %} + +{% endmacro %} diff --git a/msspecbook/_build/html/_static/scripts/bootstrap.js b/msspecbook/_build/html/_static/scripts/bootstrap.js new file mode 100644 index 0000000..c8178de --- /dev/null +++ b/msspecbook/_build/html/_static/scripts/bootstrap.js @@ -0,0 +1,3 @@ +/*! For license information please see bootstrap.js.LICENSE.txt */ +(()=>{"use strict";var t={d:(e,i)=>{for(var n in i)t.o(i,n)&&!t.o(e,n)&&Object.defineProperty(e,n,{enumerable:!0,get:i[n]})},o:(t,e)=>Object.prototype.hasOwnProperty.call(t,e),r:t=>{"undefined"!=typeof Symbol&&Symbol.toStringTag&&Object.defineProperty(t,Symbol.toStringTag,{value:"Module"}),Object.defineProperty(t,"__esModule",{value:!0})}},e={};t.r(e),t.d(e,{afterMain:()=>E,afterRead:()=>v,afterWrite:()=>C,applyStyles:()=>$,arrow:()=>J,auto:()=>a,basePlacements:()=>l,beforeMain:()=>y,beforeRead:()=>_,beforeWrite:()=>A,bottom:()=>s,clippingParents:()=>d,computeStyles:()=>it,createPopper:()=>Dt,createPopperBase:()=>St,createPopperLite:()=>$t,detectOverflow:()=>_t,end:()=>h,eventListeners:()=>st,flip:()=>bt,hide:()=>wt,left:()=>r,main:()=>w,modifierPhases:()=>O,offset:()=>Et,placements:()=>g,popper:()=>f,popperGenerator:()=>Lt,popperOffsets:()=>At,preventOverflow:()=>Tt,read:()=>b,reference:()=>p,right:()=>o,start:()=>c,top:()=>n,variationPlacements:()=>m,viewport:()=>u,write:()=>T});var i={};t.r(i),t.d(i,{Alert:()=>Oe,Button:()=>ke,Carousel:()=>li,Collapse:()=>Ei,Dropdown:()=>Ki,Modal:()=>Ln,Offcanvas:()=>Kn,Popover:()=>bs,ScrollSpy:()=>Ls,Tab:()=>Js,Toast:()=>po,Tooltip:()=>fs});var n="top",s="bottom",o="right",r="left",a="auto",l=[n,s,o,r],c="start",h="end",d="clippingParents",u="viewport",f="popper",p="reference",m=l.reduce((function(t,e){return t.concat([e+"-"+c,e+"-"+h])}),[]),g=[].concat(l,[a]).reduce((function(t,e){return t.concat([e,e+"-"+c,e+"-"+h])}),[]),_="beforeRead",b="read",v="afterRead",y="beforeMain",w="main",E="afterMain",A="beforeWrite",T="write",C="afterWrite",O=[_,b,v,y,w,E,A,T,C];function x(t){return t?(t.nodeName||"").toLowerCase():null}function k(t){if(null==t)return window;if("[object Window]"!==t.toString()){var e=t.ownerDocument;return e&&e.defaultView||window}return t}function L(t){return t instanceof k(t).Element||t instanceof Element}function S(t){return t instanceof k(t).HTMLElement||t instanceof HTMLElement}function D(t){return"undefined"!=typeof ShadowRoot&&(t instanceof k(t).ShadowRoot||t instanceof ShadowRoot)}const $={name:"applyStyles",enabled:!0,phase:"write",fn:function(t){var e=t.state;Object.keys(e.elements).forEach((function(t){var i=e.styles[t]||{},n=e.attributes[t]||{},s=e.elements[t];S(s)&&x(s)&&(Object.assign(s.style,i),Object.keys(n).forEach((function(t){var e=n[t];!1===e?s.removeAttribute(t):s.setAttribute(t,!0===e?"":e)})))}))},effect:function(t){var e=t.state,i={popper:{position:e.options.strategy,left:"0",top:"0",margin:"0"},arrow:{position:"absolute"},reference:{}};return Object.assign(e.elements.popper.style,i.popper),e.styles=i,e.elements.arrow&&Object.assign(e.elements.arrow.style,i.arrow),function(){Object.keys(e.elements).forEach((function(t){var n=e.elements[t],s=e.attributes[t]||{},o=Object.keys(e.styles.hasOwnProperty(t)?e.styles[t]:i[t]).reduce((function(t,e){return t[e]="",t}),{});S(n)&&x(n)&&(Object.assign(n.style,o),Object.keys(s).forEach((function(t){n.removeAttribute(t)})))}))}},requires:["computeStyles"]};function I(t){return t.split("-")[0]}var N=Math.max,P=Math.min,M=Math.round;function j(){var t=navigator.userAgentData;return null!=t&&t.brands&&Array.isArray(t.brands)?t.brands.map((function(t){return t.brand+"/"+t.version})).join(" "):navigator.userAgent}function F(){return!/^((?!chrome|android).)*safari/i.test(j())}function H(t,e,i){void 0===e&&(e=!1),void 0===i&&(i=!1);var n=t.getBoundingClientRect(),s=1,o=1;e&&S(t)&&(s=t.offsetWidth>0&&M(n.width)/t.offsetWidth||1,o=t.offsetHeight>0&&M(n.height)/t.offsetHeight||1);var r=(L(t)?k(t):window).visualViewport,a=!F()&&i,l=(n.left+(a&&r?r.offsetLeft:0))/s,c=(n.top+(a&&r?r.offsetTop:0))/o,h=n.width/s,d=n.height/o;return{width:h,height:d,top:c,right:l+h,bottom:c+d,left:l,x:l,y:c}}function B(t){var e=H(t),i=t.offsetWidth,n=t.offsetHeight;return Math.abs(e.width-i)<=1&&(i=e.width),Math.abs(e.height-n)<=1&&(n=e.height),{x:t.offsetLeft,y:t.offsetTop,width:i,height:n}}function W(t,e){var i=e.getRootNode&&e.getRootNode();if(t.contains(e))return!0;if(i&&D(i)){var n=e;do{if(n&&t.isSameNode(n))return!0;n=n.parentNode||n.host}while(n)}return!1}function z(t){return k(t).getComputedStyle(t)}function R(t){return["table","td","th"].indexOf(x(t))>=0}function q(t){return((L(t)?t.ownerDocument:t.document)||window.document).documentElement}function V(t){return"html"===x(t)?t:t.assignedSlot||t.parentNode||(D(t)?t.host:null)||q(t)}function Y(t){return S(t)&&"fixed"!==z(t).position?t.offsetParent:null}function K(t){for(var e=k(t),i=Y(t);i&&R(i)&&"static"===z(i).position;)i=Y(i);return i&&("html"===x(i)||"body"===x(i)&&"static"===z(i).position)?e:i||function(t){var e=/firefox/i.test(j());if(/Trident/i.test(j())&&S(t)&&"fixed"===z(t).position)return null;var i=V(t);for(D(i)&&(i=i.host);S(i)&&["html","body"].indexOf(x(i))<0;){var n=z(i);if("none"!==n.transform||"none"!==n.perspective||"paint"===n.contain||-1!==["transform","perspective"].indexOf(n.willChange)||e&&"filter"===n.willChange||e&&n.filter&&"none"!==n.filter)return i;i=i.parentNode}return null}(t)||e}function Q(t){return["top","bottom"].indexOf(t)>=0?"x":"y"}function X(t,e,i){return N(t,P(e,i))}function U(t){return Object.assign({},{top:0,right:0,bottom:0,left:0},t)}function G(t,e){return e.reduce((function(e,i){return e[i]=t,e}),{})}const J={name:"arrow",enabled:!0,phase:"main",fn:function(t){var e,i=t.state,a=t.name,c=t.options,h=i.elements.arrow,d=i.modifiersData.popperOffsets,u=I(i.placement),f=Q(u),p=[r,o].indexOf(u)>=0?"height":"width";if(h&&d){var m=function(t,e){return U("number"!=typeof(t="function"==typeof t?t(Object.assign({},e.rects,{placement:e.placement})):t)?t:G(t,l))}(c.padding,i),g=B(h),_="y"===f?n:r,b="y"===f?s:o,v=i.rects.reference[p]+i.rects.reference[f]-d[f]-i.rects.popper[p],y=d[f]-i.rects.reference[f],w=K(h),E=w?"y"===f?w.clientHeight||0:w.clientWidth||0:0,A=v/2-y/2,T=m[_],C=E-g[p]-m[b],O=E/2-g[p]/2+A,x=X(T,O,C),k=f;i.modifiersData[a]=((e={})[k]=x,e.centerOffset=x-O,e)}},effect:function(t){var e=t.state,i=t.options.element,n=void 0===i?"[data-popper-arrow]":i;null!=n&&("string"!=typeof n||(n=e.elements.popper.querySelector(n)))&&W(e.elements.popper,n)&&(e.elements.arrow=n)},requires:["popperOffsets"],requiresIfExists:["preventOverflow"]};function Z(t){return t.split("-")[1]}var tt={top:"auto",right:"auto",bottom:"auto",left:"auto"};function et(t){var e,i=t.popper,a=t.popperRect,l=t.placement,c=t.variation,d=t.offsets,u=t.position,f=t.gpuAcceleration,p=t.adaptive,m=t.roundOffsets,g=t.isFixed,_=d.x,b=void 0===_?0:_,v=d.y,y=void 0===v?0:v,w="function"==typeof m?m({x:b,y}):{x:b,y};b=w.x,y=w.y;var E=d.hasOwnProperty("x"),A=d.hasOwnProperty("y"),T=r,C=n,O=window;if(p){var x=K(i),L="clientHeight",S="clientWidth";x===k(i)&&"static"!==z(x=q(i)).position&&"absolute"===u&&(L="scrollHeight",S="scrollWidth"),(l===n||(l===r||l===o)&&c===h)&&(C=s,y-=(g&&x===O&&O.visualViewport?O.visualViewport.height:x[L])-a.height,y*=f?1:-1),l!==r&&(l!==n&&l!==s||c!==h)||(T=o,b-=(g&&x===O&&O.visualViewport?O.visualViewport.width:x[S])-a.width,b*=f?1:-1)}var D,$=Object.assign({position:u},p&&tt),I=!0===m?function(t,e){var i=t.x,n=t.y,s=e.devicePixelRatio||1;return{x:M(i*s)/s||0,y:M(n*s)/s||0}}({x:b,y},k(i)):{x:b,y};return b=I.x,y=I.y,f?Object.assign({},$,((D={})[C]=A?"0":"",D[T]=E?"0":"",D.transform=(O.devicePixelRatio||1)<=1?"translate("+b+"px, "+y+"px)":"translate3d("+b+"px, "+y+"px, 0)",D)):Object.assign({},$,((e={})[C]=A?y+"px":"",e[T]=E?b+"px":"",e.transform="",e))}const it={name:"computeStyles",enabled:!0,phase:"beforeWrite",fn:function(t){var e=t.state,i=t.options,n=i.gpuAcceleration,s=void 0===n||n,o=i.adaptive,r=void 0===o||o,a=i.roundOffsets,l=void 0===a||a,c={placement:I(e.placement),variation:Z(e.placement),popper:e.elements.popper,popperRect:e.rects.popper,gpuAcceleration:s,isFixed:"fixed"===e.options.strategy};null!=e.modifiersData.popperOffsets&&(e.styles.popper=Object.assign({},e.styles.popper,et(Object.assign({},c,{offsets:e.modifiersData.popperOffsets,position:e.options.strategy,adaptive:r,roundOffsets:l})))),null!=e.modifiersData.arrow&&(e.styles.arrow=Object.assign({},e.styles.arrow,et(Object.assign({},c,{offsets:e.modifiersData.arrow,position:"absolute",adaptive:!1,roundOffsets:l})))),e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-placement":e.placement})},data:{}};var nt={passive:!0};const st={name:"eventListeners",enabled:!0,phase:"write",fn:function(){},effect:function(t){var e=t.state,i=t.instance,n=t.options,s=n.scroll,o=void 0===s||s,r=n.resize,a=void 0===r||r,l=k(e.elements.popper),c=[].concat(e.scrollParents.reference,e.scrollParents.popper);return o&&c.forEach((function(t){t.addEventListener("scroll",i.update,nt)})),a&&l.addEventListener("resize",i.update,nt),function(){o&&c.forEach((function(t){t.removeEventListener("scroll",i.update,nt)})),a&&l.removeEventListener("resize",i.update,nt)}},data:{}};var ot={left:"right",right:"left",bottom:"top",top:"bottom"};function rt(t){return t.replace(/left|right|bottom|top/g,(function(t){return ot[t]}))}var at={start:"end",end:"start"};function lt(t){return t.replace(/start|end/g,(function(t){return at[t]}))}function ct(t){var e=k(t);return{scrollLeft:e.pageXOffset,scrollTop:e.pageYOffset}}function ht(t){return H(q(t)).left+ct(t).scrollLeft}function dt(t){var e=z(t),i=e.overflow,n=e.overflowX,s=e.overflowY;return/auto|scroll|overlay|hidden/.test(i+s+n)}function ut(t){return["html","body","#document"].indexOf(x(t))>=0?t.ownerDocument.body:S(t)&&dt(t)?t:ut(V(t))}function ft(t,e){var i;void 0===e&&(e=[]);var n=ut(t),s=n===(null==(i=t.ownerDocument)?void 0:i.body),o=k(n),r=s?[o].concat(o.visualViewport||[],dt(n)?n:[]):n,a=e.concat(r);return s?a:a.concat(ft(V(r)))}function pt(t){return Object.assign({},t,{left:t.x,top:t.y,right:t.x+t.width,bottom:t.y+t.height})}function mt(t,e,i){return e===u?pt(function(t,e){var i=k(t),n=q(t),s=i.visualViewport,o=n.clientWidth,r=n.clientHeight,a=0,l=0;if(s){o=s.width,r=s.height;var c=F();(c||!c&&"fixed"===e)&&(a=s.offsetLeft,l=s.offsetTop)}return{width:o,height:r,x:a+ht(t),y:l}}(t,i)):L(e)?function(t,e){var i=H(t,!1,"fixed"===e);return i.top=i.top+t.clientTop,i.left=i.left+t.clientLeft,i.bottom=i.top+t.clientHeight,i.right=i.left+t.clientWidth,i.width=t.clientWidth,i.height=t.clientHeight,i.x=i.left,i.y=i.top,i}(e,i):pt(function(t){var e,i=q(t),n=ct(t),s=null==(e=t.ownerDocument)?void 0:e.body,o=N(i.scrollWidth,i.clientWidth,s?s.scrollWidth:0,s?s.clientWidth:0),r=N(i.scrollHeight,i.clientHeight,s?s.scrollHeight:0,s?s.clientHeight:0),a=-n.scrollLeft+ht(t),l=-n.scrollTop;return"rtl"===z(s||i).direction&&(a+=N(i.clientWidth,s?s.clientWidth:0)-o),{width:o,height:r,x:a,y:l}}(q(t)))}function gt(t){var e,i=t.reference,a=t.element,l=t.placement,d=l?I(l):null,u=l?Z(l):null,f=i.x+i.width/2-a.width/2,p=i.y+i.height/2-a.height/2;switch(d){case n:e={x:f,y:i.y-a.height};break;case s:e={x:f,y:i.y+i.height};break;case o:e={x:i.x+i.width,y:p};break;case r:e={x:i.x-a.width,y:p};break;default:e={x:i.x,y:i.y}}var m=d?Q(d):null;if(null!=m){var g="y"===m?"height":"width";switch(u){case c:e[m]=e[m]-(i[g]/2-a[g]/2);break;case h:e[m]=e[m]+(i[g]/2-a[g]/2)}}return e}function _t(t,e){void 0===e&&(e={});var i=e,r=i.placement,a=void 0===r?t.placement:r,c=i.strategy,h=void 0===c?t.strategy:c,m=i.boundary,g=void 0===m?d:m,_=i.rootBoundary,b=void 0===_?u:_,v=i.elementContext,y=void 0===v?f:v,w=i.altBoundary,E=void 0!==w&&w,A=i.padding,T=void 0===A?0:A,C=U("number"!=typeof T?T:G(T,l)),O=y===f?p:f,k=t.rects.popper,D=t.elements[E?O:y],$=function(t,e,i,n){var s="clippingParents"===e?function(t){var e=ft(V(t)),i=["absolute","fixed"].indexOf(z(t).position)>=0&&S(t)?K(t):t;return L(i)?e.filter((function(t){return L(t)&&W(t,i)&&"body"!==x(t)})):[]}(t):[].concat(e),o=[].concat(s,[i]),r=o[0],a=o.reduce((function(e,i){var s=mt(t,i,n);return e.top=N(s.top,e.top),e.right=P(s.right,e.right),e.bottom=P(s.bottom,e.bottom),e.left=N(s.left,e.left),e}),mt(t,r,n));return a.width=a.right-a.left,a.height=a.bottom-a.top,a.x=a.left,a.y=a.top,a}(L(D)?D:D.contextElement||q(t.elements.popper),g,b,h),I=H(t.elements.reference),M=gt({reference:I,element:k,strategy:"absolute",placement:a}),j=pt(Object.assign({},k,M)),F=y===f?j:I,B={top:$.top-F.top+C.top,bottom:F.bottom-$.bottom+C.bottom,left:$.left-F.left+C.left,right:F.right-$.right+C.right},R=t.modifiersData.offset;if(y===f&&R){var Y=R[a];Object.keys(B).forEach((function(t){var e=[o,s].indexOf(t)>=0?1:-1,i=[n,s].indexOf(t)>=0?"y":"x";B[t]+=Y[i]*e}))}return B}const bt={name:"flip",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,h=t.name;if(!e.modifiersData[h]._skip){for(var d=i.mainAxis,u=void 0===d||d,f=i.altAxis,p=void 0===f||f,_=i.fallbackPlacements,b=i.padding,v=i.boundary,y=i.rootBoundary,w=i.altBoundary,E=i.flipVariations,A=void 0===E||E,T=i.allowedAutoPlacements,C=e.options.placement,O=I(C),x=_||(O!==C&&A?function(t){if(I(t)===a)return[];var e=rt(t);return[lt(t),e,lt(e)]}(C):[rt(C)]),k=[C].concat(x).reduce((function(t,i){return t.concat(I(i)===a?function(t,e){void 0===e&&(e={});var i=e,n=i.placement,s=i.boundary,o=i.rootBoundary,r=i.padding,a=i.flipVariations,c=i.allowedAutoPlacements,h=void 0===c?g:c,d=Z(n),u=d?a?m:m.filter((function(t){return Z(t)===d})):l,f=u.filter((function(t){return h.indexOf(t)>=0}));0===f.length&&(f=u);var p=f.reduce((function(e,i){return e[i]=_t(t,{placement:i,boundary:s,rootBoundary:o,padding:r})[I(i)],e}),{});return Object.keys(p).sort((function(t,e){return p[t]-p[e]}))}(e,{placement:i,boundary:v,rootBoundary:y,padding:b,flipVariations:A,allowedAutoPlacements:T}):i)}),[]),L=e.rects.reference,S=e.rects.popper,D=new Map,$=!0,N=k[0],P=0;P=0,B=H?"width":"height",W=_t(e,{placement:M,boundary:v,rootBoundary:y,altBoundary:w,padding:b}),z=H?F?o:r:F?s:n;L[B]>S[B]&&(z=rt(z));var R=rt(z),q=[];if(u&&q.push(W[j]<=0),p&&q.push(W[z]<=0,W[R]<=0),q.every((function(t){return t}))){N=M,$=!1;break}D.set(M,q)}if($)for(var V=function(t){var e=k.find((function(e){var i=D.get(e);if(i)return i.slice(0,t).every((function(t){return t}))}));if(e)return N=e,"break"},Y=A?3:1;Y>0&&"break"!==V(Y);Y--);e.placement!==N&&(e.modifiersData[h]._skip=!0,e.placement=N,e.reset=!0)}},requiresIfExists:["offset"],data:{_skip:!1}};function vt(t,e,i){return void 0===i&&(i={x:0,y:0}),{top:t.top-e.height-i.y,right:t.right-e.width+i.x,bottom:t.bottom-e.height+i.y,left:t.left-e.width-i.x}}function yt(t){return[n,o,s,r].some((function(e){return t[e]>=0}))}const wt={name:"hide",enabled:!0,phase:"main",requiresIfExists:["preventOverflow"],fn:function(t){var e=t.state,i=t.name,n=e.rects.reference,s=e.rects.popper,o=e.modifiersData.preventOverflow,r=_t(e,{elementContext:"reference"}),a=_t(e,{altBoundary:!0}),l=vt(r,n),c=vt(a,s,o),h=yt(l),d=yt(c);e.modifiersData[i]={referenceClippingOffsets:l,popperEscapeOffsets:c,isReferenceHidden:h,hasPopperEscaped:d},e.attributes.popper=Object.assign({},e.attributes.popper,{"data-popper-reference-hidden":h,"data-popper-escaped":d})}},Et={name:"offset",enabled:!0,phase:"main",requires:["popperOffsets"],fn:function(t){var e=t.state,i=t.options,s=t.name,a=i.offset,l=void 0===a?[0,0]:a,c=g.reduce((function(t,i){return t[i]=function(t,e,i){var s=I(t),a=[r,n].indexOf(s)>=0?-1:1,l="function"==typeof i?i(Object.assign({},e,{placement:t})):i,c=l[0],h=l[1];return c=c||0,h=(h||0)*a,[r,o].indexOf(s)>=0?{x:h,y:c}:{x:c,y:h}}(i,e.rects,l),t}),{}),h=c[e.placement],d=h.x,u=h.y;null!=e.modifiersData.popperOffsets&&(e.modifiersData.popperOffsets.x+=d,e.modifiersData.popperOffsets.y+=u),e.modifiersData[s]=c}},At={name:"popperOffsets",enabled:!0,phase:"read",fn:function(t){var e=t.state,i=t.name;e.modifiersData[i]=gt({reference:e.rects.reference,element:e.rects.popper,strategy:"absolute",placement:e.placement})},data:{}},Tt={name:"preventOverflow",enabled:!0,phase:"main",fn:function(t){var e=t.state,i=t.options,a=t.name,l=i.mainAxis,h=void 0===l||l,d=i.altAxis,u=void 0!==d&&d,f=i.boundary,p=i.rootBoundary,m=i.altBoundary,g=i.padding,_=i.tether,b=void 0===_||_,v=i.tetherOffset,y=void 0===v?0:v,w=_t(e,{boundary:f,rootBoundary:p,padding:g,altBoundary:m}),E=I(e.placement),A=Z(e.placement),T=!A,C=Q(E),O="x"===C?"y":"x",x=e.modifiersData.popperOffsets,k=e.rects.reference,L=e.rects.popper,S="function"==typeof y?y(Object.assign({},e.rects,{placement:e.placement})):y,D="number"==typeof S?{mainAxis:S,altAxis:S}:Object.assign({mainAxis:0,altAxis:0},S),$=e.modifiersData.offset?e.modifiersData.offset[e.placement]:null,M={x:0,y:0};if(x){if(h){var j,F="y"===C?n:r,H="y"===C?s:o,W="y"===C?"height":"width",z=x[C],R=z+w[F],q=z-w[H],V=b?-L[W]/2:0,Y=A===c?k[W]:L[W],U=A===c?-L[W]:-k[W],G=e.elements.arrow,J=b&&G?B(G):{width:0,height:0},tt=e.modifiersData["arrow#persistent"]?e.modifiersData["arrow#persistent"].padding:{top:0,right:0,bottom:0,left:0},et=tt[F],it=tt[H],nt=X(0,k[W],J[W]),st=T?k[W]/2-V-nt-et-D.mainAxis:Y-nt-et-D.mainAxis,ot=T?-k[W]/2+V+nt+it+D.mainAxis:U+nt+it+D.mainAxis,rt=e.elements.arrow&&K(e.elements.arrow),at=rt?"y"===C?rt.clientTop||0:rt.clientLeft||0:0,lt=null!=(j=null==$?void 0:$[C])?j:0,ct=z+ot-lt,ht=X(b?P(R,z+st-lt-at):R,z,b?N(q,ct):q);x[C]=ht,M[C]=ht-z}if(u){var dt,ut="x"===C?n:r,ft="x"===C?s:o,pt=x[O],mt="y"===O?"height":"width",gt=pt+w[ut],bt=pt-w[ft],vt=-1!==[n,r].indexOf(E),yt=null!=(dt=null==$?void 0:$[O])?dt:0,wt=vt?gt:pt-k[mt]-L[mt]-yt+D.altAxis,Et=vt?pt+k[mt]+L[mt]-yt-D.altAxis:bt,At=b&&vt?function(t,e,i){var n=X(t,e,i);return n>i?i:n}(wt,pt,Et):X(b?wt:gt,pt,b?Et:bt);x[O]=At,M[O]=At-pt}e.modifiersData[a]=M}},requiresIfExists:["offset"]};function Ct(t,e,i){void 0===i&&(i=!1);var n,s,o=S(e),r=S(e)&&function(t){var e=t.getBoundingClientRect(),i=M(e.width)/t.offsetWidth||1,n=M(e.height)/t.offsetHeight||1;return 1!==i||1!==n}(e),a=q(e),l=H(t,r,i),c={scrollLeft:0,scrollTop:0},h={x:0,y:0};return(o||!o&&!i)&&(("body"!==x(e)||dt(a))&&(c=(n=e)!==k(n)&&S(n)?{scrollLeft:(s=n).scrollLeft,scrollTop:s.scrollTop}:ct(n)),S(e)?((h=H(e,!0)).x+=e.clientLeft,h.y+=e.clientTop):a&&(h.x=ht(a))),{x:l.left+c.scrollLeft-h.x,y:l.top+c.scrollTop-h.y,width:l.width,height:l.height}}function Ot(t){var e=new Map,i=new Set,n=[];function s(t){i.add(t.name),[].concat(t.requires||[],t.requiresIfExists||[]).forEach((function(t){if(!i.has(t)){var n=e.get(t);n&&s(n)}})),n.push(t)}return t.forEach((function(t){e.set(t.name,t)})),t.forEach((function(t){i.has(t.name)||s(t)})),n}var xt={placement:"bottom",modifiers:[],strategy:"absolute"};function kt(){for(var t=arguments.length,e=new Array(t),i=0;iIt.has(t)&&It.get(t).get(e)||null,remove(t,e){if(!It.has(t))return;const i=It.get(t);i.delete(e),0===i.size&&It.delete(t)}},Pt="transitionend",Mt=t=>(t&&window.CSS&&window.CSS.escape&&(t=t.replace(/#([^\s"#']+)/g,((t,e)=>`#${CSS.escape(e)}`))),t),jt=t=>{t.dispatchEvent(new Event(Pt))},Ft=t=>!(!t||"object"!=typeof t)&&(void 0!==t.jquery&&(t=t[0]),void 0!==t.nodeType),Ht=t=>Ft(t)?t.jquery?t[0]:t:"string"==typeof t&&t.length>0?document.querySelector(Mt(t)):null,Bt=t=>{if(!Ft(t)||0===t.getClientRects().length)return!1;const e="visible"===getComputedStyle(t).getPropertyValue("visibility"),i=t.closest("details:not([open])");if(!i)return e;if(i!==t){const e=t.closest("summary");if(e&&e.parentNode!==i)return!1;if(null===e)return!1}return e},Wt=t=>!t||t.nodeType!==Node.ELEMENT_NODE||!!t.classList.contains("disabled")||(void 0!==t.disabled?t.disabled:t.hasAttribute("disabled")&&"false"!==t.getAttribute("disabled")),zt=t=>{if(!document.documentElement.attachShadow)return null;if("function"==typeof t.getRootNode){const e=t.getRootNode();return e instanceof ShadowRoot?e:null}return t instanceof ShadowRoot?t:t.parentNode?zt(t.parentNode):null},Rt=()=>{},qt=t=>{t.offsetHeight},Vt=()=>window.jQuery&&!document.body.hasAttribute("data-bs-no-jquery")?window.jQuery:null,Yt=[],Kt=()=>"rtl"===document.documentElement.dir,Qt=t=>{var e;e=()=>{const e=Vt();if(e){const i=t.NAME,n=e.fn[i];e.fn[i]=t.jQueryInterface,e.fn[i].Constructor=t,e.fn[i].noConflict=()=>(e.fn[i]=n,t.jQueryInterface)}},"loading"===document.readyState?(Yt.length||document.addEventListener("DOMContentLoaded",(()=>{for(const t of Yt)t()})),Yt.push(e)):e()},Xt=(t,e=[],i=t)=>"function"==typeof t?t(...e):i,Ut=(t,e,i=!0)=>{if(!i)return void Xt(t);const n=(t=>{if(!t)return 0;let{transitionDuration:e,transitionDelay:i}=window.getComputedStyle(t);const n=Number.parseFloat(e),s=Number.parseFloat(i);return n||s?(e=e.split(",")[0],i=i.split(",")[0],1e3*(Number.parseFloat(e)+Number.parseFloat(i))):0})(e)+5;let s=!1;const o=({target:i})=>{i===e&&(s=!0,e.removeEventListener(Pt,o),Xt(t))};e.addEventListener(Pt,o),setTimeout((()=>{s||jt(e)}),n)},Gt=(t,e,i,n)=>{const s=t.length;let o=t.indexOf(e);return-1===o?!i&&n?t[s-1]:t[0]:(o+=i?1:-1,n&&(o=(o+s)%s),t[Math.max(0,Math.min(o,s-1))])},Jt=/[^.]*(?=\..*)\.|.*/,Zt=/\..*/,te=/::\d+$/,ee={};let ie=1;const ne={mouseenter:"mouseover",mouseleave:"mouseout"},se=new Set(["click","dblclick","mouseup","mousedown","contextmenu","mousewheel","DOMMouseScroll","mouseover","mouseout","mousemove","selectstart","selectend","keydown","keypress","keyup","orientationchange","touchstart","touchmove","touchend","touchcancel","pointerdown","pointermove","pointerup","pointerleave","pointercancel","gesturestart","gesturechange","gestureend","focus","blur","change","reset","select","submit","focusin","focusout","load","unload","beforeunload","resize","move","DOMContentLoaded","readystatechange","error","abort","scroll"]);function oe(t,e){return e&&`${e}::${ie++}`||t.uidEvent||ie++}function re(t){const e=oe(t);return t.uidEvent=e,ee[e]=ee[e]||{},ee[e]}function ae(t,e,i=null){return Object.values(t).find((t=>t.callable===e&&t.delegationSelector===i))}function le(t,e,i){const n="string"==typeof e,s=n?i:e||i;let o=ue(t);return se.has(o)||(o=t),[n,s,o]}function ce(t,e,i,n,s){if("string"!=typeof e||!t)return;let[o,r,a]=le(e,i,n);if(e in ne){const t=t=>function(e){if(!e.relatedTarget||e.relatedTarget!==e.delegateTarget&&!e.delegateTarget.contains(e.relatedTarget))return t.call(this,e)};r=t(r)}const l=re(t),c=l[a]||(l[a]={}),h=ae(c,r,o?i:null);if(h)return void(h.oneOff=h.oneOff&&s);const d=oe(r,e.replace(Jt,"")),u=o?function(t,e,i){return function n(s){const o=t.querySelectorAll(e);for(let{target:r}=s;r&&r!==this;r=r.parentNode)for(const a of o)if(a===r)return pe(s,{delegateTarget:r}),n.oneOff&&fe.off(t,s.type,e,i),i.apply(r,[s])}}(t,i,r):function(t,e){return function i(n){return pe(n,{delegateTarget:t}),i.oneOff&&fe.off(t,n.type,e),e.apply(t,[n])}}(t,r);u.delegationSelector=o?i:null,u.callable=r,u.oneOff=s,u.uidEvent=d,c[d]=u,t.addEventListener(a,u,o)}function he(t,e,i,n,s){const o=ae(e[i],n,s);o&&(t.removeEventListener(i,o,Boolean(s)),delete e[i][o.uidEvent])}function de(t,e,i,n){const s=e[i]||{};for(const[o,r]of Object.entries(s))o.includes(n)&&he(t,e,i,r.callable,r.delegationSelector)}function ue(t){return t=t.replace(Zt,""),ne[t]||t}const fe={on(t,e,i,n){ce(t,e,i,n,!1)},one(t,e,i,n){ce(t,e,i,n,!0)},off(t,e,i,n){if("string"!=typeof e||!t)return;const[s,o,r]=le(e,i,n),a=r!==e,l=re(t),c=l[r]||{},h=e.startsWith(".");if(void 0===o){if(h)for(const i of Object.keys(l))de(t,l,i,e.slice(1));for(const[i,n]of Object.entries(c)){const s=i.replace(te,"");a&&!e.includes(s)||he(t,l,r,n.callable,n.delegationSelector)}}else{if(!Object.keys(c).length)return;he(t,l,r,o,s?i:null)}},trigger(t,e,i){if("string"!=typeof e||!t)return null;const n=Vt();let s=null,o=!0,r=!0,a=!1;e!==ue(e)&&n&&(s=n.Event(e,i),n(t).trigger(s),o=!s.isPropagationStopped(),r=!s.isImmediatePropagationStopped(),a=s.isDefaultPrevented());const l=pe(new Event(e,{bubbles:o,cancelable:!0}),i);return a&&l.preventDefault(),r&&t.dispatchEvent(l),l.defaultPrevented&&s&&s.preventDefault(),l}};function pe(t,e={}){for(const[i,n]of Object.entries(e))try{t[i]=n}catch(e){Object.defineProperty(t,i,{configurable:!0,get:()=>n})}return t}function me(t){if("true"===t)return!0;if("false"===t)return!1;if(t===Number(t).toString())return Number(t);if(""===t||"null"===t)return null;if("string"!=typeof t)return t;try{return JSON.parse(decodeURIComponent(t))}catch(e){return t}}function ge(t){return t.replace(/[A-Z]/g,(t=>`-${t.toLowerCase()}`))}const _e={setDataAttribute(t,e,i){t.setAttribute(`data-bs-${ge(e)}`,i)},removeDataAttribute(t,e){t.removeAttribute(`data-bs-${ge(e)}`)},getDataAttributes(t){if(!t)return{};const e={},i=Object.keys(t.dataset).filter((t=>t.startsWith("bs")&&!t.startsWith("bsConfig")));for(const n of i){let i=n.replace(/^bs/,"");i=i.charAt(0).toLowerCase()+i.slice(1,i.length),e[i]=me(t.dataset[n])}return e},getDataAttribute:(t,e)=>me(t.getAttribute(`data-bs-${ge(e)}`))};class be{static get Default(){return{}}static get DefaultType(){return{}}static get NAME(){throw new Error('You have to implement the static method "NAME", for each component!')}_getConfig(t){return t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t}_mergeConfigObj(t,e){const i=Ft(e)?_e.getDataAttribute(e,"config"):{};return{...this.constructor.Default,..."object"==typeof i?i:{},...Ft(e)?_e.getDataAttributes(e):{},..."object"==typeof t?t:{}}}_typeCheckConfig(t,e=this.constructor.DefaultType){for(const[n,s]of Object.entries(e)){const e=t[n],o=Ft(e)?"element":null==(i=e)?`${i}`:Object.prototype.toString.call(i).match(/\s([a-z]+)/i)[1].toLowerCase();if(!new RegExp(s).test(o))throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option "${n}" provided type "${o}" but expected type "${s}".`)}var i}}class ve extends be{constructor(t,e){super(),(t=Ht(t))&&(this._element=t,this._config=this._getConfig(e),Nt.set(this._element,this.constructor.DATA_KEY,this))}dispose(){Nt.remove(this._element,this.constructor.DATA_KEY),fe.off(this._element,this.constructor.EVENT_KEY);for(const t of Object.getOwnPropertyNames(this))this[t]=null}_queueCallback(t,e,i=!0){Ut(t,e,i)}_getConfig(t){return t=this._mergeConfigObj(t,this._element),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}static getInstance(t){return Nt.get(Ht(t),this.DATA_KEY)}static getOrCreateInstance(t,e={}){return this.getInstance(t)||new this(t,"object"==typeof e?e:null)}static get VERSION(){return"5.3.3"}static get DATA_KEY(){return`bs.${this.NAME}`}static get EVENT_KEY(){return`.${this.DATA_KEY}`}static eventName(t){return`${t}${this.EVENT_KEY}`}}const ye=t=>{let e=t.getAttribute("data-bs-target");if(!e||"#"===e){let i=t.getAttribute("href");if(!i||!i.includes("#")&&!i.startsWith("."))return null;i.includes("#")&&!i.startsWith("#")&&(i=`#${i.split("#")[1]}`),e=i&&"#"!==i?i.trim():null}return e?e.split(",").map((t=>Mt(t))).join(","):null},we={find:(t,e=document.documentElement)=>[].concat(...Element.prototype.querySelectorAll.call(e,t)),findOne:(t,e=document.documentElement)=>Element.prototype.querySelector.call(e,t),children:(t,e)=>[].concat(...t.children).filter((t=>t.matches(e))),parents(t,e){const i=[];let n=t.parentNode.closest(e);for(;n;)i.push(n),n=n.parentNode.closest(e);return i},prev(t,e){let i=t.previousElementSibling;for(;i;){if(i.matches(e))return[i];i=i.previousElementSibling}return[]},next(t,e){let i=t.nextElementSibling;for(;i;){if(i.matches(e))return[i];i=i.nextElementSibling}return[]},focusableChildren(t){const e=["a","button","input","textarea","select","details","[tabindex]",'[contenteditable="true"]'].map((t=>`${t}:not([tabindex^="-"])`)).join(",");return this.find(e,t).filter((t=>!Wt(t)&&Bt(t)))},getSelectorFromElement(t){const e=ye(t);return e&&we.findOne(e)?e:null},getElementFromSelector(t){const e=ye(t);return e?we.findOne(e):null},getMultipleElementsFromSelector(t){const e=ye(t);return e?we.find(e):[]}},Ee=(t,e="hide")=>{const i=`click.dismiss${t.EVENT_KEY}`,n=t.NAME;fe.on(document,i,`[data-bs-dismiss="${n}"]`,(function(i){if(["A","AREA"].includes(this.tagName)&&i.preventDefault(),Wt(this))return;const s=we.getElementFromSelector(this)||this.closest(`.${n}`);t.getOrCreateInstance(s)[e]()}))},Ae=".bs.alert",Te=`close${Ae}`,Ce=`closed${Ae}`;class Oe extends ve{static get NAME(){return"alert"}close(){if(fe.trigger(this._element,Te).defaultPrevented)return;this._element.classList.remove("show");const t=this._element.classList.contains("fade");this._queueCallback((()=>this._destroyElement()),this._element,t)}_destroyElement(){this._element.remove(),fe.trigger(this._element,Ce),this.dispose()}static jQueryInterface(t){return this.each((function(){const e=Oe.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}Ee(Oe,"close"),Qt(Oe);const xe='[data-bs-toggle="button"]';class ke extends ve{static get NAME(){return"button"}toggle(){this._element.setAttribute("aria-pressed",this._element.classList.toggle("active"))}static jQueryInterface(t){return this.each((function(){const e=ke.getOrCreateInstance(this);"toggle"===t&&e[t]()}))}}fe.on(document,"click.bs.button.data-api",xe,(t=>{t.preventDefault();const e=t.target.closest(xe);ke.getOrCreateInstance(e).toggle()})),Qt(ke);const Le=".bs.swipe",Se=`touchstart${Le}`,De=`touchmove${Le}`,$e=`touchend${Le}`,Ie=`pointerdown${Le}`,Ne=`pointerup${Le}`,Pe={endCallback:null,leftCallback:null,rightCallback:null},Me={endCallback:"(function|null)",leftCallback:"(function|null)",rightCallback:"(function|null)"};class je extends be{constructor(t,e){super(),this._element=t,t&&je.isSupported()&&(this._config=this._getConfig(e),this._deltaX=0,this._supportPointerEvents=Boolean(window.PointerEvent),this._initEvents())}static get Default(){return Pe}static get DefaultType(){return Me}static get NAME(){return"swipe"}dispose(){fe.off(this._element,Le)}_start(t){this._supportPointerEvents?this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX):this._deltaX=t.touches[0].clientX}_end(t){this._eventIsPointerPenTouch(t)&&(this._deltaX=t.clientX-this._deltaX),this._handleSwipe(),Xt(this._config.endCallback)}_move(t){this._deltaX=t.touches&&t.touches.length>1?0:t.touches[0].clientX-this._deltaX}_handleSwipe(){const t=Math.abs(this._deltaX);if(t<=40)return;const e=t/this._deltaX;this._deltaX=0,e&&Xt(e>0?this._config.rightCallback:this._config.leftCallback)}_initEvents(){this._supportPointerEvents?(fe.on(this._element,Ie,(t=>this._start(t))),fe.on(this._element,Ne,(t=>this._end(t))),this._element.classList.add("pointer-event")):(fe.on(this._element,Se,(t=>this._start(t))),fe.on(this._element,De,(t=>this._move(t))),fe.on(this._element,$e,(t=>this._end(t))))}_eventIsPointerPenTouch(t){return this._supportPointerEvents&&("pen"===t.pointerType||"touch"===t.pointerType)}static isSupported(){return"ontouchstart"in document.documentElement||navigator.maxTouchPoints>0}}const Fe=".bs.carousel",He=".data-api",Be="ArrowLeft",We="ArrowRight",ze="next",Re="prev",qe="left",Ve="right",Ye=`slide${Fe}`,Ke=`slid${Fe}`,Qe=`keydown${Fe}`,Xe=`mouseenter${Fe}`,Ue=`mouseleave${Fe}`,Ge=`dragstart${Fe}`,Je=`load${Fe}${He}`,Ze=`click${Fe}${He}`,ti="carousel",ei="active",ii=".active",ni=".carousel-item",si=ii+ni,oi={[Be]:Ve,[We]:qe},ri={interval:5e3,keyboard:!0,pause:"hover",ride:!1,touch:!0,wrap:!0},ai={interval:"(number|boolean)",keyboard:"boolean",pause:"(string|boolean)",ride:"(boolean|string)",touch:"boolean",wrap:"boolean"};class li extends ve{constructor(t,e){super(t,e),this._interval=null,this._activeElement=null,this._isSliding=!1,this.touchTimeout=null,this._swipeHelper=null,this._indicatorsElement=we.findOne(".carousel-indicators",this._element),this._addEventListeners(),this._config.ride===ti&&this.cycle()}static get Default(){return ri}static get DefaultType(){return ai}static get NAME(){return"carousel"}next(){this._slide(ze)}nextWhenVisible(){!document.hidden&&Bt(this._element)&&this.next()}prev(){this._slide(Re)}pause(){this._isSliding&&jt(this._element),this._clearInterval()}cycle(){this._clearInterval(),this._updateInterval(),this._interval=setInterval((()=>this.nextWhenVisible()),this._config.interval)}_maybeEnableCycle(){this._config.ride&&(this._isSliding?fe.one(this._element,Ke,(()=>this.cycle())):this.cycle())}to(t){const e=this._getItems();if(t>e.length-1||t<0)return;if(this._isSliding)return void fe.one(this._element,Ke,(()=>this.to(t)));const i=this._getItemIndex(this._getActive());if(i===t)return;const n=t>i?ze:Re;this._slide(n,e[t])}dispose(){this._swipeHelper&&this._swipeHelper.dispose(),super.dispose()}_configAfterMerge(t){return t.defaultInterval=t.interval,t}_addEventListeners(){this._config.keyboard&&fe.on(this._element,Qe,(t=>this._keydown(t))),"hover"===this._config.pause&&(fe.on(this._element,Xe,(()=>this.pause())),fe.on(this._element,Ue,(()=>this._maybeEnableCycle()))),this._config.touch&&je.isSupported()&&this._addTouchEventListeners()}_addTouchEventListeners(){for(const t of we.find(".carousel-item img",this._element))fe.on(t,Ge,(t=>t.preventDefault()));const t={leftCallback:()=>this._slide(this._directionToOrder(qe)),rightCallback:()=>this._slide(this._directionToOrder(Ve)),endCallback:()=>{"hover"===this._config.pause&&(this.pause(),this.touchTimeout&&clearTimeout(this.touchTimeout),this.touchTimeout=setTimeout((()=>this._maybeEnableCycle()),500+this._config.interval))}};this._swipeHelper=new je(this._element,t)}_keydown(t){if(/input|textarea/i.test(t.target.tagName))return;const e=oi[t.key];e&&(t.preventDefault(),this._slide(this._directionToOrder(e)))}_getItemIndex(t){return this._getItems().indexOf(t)}_setActiveIndicatorElement(t){if(!this._indicatorsElement)return;const e=we.findOne(ii,this._indicatorsElement);e.classList.remove(ei),e.removeAttribute("aria-current");const i=we.findOne(`[data-bs-slide-to="${t}"]`,this._indicatorsElement);i&&(i.classList.add(ei),i.setAttribute("aria-current","true"))}_updateInterval(){const t=this._activeElement||this._getActive();if(!t)return;const e=Number.parseInt(t.getAttribute("data-bs-interval"),10);this._config.interval=e||this._config.defaultInterval}_slide(t,e=null){if(this._isSliding)return;const i=this._getActive(),n=t===ze,s=e||Gt(this._getItems(),i,n,this._config.wrap);if(s===i)return;const o=this._getItemIndex(s),r=e=>fe.trigger(this._element,e,{relatedTarget:s,direction:this._orderToDirection(t),from:this._getItemIndex(i),to:o});if(r(Ye).defaultPrevented)return;if(!i||!s)return;const a=Boolean(this._interval);this.pause(),this._isSliding=!0,this._setActiveIndicatorElement(o),this._activeElement=s;const l=n?"carousel-item-start":"carousel-item-end",c=n?"carousel-item-next":"carousel-item-prev";s.classList.add(c),qt(s),i.classList.add(l),s.classList.add(l),this._queueCallback((()=>{s.classList.remove(l,c),s.classList.add(ei),i.classList.remove(ei,c,l),this._isSliding=!1,r(Ke)}),i,this._isAnimated()),a&&this.cycle()}_isAnimated(){return this._element.classList.contains("slide")}_getActive(){return we.findOne(si,this._element)}_getItems(){return we.find(ni,this._element)}_clearInterval(){this._interval&&(clearInterval(this._interval),this._interval=null)}_directionToOrder(t){return Kt()?t===qe?Re:ze:t===qe?ze:Re}_orderToDirection(t){return Kt()?t===Re?qe:Ve:t===Re?Ve:qe}static jQueryInterface(t){return this.each((function(){const e=li.getOrCreateInstance(this,t);if("number"!=typeof t){if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}else e.to(t)}))}}fe.on(document,Ze,"[data-bs-slide], [data-bs-slide-to]",(function(t){const e=we.getElementFromSelector(this);if(!e||!e.classList.contains(ti))return;t.preventDefault();const i=li.getOrCreateInstance(e),n=this.getAttribute("data-bs-slide-to");return n?(i.to(n),void i._maybeEnableCycle()):"next"===_e.getDataAttribute(this,"slide")?(i.next(),void i._maybeEnableCycle()):(i.prev(),void i._maybeEnableCycle())})),fe.on(window,Je,(()=>{const t=we.find('[data-bs-ride="carousel"]');for(const e of t)li.getOrCreateInstance(e)})),Qt(li);const ci=".bs.collapse",hi=`show${ci}`,di=`shown${ci}`,ui=`hide${ci}`,fi=`hidden${ci}`,pi=`click${ci}.data-api`,mi="show",gi="collapse",_i="collapsing",bi=`:scope .${gi} .${gi}`,vi='[data-bs-toggle="collapse"]',yi={parent:null,toggle:!0},wi={parent:"(null|element)",toggle:"boolean"};class Ei extends ve{constructor(t,e){super(t,e),this._isTransitioning=!1,this._triggerArray=[];const i=we.find(vi);for(const t of i){const e=we.getSelectorFromElement(t),i=we.find(e).filter((t=>t===this._element));null!==e&&i.length&&this._triggerArray.push(t)}this._initializeChildren(),this._config.parent||this._addAriaAndCollapsedClass(this._triggerArray,this._isShown()),this._config.toggle&&this.toggle()}static get Default(){return yi}static get DefaultType(){return wi}static get NAME(){return"collapse"}toggle(){this._isShown()?this.hide():this.show()}show(){if(this._isTransitioning||this._isShown())return;let t=[];if(this._config.parent&&(t=this._getFirstLevelChildren(".collapse.show, .collapse.collapsing").filter((t=>t!==this._element)).map((t=>Ei.getOrCreateInstance(t,{toggle:!1})))),t.length&&t[0]._isTransitioning)return;if(fe.trigger(this._element,hi).defaultPrevented)return;for(const e of t)e.hide();const e=this._getDimension();this._element.classList.remove(gi),this._element.classList.add(_i),this._element.style[e]=0,this._addAriaAndCollapsedClass(this._triggerArray,!0),this._isTransitioning=!0;const i=`scroll${e[0].toUpperCase()+e.slice(1)}`;this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_i),this._element.classList.add(gi,mi),this._element.style[e]="",fe.trigger(this._element,di)}),this._element,!0),this._element.style[e]=`${this._element[i]}px`}hide(){if(this._isTransitioning||!this._isShown())return;if(fe.trigger(this._element,ui).defaultPrevented)return;const t=this._getDimension();this._element.style[t]=`${this._element.getBoundingClientRect()[t]}px`,qt(this._element),this._element.classList.add(_i),this._element.classList.remove(gi,mi);for(const t of this._triggerArray){const e=we.getElementFromSelector(t);e&&!this._isShown(e)&&this._addAriaAndCollapsedClass([t],!1)}this._isTransitioning=!0,this._element.style[t]="",this._queueCallback((()=>{this._isTransitioning=!1,this._element.classList.remove(_i),this._element.classList.add(gi),fe.trigger(this._element,fi)}),this._element,!0)}_isShown(t=this._element){return t.classList.contains(mi)}_configAfterMerge(t){return t.toggle=Boolean(t.toggle),t.parent=Ht(t.parent),t}_getDimension(){return this._element.classList.contains("collapse-horizontal")?"width":"height"}_initializeChildren(){if(!this._config.parent)return;const t=this._getFirstLevelChildren(vi);for(const e of t){const t=we.getElementFromSelector(e);t&&this._addAriaAndCollapsedClass([e],this._isShown(t))}}_getFirstLevelChildren(t){const e=we.find(bi,this._config.parent);return we.find(t,this._config.parent).filter((t=>!e.includes(t)))}_addAriaAndCollapsedClass(t,e){if(t.length)for(const i of t)i.classList.toggle("collapsed",!e),i.setAttribute("aria-expanded",e)}static jQueryInterface(t){const e={};return"string"==typeof t&&/show|hide/.test(t)&&(e.toggle=!1),this.each((function(){const i=Ei.getOrCreateInstance(this,e);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t]()}}))}}fe.on(document,pi,vi,(function(t){("A"===t.target.tagName||t.delegateTarget&&"A"===t.delegateTarget.tagName)&&t.preventDefault();for(const t of we.getMultipleElementsFromSelector(this))Ei.getOrCreateInstance(t,{toggle:!1}).toggle()})),Qt(Ei);const Ai="dropdown",Ti=".bs.dropdown",Ci=".data-api",Oi="ArrowUp",xi="ArrowDown",ki=`hide${Ti}`,Li=`hidden${Ti}`,Si=`show${Ti}`,Di=`shown${Ti}`,$i=`click${Ti}${Ci}`,Ii=`keydown${Ti}${Ci}`,Ni=`keyup${Ti}${Ci}`,Pi="show",Mi='[data-bs-toggle="dropdown"]:not(.disabled):not(:disabled)',ji=`${Mi}.${Pi}`,Fi=".dropdown-menu",Hi=Kt()?"top-end":"top-start",Bi=Kt()?"top-start":"top-end",Wi=Kt()?"bottom-end":"bottom-start",zi=Kt()?"bottom-start":"bottom-end",Ri=Kt()?"left-start":"right-start",qi=Kt()?"right-start":"left-start",Vi={autoClose:!0,boundary:"clippingParents",display:"dynamic",offset:[0,2],popperConfig:null,reference:"toggle"},Yi={autoClose:"(boolean|string)",boundary:"(string|element)",display:"string",offset:"(array|string|function)",popperConfig:"(null|object|function)",reference:"(string|element|object)"};class Ki extends ve{constructor(t,e){super(t,e),this._popper=null,this._parent=this._element.parentNode,this._menu=we.next(this._element,Fi)[0]||we.prev(this._element,Fi)[0]||we.findOne(Fi,this._parent),this._inNavbar=this._detectNavbar()}static get Default(){return Vi}static get DefaultType(){return Yi}static get NAME(){return Ai}toggle(){return this._isShown()?this.hide():this.show()}show(){if(Wt(this._element)||this._isShown())return;const t={relatedTarget:this._element};if(!fe.trigger(this._element,Si,t).defaultPrevented){if(this._createPopper(),"ontouchstart"in document.documentElement&&!this._parent.closest(".navbar-nav"))for(const t of[].concat(...document.body.children))fe.on(t,"mouseover",Rt);this._element.focus(),this._element.setAttribute("aria-expanded",!0),this._menu.classList.add(Pi),this._element.classList.add(Pi),fe.trigger(this._element,Di,t)}}hide(){if(Wt(this._element)||!this._isShown())return;const t={relatedTarget:this._element};this._completeHide(t)}dispose(){this._popper&&this._popper.destroy(),super.dispose()}update(){this._inNavbar=this._detectNavbar(),this._popper&&this._popper.update()}_completeHide(t){if(!fe.trigger(this._element,ki,t).defaultPrevented){if("ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.off(t,"mouseover",Rt);this._popper&&this._popper.destroy(),this._menu.classList.remove(Pi),this._element.classList.remove(Pi),this._element.setAttribute("aria-expanded","false"),_e.removeDataAttribute(this._menu,"popper"),fe.trigger(this._element,Li,t)}}_getConfig(t){if("object"==typeof(t=super._getConfig(t)).reference&&!Ft(t.reference)&&"function"!=typeof t.reference.getBoundingClientRect)throw new TypeError(`${Ai.toUpperCase()}: Option "reference" provided type "object" without a required "getBoundingClientRect" method.`);return t}_createPopper(){if(void 0===e)throw new TypeError("Bootstrap's dropdowns require Popper (https://popper.js.org)");let t=this._element;"parent"===this._config.reference?t=this._parent:Ft(this._config.reference)?t=Ht(this._config.reference):"object"==typeof this._config.reference&&(t=this._config.reference);const i=this._getPopperConfig();this._popper=Dt(t,this._menu,i)}_isShown(){return this._menu.classList.contains(Pi)}_getPlacement(){const t=this._parent;if(t.classList.contains("dropend"))return Ri;if(t.classList.contains("dropstart"))return qi;if(t.classList.contains("dropup-center"))return"top";if(t.classList.contains("dropdown-center"))return"bottom";const e="end"===getComputedStyle(this._menu).getPropertyValue("--bs-position").trim();return t.classList.contains("dropup")?e?Bi:Hi:e?zi:Wi}_detectNavbar(){return null!==this._element.closest(".navbar")}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_getPopperConfig(){const t={placement:this._getPlacement(),modifiers:[{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"offset",options:{offset:this._getOffset()}}]};return(this._inNavbar||"static"===this._config.display)&&(_e.setDataAttribute(this._menu,"popper","static"),t.modifiers=[{name:"applyStyles",enabled:!1}]),{...t,...Xt(this._config.popperConfig,[t])}}_selectMenuItem({key:t,target:e}){const i=we.find(".dropdown-menu .dropdown-item:not(.disabled):not(:disabled)",this._menu).filter((t=>Bt(t)));i.length&&Gt(i,e,t===xi,!i.includes(e)).focus()}static jQueryInterface(t){return this.each((function(){const e=Ki.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}static clearMenus(t){if(2===t.button||"keyup"===t.type&&"Tab"!==t.key)return;const e=we.find(ji);for(const i of e){const e=Ki.getInstance(i);if(!e||!1===e._config.autoClose)continue;const n=t.composedPath(),s=n.includes(e._menu);if(n.includes(e._element)||"inside"===e._config.autoClose&&!s||"outside"===e._config.autoClose&&s)continue;if(e._menu.contains(t.target)&&("keyup"===t.type&&"Tab"===t.key||/input|select|option|textarea|form/i.test(t.target.tagName)))continue;const o={relatedTarget:e._element};"click"===t.type&&(o.clickEvent=t),e._completeHide(o)}}static dataApiKeydownHandler(t){const e=/input|textarea/i.test(t.target.tagName),i="Escape"===t.key,n=[Oi,xi].includes(t.key);if(!n&&!i)return;if(e&&!i)return;t.preventDefault();const s=this.matches(Mi)?this:we.prev(this,Mi)[0]||we.next(this,Mi)[0]||we.findOne(Mi,t.delegateTarget.parentNode),o=Ki.getOrCreateInstance(s);if(n)return t.stopPropagation(),o.show(),void o._selectMenuItem(t);o._isShown()&&(t.stopPropagation(),o.hide(),s.focus())}}fe.on(document,Ii,Mi,Ki.dataApiKeydownHandler),fe.on(document,Ii,Fi,Ki.dataApiKeydownHandler),fe.on(document,$i,Ki.clearMenus),fe.on(document,Ni,Ki.clearMenus),fe.on(document,$i,Mi,(function(t){t.preventDefault(),Ki.getOrCreateInstance(this).toggle()})),Qt(Ki);const Qi="backdrop",Xi="show",Ui=`mousedown.bs.${Qi}`,Gi={className:"modal-backdrop",clickCallback:null,isAnimated:!1,isVisible:!0,rootElement:"body"},Ji={className:"string",clickCallback:"(function|null)",isAnimated:"boolean",isVisible:"boolean",rootElement:"(element|string)"};class Zi extends be{constructor(t){super(),this._config=this._getConfig(t),this._isAppended=!1,this._element=null}static get Default(){return Gi}static get DefaultType(){return Ji}static get NAME(){return Qi}show(t){if(!this._config.isVisible)return void Xt(t);this._append();const e=this._getElement();this._config.isAnimated&&qt(e),e.classList.add(Xi),this._emulateAnimation((()=>{Xt(t)}))}hide(t){this._config.isVisible?(this._getElement().classList.remove(Xi),this._emulateAnimation((()=>{this.dispose(),Xt(t)}))):Xt(t)}dispose(){this._isAppended&&(fe.off(this._element,Ui),this._element.remove(),this._isAppended=!1)}_getElement(){if(!this._element){const t=document.createElement("div");t.className=this._config.className,this._config.isAnimated&&t.classList.add("fade"),this._element=t}return this._element}_configAfterMerge(t){return t.rootElement=Ht(t.rootElement),t}_append(){if(this._isAppended)return;const t=this._getElement();this._config.rootElement.append(t),fe.on(t,Ui,(()=>{Xt(this._config.clickCallback)})),this._isAppended=!0}_emulateAnimation(t){Ut(t,this._getElement(),this._config.isAnimated)}}const tn=".bs.focustrap",en=`focusin${tn}`,nn=`keydown.tab${tn}`,sn="backward",on={autofocus:!0,trapElement:null},rn={autofocus:"boolean",trapElement:"element"};class an extends be{constructor(t){super(),this._config=this._getConfig(t),this._isActive=!1,this._lastTabNavDirection=null}static get Default(){return on}static get DefaultType(){return rn}static get NAME(){return"focustrap"}activate(){this._isActive||(this._config.autofocus&&this._config.trapElement.focus(),fe.off(document,tn),fe.on(document,en,(t=>this._handleFocusin(t))),fe.on(document,nn,(t=>this._handleKeydown(t))),this._isActive=!0)}deactivate(){this._isActive&&(this._isActive=!1,fe.off(document,tn))}_handleFocusin(t){const{trapElement:e}=this._config;if(t.target===document||t.target===e||e.contains(t.target))return;const i=we.focusableChildren(e);0===i.length?e.focus():this._lastTabNavDirection===sn?i[i.length-1].focus():i[0].focus()}_handleKeydown(t){"Tab"===t.key&&(this._lastTabNavDirection=t.shiftKey?sn:"forward")}}const ln=".fixed-top, .fixed-bottom, .is-fixed, .sticky-top",cn=".sticky-top",hn="padding-right",dn="margin-right";class un{constructor(){this._element=document.body}getWidth(){const t=document.documentElement.clientWidth;return Math.abs(window.innerWidth-t)}hide(){const t=this.getWidth();this._disableOverFlow(),this._setElementAttributes(this._element,hn,(e=>e+t)),this._setElementAttributes(ln,hn,(e=>e+t)),this._setElementAttributes(cn,dn,(e=>e-t))}reset(){this._resetElementAttributes(this._element,"overflow"),this._resetElementAttributes(this._element,hn),this._resetElementAttributes(ln,hn),this._resetElementAttributes(cn,dn)}isOverflowing(){return this.getWidth()>0}_disableOverFlow(){this._saveInitialAttribute(this._element,"overflow"),this._element.style.overflow="hidden"}_setElementAttributes(t,e,i){const n=this.getWidth();this._applyManipulationCallback(t,(t=>{if(t!==this._element&&window.innerWidth>t.clientWidth+n)return;this._saveInitialAttribute(t,e);const s=window.getComputedStyle(t).getPropertyValue(e);t.style.setProperty(e,`${i(Number.parseFloat(s))}px`)}))}_saveInitialAttribute(t,e){const i=t.style.getPropertyValue(e);i&&_e.setDataAttribute(t,e,i)}_resetElementAttributes(t,e){this._applyManipulationCallback(t,(t=>{const i=_e.getDataAttribute(t,e);null!==i?(_e.removeDataAttribute(t,e),t.style.setProperty(e,i)):t.style.removeProperty(e)}))}_applyManipulationCallback(t,e){if(Ft(t))e(t);else for(const i of we.find(t,this._element))e(i)}}const fn=".bs.modal",pn=`hide${fn}`,mn=`hidePrevented${fn}`,gn=`hidden${fn}`,_n=`show${fn}`,bn=`shown${fn}`,vn=`resize${fn}`,yn=`click.dismiss${fn}`,wn=`mousedown.dismiss${fn}`,En=`keydown.dismiss${fn}`,An=`click${fn}.data-api`,Tn="modal-open",Cn="show",On="modal-static",xn={backdrop:!0,focus:!0,keyboard:!0},kn={backdrop:"(boolean|string)",focus:"boolean",keyboard:"boolean"};class Ln extends ve{constructor(t,e){super(t,e),this._dialog=we.findOne(".modal-dialog",this._element),this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._isShown=!1,this._isTransitioning=!1,this._scrollBar=new un,this._addEventListeners()}static get Default(){return xn}static get DefaultType(){return kn}static get NAME(){return"modal"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||this._isTransitioning||fe.trigger(this._element,_n,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._isTransitioning=!0,this._scrollBar.hide(),document.body.classList.add(Tn),this._adjustDialog(),this._backdrop.show((()=>this._showElement(t))))}hide(){this._isShown&&!this._isTransitioning&&(fe.trigger(this._element,pn).defaultPrevented||(this._isShown=!1,this._isTransitioning=!0,this._focustrap.deactivate(),this._element.classList.remove(Cn),this._queueCallback((()=>this._hideModal()),this._element,this._isAnimated())))}dispose(){fe.off(window,fn),fe.off(this._dialog,fn),this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}handleUpdate(){this._adjustDialog()}_initializeBackDrop(){return new Zi({isVisible:Boolean(this._config.backdrop),isAnimated:this._isAnimated()})}_initializeFocusTrap(){return new an({trapElement:this._element})}_showElement(t){document.body.contains(this._element)||document.body.append(this._element),this._element.style.display="block",this._element.removeAttribute("aria-hidden"),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.scrollTop=0;const e=we.findOne(".modal-body",this._dialog);e&&(e.scrollTop=0),qt(this._element),this._element.classList.add(Cn),this._queueCallback((()=>{this._config.focus&&this._focustrap.activate(),this._isTransitioning=!1,fe.trigger(this._element,bn,{relatedTarget:t})}),this._dialog,this._isAnimated())}_addEventListeners(){fe.on(this._element,En,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():this._triggerBackdropTransition())})),fe.on(window,vn,(()=>{this._isShown&&!this._isTransitioning&&this._adjustDialog()})),fe.on(this._element,wn,(t=>{fe.one(this._element,yn,(e=>{this._element===t.target&&this._element===e.target&&("static"!==this._config.backdrop?this._config.backdrop&&this.hide():this._triggerBackdropTransition())}))}))}_hideModal(){this._element.style.display="none",this._element.setAttribute("aria-hidden",!0),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._isTransitioning=!1,this._backdrop.hide((()=>{document.body.classList.remove(Tn),this._resetAdjustments(),this._scrollBar.reset(),fe.trigger(this._element,gn)}))}_isAnimated(){return this._element.classList.contains("fade")}_triggerBackdropTransition(){if(fe.trigger(this._element,mn).defaultPrevented)return;const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._element.style.overflowY;"hidden"===e||this._element.classList.contains(On)||(t||(this._element.style.overflowY="hidden"),this._element.classList.add(On),this._queueCallback((()=>{this._element.classList.remove(On),this._queueCallback((()=>{this._element.style.overflowY=e}),this._dialog)}),this._dialog),this._element.focus())}_adjustDialog(){const t=this._element.scrollHeight>document.documentElement.clientHeight,e=this._scrollBar.getWidth(),i=e>0;if(i&&!t){const t=Kt()?"paddingLeft":"paddingRight";this._element.style[t]=`${e}px`}if(!i&&t){const t=Kt()?"paddingRight":"paddingLeft";this._element.style[t]=`${e}px`}}_resetAdjustments(){this._element.style.paddingLeft="",this._element.style.paddingRight=""}static jQueryInterface(t,e){return this.each((function(){const i=Ln.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===i[t])throw new TypeError(`No method named "${t}"`);i[t](e)}}))}}fe.on(document,An,'[data-bs-toggle="modal"]',(function(t){const e=we.getElementFromSelector(this);["A","AREA"].includes(this.tagName)&&t.preventDefault(),fe.one(e,_n,(t=>{t.defaultPrevented||fe.one(e,gn,(()=>{Bt(this)&&this.focus()}))}));const i=we.findOne(".modal.show");i&&Ln.getInstance(i).hide(),Ln.getOrCreateInstance(e).toggle(this)})),Ee(Ln),Qt(Ln);const Sn=".bs.offcanvas",Dn=".data-api",$n=`load${Sn}${Dn}`,In="show",Nn="showing",Pn="hiding",Mn=".offcanvas.show",jn=`show${Sn}`,Fn=`shown${Sn}`,Hn=`hide${Sn}`,Bn=`hidePrevented${Sn}`,Wn=`hidden${Sn}`,zn=`resize${Sn}`,Rn=`click${Sn}${Dn}`,qn=`keydown.dismiss${Sn}`,Vn={backdrop:!0,keyboard:!0,scroll:!1},Yn={backdrop:"(boolean|string)",keyboard:"boolean",scroll:"boolean"};class Kn extends ve{constructor(t,e){super(t,e),this._isShown=!1,this._backdrop=this._initializeBackDrop(),this._focustrap=this._initializeFocusTrap(),this._addEventListeners()}static get Default(){return Vn}static get DefaultType(){return Yn}static get NAME(){return"offcanvas"}toggle(t){return this._isShown?this.hide():this.show(t)}show(t){this._isShown||fe.trigger(this._element,jn,{relatedTarget:t}).defaultPrevented||(this._isShown=!0,this._backdrop.show(),this._config.scroll||(new un).hide(),this._element.setAttribute("aria-modal",!0),this._element.setAttribute("role","dialog"),this._element.classList.add(Nn),this._queueCallback((()=>{this._config.scroll&&!this._config.backdrop||this._focustrap.activate(),this._element.classList.add(In),this._element.classList.remove(Nn),fe.trigger(this._element,Fn,{relatedTarget:t})}),this._element,!0))}hide(){this._isShown&&(fe.trigger(this._element,Hn).defaultPrevented||(this._focustrap.deactivate(),this._element.blur(),this._isShown=!1,this._element.classList.add(Pn),this._backdrop.hide(),this._queueCallback((()=>{this._element.classList.remove(In,Pn),this._element.removeAttribute("aria-modal"),this._element.removeAttribute("role"),this._config.scroll||(new un).reset(),fe.trigger(this._element,Wn)}),this._element,!0)))}dispose(){this._backdrop.dispose(),this._focustrap.deactivate(),super.dispose()}_initializeBackDrop(){const t=Boolean(this._config.backdrop);return new Zi({className:"offcanvas-backdrop",isVisible:t,isAnimated:!0,rootElement:this._element.parentNode,clickCallback:t?()=>{"static"!==this._config.backdrop?this.hide():fe.trigger(this._element,Bn)}:null})}_initializeFocusTrap(){return new an({trapElement:this._element})}_addEventListeners(){fe.on(this._element,qn,(t=>{"Escape"===t.key&&(this._config.keyboard?this.hide():fe.trigger(this._element,Bn))}))}static jQueryInterface(t){return this.each((function(){const e=Kn.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}fe.on(document,Rn,'[data-bs-toggle="offcanvas"]',(function(t){const e=we.getElementFromSelector(this);if(["A","AREA"].includes(this.tagName)&&t.preventDefault(),Wt(this))return;fe.one(e,Wn,(()=>{Bt(this)&&this.focus()}));const i=we.findOne(Mn);i&&i!==e&&Kn.getInstance(i).hide(),Kn.getOrCreateInstance(e).toggle(this)})),fe.on(window,$n,(()=>{for(const t of we.find(Mn))Kn.getOrCreateInstance(t).show()})),fe.on(window,zn,(()=>{for(const t of we.find("[aria-modal][class*=show][class*=offcanvas-]"))"fixed"!==getComputedStyle(t).position&&Kn.getOrCreateInstance(t).hide()})),Ee(Kn),Qt(Kn);const Qn={"*":["class","dir","id","lang","role",/^aria-[\w-]*$/i],a:["target","href","title","rel"],area:[],b:[],br:[],col:[],code:[],dd:[],div:[],dl:[],dt:[],em:[],hr:[],h1:[],h2:[],h3:[],h4:[],h5:[],h6:[],i:[],img:["src","srcset","alt","title","width","height"],li:[],ol:[],p:[],pre:[],s:[],small:[],span:[],sub:[],sup:[],strong:[],u:[],ul:[]},Xn=new Set(["background","cite","href","itemtype","longdesc","poster","src","xlink:href"]),Un=/^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i,Gn=(t,e)=>{const i=t.nodeName.toLowerCase();return e.includes(i)?!Xn.has(i)||Boolean(Un.test(t.nodeValue)):e.filter((t=>t instanceof RegExp)).some((t=>t.test(i)))},Jn={allowList:Qn,content:{},extraClass:"",html:!1,sanitize:!0,sanitizeFn:null,template:"
"},Zn={allowList:"object",content:"object",extraClass:"(string|function)",html:"boolean",sanitize:"boolean",sanitizeFn:"(null|function)",template:"string"},ts={entry:"(string|element|function|null)",selector:"(string|element)"};class es extends be{constructor(t){super(),this._config=this._getConfig(t)}static get Default(){return Jn}static get DefaultType(){return Zn}static get NAME(){return"TemplateFactory"}getContent(){return Object.values(this._config.content).map((t=>this._resolvePossibleFunction(t))).filter(Boolean)}hasContent(){return this.getContent().length>0}changeContent(t){return this._checkContent(t),this._config.content={...this._config.content,...t},this}toHtml(){const t=document.createElement("div");t.innerHTML=this._maybeSanitize(this._config.template);for(const[e,i]of Object.entries(this._config.content))this._setContent(t,i,e);const e=t.children[0],i=this._resolvePossibleFunction(this._config.extraClass);return i&&e.classList.add(...i.split(" ")),e}_typeCheckConfig(t){super._typeCheckConfig(t),this._checkContent(t.content)}_checkContent(t){for(const[e,i]of Object.entries(t))super._typeCheckConfig({selector:e,entry:i},ts)}_setContent(t,e,i){const n=we.findOne(i,t);n&&((e=this._resolvePossibleFunction(e))?Ft(e)?this._putElementInTemplate(Ht(e),n):this._config.html?n.innerHTML=this._maybeSanitize(e):n.textContent=e:n.remove())}_maybeSanitize(t){return this._config.sanitize?function(t,e,i){if(!t.length)return t;if(i&&"function"==typeof i)return i(t);const n=(new window.DOMParser).parseFromString(t,"text/html"),s=[].concat(...n.body.querySelectorAll("*"));for(const t of s){const i=t.nodeName.toLowerCase();if(!Object.keys(e).includes(i)){t.remove();continue}const n=[].concat(...t.attributes),s=[].concat(e["*"]||[],e[i]||[]);for(const e of n)Gn(e,s)||t.removeAttribute(e.nodeName)}return n.body.innerHTML}(t,this._config.allowList,this._config.sanitizeFn):t}_resolvePossibleFunction(t){return Xt(t,[this])}_putElementInTemplate(t,e){if(this._config.html)return e.innerHTML="",void e.append(t);e.textContent=t.textContent}}const is=new Set(["sanitize","allowList","sanitizeFn"]),ns="fade",ss="show",os=".tooltip-inner",rs=".modal",as="hide.bs.modal",ls="hover",cs="focus",hs={AUTO:"auto",TOP:"top",RIGHT:Kt()?"left":"right",BOTTOM:"bottom",LEFT:Kt()?"right":"left"},ds={allowList:Qn,animation:!0,boundary:"clippingParents",container:!1,customClass:"",delay:0,fallbackPlacements:["top","right","bottom","left"],html:!1,offset:[0,6],placement:"top",popperConfig:null,sanitize:!0,sanitizeFn:null,selector:!1,template:'',title:"",trigger:"hover focus"},us={allowList:"object",animation:"boolean",boundary:"(string|element)",container:"(string|element|boolean)",customClass:"(string|function)",delay:"(number|object)",fallbackPlacements:"array",html:"boolean",offset:"(array|string|function)",placement:"(string|function)",popperConfig:"(null|object|function)",sanitize:"boolean",sanitizeFn:"(null|function)",selector:"(string|boolean)",template:"string",title:"(string|element|function)",trigger:"string"};class fs extends ve{constructor(t,i){if(void 0===e)throw new TypeError("Bootstrap's tooltips require Popper (https://popper.js.org)");super(t,i),this._isEnabled=!0,this._timeout=0,this._isHovered=null,this._activeTrigger={},this._popper=null,this._templateFactory=null,this._newContent=null,this.tip=null,this._setListeners(),this._config.selector||this._fixTitle()}static get Default(){return ds}static get DefaultType(){return us}static get NAME(){return"tooltip"}enable(){this._isEnabled=!0}disable(){this._isEnabled=!1}toggleEnabled(){this._isEnabled=!this._isEnabled}toggle(){this._isEnabled&&(this._activeTrigger.click=!this._activeTrigger.click,this._isShown()?this._leave():this._enter())}dispose(){clearTimeout(this._timeout),fe.off(this._element.closest(rs),as,this._hideModalHandler),this._element.getAttribute("data-bs-original-title")&&this._element.setAttribute("title",this._element.getAttribute("data-bs-original-title")),this._disposePopper(),super.dispose()}show(){if("none"===this._element.style.display)throw new Error("Please use show on visible elements");if(!this._isWithContent()||!this._isEnabled)return;const t=fe.trigger(this._element,this.constructor.eventName("show")),e=(zt(this._element)||this._element.ownerDocument.documentElement).contains(this._element);if(t.defaultPrevented||!e)return;this._disposePopper();const i=this._getTipElement();this._element.setAttribute("aria-describedby",i.getAttribute("id"));const{container:n}=this._config;if(this._element.ownerDocument.documentElement.contains(this.tip)||(n.append(i),fe.trigger(this._element,this.constructor.eventName("inserted"))),this._popper=this._createPopper(i),i.classList.add(ss),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.on(t,"mouseover",Rt);this._queueCallback((()=>{fe.trigger(this._element,this.constructor.eventName("shown")),!1===this._isHovered&&this._leave(),this._isHovered=!1}),this.tip,this._isAnimated())}hide(){if(this._isShown()&&!fe.trigger(this._element,this.constructor.eventName("hide")).defaultPrevented){if(this._getTipElement().classList.remove(ss),"ontouchstart"in document.documentElement)for(const t of[].concat(...document.body.children))fe.off(t,"mouseover",Rt);this._activeTrigger.click=!1,this._activeTrigger[cs]=!1,this._activeTrigger[ls]=!1,this._isHovered=null,this._queueCallback((()=>{this._isWithActiveTrigger()||(this._isHovered||this._disposePopper(),this._element.removeAttribute("aria-describedby"),fe.trigger(this._element,this.constructor.eventName("hidden")))}),this.tip,this._isAnimated())}}update(){this._popper&&this._popper.update()}_isWithContent(){return Boolean(this._getTitle())}_getTipElement(){return this.tip||(this.tip=this._createTipElement(this._newContent||this._getContentForTemplate())),this.tip}_createTipElement(t){const e=this._getTemplateFactory(t).toHtml();if(!e)return null;e.classList.remove(ns,ss),e.classList.add(`bs-${this.constructor.NAME}-auto`);const i=(t=>{do{t+=Math.floor(1e6*Math.random())}while(document.getElementById(t));return t})(this.constructor.NAME).toString();return e.setAttribute("id",i),this._isAnimated()&&e.classList.add(ns),e}setContent(t){this._newContent=t,this._isShown()&&(this._disposePopper(),this.show())}_getTemplateFactory(t){return this._templateFactory?this._templateFactory.changeContent(t):this._templateFactory=new es({...this._config,content:t,extraClass:this._resolvePossibleFunction(this._config.customClass)}),this._templateFactory}_getContentForTemplate(){return{[os]:this._getTitle()}}_getTitle(){return this._resolvePossibleFunction(this._config.title)||this._element.getAttribute("data-bs-original-title")}_initializeOnDelegatedTarget(t){return this.constructor.getOrCreateInstance(t.delegateTarget,this._getDelegateConfig())}_isAnimated(){return this._config.animation||this.tip&&this.tip.classList.contains(ns)}_isShown(){return this.tip&&this.tip.classList.contains(ss)}_createPopper(t){const e=Xt(this._config.placement,[this,t,this._element]),i=hs[e.toUpperCase()];return Dt(this._element,t,this._getPopperConfig(i))}_getOffset(){const{offset:t}=this._config;return"string"==typeof t?t.split(",").map((t=>Number.parseInt(t,10))):"function"==typeof t?e=>t(e,this._element):t}_resolvePossibleFunction(t){return Xt(t,[this._element])}_getPopperConfig(t){const e={placement:t,modifiers:[{name:"flip",options:{fallbackPlacements:this._config.fallbackPlacements}},{name:"offset",options:{offset:this._getOffset()}},{name:"preventOverflow",options:{boundary:this._config.boundary}},{name:"arrow",options:{element:`.${this.constructor.NAME}-arrow`}},{name:"preSetPlacement",enabled:!0,phase:"beforeMain",fn:t=>{this._getTipElement().setAttribute("data-popper-placement",t.state.placement)}}]};return{...e,...Xt(this._config.popperConfig,[e])}}_setListeners(){const t=this._config.trigger.split(" ");for(const e of t)if("click"===e)fe.on(this._element,this.constructor.eventName("click"),this._config.selector,(t=>{this._initializeOnDelegatedTarget(t).toggle()}));else if("manual"!==e){const t=e===ls?this.constructor.eventName("mouseenter"):this.constructor.eventName("focusin"),i=e===ls?this.constructor.eventName("mouseleave"):this.constructor.eventName("focusout");fe.on(this._element,t,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusin"===t.type?cs:ls]=!0,e._enter()})),fe.on(this._element,i,this._config.selector,(t=>{const e=this._initializeOnDelegatedTarget(t);e._activeTrigger["focusout"===t.type?cs:ls]=e._element.contains(t.relatedTarget),e._leave()}))}this._hideModalHandler=()=>{this._element&&this.hide()},fe.on(this._element.closest(rs),as,this._hideModalHandler)}_fixTitle(){const t=this._element.getAttribute("title");t&&(this._element.getAttribute("aria-label")||this._element.textContent.trim()||this._element.setAttribute("aria-label",t),this._element.setAttribute("data-bs-original-title",t),this._element.removeAttribute("title"))}_enter(){this._isShown()||this._isHovered?this._isHovered=!0:(this._isHovered=!0,this._setTimeout((()=>{this._isHovered&&this.show()}),this._config.delay.show))}_leave(){this._isWithActiveTrigger()||(this._isHovered=!1,this._setTimeout((()=>{this._isHovered||this.hide()}),this._config.delay.hide))}_setTimeout(t,e){clearTimeout(this._timeout),this._timeout=setTimeout(t,e)}_isWithActiveTrigger(){return Object.values(this._activeTrigger).includes(!0)}_getConfig(t){const e=_e.getDataAttributes(this._element);for(const t of Object.keys(e))is.has(t)&&delete e[t];return t={...e,..."object"==typeof t&&t?t:{}},t=this._mergeConfigObj(t),t=this._configAfterMerge(t),this._typeCheckConfig(t),t}_configAfterMerge(t){return t.container=!1===t.container?document.body:Ht(t.container),"number"==typeof t.delay&&(t.delay={show:t.delay,hide:t.delay}),"number"==typeof t.title&&(t.title=t.title.toString()),"number"==typeof t.content&&(t.content=t.content.toString()),t}_getDelegateConfig(){const t={};for(const[e,i]of Object.entries(this._config))this.constructor.Default[e]!==i&&(t[e]=i);return t.selector=!1,t.trigger="manual",t}_disposePopper(){this._popper&&(this._popper.destroy(),this._popper=null),this.tip&&(this.tip.remove(),this.tip=null)}static jQueryInterface(t){return this.each((function(){const e=fs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(fs);const ps=".popover-header",ms=".popover-body",gs={...fs.Default,content:"",offset:[0,8],placement:"right",template:'',trigger:"click"},_s={...fs.DefaultType,content:"(null|string|element|function)"};class bs extends fs{static get Default(){return gs}static get DefaultType(){return _s}static get NAME(){return"popover"}_isWithContent(){return this._getTitle()||this._getContent()}_getContentForTemplate(){return{[ps]:this._getTitle(),[ms]:this._getContent()}}_getContent(){return this._resolvePossibleFunction(this._config.content)}static jQueryInterface(t){return this.each((function(){const e=bs.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t]()}}))}}Qt(bs);const vs=".bs.scrollspy",ys=`activate${vs}`,ws=`click${vs}`,Es=`load${vs}.data-api`,As="active",Ts="[href]",Cs=".nav-link",Os=`${Cs}, .nav-item > ${Cs}, .list-group-item`,xs={offset:null,rootMargin:"0px 0px -25%",smoothScroll:!1,target:null,threshold:[.1,.5,1]},ks={offset:"(number|null)",rootMargin:"string",smoothScroll:"boolean",target:"element",threshold:"array"};class Ls extends ve{constructor(t,e){super(t,e),this._targetLinks=new Map,this._observableSections=new Map,this._rootElement="visible"===getComputedStyle(this._element).overflowY?null:this._element,this._activeTarget=null,this._observer=null,this._previousScrollData={visibleEntryTop:0,parentScrollTop:0},this.refresh()}static get Default(){return xs}static get DefaultType(){return ks}static get NAME(){return"scrollspy"}refresh(){this._initializeTargetsAndObservables(),this._maybeEnableSmoothScroll(),this._observer?this._observer.disconnect():this._observer=this._getNewObserver();for(const t of this._observableSections.values())this._observer.observe(t)}dispose(){this._observer.disconnect(),super.dispose()}_configAfterMerge(t){return t.target=Ht(t.target)||document.body,t.rootMargin=t.offset?`${t.offset}px 0px -30%`:t.rootMargin,"string"==typeof t.threshold&&(t.threshold=t.threshold.split(",").map((t=>Number.parseFloat(t)))),t}_maybeEnableSmoothScroll(){this._config.smoothScroll&&(fe.off(this._config.target,ws),fe.on(this._config.target,ws,Ts,(t=>{const e=this._observableSections.get(t.target.hash);if(e){t.preventDefault();const i=this._rootElement||window,n=e.offsetTop-this._element.offsetTop;if(i.scrollTo)return void i.scrollTo({top:n,behavior:"smooth"});i.scrollTop=n}})))}_getNewObserver(){const t={root:this._rootElement,threshold:this._config.threshold,rootMargin:this._config.rootMargin};return new IntersectionObserver((t=>this._observerCallback(t)),t)}_observerCallback(t){const e=t=>this._targetLinks.get(`#${t.target.id}`),i=t=>{this._previousScrollData.visibleEntryTop=t.target.offsetTop,this._process(e(t))},n=(this._rootElement||document.documentElement).scrollTop,s=n>=this._previousScrollData.parentScrollTop;this._previousScrollData.parentScrollTop=n;for(const o of t){if(!o.isIntersecting){this._activeTarget=null,this._clearActiveClass(e(o));continue}const t=o.target.offsetTop>=this._previousScrollData.visibleEntryTop;if(s&&t){if(i(o),!n)return}else s||t||i(o)}}_initializeTargetsAndObservables(){this._targetLinks=new Map,this._observableSections=new Map;const t=we.find(Ts,this._config.target);for(const e of t){if(!e.hash||Wt(e))continue;const t=we.findOne(decodeURI(e.hash),this._element);Bt(t)&&(this._targetLinks.set(decodeURI(e.hash),e),this._observableSections.set(e.hash,t))}}_process(t){this._activeTarget!==t&&(this._clearActiveClass(this._config.target),this._activeTarget=t,t.classList.add(As),this._activateParents(t),fe.trigger(this._element,ys,{relatedTarget:t}))}_activateParents(t){if(t.classList.contains("dropdown-item"))we.findOne(".dropdown-toggle",t.closest(".dropdown")).classList.add(As);else for(const e of we.parents(t,".nav, .list-group"))for(const t of we.prev(e,Os))t.classList.add(As)}_clearActiveClass(t){t.classList.remove(As);const e=we.find(`${Ts}.${As}`,t);for(const t of e)t.classList.remove(As)}static jQueryInterface(t){return this.each((function(){const e=Ls.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}fe.on(window,Es,(()=>{for(const t of we.find('[data-bs-spy="scroll"]'))Ls.getOrCreateInstance(t)})),Qt(Ls);const Ss=".bs.tab",Ds=`hide${Ss}`,$s=`hidden${Ss}`,Is=`show${Ss}`,Ns=`shown${Ss}`,Ps=`click${Ss}`,Ms=`keydown${Ss}`,js=`load${Ss}`,Fs="ArrowLeft",Hs="ArrowRight",Bs="ArrowUp",Ws="ArrowDown",zs="Home",Rs="End",qs="active",Vs="fade",Ys="show",Ks=".dropdown-toggle",Qs=`:not(${Ks})`,Xs='[data-bs-toggle="tab"], [data-bs-toggle="pill"], [data-bs-toggle="list"]',Us=`.nav-link${Qs}, .list-group-item${Qs}, [role="tab"]${Qs}, ${Xs}`,Gs=`.${qs}[data-bs-toggle="tab"], .${qs}[data-bs-toggle="pill"], .${qs}[data-bs-toggle="list"]`;class Js extends ve{constructor(t){super(t),this._parent=this._element.closest('.list-group, .nav, [role="tablist"]'),this._parent&&(this._setInitialAttributes(this._parent,this._getChildren()),fe.on(this._element,Ms,(t=>this._keydown(t))))}static get NAME(){return"tab"}show(){const t=this._element;if(this._elemIsActive(t))return;const e=this._getActiveElem(),i=e?fe.trigger(e,Ds,{relatedTarget:t}):null;fe.trigger(t,Is,{relatedTarget:e}).defaultPrevented||i&&i.defaultPrevented||(this._deactivate(e,t),this._activate(t,e))}_activate(t,e){t&&(t.classList.add(qs),this._activate(we.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.removeAttribute("tabindex"),t.setAttribute("aria-selected",!0),this._toggleDropDown(t,!0),fe.trigger(t,Ns,{relatedTarget:e})):t.classList.add(Ys)}),t,t.classList.contains(Vs)))}_deactivate(t,e){t&&(t.classList.remove(qs),t.blur(),this._deactivate(we.getElementFromSelector(t)),this._queueCallback((()=>{"tab"===t.getAttribute("role")?(t.setAttribute("aria-selected",!1),t.setAttribute("tabindex","-1"),this._toggleDropDown(t,!1),fe.trigger(t,$s,{relatedTarget:e})):t.classList.remove(Ys)}),t,t.classList.contains(Vs)))}_keydown(t){if(![Fs,Hs,Bs,Ws,zs,Rs].includes(t.key))return;t.stopPropagation(),t.preventDefault();const e=this._getChildren().filter((t=>!Wt(t)));let i;if([zs,Rs].includes(t.key))i=e[t.key===zs?0:e.length-1];else{const n=[Hs,Ws].includes(t.key);i=Gt(e,t.target,n,!0)}i&&(i.focus({preventScroll:!0}),Js.getOrCreateInstance(i).show())}_getChildren(){return we.find(Us,this._parent)}_getActiveElem(){return this._getChildren().find((t=>this._elemIsActive(t)))||null}_setInitialAttributes(t,e){this._setAttributeIfNotExists(t,"role","tablist");for(const t of e)this._setInitialAttributesOnChild(t)}_setInitialAttributesOnChild(t){t=this._getInnerElement(t);const e=this._elemIsActive(t),i=this._getOuterElement(t);t.setAttribute("aria-selected",e),i!==t&&this._setAttributeIfNotExists(i,"role","presentation"),e||t.setAttribute("tabindex","-1"),this._setAttributeIfNotExists(t,"role","tab"),this._setInitialAttributesOnTargetPanel(t)}_setInitialAttributesOnTargetPanel(t){const e=we.getElementFromSelector(t);e&&(this._setAttributeIfNotExists(e,"role","tabpanel"),t.id&&this._setAttributeIfNotExists(e,"aria-labelledby",`${t.id}`))}_toggleDropDown(t,e){const i=this._getOuterElement(t);if(!i.classList.contains("dropdown"))return;const n=(t,n)=>{const s=we.findOne(t,i);s&&s.classList.toggle(n,e)};n(Ks,qs),n(".dropdown-menu",Ys),i.setAttribute("aria-expanded",e)}_setAttributeIfNotExists(t,e,i){t.hasAttribute(e)||t.setAttribute(e,i)}_elemIsActive(t){return t.classList.contains(qs)}_getInnerElement(t){return t.matches(Us)?t:we.findOne(Us,t)}_getOuterElement(t){return t.closest(".nav-item, .list-group-item")||t}static jQueryInterface(t){return this.each((function(){const e=Js.getOrCreateInstance(this);if("string"==typeof t){if(void 0===e[t]||t.startsWith("_")||"constructor"===t)throw new TypeError(`No method named "${t}"`);e[t]()}}))}}fe.on(document,Ps,Xs,(function(t){["A","AREA"].includes(this.tagName)&&t.preventDefault(),Wt(this)||Js.getOrCreateInstance(this).show()})),fe.on(window,js,(()=>{for(const t of we.find(Gs))Js.getOrCreateInstance(t)})),Qt(Js);const Zs=".bs.toast",to=`mouseover${Zs}`,eo=`mouseout${Zs}`,io=`focusin${Zs}`,no=`focusout${Zs}`,so=`hide${Zs}`,oo=`hidden${Zs}`,ro=`show${Zs}`,ao=`shown${Zs}`,lo="hide",co="show",ho="showing",uo={animation:"boolean",autohide:"boolean",delay:"number"},fo={animation:!0,autohide:!0,delay:5e3};class po extends ve{constructor(t,e){super(t,e),this._timeout=null,this._hasMouseInteraction=!1,this._hasKeyboardInteraction=!1,this._setListeners()}static get Default(){return fo}static get DefaultType(){return uo}static get NAME(){return"toast"}show(){fe.trigger(this._element,ro).defaultPrevented||(this._clearTimeout(),this._config.animation&&this._element.classList.add("fade"),this._element.classList.remove(lo),qt(this._element),this._element.classList.add(co,ho),this._queueCallback((()=>{this._element.classList.remove(ho),fe.trigger(this._element,ao),this._maybeScheduleHide()}),this._element,this._config.animation))}hide(){this.isShown()&&(fe.trigger(this._element,so).defaultPrevented||(this._element.classList.add(ho),this._queueCallback((()=>{this._element.classList.add(lo),this._element.classList.remove(ho,co),fe.trigger(this._element,oo)}),this._element,this._config.animation)))}dispose(){this._clearTimeout(),this.isShown()&&this._element.classList.remove(co),super.dispose()}isShown(){return this._element.classList.contains(co)}_maybeScheduleHide(){this._config.autohide&&(this._hasMouseInteraction||this._hasKeyboardInteraction||(this._timeout=setTimeout((()=>{this.hide()}),this._config.delay)))}_onInteraction(t,e){switch(t.type){case"mouseover":case"mouseout":this._hasMouseInteraction=e;break;case"focusin":case"focusout":this._hasKeyboardInteraction=e}if(e)return void this._clearTimeout();const i=t.relatedTarget;this._element===i||this._element.contains(i)||this._maybeScheduleHide()}_setListeners(){fe.on(this._element,to,(t=>this._onInteraction(t,!0))),fe.on(this._element,eo,(t=>this._onInteraction(t,!1))),fe.on(this._element,io,(t=>this._onInteraction(t,!0))),fe.on(this._element,no,(t=>this._onInteraction(t,!1)))}_clearTimeout(){clearTimeout(this._timeout),this._timeout=null}static jQueryInterface(t){return this.each((function(){const e=po.getOrCreateInstance(this,t);if("string"==typeof t){if(void 0===e[t])throw new TypeError(`No method named "${t}"`);e[t](this)}}))}}function mo(t){"loading"!=document.readyState?t():document.addEventListener("DOMContentLoaded",t)}Ee(po),Qt(po),mo((function(){[].slice.call(document.querySelectorAll('[data-bs-toggle="tooltip"]')).map((function(t){return new fs(t,{delay:{show:500,hide:100}})}))})),mo((function(){document.getElementById("pst-back-to-top").addEventListener("click",(function(){document.body.scrollTop=0,document.documentElement.scrollTop=0}))})),mo((function(){var t=document.getElementById("pst-back-to-top"),e=document.getElementsByClassName("bd-header")[0].getBoundingClientRect();window.addEventListener("scroll",(function(){this.oldScroll>this.scrollY&&this.scrollY>e.bottom?t.style.display="block":t.style.display="none",this.oldScroll=this.scrollY}))})),window.bootstrap=i})(); +//# sourceMappingURL=bootstrap.js.map \ No newline at end of file diff --git a/msspecbook/_build/html/_static/scripts/bootstrap.js.LICENSE.txt b/msspecbook/_build/html/_static/scripts/bootstrap.js.LICENSE.txt new file mode 100644 index 0000000..28755c2 --- /dev/null +++ b/msspecbook/_build/html/_static/scripts/bootstrap.js.LICENSE.txt @@ -0,0 +1,5 @@ +/*! + * Bootstrap v5.3.3 (https://getbootstrap.com/) + * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE) + */ diff --git a/msspecbook/_build/html/_static/scripts/bootstrap.js.map b/msspecbook/_build/html/_static/scripts/bootstrap.js.map new file mode 100644 index 0000000..e9e8158 --- /dev/null +++ b/msspecbook/_build/html/_static/scripts/bootstrap.js.map @@ -0,0 +1 @@ +{"version":3,"file":"scripts/bootstrap.js","mappings":";mBACA,IAAIA,EAAsB,CCA1BA,EAAwB,CAACC,EAASC,KACjC,IAAI,IAAIC,KAAOD,EACXF,EAAoBI,EAAEF,EAAYC,KAASH,EAAoBI,EAAEH,EAASE,IAC5EE,OAAOC,eAAeL,EAASE,EAAK,CAAEI,YAAY,EAAMC,IAAKN,EAAWC,IAE1E,ECNDH,EAAwB,CAACS,EAAKC,IAAUL,OAAOM,UAAUC,eAAeC,KAAKJ,EAAKC,GCClFV,EAAyBC,IACH,oBAAXa,QAA0BA,OAAOC,aAC1CV,OAAOC,eAAeL,EAASa,OAAOC,YAAa,CAAEC,MAAO,WAE7DX,OAAOC,eAAeL,EAAS,aAAc,CAAEe,OAAO,GAAO,01BCLvD,IAAI,EAAM,MACNC,EAAS,SACTC,EAAQ,QACRC,EAAO,OACPC,EAAO,OACPC,EAAiB,CAAC,EAAKJ,EAAQC,EAAOC,GACtCG,EAAQ,QACRC,EAAM,MACNC,EAAkB,kBAClBC,EAAW,WACXC,EAAS,SACTC,EAAY,YACZC,EAAmCP,EAAeQ,QAAO,SAAUC,EAAKC,GACjF,OAAOD,EAAIE,OAAO,CAACD,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAChE,GAAG,IACQ,EAA0B,GAAGS,OAAOX,EAAgB,CAACD,IAAOS,QAAO,SAAUC,EAAKC,GAC3F,OAAOD,EAAIE,OAAO,CAACD,EAAWA,EAAY,IAAMT,EAAOS,EAAY,IAAMR,GAC3E,GAAG,IAEQU,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAa,aACbC,EAAO,OACPC,EAAY,YAEZC,EAAc,cACdC,EAAQ,QACRC,EAAa,aACbC,EAAiB,CAACT,EAAYC,EAAMC,EAAWC,EAAYC,EAAMC,EAAWC,EAAaC,EAAOC,GC9B5F,SAASE,EAAYC,GAClC,OAAOA,GAAWA,EAAQC,UAAY,IAAIC,cAAgB,IAC5D,CCFe,SAASC,EAAUC,GAChC,GAAY,MAARA,EACF,OAAOC,OAGT,GAAwB,oBAApBD,EAAKE,WAAkC,CACzC,IAAIC,EAAgBH,EAAKG,cACzB,OAAOA,GAAgBA,EAAcC,aAAwBH,MAC/D,CAEA,OAAOD,CACT,CCTA,SAASK,EAAUL,GAEjB,OAAOA,aADUD,EAAUC,GAAMM,SACIN,aAAgBM,OACvD,CAEA,SAASC,EAAcP,GAErB,OAAOA,aADUD,EAAUC,GAAMQ,aACIR,aAAgBQ,WACvD,CAEA,SAASC,EAAaT,GAEpB,MAA0B,oBAAfU,aAKJV,aADUD,EAAUC,GAAMU,YACIV,aAAgBU,WACvD,CCwDA,SACEC,KAAM,cACNC,SAAS,EACTC,MAAO,QACPC,GA5EF,SAAqBC,GACnB,IAAIC,EAAQD,EAAKC,MACjB3D,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIS,EAAQJ,EAAMK,OAAOV,IAAS,CAAC,EAC/BW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EACxCf,EAAUoB,EAAME,SAASP,GAExBJ,EAAcX,IAAaD,EAAYC,KAO5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUR,GACxC,IAAI3C,EAAQsD,EAAWX,IAET,IAAV3C,EACF4B,EAAQ4B,gBAAgBb,GAExBf,EAAQ6B,aAAad,GAAgB,IAAV3C,EAAiB,GAAKA,EAErD,IACF,GACF,EAoDE0D,OAlDF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MACdY,EAAgB,CAClBlD,OAAQ,CACNmD,SAAUb,EAAMc,QAAQC,SACxB5D,KAAM,IACN6D,IAAK,IACLC,OAAQ,KAEVC,MAAO,CACLL,SAAU,YAEZlD,UAAW,CAAC,GASd,OAPAtB,OAAOkE,OAAOP,EAAME,SAASxC,OAAO0C,MAAOQ,EAAclD,QACzDsC,EAAMK,OAASO,EAEXZ,EAAME,SAASgB,OACjB7E,OAAOkE,OAAOP,EAAME,SAASgB,MAAMd,MAAOQ,EAAcM,OAGnD,WACL7E,OAAO4D,KAAKD,EAAME,UAAUC,SAAQ,SAAUR,GAC5C,IAAIf,EAAUoB,EAAME,SAASP,GACzBW,EAAaN,EAAMM,WAAWX,IAAS,CAAC,EAGxCS,EAFkB/D,OAAO4D,KAAKD,EAAMK,OAAOzD,eAAe+C,GAAQK,EAAMK,OAAOV,GAAQiB,EAAcjB,IAE7E9B,QAAO,SAAUuC,EAAOe,GAElD,OADAf,EAAMe,GAAY,GACXf,CACT,GAAG,CAAC,GAECb,EAAcX,IAAaD,EAAYC,KAI5CvC,OAAOkE,OAAO3B,EAAQwB,MAAOA,GAC7B/D,OAAO4D,KAAKK,GAAYH,SAAQ,SAAUiB,GACxCxC,EAAQ4B,gBAAgBY,EAC1B,IACF,GACF,CACF,EASEC,SAAU,CAAC,kBCjFE,SAASC,EAAiBvD,GACvC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCHO,IAAI,EAAMC,KAAKC,IACX,EAAMD,KAAKE,IACXC,EAAQH,KAAKG,MCFT,SAASC,IACtB,IAAIC,EAASC,UAAUC,cAEvB,OAAc,MAAVF,GAAkBA,EAAOG,QAAUC,MAAMC,QAAQL,EAAOG,QACnDH,EAAOG,OAAOG,KAAI,SAAUC,GACjC,OAAOA,EAAKC,MAAQ,IAAMD,EAAKE,OACjC,IAAGC,KAAK,KAGHT,UAAUU,SACnB,CCTe,SAASC,IACtB,OAAQ,iCAAiCC,KAAKd,IAChD,CCCe,SAASe,EAAsB/D,EAASgE,EAAcC,QAC9C,IAAjBD,IACFA,GAAe,QAGO,IAApBC,IACFA,GAAkB,GAGpB,IAAIC,EAAalE,EAAQ+D,wBACrBI,EAAS,EACTC,EAAS,EAETJ,GAAgBrD,EAAcX,KAChCmE,EAASnE,EAAQqE,YAAc,GAAItB,EAAMmB,EAAWI,OAAStE,EAAQqE,aAAmB,EACxFD,EAASpE,EAAQuE,aAAe,GAAIxB,EAAMmB,EAAWM,QAAUxE,EAAQuE,cAAoB,GAG7F,IACIE,GADOhE,EAAUT,GAAWG,EAAUH,GAAWK,QAC3BoE,eAEtBC,GAAoBb,KAAsBI,EAC1CU,GAAKT,EAAW3F,MAAQmG,GAAoBD,EAAiBA,EAAeG,WAAa,IAAMT,EAC/FU,GAAKX,EAAW9B,KAAOsC,GAAoBD,EAAiBA,EAAeK,UAAY,IAAMV,EAC7FE,EAAQJ,EAAWI,MAAQH,EAC3BK,EAASN,EAAWM,OAASJ,EACjC,MAAO,CACLE,MAAOA,EACPE,OAAQA,EACRpC,IAAKyC,EACLvG,MAAOqG,EAAIL,EACXjG,OAAQwG,EAAIL,EACZjG,KAAMoG,EACNA,EAAGA,EACHE,EAAGA,EAEP,CCrCe,SAASE,EAAc/E,GACpC,IAAIkE,EAAaH,EAAsB/D,GAGnCsE,EAAQtE,EAAQqE,YAChBG,EAASxE,EAAQuE,aAUrB,OARI3B,KAAKoC,IAAId,EAAWI,MAAQA,IAAU,IACxCA,EAAQJ,EAAWI,OAGjB1B,KAAKoC,IAAId,EAAWM,OAASA,IAAW,IAC1CA,EAASN,EAAWM,QAGf,CACLG,EAAG3E,EAAQ4E,WACXC,EAAG7E,EAAQ8E,UACXR,MAAOA,EACPE,OAAQA,EAEZ,CCvBe,SAASS,EAASC,EAAQC,GACvC,IAAIC,EAAWD,EAAME,aAAeF,EAAME,cAE1C,GAAIH,EAAOD,SAASE,GAClB,OAAO,EAEJ,GAAIC,GAAYvE,EAAauE,GAAW,CACzC,IAAIE,EAAOH,EAEX,EAAG,CACD,GAAIG,GAAQJ,EAAOK,WAAWD,GAC5B,OAAO,EAITA,EAAOA,EAAKE,YAAcF,EAAKG,IACjC,OAASH,EACX,CAGF,OAAO,CACT,CCrBe,SAAS,EAAiBtF,GACvC,OAAOG,EAAUH,GAAS0F,iBAAiB1F,EAC7C,CCFe,SAAS2F,EAAe3F,GACrC,MAAO,CAAC,QAAS,KAAM,MAAM4F,QAAQ7F,EAAYC,KAAa,CAChE,CCFe,SAAS6F,EAAmB7F,GAEzC,QAASS,EAAUT,GAAWA,EAAQO,cACtCP,EAAQ8F,WAAazF,OAAOyF,UAAUC,eACxC,CCFe,SAASC,EAAchG,GACpC,MAA6B,SAAzBD,EAAYC,GACPA,EAMPA,EAAQiG,cACRjG,EAAQwF,aACR3E,EAAab,GAAWA,EAAQyF,KAAO,OAEvCI,EAAmB7F,EAGvB,CCVA,SAASkG,EAAoBlG,GAC3B,OAAKW,EAAcX,IACoB,UAAvC,EAAiBA,GAASiC,SAInBjC,EAAQmG,aAHN,IAIX,CAwCe,SAASC,EAAgBpG,GAItC,IAHA,IAAIK,EAASF,EAAUH,GACnBmG,EAAeD,EAAoBlG,GAEhCmG,GAAgBR,EAAeQ,IAA6D,WAA5C,EAAiBA,GAAclE,UACpFkE,EAAeD,EAAoBC,GAGrC,OAAIA,IAA+C,SAA9BpG,EAAYoG,IAA0D,SAA9BpG,EAAYoG,IAAwE,WAA5C,EAAiBA,GAAclE,UAC3H5B,EAGF8F,GAhDT,SAA4BnG,GAC1B,IAAIqG,EAAY,WAAWvC,KAAKd,KAGhC,GAFW,WAAWc,KAAKd,MAEfrC,EAAcX,IAII,UAFX,EAAiBA,GAEnBiC,SACb,OAAO,KAIX,IAAIqE,EAAcN,EAAchG,GAMhC,IAJIa,EAAayF,KACfA,EAAcA,EAAYb,MAGrB9E,EAAc2F,IAAgB,CAAC,OAAQ,QAAQV,QAAQ7F,EAAYuG,IAAgB,GAAG,CAC3F,IAAIC,EAAM,EAAiBD,GAI3B,GAAsB,SAAlBC,EAAIC,WAA4C,SAApBD,EAAIE,aAA0C,UAAhBF,EAAIG,UAAiF,IAA1D,CAAC,YAAa,eAAed,QAAQW,EAAII,aAAsBN,GAAgC,WAAnBE,EAAII,YAA2BN,GAAaE,EAAIK,QAAyB,SAAfL,EAAIK,OACjO,OAAON,EAEPA,EAAcA,EAAYd,UAE9B,CAEA,OAAO,IACT,CAgByBqB,CAAmB7G,IAAYK,CACxD,CCpEe,SAASyG,EAAyB3H,GAC/C,MAAO,CAAC,MAAO,UAAUyG,QAAQzG,IAAc,EAAI,IAAM,GAC3D,CCDO,SAAS4H,EAAOjE,EAAK1E,EAAOyE,GACjC,OAAO,EAAQC,EAAK,EAAQ1E,EAAOyE,GACrC,CCFe,SAASmE,EAAmBC,GACzC,OAAOxJ,OAAOkE,OAAO,CAAC,ECDf,CACLS,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GDHuC0I,EACjD,CEHe,SAASC,EAAgB9I,EAAOiD,GAC7C,OAAOA,EAAKpC,QAAO,SAAUkI,EAAS5J,GAEpC,OADA4J,EAAQ5J,GAAOa,EACR+I,CACT,GAAG,CAAC,EACN,CC4EA,SACEpG,KAAM,QACNC,SAAS,EACTC,MAAO,OACPC,GApEF,SAAeC,GACb,IAAIiG,EAEAhG,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZmB,EAAUf,EAAKe,QACfmF,EAAejG,EAAME,SAASgB,MAC9BgF,EAAgBlG,EAAMmG,cAAcD,cACpCE,EAAgB9E,EAAiBtB,EAAMjC,WACvCsI,EAAOX,EAAyBU,GAEhCE,EADa,CAACnJ,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAClC,SAAW,QAElC,GAAKH,GAAiBC,EAAtB,CAIA,IAAIL,EAxBgB,SAAyBU,EAASvG,GAItD,OAAO4F,EAAsC,iBAH7CW,EAA6B,mBAAZA,EAAyBA,EAAQlK,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CAC/EzI,UAAWiC,EAAMjC,aACbwI,GACkDA,EAAUT,EAAgBS,EAASlJ,GAC7F,CAmBsBoJ,CAAgB3F,EAAQyF,QAASvG,GACjD0G,EAAY/C,EAAcsC,GAC1BU,EAAmB,MAATN,EAAe,EAAMlJ,EAC/ByJ,EAAmB,MAATP,EAAepJ,EAASC,EAClC2J,EAAU7G,EAAMwG,MAAM7I,UAAU2I,GAAOtG,EAAMwG,MAAM7I,UAAU0I,GAAQH,EAAcG,GAAQrG,EAAMwG,MAAM9I,OAAO4I,GAC9GQ,EAAYZ,EAAcG,GAAQrG,EAAMwG,MAAM7I,UAAU0I,GACxDU,EAAoB/B,EAAgBiB,GACpCe,EAAaD,EAA6B,MAATV,EAAeU,EAAkBE,cAAgB,EAAIF,EAAkBG,aAAe,EAAI,EAC3HC,EAAoBN,EAAU,EAAIC,EAAY,EAG9CpF,EAAMmE,EAAcc,GACpBlF,EAAMuF,EAAaN,EAAUJ,GAAOT,EAAce,GAClDQ,EAASJ,EAAa,EAAIN,EAAUJ,GAAO,EAAIa,EAC/CE,EAAS1B,EAAOjE,EAAK0F,EAAQ3F,GAE7B6F,EAAWjB,EACfrG,EAAMmG,cAAcxG,KAASqG,EAAwB,CAAC,GAAyBsB,GAAYD,EAAQrB,EAAsBuB,aAAeF,EAASD,EAAQpB,EAnBzJ,CAoBF,EAkCEtF,OAhCF,SAAgBC,GACd,IAAIX,EAAQW,EAAMX,MAEdwH,EADU7G,EAAMG,QACWlC,QAC3BqH,OAAoC,IAArBuB,EAA8B,sBAAwBA,EAErD,MAAhBvB,IAKwB,iBAAjBA,IACTA,EAAejG,EAAME,SAASxC,OAAO+J,cAAcxB,MAOhDpC,EAAS7D,EAAME,SAASxC,OAAQuI,KAIrCjG,EAAME,SAASgB,MAAQ+E,EACzB,EASE5E,SAAU,CAAC,iBACXqG,iBAAkB,CAAC,oBCxFN,SAASC,EAAa5J,GACnC,OAAOA,EAAUwD,MAAM,KAAK,EAC9B,CCOA,IAAIqG,GAAa,CACf5G,IAAK,OACL9D,MAAO,OACPD,OAAQ,OACRE,KAAM,QAeD,SAAS0K,GAAYlH,GAC1B,IAAImH,EAEApK,EAASiD,EAAMjD,OACfqK,EAAapH,EAAMoH,WACnBhK,EAAY4C,EAAM5C,UAClBiK,EAAYrH,EAAMqH,UAClBC,EAAUtH,EAAMsH,QAChBpH,EAAWF,EAAME,SACjBqH,EAAkBvH,EAAMuH,gBACxBC,EAAWxH,EAAMwH,SACjBC,EAAezH,EAAMyH,aACrBC,EAAU1H,EAAM0H,QAChBC,EAAaL,EAAQ1E,EACrBA,OAAmB,IAAf+E,EAAwB,EAAIA,EAChCC,EAAaN,EAAQxE,EACrBA,OAAmB,IAAf8E,EAAwB,EAAIA,EAEhCC,EAAgC,mBAAjBJ,EAA8BA,EAAa,CAC5D7E,EAAGA,EACHE,IACG,CACHF,EAAGA,EACHE,GAGFF,EAAIiF,EAAMjF,EACVE,EAAI+E,EAAM/E,EACV,IAAIgF,EAAOR,EAAQrL,eAAe,KAC9B8L,EAAOT,EAAQrL,eAAe,KAC9B+L,EAAQxL,EACRyL,EAAQ,EACRC,EAAM5J,OAEV,GAAIkJ,EAAU,CACZ,IAAIpD,EAAeC,EAAgBtH,GAC/BoL,EAAa,eACbC,EAAY,cAEZhE,IAAiBhG,EAAUrB,IAGmB,WAA5C,EAFJqH,EAAeN,EAAmB/G,IAECmD,UAAsC,aAAbA,IAC1DiI,EAAa,eACbC,EAAY,gBAOZhL,IAAc,IAAQA,IAAcZ,GAAQY,IAAcb,IAAU8K,IAAczK,KACpFqL,EAAQ3L,EAGRwG,IAFc4E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeD,OACzF2B,EAAa+D,IACEf,EAAW3E,OAC1BK,GAAKyE,EAAkB,GAAK,GAG1BnK,IAAcZ,IAASY,IAAc,GAAOA,IAAcd,GAAW+K,IAAczK,KACrFoL,EAAQzL,EAGRqG,IAFc8E,GAAWtD,IAAiB8D,GAAOA,EAAIxF,eAAiBwF,EAAIxF,eAAeH,MACzF6B,EAAagE,IACEhB,EAAW7E,MAC1BK,GAAK2E,EAAkB,GAAK,EAEhC,CAEA,IAgBMc,EAhBFC,EAAe5M,OAAOkE,OAAO,CAC/BM,SAAUA,GACTsH,GAAYP,IAEXsB,GAAyB,IAAjBd,EAlFd,SAA2BrI,EAAM8I,GAC/B,IAAItF,EAAIxD,EAAKwD,EACTE,EAAI1D,EAAK0D,EACT0F,EAAMN,EAAIO,kBAAoB,EAClC,MAAO,CACL7F,EAAG5B,EAAM4B,EAAI4F,GAAOA,GAAO,EAC3B1F,EAAG9B,EAAM8B,EAAI0F,GAAOA,GAAO,EAE/B,CA0EsCE,CAAkB,CACpD9F,EAAGA,EACHE,GACC1E,EAAUrB,IAAW,CACtB6F,EAAGA,EACHE,GAMF,OAHAF,EAAI2F,EAAM3F,EACVE,EAAIyF,EAAMzF,EAENyE,EAGK7L,OAAOkE,OAAO,CAAC,EAAG0I,IAAeD,EAAiB,CAAC,GAAkBJ,GAASF,EAAO,IAAM,GAAIM,EAAeL,GAASF,EAAO,IAAM,GAAIO,EAAe5D,WAAayD,EAAIO,kBAAoB,IAAM,EAAI,aAAe7F,EAAI,OAASE,EAAI,MAAQ,eAAiBF,EAAI,OAASE,EAAI,SAAUuF,IAG5R3M,OAAOkE,OAAO,CAAC,EAAG0I,IAAenB,EAAkB,CAAC,GAAmBc,GAASF,EAAOjF,EAAI,KAAO,GAAIqE,EAAgBa,GAASF,EAAOlF,EAAI,KAAO,GAAIuE,EAAgB1C,UAAY,GAAI0C,GAC9L,CA4CA,UACEnI,KAAM,gBACNC,SAAS,EACTC,MAAO,cACPC,GA9CF,SAAuBwJ,GACrB,IAAItJ,EAAQsJ,EAAMtJ,MACdc,EAAUwI,EAAMxI,QAChByI,EAAwBzI,EAAQoH,gBAChCA,OAA4C,IAA1BqB,GAA0CA,EAC5DC,EAAoB1I,EAAQqH,SAC5BA,OAAiC,IAAtBqB,GAAsCA,EACjDC,EAAwB3I,EAAQsH,aAChCA,OAAyC,IAA1BqB,GAA0CA,EACzDR,EAAe,CACjBlL,UAAWuD,EAAiBtB,EAAMjC,WAClCiK,UAAWL,EAAa3H,EAAMjC,WAC9BL,OAAQsC,EAAME,SAASxC,OACvBqK,WAAY/H,EAAMwG,MAAM9I,OACxBwK,gBAAiBA,EACjBG,QAAoC,UAA3BrI,EAAMc,QAAQC,UAGgB,MAArCf,EAAMmG,cAAcD,gBACtBlG,EAAMK,OAAO3C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAO3C,OAAQmK,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACvGhB,QAASjI,EAAMmG,cAAcD,cAC7BrF,SAAUb,EAAMc,QAAQC,SACxBoH,SAAUA,EACVC,aAAcA,OAIe,MAA7BpI,EAAMmG,cAAcjF,QACtBlB,EAAMK,OAAOa,MAAQ7E,OAAOkE,OAAO,CAAC,EAAGP,EAAMK,OAAOa,MAAO2G,GAAYxL,OAAOkE,OAAO,CAAC,EAAG0I,EAAc,CACrGhB,QAASjI,EAAMmG,cAAcjF,MAC7BL,SAAU,WACVsH,UAAU,EACVC,aAAcA,OAIlBpI,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,wBAAyBsC,EAAMjC,WAEnC,EAQE2L,KAAM,CAAC,GCrKT,IAAIC,GAAU,CACZA,SAAS,GAsCX,UACEhK,KAAM,iBACNC,SAAS,EACTC,MAAO,QACPC,GAAI,WAAe,EACnBY,OAxCF,SAAgBX,GACd,IAAIC,EAAQD,EAAKC,MACb4J,EAAW7J,EAAK6J,SAChB9I,EAAUf,EAAKe,QACf+I,EAAkB/I,EAAQgJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAkBjJ,EAAQkJ,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7C9K,EAASF,EAAUiB,EAAME,SAASxC,QAClCuM,EAAgB,GAAGjM,OAAOgC,EAAMiK,cAActM,UAAWqC,EAAMiK,cAAcvM,QAYjF,OAVIoM,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaC,iBAAiB,SAAUP,EAASQ,OAAQT,GAC3D,IAGEK,GACF/K,EAAOkL,iBAAiB,SAAUP,EAASQ,OAAQT,IAG9C,WACDG,GACFG,EAAc9J,SAAQ,SAAU+J,GAC9BA,EAAaG,oBAAoB,SAAUT,EAASQ,OAAQT,GAC9D,IAGEK,GACF/K,EAAOoL,oBAAoB,SAAUT,EAASQ,OAAQT,GAE1D,CACF,EASED,KAAM,CAAC,GC/CT,IAAIY,GAAO,CACTnN,KAAM,QACND,MAAO,OACPD,OAAQ,MACR+D,IAAK,UAEQ,SAASuJ,GAAqBxM,GAC3C,OAAOA,EAAUyM,QAAQ,0BAA0B,SAAUC,GAC3D,OAAOH,GAAKG,EACd,GACF,CCVA,IAAI,GAAO,CACTnN,MAAO,MACPC,IAAK,SAEQ,SAASmN,GAA8B3M,GACpD,OAAOA,EAAUyM,QAAQ,cAAc,SAAUC,GAC/C,OAAO,GAAKA,EACd,GACF,CCPe,SAASE,GAAgB3L,GACtC,IAAI6J,EAAM9J,EAAUC,GAGpB,MAAO,CACL4L,WAHe/B,EAAIgC,YAInBC,UAHcjC,EAAIkC,YAKtB,CCNe,SAASC,GAAoBpM,GAQ1C,OAAO+D,EAAsB8B,EAAmB7F,IAAUzB,KAAOwN,GAAgB/L,GAASgM,UAC5F,CCXe,SAASK,GAAerM,GAErC,IAAIsM,EAAoB,EAAiBtM,GACrCuM,EAAWD,EAAkBC,SAC7BC,EAAYF,EAAkBE,UAC9BC,EAAYH,EAAkBG,UAElC,MAAO,6BAA6B3I,KAAKyI,EAAWE,EAAYD,EAClE,CCLe,SAASE,GAAgBtM,GACtC,MAAI,CAAC,OAAQ,OAAQ,aAAawF,QAAQ7F,EAAYK,KAAU,EAEvDA,EAAKG,cAAcoM,KAGxBhM,EAAcP,IAASiM,GAAejM,GACjCA,EAGFsM,GAAgB1G,EAAc5F,GACvC,CCJe,SAASwM,GAAkB5M,EAAS6M,GACjD,IAAIC,OAES,IAATD,IACFA,EAAO,IAGT,IAAIvB,EAAeoB,GAAgB1M,GAC/B+M,EAASzB,KAAqE,OAAlDwB,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,MACpH1C,EAAM9J,EAAUmL,GAChB0B,EAASD,EAAS,CAAC9C,GAAK7K,OAAO6K,EAAIxF,gBAAkB,GAAI4H,GAAef,GAAgBA,EAAe,IAAMA,EAC7G2B,EAAcJ,EAAKzN,OAAO4N,GAC9B,OAAOD,EAASE,EAChBA,EAAY7N,OAAOwN,GAAkB5G,EAAcgH,IACrD,CCzBe,SAASE,GAAiBC,GACvC,OAAO1P,OAAOkE,OAAO,CAAC,EAAGwL,EAAM,CAC7B5O,KAAM4O,EAAKxI,EACXvC,IAAK+K,EAAKtI,EACVvG,MAAO6O,EAAKxI,EAAIwI,EAAK7I,MACrBjG,OAAQ8O,EAAKtI,EAAIsI,EAAK3I,QAE1B,CCqBA,SAAS4I,GAA2BpN,EAASqN,EAAgBlL,GAC3D,OAAOkL,IAAmBxO,EAAWqO,GCzBxB,SAAyBlN,EAASmC,GAC/C,IAAI8H,EAAM9J,EAAUH,GAChBsN,EAAOzH,EAAmB7F,GAC1ByE,EAAiBwF,EAAIxF,eACrBH,EAAQgJ,EAAKhF,YACb9D,EAAS8I,EAAKjF,aACd1D,EAAI,EACJE,EAAI,EAER,GAAIJ,EAAgB,CAClBH,EAAQG,EAAeH,MACvBE,EAASC,EAAeD,OACxB,IAAI+I,EAAiB1J,KAEjB0J,IAAmBA,GAA+B,UAAbpL,KACvCwC,EAAIF,EAAeG,WACnBC,EAAIJ,EAAeK,UAEvB,CAEA,MAAO,CACLR,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EAAIyH,GAAoBpM,GAC3B6E,EAAGA,EAEP,CDDwD2I,CAAgBxN,EAASmC,IAAa1B,EAAU4M,GAdxG,SAAoCrN,EAASmC,GAC3C,IAAIgL,EAAOpJ,EAAsB/D,GAAS,EAAoB,UAAbmC,GASjD,OARAgL,EAAK/K,IAAM+K,EAAK/K,IAAMpC,EAAQyN,UAC9BN,EAAK5O,KAAO4O,EAAK5O,KAAOyB,EAAQ0N,WAChCP,EAAK9O,OAAS8O,EAAK/K,IAAMpC,EAAQqI,aACjC8E,EAAK7O,MAAQ6O,EAAK5O,KAAOyB,EAAQsI,YACjC6E,EAAK7I,MAAQtE,EAAQsI,YACrB6E,EAAK3I,OAASxE,EAAQqI,aACtB8E,EAAKxI,EAAIwI,EAAK5O,KACd4O,EAAKtI,EAAIsI,EAAK/K,IACP+K,CACT,CAG0HQ,CAA2BN,EAAgBlL,GAAY+K,GEtBlK,SAAyBlN,GACtC,IAAI8M,EAEAQ,EAAOzH,EAAmB7F,GAC1B4N,EAAY7B,GAAgB/L,GAC5B2M,EAA0D,OAAlDG,EAAwB9M,EAAQO,oBAAyB,EAASuM,EAAsBH,KAChGrI,EAAQ,EAAIgJ,EAAKO,YAAaP,EAAKhF,YAAaqE,EAAOA,EAAKkB,YAAc,EAAGlB,EAAOA,EAAKrE,YAAc,GACvG9D,EAAS,EAAI8I,EAAKQ,aAAcR,EAAKjF,aAAcsE,EAAOA,EAAKmB,aAAe,EAAGnB,EAAOA,EAAKtE,aAAe,GAC5G1D,GAAKiJ,EAAU5B,WAAaI,GAAoBpM,GAChD6E,GAAK+I,EAAU1B,UAMnB,MAJiD,QAA7C,EAAiBS,GAAQW,GAAMS,YACjCpJ,GAAK,EAAI2I,EAAKhF,YAAaqE,EAAOA,EAAKrE,YAAc,GAAKhE,GAGrD,CACLA,MAAOA,EACPE,OAAQA,EACRG,EAAGA,EACHE,EAAGA,EAEP,CFCkMmJ,CAAgBnI,EAAmB7F,IACrO,CG1Be,SAASiO,GAAe9M,GACrC,IAOIkI,EAPAtK,EAAYoC,EAAKpC,UACjBiB,EAAUmB,EAAKnB,QACfb,EAAYgC,EAAKhC,UACjBqI,EAAgBrI,EAAYuD,EAAiBvD,GAAa,KAC1DiK,EAAYjK,EAAY4J,EAAa5J,GAAa,KAClD+O,EAAUnP,EAAU4F,EAAI5F,EAAUuF,MAAQ,EAAItE,EAAQsE,MAAQ,EAC9D6J,EAAUpP,EAAU8F,EAAI9F,EAAUyF,OAAS,EAAIxE,EAAQwE,OAAS,EAGpE,OAAQgD,GACN,KAAK,EACH6B,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI7E,EAAQwE,QAE3B,MAEF,KAAKnG,EACHgL,EAAU,CACR1E,EAAGuJ,EACHrJ,EAAG9F,EAAU8F,EAAI9F,EAAUyF,QAE7B,MAEF,KAAKlG,EACH+K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI5F,EAAUuF,MAC3BO,EAAGsJ,GAEL,MAEF,KAAK5P,EACH8K,EAAU,CACR1E,EAAG5F,EAAU4F,EAAI3E,EAAQsE,MACzBO,EAAGsJ,GAEL,MAEF,QACE9E,EAAU,CACR1E,EAAG5F,EAAU4F,EACbE,EAAG9F,EAAU8F,GAInB,IAAIuJ,EAAW5G,EAAgBV,EAAyBU,GAAiB,KAEzE,GAAgB,MAAZ4G,EAAkB,CACpB,IAAI1G,EAAmB,MAAb0G,EAAmB,SAAW,QAExC,OAAQhF,GACN,KAAK1K,EACH2K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAC7E,MAEF,KAAK/I,EACH0K,EAAQ+E,GAAY/E,EAAQ+E,IAAarP,EAAU2I,GAAO,EAAI1H,EAAQ0H,GAAO,GAKnF,CAEA,OAAO2B,CACT,CC3De,SAASgF,GAAejN,EAAOc,QAC5B,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACXqM,EAAqBD,EAASnP,UAC9BA,OAAmC,IAAvBoP,EAAgCnN,EAAMjC,UAAYoP,EAC9DC,EAAoBF,EAASnM,SAC7BA,OAAiC,IAAtBqM,EAA+BpN,EAAMe,SAAWqM,EAC3DC,EAAoBH,EAASI,SAC7BA,OAAiC,IAAtBD,EAA+B7P,EAAkB6P,EAC5DE,EAAwBL,EAASM,aACjCA,OAAyC,IAA1BD,EAAmC9P,EAAW8P,EAC7DE,EAAwBP,EAASQ,eACjCA,OAA2C,IAA1BD,EAAmC/P,EAAS+P,EAC7DE,EAAuBT,EAASU,YAChCA,OAAuC,IAAzBD,GAA0CA,EACxDE,EAAmBX,EAAS3G,QAC5BA,OAA+B,IAArBsH,EAA8B,EAAIA,EAC5ChI,EAAgBD,EAAsC,iBAAZW,EAAuBA,EAAUT,EAAgBS,EAASlJ,IACpGyQ,EAAaJ,IAAmBhQ,EAASC,EAAYD,EACrDqK,EAAa/H,EAAMwG,MAAM9I,OACzBkB,EAAUoB,EAAME,SAAS0N,EAAcE,EAAaJ,GACpDK,EJkBS,SAAyBnP,EAAS0O,EAAUE,EAAczM,GACvE,IAAIiN,EAAmC,oBAAbV,EAlB5B,SAA4B1O,GAC1B,IAAIpB,EAAkBgO,GAAkB5G,EAAchG,IAElDqP,EADoB,CAAC,WAAY,SAASzJ,QAAQ,EAAiB5F,GAASiC,WAAa,GACnDtB,EAAcX,GAAWoG,EAAgBpG,GAAWA,EAE9F,OAAKS,EAAU4O,GAKRzQ,EAAgBgI,QAAO,SAAUyG,GACtC,OAAO5M,EAAU4M,IAAmBpI,EAASoI,EAAgBgC,IAAmD,SAAhCtP,EAAYsN,EAC9F,IANS,EAOX,CAK6DiC,CAAmBtP,GAAW,GAAGZ,OAAOsP,GAC/F9P,EAAkB,GAAGQ,OAAOgQ,EAAqB,CAACR,IAClDW,EAAsB3Q,EAAgB,GACtC4Q,EAAe5Q,EAAgBK,QAAO,SAAUwQ,EAASpC,GAC3D,IAAIF,EAAOC,GAA2BpN,EAASqN,EAAgBlL,GAK/D,OAJAsN,EAAQrN,IAAM,EAAI+K,EAAK/K,IAAKqN,EAAQrN,KACpCqN,EAAQnR,MAAQ,EAAI6O,EAAK7O,MAAOmR,EAAQnR,OACxCmR,EAAQpR,OAAS,EAAI8O,EAAK9O,OAAQoR,EAAQpR,QAC1CoR,EAAQlR,KAAO,EAAI4O,EAAK5O,KAAMkR,EAAQlR,MAC/BkR,CACT,GAAGrC,GAA2BpN,EAASuP,EAAqBpN,IAK5D,OAJAqN,EAAalL,MAAQkL,EAAalR,MAAQkR,EAAajR,KACvDiR,EAAahL,OAASgL,EAAanR,OAASmR,EAAapN,IACzDoN,EAAa7K,EAAI6K,EAAajR,KAC9BiR,EAAa3K,EAAI2K,EAAapN,IACvBoN,CACT,CInC2BE,CAAgBjP,EAAUT,GAAWA,EAAUA,EAAQ2P,gBAAkB9J,EAAmBzE,EAAME,SAASxC,QAAS4P,EAAUE,EAAczM,GACjKyN,EAAsB7L,EAAsB3C,EAAME,SAASvC,WAC3DuI,EAAgB2G,GAAe,CACjClP,UAAW6Q,EACX5P,QAASmJ,EACThH,SAAU,WACVhD,UAAWA,IAET0Q,EAAmB3C,GAAiBzP,OAAOkE,OAAO,CAAC,EAAGwH,EAAY7B,IAClEwI,EAAoBhB,IAAmBhQ,EAAS+Q,EAAmBD,EAGnEG,EAAkB,CACpB3N,IAAK+M,EAAmB/M,IAAM0N,EAAkB1N,IAAM6E,EAAc7E,IACpE/D,OAAQyR,EAAkBzR,OAAS8Q,EAAmB9Q,OAAS4I,EAAc5I,OAC7EE,KAAM4Q,EAAmB5Q,KAAOuR,EAAkBvR,KAAO0I,EAAc1I,KACvED,MAAOwR,EAAkBxR,MAAQ6Q,EAAmB7Q,MAAQ2I,EAAc3I,OAExE0R,EAAa5O,EAAMmG,cAAckB,OAErC,GAAIqG,IAAmBhQ,GAAUkR,EAAY,CAC3C,IAAIvH,EAASuH,EAAW7Q,GACxB1B,OAAO4D,KAAK0O,GAAiBxO,SAAQ,SAAUhE,GAC7C,IAAI0S,EAAW,CAAC3R,EAAOD,GAAQuH,QAAQrI,IAAQ,EAAI,GAAK,EACpDkK,EAAO,CAAC,EAAKpJ,GAAQuH,QAAQrI,IAAQ,EAAI,IAAM,IACnDwS,EAAgBxS,IAAQkL,EAAOhB,GAAQwI,CACzC,GACF,CAEA,OAAOF,CACT,CCyEA,UACEhP,KAAM,OACNC,SAAS,EACTC,MAAO,OACPC,GA5HF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KAEhB,IAAIK,EAAMmG,cAAcxG,GAAMmP,MAA9B,CAoCA,IAhCA,IAAIC,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAqCA,EACpDG,EAA8BtO,EAAQuO,mBACtC9I,EAAUzF,EAAQyF,QAClB+G,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtB0B,EAAwBxO,EAAQyO,eAChCA,OAA2C,IAA1BD,GAA0CA,EAC3DE,EAAwB1O,EAAQ0O,sBAChCC,EAAqBzP,EAAMc,QAAQ/C,UACnCqI,EAAgB9E,EAAiBmO,GAEjCJ,EAAqBD,IADHhJ,IAAkBqJ,GACqCF,EAjC/E,SAAuCxR,GACrC,GAAIuD,EAAiBvD,KAAeX,EAClC,MAAO,GAGT,IAAIsS,EAAoBnF,GAAqBxM,GAC7C,MAAO,CAAC2M,GAA8B3M,GAAY2R,EAAmBhF,GAA8BgF,GACrG,CA0B6IC,CAA8BF,GAA3E,CAAClF,GAAqBkF,KAChHG,EAAa,CAACH,GAAoBzR,OAAOqR,GAAoBxR,QAAO,SAAUC,EAAKC,GACrF,OAAOD,EAAIE,OAAOsD,EAAiBvD,KAAeX,ECvCvC,SAA8B4C,EAAOc,QAClC,IAAZA,IACFA,EAAU,CAAC,GAGb,IAAIoM,EAAWpM,EACX/C,EAAYmP,EAASnP,UACrBuP,EAAWJ,EAASI,SACpBE,EAAeN,EAASM,aACxBjH,EAAU2G,EAAS3G,QACnBgJ,EAAiBrC,EAASqC,eAC1BM,EAAwB3C,EAASsC,sBACjCA,OAAkD,IAA1BK,EAAmC,EAAgBA,EAC3E7H,EAAYL,EAAa5J,GACzB6R,EAAa5H,EAAYuH,EAAiB3R,EAAsBA,EAAoB4H,QAAO,SAAUzH,GACvG,OAAO4J,EAAa5J,KAAeiK,CACrC,IAAK3K,EACDyS,EAAoBF,EAAWpK,QAAO,SAAUzH,GAClD,OAAOyR,EAAsBhL,QAAQzG,IAAc,CACrD,IAEiC,IAA7B+R,EAAkBC,SACpBD,EAAoBF,GAItB,IAAII,EAAYF,EAAkBjS,QAAO,SAAUC,EAAKC,GAOtD,OANAD,EAAIC,GAAakP,GAAejN,EAAO,CACrCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,IACRjF,EAAiBvD,IACbD,CACT,GAAG,CAAC,GACJ,OAAOzB,OAAO4D,KAAK+P,GAAWC,MAAK,SAAUC,EAAGC,GAC9C,OAAOH,EAAUE,GAAKF,EAAUG,EAClC,GACF,CDC6DC,CAAqBpQ,EAAO,CACnFjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTgJ,eAAgBA,EAChBC,sBAAuBA,IACpBzR,EACP,GAAG,IACCsS,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzB4S,EAAY,IAAIC,IAChBC,GAAqB,EACrBC,EAAwBb,EAAW,GAE9Bc,EAAI,EAAGA,EAAId,EAAWG,OAAQW,IAAK,CAC1C,IAAI3S,EAAY6R,EAAWc,GAEvBC,EAAiBrP,EAAiBvD,GAElC6S,EAAmBjJ,EAAa5J,KAAeT,EAC/CuT,EAAa,CAAC,EAAK5T,GAAQuH,QAAQmM,IAAmB,EACtDrK,EAAMuK,EAAa,QAAU,SAC7B1F,EAAW8B,GAAejN,EAAO,CACnCjC,UAAWA,EACXuP,SAAUA,EACVE,aAAcA,EACdI,YAAaA,EACbrH,QAASA,IAEPuK,EAAoBD,EAAaD,EAAmB1T,EAAQC,EAAOyT,EAAmB3T,EAAS,EAE/FoT,EAAc/J,GAAOyB,EAAWzB,KAClCwK,EAAoBvG,GAAqBuG,IAG3C,IAAIC,EAAmBxG,GAAqBuG,GACxCE,EAAS,GAUb,GARIhC,GACFgC,EAAOC,KAAK9F,EAASwF,IAAmB,GAGtCxB,GACF6B,EAAOC,KAAK9F,EAAS2F,IAAsB,EAAG3F,EAAS4F,IAAqB,GAG1EC,EAAOE,OAAM,SAAUC,GACzB,OAAOA,CACT,IAAI,CACFV,EAAwB1S,EACxByS,GAAqB,EACrB,KACF,CAEAF,EAAUc,IAAIrT,EAAWiT,EAC3B,CAEA,GAAIR,EAqBF,IAnBA,IAEIa,EAAQ,SAAeC,GACzB,IAAIC,EAAmB3B,EAAW4B,MAAK,SAAUzT,GAC/C,IAAIiT,EAASV,EAAU9T,IAAIuB,GAE3B,GAAIiT,EACF,OAAOA,EAAOS,MAAM,EAAGH,GAAIJ,OAAM,SAAUC,GACzC,OAAOA,CACT,GAEJ,IAEA,GAAII,EAEF,OADAd,EAAwBc,EACjB,OAEX,EAESD,EAnBY/B,EAAiB,EAAI,EAmBZ+B,EAAK,GAGpB,UAFFD,EAAMC,GADmBA,KAOpCtR,EAAMjC,YAAc0S,IACtBzQ,EAAMmG,cAAcxG,GAAMmP,OAAQ,EAClC9O,EAAMjC,UAAY0S,EAClBzQ,EAAM0R,OAAQ,EA5GhB,CA8GF,EAQEhK,iBAAkB,CAAC,UACnBgC,KAAM,CACJoF,OAAO,IE7IX,SAAS6C,GAAexG,EAAUY,EAAM6F,GAQtC,YAPyB,IAArBA,IACFA,EAAmB,CACjBrO,EAAG,EACHE,EAAG,IAIA,CACLzC,IAAKmK,EAASnK,IAAM+K,EAAK3I,OAASwO,EAAiBnO,EACnDvG,MAAOiO,EAASjO,MAAQ6O,EAAK7I,MAAQ0O,EAAiBrO,EACtDtG,OAAQkO,EAASlO,OAAS8O,EAAK3I,OAASwO,EAAiBnO,EACzDtG,KAAMgO,EAAShO,KAAO4O,EAAK7I,MAAQ0O,EAAiBrO,EAExD,CAEA,SAASsO,GAAsB1G,GAC7B,MAAO,CAAC,EAAKjO,EAAOD,EAAQE,GAAM2U,MAAK,SAAUC,GAC/C,OAAO5G,EAAS4G,IAAS,CAC3B,GACF,CA+BA,UACEpS,KAAM,OACNC,SAAS,EACTC,MAAO,OACP6H,iBAAkB,CAAC,mBACnB5H,GAlCF,SAAcC,GACZ,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KACZ0Q,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBkU,EAAmB5R,EAAMmG,cAAc6L,gBACvCC,EAAoBhF,GAAejN,EAAO,CAC5C0N,eAAgB,cAEdwE,EAAoBjF,GAAejN,EAAO,CAC5C4N,aAAa,IAEXuE,EAA2BR,GAAeM,EAAmB5B,GAC7D+B,EAAsBT,GAAeO,EAAmBnK,EAAY6J,GACpES,EAAoBR,GAAsBM,GAC1CG,EAAmBT,GAAsBO,GAC7CpS,EAAMmG,cAAcxG,GAAQ,CAC1BwS,yBAA0BA,EAC1BC,oBAAqBA,EACrBC,kBAAmBA,EACnBC,iBAAkBA,GAEpBtS,EAAMM,WAAW5C,OAASrB,OAAOkE,OAAO,CAAC,EAAGP,EAAMM,WAAW5C,OAAQ,CACnE,+BAAgC2U,EAChC,sBAAuBC,GAE3B,GCJA,IACE3S,KAAM,SACNC,SAAS,EACTC,MAAO,OACPwB,SAAU,CAAC,iBACXvB,GA5BF,SAAgBa,GACd,IAAIX,EAAQW,EAAMX,MACdc,EAAUH,EAAMG,QAChBnB,EAAOgB,EAAMhB,KACb4S,EAAkBzR,EAAQuG,OAC1BA,OAA6B,IAApBkL,EAA6B,CAAC,EAAG,GAAKA,EAC/C7I,EAAO,EAAW7L,QAAO,SAAUC,EAAKC,GAE1C,OADAD,EAAIC,GA5BD,SAAiCA,EAAWyI,EAAOa,GACxD,IAAIjB,EAAgB9E,EAAiBvD,GACjCyU,EAAiB,CAACrV,EAAM,GAAKqH,QAAQ4B,IAAkB,GAAK,EAAI,EAEhErG,EAAyB,mBAAXsH,EAAwBA,EAAOhL,OAAOkE,OAAO,CAAC,EAAGiG,EAAO,CACxEzI,UAAWA,KACPsJ,EACFoL,EAAW1S,EAAK,GAChB2S,EAAW3S,EAAK,GAIpB,OAFA0S,EAAWA,GAAY,EACvBC,GAAYA,GAAY,GAAKF,EACtB,CAACrV,EAAMD,GAAOsH,QAAQ4B,IAAkB,EAAI,CACjD7C,EAAGmP,EACHjP,EAAGgP,GACD,CACFlP,EAAGkP,EACHhP,EAAGiP,EAEP,CASqBC,CAAwB5U,EAAWiC,EAAMwG,MAAOa,GAC1DvJ,CACT,GAAG,CAAC,GACA8U,EAAwBlJ,EAAK1J,EAAMjC,WACnCwF,EAAIqP,EAAsBrP,EAC1BE,EAAImP,EAAsBnP,EAEW,MAArCzD,EAAMmG,cAAcD,gBACtBlG,EAAMmG,cAAcD,cAAc3C,GAAKA,EACvCvD,EAAMmG,cAAcD,cAAczC,GAAKA,GAGzCzD,EAAMmG,cAAcxG,GAAQ+J,CAC9B,GC1BA,IACE/J,KAAM,gBACNC,SAAS,EACTC,MAAO,OACPC,GApBF,SAAuBC,GACrB,IAAIC,EAAQD,EAAKC,MACbL,EAAOI,EAAKJ,KAKhBK,EAAMmG,cAAcxG,GAAQkN,GAAe,CACzClP,UAAWqC,EAAMwG,MAAM7I,UACvBiB,QAASoB,EAAMwG,MAAM9I,OACrBqD,SAAU,WACVhD,UAAWiC,EAAMjC,WAErB,EAQE2L,KAAM,CAAC,GCgHT,IACE/J,KAAM,kBACNC,SAAS,EACTC,MAAO,OACPC,GA/HF,SAAyBC,GACvB,IAAIC,EAAQD,EAAKC,MACbc,EAAUf,EAAKe,QACfnB,EAAOI,EAAKJ,KACZoP,EAAoBjO,EAAQkM,SAC5BgC,OAAsC,IAAtBD,GAAsCA,EACtDE,EAAmBnO,EAAQoO,QAC3BC,OAAoC,IAArBF,GAAsCA,EACrD3B,EAAWxM,EAAQwM,SACnBE,EAAe1M,EAAQ0M,aACvBI,EAAc9M,EAAQ8M,YACtBrH,EAAUzF,EAAQyF,QAClBsM,EAAkB/R,EAAQgS,OAC1BA,OAA6B,IAApBD,GAAoCA,EAC7CE,EAAwBjS,EAAQkS,aAChCA,OAAyC,IAA1BD,EAAmC,EAAIA,EACtD5H,EAAW8B,GAAejN,EAAO,CACnCsN,SAAUA,EACVE,aAAcA,EACdjH,QAASA,EACTqH,YAAaA,IAEXxH,EAAgB9E,EAAiBtB,EAAMjC,WACvCiK,EAAYL,EAAa3H,EAAMjC,WAC/BkV,GAAmBjL,EACnBgF,EAAWtH,EAAyBU,GACpC8I,ECrCY,MDqCSlC,ECrCH,IAAM,IDsCxB9G,EAAgBlG,EAAMmG,cAAcD,cACpCmK,EAAgBrQ,EAAMwG,MAAM7I,UAC5BoK,EAAa/H,EAAMwG,MAAM9I,OACzBwV,EAA4C,mBAAjBF,EAA8BA,EAAa3W,OAAOkE,OAAO,CAAC,EAAGP,EAAMwG,MAAO,CACvGzI,UAAWiC,EAAMjC,aACbiV,EACFG,EAA2D,iBAAtBD,EAAiC,CACxElG,SAAUkG,EACVhE,QAASgE,GACP7W,OAAOkE,OAAO,CAChByM,SAAU,EACVkC,QAAS,GACRgE,GACCE,EAAsBpT,EAAMmG,cAAckB,OAASrH,EAAMmG,cAAckB,OAAOrH,EAAMjC,WAAa,KACjG2L,EAAO,CACTnG,EAAG,EACHE,EAAG,GAGL,GAAKyC,EAAL,CAIA,GAAI8I,EAAe,CACjB,IAAIqE,EAEAC,EAAwB,MAAbtG,EAAmB,EAAM7P,EACpCoW,EAAuB,MAAbvG,EAAmB/P,EAASC,EACtCoJ,EAAmB,MAAb0G,EAAmB,SAAW,QACpC3F,EAASnB,EAAc8G,GACvBtL,EAAM2F,EAAS8D,EAASmI,GACxB7R,EAAM4F,EAAS8D,EAASoI,GACxBC,EAAWV,GAAU/K,EAAWzB,GAAO,EAAI,EAC3CmN,EAASzL,IAAc1K,EAAQ+S,EAAc/J,GAAOyB,EAAWzB,GAC/DoN,EAAS1L,IAAc1K,GAASyK,EAAWzB,IAAQ+J,EAAc/J,GAGjEL,EAAejG,EAAME,SAASgB,MAC9BwF,EAAYoM,GAAU7M,EAAetC,EAAcsC,GAAgB,CACrE/C,MAAO,EACPE,OAAQ,GAENuQ,GAAqB3T,EAAMmG,cAAc,oBAAsBnG,EAAMmG,cAAc,oBAAoBI,QxBhFtG,CACLvF,IAAK,EACL9D,MAAO,EACPD,OAAQ,EACRE,KAAM,GwB6EFyW,GAAkBD,GAAmBL,GACrCO,GAAkBF,GAAmBJ,GAMrCO,GAAWnO,EAAO,EAAG0K,EAAc/J,GAAMI,EAAUJ,IACnDyN,GAAYd,EAAkB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWF,GAAkBT,EAA4BnG,SAAWyG,EAASK,GAAWF,GAAkBT,EAA4BnG,SACxMgH,GAAYf,GAAmB5C,EAAc/J,GAAO,EAAIkN,EAAWM,GAAWD,GAAkBV,EAA4BnG,SAAW0G,EAASI,GAAWD,GAAkBV,EAA4BnG,SACzMjG,GAAoB/G,EAAME,SAASgB,OAAS8D,EAAgBhF,EAAME,SAASgB,OAC3E+S,GAAelN,GAAiC,MAAbiG,EAAmBjG,GAAkBsF,WAAa,EAAItF,GAAkBuF,YAAc,EAAI,EAC7H4H,GAAwH,OAAjGb,EAA+C,MAAvBD,OAA8B,EAASA,EAAoBpG,IAAqBqG,EAAwB,EAEvJc,GAAY9M,EAAS2M,GAAYE,GACjCE,GAAkBzO,EAAOmN,EAAS,EAAQpR,EAF9B2F,EAAS0M,GAAYG,GAAsBD,IAEKvS,EAAK2F,EAAQyL,EAAS,EAAQrR,EAAK0S,IAAa1S,GAChHyE,EAAc8G,GAAYoH,GAC1B1K,EAAKsD,GAAYoH,GAAkB/M,CACrC,CAEA,GAAI8H,EAAc,CAChB,IAAIkF,GAEAC,GAAyB,MAAbtH,EAAmB,EAAM7P,EAErCoX,GAAwB,MAAbvH,EAAmB/P,EAASC,EAEvCsX,GAAUtO,EAAcgJ,GAExBuF,GAAmB,MAAZvF,EAAkB,SAAW,QAEpCwF,GAAOF,GAAUrJ,EAASmJ,IAE1BK,GAAOH,GAAUrJ,EAASoJ,IAE1BK,IAAuD,IAAxC,CAAC,EAAKzX,GAAMqH,QAAQ4B,GAEnCyO,GAAyH,OAAjGR,GAAgD,MAAvBjB,OAA8B,EAASA,EAAoBlE,IAAoBmF,GAAyB,EAEzJS,GAAaF,GAAeF,GAAOF,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAEzI6F,GAAaH,GAAeJ,GAAUnE,EAAcoE,IAAQ1M,EAAW0M,IAAQI,GAAuB1B,EAA4BjE,QAAUyF,GAE5IK,GAAmBlC,GAAU8B,G1BzH9B,SAAwBlT,EAAK1E,EAAOyE,GACzC,IAAIwT,EAAItP,EAAOjE,EAAK1E,EAAOyE,GAC3B,OAAOwT,EAAIxT,EAAMA,EAAMwT,CACzB,C0BsHoDC,CAAeJ,GAAYN,GAASO,IAAcpP,EAAOmN,EAASgC,GAAaJ,GAAMF,GAAS1B,EAASiC,GAAaJ,IAEpKzO,EAAcgJ,GAAW8F,GACzBtL,EAAKwF,GAAW8F,GAAmBR,EACrC,CAEAxU,EAAMmG,cAAcxG,GAAQ+J,CAvE5B,CAwEF,EAQEhC,iBAAkB,CAAC,WE1HN,SAASyN,GAAiBC,EAAyBrQ,EAAcsD,QAC9D,IAAZA,IACFA,GAAU,GAGZ,ICnBoCrJ,ECJOJ,EFuBvCyW,EAA0B9V,EAAcwF,GACxCuQ,EAAuB/V,EAAcwF,IAf3C,SAAyBnG,GACvB,IAAImN,EAAOnN,EAAQ+D,wBACfI,EAASpB,EAAMoK,EAAK7I,OAAStE,EAAQqE,aAAe,EACpDD,EAASrB,EAAMoK,EAAK3I,QAAUxE,EAAQuE,cAAgB,EAC1D,OAAkB,IAAXJ,GAA2B,IAAXC,CACzB,CAU4DuS,CAAgBxQ,GACtEJ,EAAkBF,EAAmBM,GACrCgH,EAAOpJ,EAAsByS,EAAyBE,EAAsBjN,GAC5EyB,EAAS,CACXc,WAAY,EACZE,UAAW,GAET7C,EAAU,CACZ1E,EAAG,EACHE,EAAG,GAkBL,OAfI4R,IAA4BA,IAA4BhN,MACxB,SAA9B1J,EAAYoG,IAChBkG,GAAetG,MACbmF,GCnCgC9K,EDmCT+F,KClCdhG,EAAUC,IAAUO,EAAcP,GCJxC,CACL4L,YAFyChM,EDQbI,GCNR4L,WACpBE,UAAWlM,EAAQkM,WDGZH,GAAgB3L,IDoCnBO,EAAcwF,KAChBkD,EAAUtF,EAAsBoC,GAAc,IACtCxB,GAAKwB,EAAauH,WAC1BrE,EAAQxE,GAAKsB,EAAasH,WACjB1H,IACTsD,EAAQ1E,EAAIyH,GAAoBrG,KAI7B,CACLpB,EAAGwI,EAAK5O,KAAO2M,EAAOc,WAAa3C,EAAQ1E,EAC3CE,EAAGsI,EAAK/K,IAAM8I,EAAOgB,UAAY7C,EAAQxE,EACzCP,MAAO6I,EAAK7I,MACZE,OAAQ2I,EAAK3I,OAEjB,CGvDA,SAASoS,GAAMC,GACb,IAAItT,EAAM,IAAIoO,IACVmF,EAAU,IAAIC,IACdC,EAAS,GAKb,SAAS3F,EAAK4F,GACZH,EAAQI,IAAID,EAASlW,MACN,GAAG3B,OAAO6X,EAASxU,UAAY,GAAIwU,EAASnO,kBAAoB,IACtEvH,SAAQ,SAAU4V,GACzB,IAAKL,EAAQM,IAAID,GAAM,CACrB,IAAIE,EAAc9T,EAAI3F,IAAIuZ,GAEtBE,GACFhG,EAAKgG,EAET,CACF,IACAL,EAAO3E,KAAK4E,EACd,CAQA,OAzBAJ,EAAUtV,SAAQ,SAAU0V,GAC1B1T,EAAIiP,IAAIyE,EAASlW,KAAMkW,EACzB,IAiBAJ,EAAUtV,SAAQ,SAAU0V,GACrBH,EAAQM,IAAIH,EAASlW,OAExBsQ,EAAK4F,EAET,IACOD,CACT,CCvBA,IAAIM,GAAkB,CACpBnY,UAAW,SACX0X,UAAW,GACX1U,SAAU,YAGZ,SAASoV,KACP,IAAK,IAAI1B,EAAO2B,UAAUrG,OAAQsG,EAAO,IAAIpU,MAAMwS,GAAO6B,EAAO,EAAGA,EAAO7B,EAAM6B,IAC/ED,EAAKC,GAAQF,UAAUE,GAGzB,OAAQD,EAAKvE,MAAK,SAAUlT,GAC1B,QAASA,GAAoD,mBAAlCA,EAAQ+D,sBACrC,GACF,CAEO,SAAS4T,GAAgBC,QACL,IAArBA,IACFA,EAAmB,CAAC,GAGtB,IAAIC,EAAoBD,EACpBE,EAAwBD,EAAkBE,iBAC1CA,OAA6C,IAA1BD,EAAmC,GAAKA,EAC3DE,EAAyBH,EAAkBI,eAC3CA,OAA4C,IAA3BD,EAAoCV,GAAkBU,EAC3E,OAAO,SAAsBjZ,EAAWD,EAAQoD,QAC9B,IAAZA,IACFA,EAAU+V,GAGZ,ICxC6B/W,EAC3BgX,EDuCE9W,EAAQ,CACVjC,UAAW,SACXgZ,iBAAkB,GAClBjW,QAASzE,OAAOkE,OAAO,CAAC,EAAG2V,GAAiBW,GAC5C1Q,cAAe,CAAC,EAChBjG,SAAU,CACRvC,UAAWA,EACXD,OAAQA,GAEV4C,WAAY,CAAC,EACbD,OAAQ,CAAC,GAEP2W,EAAmB,GACnBC,GAAc,EACdrN,EAAW,CACb5J,MAAOA,EACPkX,WAAY,SAAoBC,GAC9B,IAAIrW,EAAsC,mBAArBqW,EAAkCA,EAAiBnX,EAAMc,SAAWqW,EACzFC,IACApX,EAAMc,QAAUzE,OAAOkE,OAAO,CAAC,EAAGsW,EAAgB7W,EAAMc,QAASA,GACjEd,EAAMiK,cAAgB,CACpBtM,UAAW0B,EAAU1B,GAAa6N,GAAkB7N,GAAaA,EAAU4Q,eAAiB/C,GAAkB7N,EAAU4Q,gBAAkB,GAC1I7Q,OAAQ8N,GAAkB9N,IAI5B,IElE4B+X,EAC9B4B,EFiEMN,EDhCG,SAAwBtB,GAErC,IAAIsB,EAAmBvB,GAAMC,GAE7B,OAAO/W,EAAeb,QAAO,SAAUC,EAAK+B,GAC1C,OAAO/B,EAAIE,OAAO+Y,EAAiBvR,QAAO,SAAUqQ,GAClD,OAAOA,EAAShW,QAAUA,CAC5B,IACF,GAAG,GACL,CCuB+ByX,EElEK7B,EFkEsB,GAAGzX,OAAO2Y,EAAkB3W,EAAMc,QAAQ2U,WEjE9F4B,EAAS5B,EAAU5X,QAAO,SAAUwZ,EAAQE,GAC9C,IAAIC,EAAWH,EAAOE,EAAQ5X,MAK9B,OAJA0X,EAAOE,EAAQ5X,MAAQ6X,EAAWnb,OAAOkE,OAAO,CAAC,EAAGiX,EAAUD,EAAS,CACrEzW,QAASzE,OAAOkE,OAAO,CAAC,EAAGiX,EAAS1W,QAASyW,EAAQzW,SACrD4I,KAAMrN,OAAOkE,OAAO,CAAC,EAAGiX,EAAS9N,KAAM6N,EAAQ7N,QAC5C6N,EACEF,CACT,GAAG,CAAC,GAEGhb,OAAO4D,KAAKoX,GAAQlV,KAAI,SAAUhG,GACvC,OAAOkb,EAAOlb,EAChB,MF4DM,OAJA6D,EAAM+W,iBAAmBA,EAAiBvR,QAAO,SAAUiS,GACzD,OAAOA,EAAE7X,OACX,IA+FFI,EAAM+W,iBAAiB5W,SAAQ,SAAUJ,GACvC,IAAIJ,EAAOI,EAAKJ,KACZ+X,EAAe3X,EAAKe,QACpBA,OAA2B,IAAjB4W,EAA0B,CAAC,EAAIA,EACzChX,EAASX,EAAKW,OAElB,GAAsB,mBAAXA,EAAuB,CAChC,IAAIiX,EAAYjX,EAAO,CACrBV,MAAOA,EACPL,KAAMA,EACNiK,SAAUA,EACV9I,QAASA,IAKXkW,EAAiB/F,KAAK0G,GAFT,WAAmB,EAGlC,CACF,IA/GS/N,EAASQ,QAClB,EAMAwN,YAAa,WACX,IAAIX,EAAJ,CAIA,IAAIY,EAAkB7X,EAAME,SACxBvC,EAAYka,EAAgBla,UAC5BD,EAASma,EAAgBna,OAG7B,GAAKyY,GAAiBxY,EAAWD,GAAjC,CAKAsC,EAAMwG,MAAQ,CACZ7I,UAAWwX,GAAiBxX,EAAWqH,EAAgBtH,GAAoC,UAA3BsC,EAAMc,QAAQC,UAC9ErD,OAAQiG,EAAcjG,IAOxBsC,EAAM0R,OAAQ,EACd1R,EAAMjC,UAAYiC,EAAMc,QAAQ/C,UAKhCiC,EAAM+W,iBAAiB5W,SAAQ,SAAU0V,GACvC,OAAO7V,EAAMmG,cAAc0P,EAASlW,MAAQtD,OAAOkE,OAAO,CAAC,EAAGsV,EAASnM,KACzE,IAEA,IAAK,IAAIoO,EAAQ,EAAGA,EAAQ9X,EAAM+W,iBAAiBhH,OAAQ+H,IACzD,IAAoB,IAAhB9X,EAAM0R,MAAV,CAMA,IAAIqG,EAAwB/X,EAAM+W,iBAAiBe,GAC/ChY,EAAKiY,EAAsBjY,GAC3BkY,EAAyBD,EAAsBjX,QAC/CoM,OAAsC,IAA3B8K,EAAoC,CAAC,EAAIA,EACpDrY,EAAOoY,EAAsBpY,KAEf,mBAAPG,IACTE,EAAQF,EAAG,CACTE,MAAOA,EACPc,QAASoM,EACTvN,KAAMA,EACNiK,SAAUA,KACN5J,EAdR,MAHEA,EAAM0R,OAAQ,EACdoG,GAAS,CAzBb,CATA,CAqDF,EAGA1N,QC1I2BtK,ED0IV,WACf,OAAO,IAAImY,SAAQ,SAAUC,GAC3BtO,EAASgO,cACTM,EAAQlY,EACV,GACF,EC7IG,WAUL,OATK8W,IACHA,EAAU,IAAImB,SAAQ,SAAUC,GAC9BD,QAAQC,UAAUC,MAAK,WACrBrB,OAAUsB,EACVF,EAAQpY,IACV,GACF,KAGKgX,CACT,GDmIIuB,QAAS,WACPjB,IACAH,GAAc,CAChB,GAGF,IAAKd,GAAiBxY,EAAWD,GAC/B,OAAOkM,EAmCT,SAASwN,IACPJ,EAAiB7W,SAAQ,SAAUL,GACjC,OAAOA,GACT,IACAkX,EAAmB,EACrB,CAEA,OAvCApN,EAASsN,WAAWpW,GAASqX,MAAK,SAAUnY,IACrCiX,GAAenW,EAAQwX,eAC1BxX,EAAQwX,cAActY,EAE1B,IAmCO4J,CACT,CACF,CACO,IAAI2O,GAA4BhC,KGzLnC,GAA4BA,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,EAAa,GAAQ,GAAM,GAAiB,EAAO,MCJrH,GAA4BjC,GAAgB,CAC9CI,iBAFqB,CAAC6B,GAAgB,GAAe,GAAe,KCatE,MAAMC,GAAa,IAAIlI,IACjBmI,GAAO,CACX,GAAAtH,CAAIxS,EAASzC,EAAKyN,GACX6O,GAAWzC,IAAIpX,IAClB6Z,GAAWrH,IAAIxS,EAAS,IAAI2R,KAE9B,MAAMoI,EAAcF,GAAWjc,IAAIoC,GAI9B+Z,EAAY3C,IAAI7Z,IAA6B,IAArBwc,EAAYC,KAKzCD,EAAYvH,IAAIjV,EAAKyN,GAHnBiP,QAAQC,MAAM,+EAA+E7W,MAAM8W,KAAKJ,EAAY1Y,QAAQ,MAIhI,EACAzD,IAAG,CAACoC,EAASzC,IACPsc,GAAWzC,IAAIpX,IACV6Z,GAAWjc,IAAIoC,GAASpC,IAAIL,IAE9B,KAET,MAAA6c,CAAOpa,EAASzC,GACd,IAAKsc,GAAWzC,IAAIpX,GAClB,OAEF,MAAM+Z,EAAcF,GAAWjc,IAAIoC,GACnC+Z,EAAYM,OAAO9c,GAGM,IAArBwc,EAAYC,MACdH,GAAWQ,OAAOra,EAEtB,GAYIsa,GAAiB,gBAOjBC,GAAgBC,IAChBA,GAAYna,OAAOoa,KAAOpa,OAAOoa,IAAIC,SAEvCF,EAAWA,EAAS5O,QAAQ,iBAAiB,CAAC+O,EAAOC,IAAO,IAAIH,IAAIC,OAAOE,QAEtEJ,GA4CHK,GAAuB7a,IAC3BA,EAAQ8a,cAAc,IAAIC,MAAMT,IAAgB,EAE5C,GAAYU,MACXA,GAA4B,iBAAXA,UAGO,IAAlBA,EAAOC,SAChBD,EAASA,EAAO,SAEgB,IAApBA,EAAOE,UAEjBC,GAAaH,GAEb,GAAUA,GACLA,EAAOC,OAASD,EAAO,GAAKA,EAEf,iBAAXA,GAAuBA,EAAO7J,OAAS,EACzCrL,SAAS+C,cAAc0R,GAAcS,IAEvC,KAEHI,GAAYpb,IAChB,IAAK,GAAUA,IAAgD,IAApCA,EAAQqb,iBAAiBlK,OAClD,OAAO,EAET,MAAMmK,EAAgF,YAA7D5V,iBAAiB1F,GAASub,iBAAiB,cAE9DC,EAAgBxb,EAAQyb,QAAQ,uBACtC,IAAKD,EACH,OAAOF,EAET,GAAIE,IAAkBxb,EAAS,CAC7B,MAAM0b,EAAU1b,EAAQyb,QAAQ,WAChC,GAAIC,GAAWA,EAAQlW,aAAegW,EACpC,OAAO,EAET,GAAgB,OAAZE,EACF,OAAO,CAEX,CACA,OAAOJ,CAAgB,EAEnBK,GAAa3b,IACZA,GAAWA,EAAQkb,WAAaU,KAAKC,gBAGtC7b,EAAQ8b,UAAU7W,SAAS,mBAGC,IAArBjF,EAAQ+b,SACV/b,EAAQ+b,SAEV/b,EAAQgc,aAAa,aAAoD,UAArChc,EAAQic,aAAa,aAE5DC,GAAiBlc,IACrB,IAAK8F,SAASC,gBAAgBoW,aAC5B,OAAO,KAIT,GAAmC,mBAAxBnc,EAAQqF,YAA4B,CAC7C,MAAM+W,EAAOpc,EAAQqF,cACrB,OAAO+W,aAAgBtb,WAAasb,EAAO,IAC7C,CACA,OAAIpc,aAAmBc,WACdd,EAIJA,EAAQwF,WAGN0W,GAAelc,EAAQwF,YAFrB,IAEgC,EAErC6W,GAAO,OAUPC,GAAStc,IACbA,EAAQuE,YAAY,EAEhBgY,GAAY,IACZlc,OAAOmc,SAAW1W,SAAS6G,KAAKqP,aAAa,qBACxC3b,OAAOmc,OAET,KAEHC,GAA4B,GAgB5BC,GAAQ,IAAuC,QAAjC5W,SAASC,gBAAgB4W,IACvCC,GAAqBC,IAhBAC,QAiBN,KACjB,MAAMC,EAAIR,KAEV,GAAIQ,EAAG,CACL,MAAMhc,EAAO8b,EAAOG,KACdC,EAAqBF,EAAE7b,GAAGH,GAChCgc,EAAE7b,GAAGH,GAAQ8b,EAAOK,gBACpBH,EAAE7b,GAAGH,GAAMoc,YAAcN,EACzBE,EAAE7b,GAAGH,GAAMqc,WAAa,KACtBL,EAAE7b,GAAGH,GAAQkc,EACNJ,EAAOK,gBAElB,GA5B0B,YAAxBpX,SAASuX,YAENZ,GAA0BtL,QAC7BrL,SAASyF,iBAAiB,oBAAoB,KAC5C,IAAK,MAAMuR,KAAYL,GACrBK,GACF,IAGJL,GAA0BpK,KAAKyK,IAE/BA,GAkBA,EAEEQ,GAAU,CAACC,EAAkB9F,EAAO,GAAI+F,EAAeD,IACxB,mBAArBA,EAAkCA,KAAoB9F,GAAQ+F,EAExEC,GAAyB,CAACX,EAAUY,EAAmBC,GAAoB,KAC/E,IAAKA,EAEH,YADAL,GAAQR,GAGV,MACMc,EA/JiC5d,KACvC,IAAKA,EACH,OAAO,EAIT,IAAI,mBACF6d,EAAkB,gBAClBC,GACEzd,OAAOqF,iBAAiB1F,GAC5B,MAAM+d,EAA0BC,OAAOC,WAAWJ,GAC5CK,EAAuBF,OAAOC,WAAWH,GAG/C,OAAKC,GAA4BG,GAKjCL,EAAqBA,EAAmBlb,MAAM,KAAK,GACnDmb,EAAkBA,EAAgBnb,MAAM,KAAK,GAtDf,KAuDtBqb,OAAOC,WAAWJ,GAAsBG,OAAOC,WAAWH,KANzD,CAMoG,EA0IpFK,CAAiCT,GADlC,EAExB,IAAIU,GAAS,EACb,MAAMC,EAAU,EACdrR,aAEIA,IAAW0Q,IAGfU,GAAS,EACTV,EAAkBjS,oBAAoB6O,GAAgB+D,GACtDf,GAAQR,GAAS,EAEnBY,EAAkBnS,iBAAiB+O,GAAgB+D,GACnDC,YAAW,KACJF,GACHvD,GAAqB6C,EACvB,GACCE,EAAiB,EAYhBW,GAAuB,CAAC1R,EAAM2R,EAAeC,EAAeC,KAChE,MAAMC,EAAa9R,EAAKsE,OACxB,IAAI+H,EAAQrM,EAAKjH,QAAQ4Y,GAIzB,OAAe,IAAXtF,GACMuF,GAAiBC,EAAiB7R,EAAK8R,EAAa,GAAK9R,EAAK,IAExEqM,GAASuF,EAAgB,GAAK,EAC1BC,IACFxF,GAASA,EAAQyF,GAAcA,GAE1B9R,EAAKjK,KAAKC,IAAI,EAAGD,KAAKE,IAAIoW,EAAOyF,EAAa,KAAI,EAerDC,GAAiB,qBACjBC,GAAiB,OACjBC,GAAgB,SAChBC,GAAgB,CAAC,EACvB,IAAIC,GAAW,EACf,MAAMC,GAAe,CACnBC,WAAY,YACZC,WAAY,YAERC,GAAe,IAAIrI,IAAI,CAAC,QAAS,WAAY,UAAW,YAAa,cAAe,aAAc,iBAAkB,YAAa,WAAY,YAAa,cAAe,YAAa,UAAW,WAAY,QAAS,oBAAqB,aAAc,YAAa,WAAY,cAAe,cAAe,cAAe,YAAa,eAAgB,gBAAiB,eAAgB,gBAAiB,aAAc,QAAS,OAAQ,SAAU,QAAS,SAAU,SAAU,UAAW,WAAY,OAAQ,SAAU,eAAgB,SAAU,OAAQ,mBAAoB,mBAAoB,QAAS,QAAS,WAM/lB,SAASsI,GAAarf,EAASsf,GAC7B,OAAOA,GAAO,GAAGA,MAAQN,QAAgBhf,EAAQgf,UAAYA,IAC/D,CACA,SAASO,GAAiBvf,GACxB,MAAMsf,EAAMD,GAAarf,GAGzB,OAFAA,EAAQgf,SAAWM,EACnBP,GAAcO,GAAOP,GAAcO,IAAQ,CAAC,EACrCP,GAAcO,EACvB,CAiCA,SAASE,GAAYC,EAAQC,EAAUC,EAAqB,MAC1D,OAAOliB,OAAOmiB,OAAOH,GAAQ7M,MAAKiN,GAASA,EAAMH,WAAaA,GAAYG,EAAMF,qBAAuBA,GACzG,CACA,SAASG,GAAoBC,EAAmB1B,EAAS2B,GACvD,MAAMC,EAAiC,iBAAZ5B,EAErBqB,EAAWO,EAAcD,EAAqB3B,GAAW2B,EAC/D,IAAIE,EAAYC,GAAaJ,GAI7B,OAHKX,GAAahI,IAAI8I,KACpBA,EAAYH,GAEP,CAACE,EAAaP,EAAUQ,EACjC,CACA,SAASE,GAAWpgB,EAAS+f,EAAmB1B,EAAS2B,EAAoBK,GAC3E,GAAiC,iBAAtBN,IAAmC/f,EAC5C,OAEF,IAAKigB,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GAIzF,GAAID,KAAqBd,GAAc,CACrC,MAAMqB,EAAepf,GACZ,SAAU2e,GACf,IAAKA,EAAMU,eAAiBV,EAAMU,gBAAkBV,EAAMW,iBAAmBX,EAAMW,eAAevb,SAAS4a,EAAMU,eAC/G,OAAOrf,EAAGjD,KAAKwiB,KAAMZ,EAEzB,EAEFH,EAAWY,EAAaZ,EAC1B,CACA,MAAMD,EAASF,GAAiBvf,GAC1B0gB,EAAWjB,EAAOS,KAAeT,EAAOS,GAAa,CAAC,GACtDS,EAAmBnB,GAAYkB,EAAUhB,EAAUO,EAAc5B,EAAU,MACjF,GAAIsC,EAEF,YADAA,EAAiBN,OAASM,EAAiBN,QAAUA,GAGvD,MAAMf,EAAMD,GAAaK,EAAUK,EAAkBnU,QAAQgT,GAAgB,KACvE1d,EAAK+e,EA5Db,SAAoCjgB,EAASwa,EAAUtZ,GACrD,OAAO,SAASmd,EAAQwB,GACtB,MAAMe,EAAc5gB,EAAQ6gB,iBAAiBrG,GAC7C,IAAK,IAAI,OACPxN,GACE6S,EAAO7S,GAAUA,IAAWyT,KAAMzT,EAASA,EAAOxH,WACpD,IAAK,MAAMsb,KAAcF,EACvB,GAAIE,IAAe9T,EASnB,OANA+T,GAAWlB,EAAO,CAChBW,eAAgBxT,IAEdqR,EAAQgC,QACVW,GAAaC,IAAIjhB,EAAS6f,EAAMqB,KAAM1G,EAAUtZ,GAE3CA,EAAGigB,MAAMnU,EAAQ,CAAC6S,GAG/B,CACF,CAwC2BuB,CAA2BphB,EAASqe,EAASqB,GAvExE,SAA0B1f,EAASkB,GACjC,OAAO,SAASmd,EAAQwB,GAOtB,OANAkB,GAAWlB,EAAO,CAChBW,eAAgBxgB,IAEdqe,EAAQgC,QACVW,GAAaC,IAAIjhB,EAAS6f,EAAMqB,KAAMhgB,GAEjCA,EAAGigB,MAAMnhB,EAAS,CAAC6f,GAC5B,CACF,CA6DoFwB,CAAiBrhB,EAAS0f,GAC5Gxe,EAAGye,mBAAqBM,EAAc5B,EAAU,KAChDnd,EAAGwe,SAAWA,EACdxe,EAAGmf,OAASA,EACZnf,EAAG8d,SAAWM,EACdoB,EAASpB,GAAOpe,EAChBlB,EAAQuL,iBAAiB2U,EAAWhf,EAAI+e,EAC1C,CACA,SAASqB,GAActhB,EAASyf,EAAQS,EAAW7B,EAASsB,GAC1D,MAAMze,EAAKse,GAAYC,EAAOS,GAAY7B,EAASsB,GAC9Cze,IAGLlB,EAAQyL,oBAAoByU,EAAWhf,EAAIqgB,QAAQ5B,WAC5CF,EAAOS,GAAWhf,EAAG8d,UAC9B,CACA,SAASwC,GAAyBxhB,EAASyf,EAAQS,EAAWuB,GAC5D,MAAMC,EAAoBjC,EAAOS,IAAc,CAAC,EAChD,IAAK,MAAOyB,EAAY9B,KAAUpiB,OAAOmkB,QAAQF,GAC3CC,EAAWE,SAASJ,IACtBH,GAActhB,EAASyf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAGtE,CACA,SAASQ,GAAaN,GAGpB,OADAA,EAAQA,EAAMjU,QAAQiT,GAAgB,IAC/BI,GAAaY,IAAUA,CAChC,CACA,MAAMmB,GAAe,CACnB,EAAAc,CAAG9hB,EAAS6f,EAAOxB,EAAS2B,GAC1BI,GAAWpgB,EAAS6f,EAAOxB,EAAS2B,GAAoB,EAC1D,EACA,GAAA+B,CAAI/hB,EAAS6f,EAAOxB,EAAS2B,GAC3BI,GAAWpgB,EAAS6f,EAAOxB,EAAS2B,GAAoB,EAC1D,EACA,GAAAiB,CAAIjhB,EAAS+f,EAAmB1B,EAAS2B,GACvC,GAAiC,iBAAtBD,IAAmC/f,EAC5C,OAEF,MAAOigB,EAAaP,EAAUQ,GAAaJ,GAAoBC,EAAmB1B,EAAS2B,GACrFgC,EAAc9B,IAAcH,EAC5BN,EAASF,GAAiBvf,GAC1B0hB,EAAoBjC,EAAOS,IAAc,CAAC,EAC1C+B,EAAclC,EAAkBmC,WAAW,KACjD,QAAwB,IAAbxC,EAAX,CAQA,GAAIuC,EACF,IAAK,MAAME,KAAgB1kB,OAAO4D,KAAKoe,GACrC+B,GAAyBxhB,EAASyf,EAAQ0C,EAAcpC,EAAkBlN,MAAM,IAGpF,IAAK,MAAOuP,EAAavC,KAAUpiB,OAAOmkB,QAAQF,GAAoB,CACpE,MAAMC,EAAaS,EAAYxW,QAAQkT,GAAe,IACjDkD,IAAejC,EAAkB8B,SAASF,IAC7CL,GAActhB,EAASyf,EAAQS,EAAWL,EAAMH,SAAUG,EAAMF,mBAEpE,CAXA,KAPA,CAEE,IAAKliB,OAAO4D,KAAKqgB,GAAmBvQ,OAClC,OAEFmQ,GAActhB,EAASyf,EAAQS,EAAWR,EAAUO,EAAc5B,EAAU,KAE9E,CAYF,EACA,OAAAgE,CAAQriB,EAAS6f,EAAOpI,GACtB,GAAqB,iBAAVoI,IAAuB7f,EAChC,OAAO,KAET,MAAM+c,EAAIR,KAGV,IAAI+F,EAAc,KACdC,GAAU,EACVC,GAAiB,EACjBC,GAAmB,EAJH5C,IADFM,GAAaN,IAMZ9C,IACjBuF,EAAcvF,EAAEhC,MAAM8E,EAAOpI,GAC7BsF,EAAE/c,GAASqiB,QAAQC,GACnBC,GAAWD,EAAYI,uBACvBF,GAAkBF,EAAYK,gCAC9BF,EAAmBH,EAAYM,sBAEjC,MAAMC,EAAM9B,GAAW,IAAIhG,MAAM8E,EAAO,CACtC0C,UACAO,YAAY,IACVrL,GAUJ,OATIgL,GACFI,EAAIE,iBAEFP,GACFxiB,EAAQ8a,cAAc+H,GAEpBA,EAAIJ,kBAAoBH,GAC1BA,EAAYS,iBAEPF,CACT,GAEF,SAAS9B,GAAWljB,EAAKmlB,EAAO,CAAC,GAC/B,IAAK,MAAOzlB,EAAKa,KAAUX,OAAOmkB,QAAQoB,GACxC,IACEnlB,EAAIN,GAAOa,CACb,CAAE,MAAO6kB,GACPxlB,OAAOC,eAAeG,EAAKN,EAAK,CAC9B2lB,cAAc,EACdtlB,IAAG,IACMQ,GAGb,CAEF,OAAOP,CACT,CASA,SAASslB,GAAc/kB,GACrB,GAAc,SAAVA,EACF,OAAO,EAET,GAAc,UAAVA,EACF,OAAO,EAET,GAAIA,IAAU4f,OAAO5f,GAAOkC,WAC1B,OAAO0d,OAAO5f,GAEhB,GAAc,KAAVA,GAA0B,SAAVA,EAClB,OAAO,KAET,GAAqB,iBAAVA,EACT,OAAOA,EAET,IACE,OAAOglB,KAAKC,MAAMC,mBAAmBllB,GACvC,CAAE,MAAO6kB,GACP,OAAO7kB,CACT,CACF,CACA,SAASmlB,GAAiBhmB,GACxB,OAAOA,EAAIqO,QAAQ,UAAU4X,GAAO,IAAIA,EAAItjB,iBAC9C,CACA,MAAMujB,GAAc,CAClB,gBAAAC,CAAiB1jB,EAASzC,EAAKa,GAC7B4B,EAAQ6B,aAAa,WAAW0hB,GAAiBhmB,KAAQa,EAC3D,EACA,mBAAAulB,CAAoB3jB,EAASzC,GAC3ByC,EAAQ4B,gBAAgB,WAAW2hB,GAAiBhmB,KACtD,EACA,iBAAAqmB,CAAkB5jB,GAChB,IAAKA,EACH,MAAO,CAAC,EAEV,MAAM0B,EAAa,CAAC,EACdmiB,EAASpmB,OAAO4D,KAAKrB,EAAQ8jB,SAASld,QAAOrJ,GAAOA,EAAI2kB,WAAW,QAAU3kB,EAAI2kB,WAAW,cAClG,IAAK,MAAM3kB,KAAOsmB,EAAQ,CACxB,IAAIE,EAAUxmB,EAAIqO,QAAQ,MAAO,IACjCmY,EAAUA,EAAQC,OAAO,GAAG9jB,cAAgB6jB,EAAQlR,MAAM,EAAGkR,EAAQ5S,QACrEzP,EAAWqiB,GAAWZ,GAAcnjB,EAAQ8jB,QAAQvmB,GACtD,CACA,OAAOmE,CACT,EACAuiB,iBAAgB,CAACjkB,EAASzC,IACjB4lB,GAAcnjB,EAAQic,aAAa,WAAWsH,GAAiBhmB,QAgB1E,MAAM2mB,GAEJ,kBAAWC,GACT,MAAO,CAAC,CACV,CACA,sBAAWC,GACT,MAAO,CAAC,CACV,CACA,eAAWpH,GACT,MAAM,IAAIqH,MAAM,sEAClB,CACA,UAAAC,CAAWC,GAIT,OAHAA,EAAS9D,KAAK+D,gBAAgBD,GAC9BA,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CACA,iBAAAE,CAAkBF,GAChB,OAAOA,CACT,CACA,eAAAC,CAAgBD,EAAQvkB,GACtB,MAAM2kB,EAAa,GAAU3kB,GAAWyjB,GAAYQ,iBAAiBjkB,EAAS,UAAY,CAAC,EAE3F,MAAO,IACFygB,KAAKmE,YAAYT,WACM,iBAAfQ,EAA0BA,EAAa,CAAC,KAC/C,GAAU3kB,GAAWyjB,GAAYG,kBAAkB5jB,GAAW,CAAC,KAC7C,iBAAXukB,EAAsBA,EAAS,CAAC,EAE/C,CACA,gBAAAG,CAAiBH,EAAQM,EAAcpE,KAAKmE,YAAYR,aACtD,IAAK,MAAO7hB,EAAUuiB,KAAkBrnB,OAAOmkB,QAAQiD,GAAc,CACnE,MAAMzmB,EAAQmmB,EAAOhiB,GACfwiB,EAAY,GAAU3mB,GAAS,UAhiBrC4c,OADSA,EAiiB+C5c,GA/hBnD,GAAG4c,IAELvd,OAAOM,UAAUuC,SAASrC,KAAK+c,GAAQL,MAAM,eAAe,GAAGza,cA8hBlE,IAAK,IAAI8kB,OAAOF,GAAehhB,KAAKihB,GAClC,MAAM,IAAIE,UAAU,GAAGxE,KAAKmE,YAAY5H,KAAKkI,0BAA0B3iB,qBAA4BwiB,yBAAiCD,MAExI,CAriBW9J,KAsiBb,EAqBF,MAAMmK,WAAsBjB,GAC1B,WAAAU,CAAY5kB,EAASukB,GACnBa,SACAplB,EAAUmb,GAAWnb,MAIrBygB,KAAK4E,SAAWrlB,EAChBygB,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/BzK,GAAKtH,IAAIiO,KAAK4E,SAAU5E,KAAKmE,YAAYW,SAAU9E,MACrD,CAGA,OAAA+E,GACE1L,GAAKM,OAAOqG,KAAK4E,SAAU5E,KAAKmE,YAAYW,UAC5CvE,GAAaC,IAAIR,KAAK4E,SAAU5E,KAAKmE,YAAYa,WACjD,IAAK,MAAMC,KAAgBjoB,OAAOkoB,oBAAoBlF,MACpDA,KAAKiF,GAAgB,IAEzB,CACA,cAAAE,CAAe9I,EAAU9c,EAAS6lB,GAAa,GAC7CpI,GAAuBX,EAAU9c,EAAS6lB,EAC5C,CACA,UAAAvB,CAAWC,GAIT,OAHAA,EAAS9D,KAAK+D,gBAAgBD,EAAQ9D,KAAK4E,UAC3Cd,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CAGA,kBAAOuB,CAAY9lB,GACjB,OAAO8Z,GAAKlc,IAAIud,GAAWnb,GAAUygB,KAAK8E,SAC5C,CACA,0BAAOQ,CAAoB/lB,EAASukB,EAAS,CAAC,GAC5C,OAAO9D,KAAKqF,YAAY9lB,IAAY,IAAIygB,KAAKzgB,EAA2B,iBAAXukB,EAAsBA,EAAS,KAC9F,CACA,kBAAWyB,GACT,MA5CY,OA6Cd,CACA,mBAAWT,GACT,MAAO,MAAM9E,KAAKzD,MACpB,CACA,oBAAWyI,GACT,MAAO,IAAIhF,KAAK8E,UAClB,CACA,gBAAOU,CAAUllB,GACf,MAAO,GAAGA,IAAO0f,KAAKgF,WACxB,EAUF,MAAMS,GAAclmB,IAClB,IAAIwa,EAAWxa,EAAQic,aAAa,kBACpC,IAAKzB,GAAyB,MAAbA,EAAkB,CACjC,IAAI2L,EAAgBnmB,EAAQic,aAAa,QAMzC,IAAKkK,IAAkBA,EAActE,SAAS,OAASsE,EAAcjE,WAAW,KAC9E,OAAO,KAILiE,EAActE,SAAS,OAASsE,EAAcjE,WAAW,OAC3DiE,EAAgB,IAAIA,EAAcxjB,MAAM,KAAK,MAE/C6X,EAAW2L,GAAmC,MAAlBA,EAAwBA,EAAcC,OAAS,IAC7E,CACA,OAAO5L,EAAWA,EAAS7X,MAAM,KAAKY,KAAI8iB,GAAO9L,GAAc8L,KAAM1iB,KAAK,KAAO,IAAI,EAEjF2iB,GAAiB,CACrB1T,KAAI,CAAC4H,EAAUxa,EAAU8F,SAASC,kBACzB,GAAG3G,UAAUsB,QAAQ3C,UAAU8iB,iBAAiB5iB,KAAK+B,EAASwa,IAEvE+L,QAAO,CAAC/L,EAAUxa,EAAU8F,SAASC,kBAC5BrF,QAAQ3C,UAAU8K,cAAc5K,KAAK+B,EAASwa,GAEvDgM,SAAQ,CAACxmB,EAASwa,IACT,GAAGpb,UAAUY,EAAQwmB,UAAU5f,QAAOzB,GAASA,EAAMshB,QAAQjM,KAEtE,OAAAkM,CAAQ1mB,EAASwa,GACf,MAAMkM,EAAU,GAChB,IAAIC,EAAW3mB,EAAQwF,WAAWiW,QAAQjB,GAC1C,KAAOmM,GACLD,EAAQrU,KAAKsU,GACbA,EAAWA,EAASnhB,WAAWiW,QAAQjB,GAEzC,OAAOkM,CACT,EACA,IAAAE,CAAK5mB,EAASwa,GACZ,IAAIqM,EAAW7mB,EAAQ8mB,uBACvB,KAAOD,GAAU,CACf,GAAIA,EAASJ,QAAQjM,GACnB,MAAO,CAACqM,GAEVA,EAAWA,EAASC,sBACtB,CACA,MAAO,EACT,EAEA,IAAAxhB,CAAKtF,EAASwa,GACZ,IAAIlV,EAAOtF,EAAQ+mB,mBACnB,KAAOzhB,GAAM,CACX,GAAIA,EAAKmhB,QAAQjM,GACf,MAAO,CAAClV,GAEVA,EAAOA,EAAKyhB,kBACd,CACA,MAAO,EACT,EACA,iBAAAC,CAAkBhnB,GAChB,MAAMinB,EAAa,CAAC,IAAK,SAAU,QAAS,WAAY,SAAU,UAAW,aAAc,4BAA4B1jB,KAAIiX,GAAY,GAAGA,2BAAiC7W,KAAK,KAChL,OAAO8c,KAAK7N,KAAKqU,EAAYjnB,GAAS4G,QAAOsgB,IAAOvL,GAAWuL,IAAO9L,GAAU8L,IAClF,EACA,sBAAAC,CAAuBnnB,GACrB,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAIwa,GACK8L,GAAeC,QAAQ/L,GAAYA,EAErC,IACT,EACA,sBAAA4M,CAAuBpnB,GACrB,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAOwa,EAAW8L,GAAeC,QAAQ/L,GAAY,IACvD,EACA,+BAAA6M,CAAgCrnB,GAC9B,MAAMwa,EAAW0L,GAAYlmB,GAC7B,OAAOwa,EAAW8L,GAAe1T,KAAK4H,GAAY,EACpD,GAUI8M,GAAuB,CAACC,EAAWC,EAAS,UAChD,MAAMC,EAAa,gBAAgBF,EAAU9B,YACvC1kB,EAAOwmB,EAAUvK,KACvBgE,GAAac,GAAGhc,SAAU2hB,EAAY,qBAAqB1mB,OAAU,SAAU8e,GAI7E,GAHI,CAAC,IAAK,QAAQgC,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,MACb,OAEF,MAAMzT,EAASsZ,GAAec,uBAAuB3G,OAASA,KAAKhF,QAAQ,IAAI1a,KAC9DwmB,EAAUxB,oBAAoB/Y,GAGtCwa,IACX,GAAE,EAiBEG,GAAc,YACdC,GAAc,QAAQD,KACtBE,GAAe,SAASF,KAQ9B,MAAMG,WAAc3C,GAElB,eAAWnI,GACT,MAfW,OAgBb,CAGA,KAAA+K,GAEE,GADmB/G,GAAaqB,QAAQ5B,KAAK4E,SAAUuC,IACxCnF,iBACb,OAEFhC,KAAK4E,SAASvJ,UAAU1B,OAlBF,QAmBtB,MAAMyL,EAAapF,KAAK4E,SAASvJ,UAAU7W,SApBrB,QAqBtBwb,KAAKmF,gBAAe,IAAMnF,KAAKuH,mBAAmBvH,KAAK4E,SAAUQ,EACnE,CAGA,eAAAmC,GACEvH,KAAK4E,SAASjL,SACd4G,GAAaqB,QAAQ5B,KAAK4E,SAAUwC,IACpCpH,KAAK+E,SACP,CAGA,sBAAOtI,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOgd,GAAM/B,oBAAoBtF,MACvC,GAAsB,iBAAX8D,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KAJb,CAKF,GACF,EAOF6G,GAAqBQ,GAAO,SAM5BlL,GAAmBkL,IAcnB,MAKMI,GAAyB,4BAO/B,MAAMC,WAAehD,GAEnB,eAAWnI,GACT,MAfW,QAgBb,CAGA,MAAAoL,GAEE3H,KAAK4E,SAASxjB,aAAa,eAAgB4e,KAAK4E,SAASvJ,UAAUsM,OAjB3C,UAkB1B,CAGA,sBAAOlL,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOqd,GAAOpC,oBAAoBtF,MACzB,WAAX8D,GACFzZ,EAAKyZ,IAET,GACF,EAOFvD,GAAac,GAAGhc,SAjCe,2BAiCmBoiB,IAAwBrI,IACxEA,EAAMkD,iBACN,MAAMsF,EAASxI,EAAM7S,OAAOyO,QAAQyM,IACvBC,GAAOpC,oBAAoBsC,GACnCD,QAAQ,IAOfxL,GAAmBuL,IAcnB,MACMG,GAAc,YACdC,GAAmB,aAAaD,KAChCE,GAAkB,YAAYF,KAC9BG,GAAiB,WAAWH,KAC5BI,GAAoB,cAAcJ,KAClCK,GAAkB,YAAYL,KAK9BM,GAAY,CAChBC,YAAa,KACbC,aAAc,KACdC,cAAe,MAEXC,GAAgB,CACpBH,YAAa,kBACbC,aAAc,kBACdC,cAAe,mBAOjB,MAAME,WAAc/E,GAClB,WAAAU,CAAY5kB,EAASukB,GACnBa,QACA3E,KAAK4E,SAAWrlB,EACXA,GAAYipB,GAAMC,gBAGvBzI,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAK0I,QAAU,EACf1I,KAAK2I,sBAAwB7H,QAAQlhB,OAAOgpB,cAC5C5I,KAAK6I,cACP,CAGA,kBAAWnF,GACT,OAAOyE,EACT,CACA,sBAAWxE,GACT,OAAO4E,EACT,CACA,eAAWhM,GACT,MA/CW,OAgDb,CAGA,OAAAwI,GACExE,GAAaC,IAAIR,KAAK4E,SAAUiD,GAClC,CAGA,MAAAiB,CAAO1J,GACAY,KAAK2I,sBAIN3I,KAAK+I,wBAAwB3J,KAC/BY,KAAK0I,QAAUtJ,EAAM4J,SAJrBhJ,KAAK0I,QAAUtJ,EAAM6J,QAAQ,GAAGD,OAMpC,CACA,IAAAE,CAAK9J,GACCY,KAAK+I,wBAAwB3J,KAC/BY,KAAK0I,QAAUtJ,EAAM4J,QAAUhJ,KAAK0I,SAEtC1I,KAAKmJ,eACLtM,GAAQmD,KAAK6E,QAAQuD,YACvB,CACA,KAAAgB,CAAMhK,GACJY,KAAK0I,QAAUtJ,EAAM6J,SAAW7J,EAAM6J,QAAQvY,OAAS,EAAI,EAAI0O,EAAM6J,QAAQ,GAAGD,QAAUhJ,KAAK0I,OACjG,CACA,YAAAS,GACE,MAAME,EAAYlnB,KAAKoC,IAAIyb,KAAK0I,SAChC,GAAIW,GAnEgB,GAoElB,OAEF,MAAM/b,EAAY+b,EAAYrJ,KAAK0I,QACnC1I,KAAK0I,QAAU,EACVpb,GAGLuP,GAAQvP,EAAY,EAAI0S,KAAK6E,QAAQyD,cAAgBtI,KAAK6E,QAAQwD,aACpE,CACA,WAAAQ,GACM7I,KAAK2I,uBACPpI,GAAac,GAAGrB,KAAK4E,SAAUqD,IAAmB7I,GAASY,KAAK8I,OAAO1J,KACvEmB,GAAac,GAAGrB,KAAK4E,SAAUsD,IAAiB9I,GAASY,KAAKkJ,KAAK9J,KACnEY,KAAK4E,SAASvJ,UAAU5E,IAlFG,mBAoF3B8J,GAAac,GAAGrB,KAAK4E,SAAUkD,IAAkB1I,GAASY,KAAK8I,OAAO1J,KACtEmB,GAAac,GAAGrB,KAAK4E,SAAUmD,IAAiB3I,GAASY,KAAKoJ,MAAMhK,KACpEmB,GAAac,GAAGrB,KAAK4E,SAAUoD,IAAgB5I,GAASY,KAAKkJ,KAAK9J,KAEtE,CACA,uBAAA2J,CAAwB3J,GACtB,OAAOY,KAAK2I,wBA3FS,QA2FiBvJ,EAAMkK,aA5FrB,UA4FyDlK,EAAMkK,YACxF,CAGA,kBAAOb,GACL,MAAO,iBAAkBpjB,SAASC,iBAAmB7C,UAAU8mB,eAAiB,CAClF,EAeF,MAEMC,GAAc,eACdC,GAAiB,YACjBC,GAAmB,YACnBC,GAAoB,aAGpBC,GAAa,OACbC,GAAa,OACbC,GAAiB,OACjBC,GAAkB,QAClBC,GAAc,QAAQR,KACtBS,GAAa,OAAOT,KACpBU,GAAkB,UAAUV,KAC5BW,GAAqB,aAAaX,KAClCY,GAAqB,aAAaZ,KAClCa,GAAmB,YAAYb,KAC/Bc,GAAwB,OAAOd,KAAcC,KAC7Cc,GAAyB,QAAQf,KAAcC,KAC/Ce,GAAsB,WACtBC,GAAsB,SAMtBC,GAAkB,UAClBC,GAAgB,iBAChBC,GAAuBF,GAAkBC,GAKzCE,GAAmB,CACvB,CAACnB,IAAmBK,GACpB,CAACJ,IAAoBG,IAEjBgB,GAAY,CAChBC,SAAU,IACVC,UAAU,EACVC,MAAO,QACPC,MAAM,EACNC,OAAO,EACPC,MAAM,GAEFC,GAAgB,CACpBN,SAAU,mBAEVC,SAAU,UACVC,MAAO,mBACPC,KAAM,mBACNC,MAAO,UACPC,KAAM,WAOR,MAAME,WAAiB5G,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKuL,UAAY,KACjBvL,KAAKwL,eAAiB,KACtBxL,KAAKyL,YAAa,EAClBzL,KAAK0L,aAAe,KACpB1L,KAAK2L,aAAe,KACpB3L,KAAK4L,mBAAqB/F,GAAeC,QArCjB,uBAqC8C9F,KAAK4E,UAC3E5E,KAAK6L,qBACD7L,KAAK6E,QAAQqG,OAASV,IACxBxK,KAAK8L,OAET,CAGA,kBAAWpI,GACT,OAAOoH,EACT,CACA,sBAAWnH,GACT,OAAO0H,EACT,CACA,eAAW9O,GACT,MAnFW,UAoFb,CAGA,IAAA1X,GACEmb,KAAK+L,OAAOnC,GACd,CACA,eAAAoC,IAIO3mB,SAAS4mB,QAAUtR,GAAUqF,KAAK4E,WACrC5E,KAAKnb,MAET,CACA,IAAAshB,GACEnG,KAAK+L,OAAOlC,GACd,CACA,KAAAoB,GACMjL,KAAKyL,YACPrR,GAAqB4F,KAAK4E,UAE5B5E,KAAKkM,gBACP,CACA,KAAAJ,GACE9L,KAAKkM,iBACLlM,KAAKmM,kBACLnM,KAAKuL,UAAYa,aAAY,IAAMpM,KAAKgM,mBAAmBhM,KAAK6E,QAAQkG,SAC1E,CACA,iBAAAsB,GACOrM,KAAK6E,QAAQqG,OAGdlL,KAAKyL,WACPlL,GAAae,IAAItB,KAAK4E,SAAUqF,IAAY,IAAMjK,KAAK8L,UAGzD9L,KAAK8L,QACP,CACA,EAAAQ,CAAG7T,GACD,MAAM8T,EAAQvM,KAAKwM,YACnB,GAAI/T,EAAQ8T,EAAM7b,OAAS,GAAK+H,EAAQ,EACtC,OAEF,GAAIuH,KAAKyL,WAEP,YADAlL,GAAae,IAAItB,KAAK4E,SAAUqF,IAAY,IAAMjK,KAAKsM,GAAG7T,KAG5D,MAAMgU,EAAczM,KAAK0M,cAAc1M,KAAK2M,cAC5C,GAAIF,IAAgBhU,EAClB,OAEF,MAAMtC,EAAQsC,EAAQgU,EAAc7C,GAAaC,GACjD7J,KAAK+L,OAAO5V,EAAOoW,EAAM9T,GAC3B,CACA,OAAAsM,GACM/E,KAAK2L,cACP3L,KAAK2L,aAAa5G,UAEpBJ,MAAMI,SACR,CAGA,iBAAAf,CAAkBF,GAEhB,OADAA,EAAO8I,gBAAkB9I,EAAOiH,SACzBjH,CACT,CACA,kBAAA+H,GACM7L,KAAK6E,QAAQmG,UACfzK,GAAac,GAAGrB,KAAK4E,SAAUsF,IAAiB9K,GAASY,KAAK6M,SAASzN,KAE9C,UAAvBY,KAAK6E,QAAQoG,QACf1K,GAAac,GAAGrB,KAAK4E,SAAUuF,IAAoB,IAAMnK,KAAKiL,UAC9D1K,GAAac,GAAGrB,KAAK4E,SAAUwF,IAAoB,IAAMpK,KAAKqM,uBAE5DrM,KAAK6E,QAAQsG,OAAS3C,GAAMC,eAC9BzI,KAAK8M,yBAET,CACA,uBAAAA,GACE,IAAK,MAAMC,KAAOlH,GAAe1T,KArIX,qBAqImC6N,KAAK4E,UAC5DrE,GAAac,GAAG0L,EAAK1C,IAAkBjL,GAASA,EAAMkD,mBAExD,MAmBM0K,EAAc,CAClB3E,aAAc,IAAMrI,KAAK+L,OAAO/L,KAAKiN,kBAAkBnD,KACvDxB,cAAe,IAAMtI,KAAK+L,OAAO/L,KAAKiN,kBAAkBlD,KACxD3B,YAtBkB,KACS,UAAvBpI,KAAK6E,QAAQoG,QAYjBjL,KAAKiL,QACDjL,KAAK0L,cACPwB,aAAalN,KAAK0L,cAEpB1L,KAAK0L,aAAe7N,YAAW,IAAMmC,KAAKqM,qBAjLjB,IAiL+DrM,KAAK6E,QAAQkG,UAAS,GAOhH/K,KAAK2L,aAAe,IAAInD,GAAMxI,KAAK4E,SAAUoI,EAC/C,CACA,QAAAH,CAASzN,GACP,GAAI,kBAAkB/b,KAAK+b,EAAM7S,OAAO0a,SACtC,OAEF,MAAM3Z,EAAYud,GAAiBzL,EAAMtiB,KACrCwQ,IACF8R,EAAMkD,iBACNtC,KAAK+L,OAAO/L,KAAKiN,kBAAkB3f,IAEvC,CACA,aAAAof,CAAcntB,GACZ,OAAOygB,KAAKwM,YAAYrnB,QAAQ5F,EAClC,CACA,0BAAA4tB,CAA2B1U,GACzB,IAAKuH,KAAK4L,mBACR,OAEF,MAAMwB,EAAkBvH,GAAeC,QAAQ4E,GAAiB1K,KAAK4L,oBACrEwB,EAAgB/R,UAAU1B,OAAO8Q,IACjC2C,EAAgBjsB,gBAAgB,gBAChC,MAAMksB,EAAqBxH,GAAeC,QAAQ,sBAAsBrN,MAAWuH,KAAK4L,oBACpFyB,IACFA,EAAmBhS,UAAU5E,IAAIgU,IACjC4C,EAAmBjsB,aAAa,eAAgB,QAEpD,CACA,eAAA+qB,GACE,MAAM5sB,EAAUygB,KAAKwL,gBAAkBxL,KAAK2M,aAC5C,IAAKptB,EACH,OAEF,MAAM+tB,EAAkB/P,OAAOgQ,SAAShuB,EAAQic,aAAa,oBAAqB,IAClFwE,KAAK6E,QAAQkG,SAAWuC,GAAmBtN,KAAK6E,QAAQ+H,eAC1D,CACA,MAAAb,CAAO5V,EAAO5W,EAAU,MACtB,GAAIygB,KAAKyL,WACP,OAEF,MAAM1N,EAAgBiC,KAAK2M,aACrBa,EAASrX,IAAUyT,GACnB6D,EAAcluB,GAAWue,GAAqBkC,KAAKwM,YAAazO,EAAeyP,EAAQxN,KAAK6E,QAAQuG,MAC1G,GAAIqC,IAAgB1P,EAClB,OAEF,MAAM2P,EAAmB1N,KAAK0M,cAAce,GACtCE,EAAenI,GACZjF,GAAaqB,QAAQ5B,KAAK4E,SAAUY,EAAW,CACpD1F,cAAe2N,EACfngB,UAAW0S,KAAK4N,kBAAkBzX,GAClCuD,KAAMsG,KAAK0M,cAAc3O,GACzBuO,GAAIoB,IAIR,GADmBC,EAAa3D,IACjBhI,iBACb,OAEF,IAAKjE,IAAkB0P,EAGrB,OAEF,MAAMI,EAAY/M,QAAQd,KAAKuL,WAC/BvL,KAAKiL,QACLjL,KAAKyL,YAAa,EAClBzL,KAAKmN,2BAA2BO,GAChC1N,KAAKwL,eAAiBiC,EACtB,MAAMK,EAAuBN,EA3OR,sBADF,oBA6ObO,EAAiBP,EA3OH,qBACA,qBA2OpBC,EAAYpS,UAAU5E,IAAIsX,GAC1BlS,GAAO4R,GACP1P,EAAc1C,UAAU5E,IAAIqX,GAC5BL,EAAYpS,UAAU5E,IAAIqX,GAQ1B9N,KAAKmF,gBAPoB,KACvBsI,EAAYpS,UAAU1B,OAAOmU,EAAsBC,GACnDN,EAAYpS,UAAU5E,IAAIgU,IAC1B1M,EAAc1C,UAAU1B,OAAO8Q,GAAqBsD,EAAgBD,GACpE9N,KAAKyL,YAAa,EAClBkC,EAAa1D,GAAW,GAEYlM,EAAeiC,KAAKgO,eACtDH,GACF7N,KAAK8L,OAET,CACA,WAAAkC,GACE,OAAOhO,KAAK4E,SAASvJ,UAAU7W,SAhQV,QAiQvB,CACA,UAAAmoB,GACE,OAAO9G,GAAeC,QAAQ8E,GAAsB5K,KAAK4E,SAC3D,CACA,SAAA4H,GACE,OAAO3G,GAAe1T,KAAKwY,GAAe3K,KAAK4E,SACjD,CACA,cAAAsH,GACMlM,KAAKuL,YACP0C,cAAcjO,KAAKuL,WACnBvL,KAAKuL,UAAY,KAErB,CACA,iBAAA0B,CAAkB3f,GAChB,OAAI2O,KACK3O,IAAcwc,GAAiBD,GAAaD,GAE9Ctc,IAAcwc,GAAiBF,GAAaC,EACrD,CACA,iBAAA+D,CAAkBzX,GAChB,OAAI8F,KACK9F,IAAU0T,GAAaC,GAAiBC,GAE1C5T,IAAU0T,GAAaE,GAAkBD,EAClD,CAGA,sBAAOrN,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOihB,GAAShG,oBAAoBtF,KAAM8D,GAChD,GAAsB,iBAAXA,GAIX,GAAsB,iBAAXA,EAAqB,CAC9B,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IACP,OAREzZ,EAAKiiB,GAAGxI,EASZ,GACF,EAOFvD,GAAac,GAAGhc,SAAUklB,GAvSE,uCAuS2C,SAAUnL,GAC/E,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MACrD,IAAKzT,IAAWA,EAAO8O,UAAU7W,SAASgmB,IACxC,OAEFpL,EAAMkD,iBACN,MAAM4L,EAAW5C,GAAShG,oBAAoB/Y,GACxC4hB,EAAanO,KAAKxE,aAAa,oBACrC,OAAI2S,GACFD,EAAS5B,GAAG6B,QACZD,EAAS7B,qBAGyC,SAAhDrJ,GAAYQ,iBAAiBxD,KAAM,UACrCkO,EAASrpB,YACTqpB,EAAS7B,sBAGX6B,EAAS/H,YACT+H,EAAS7B,oBACX,IACA9L,GAAac,GAAGzhB,OAAQ0qB,IAAuB,KAC7C,MAAM8D,EAAYvI,GAAe1T,KA5TR,6BA6TzB,IAAK,MAAM+b,KAAYE,EACrB9C,GAAShG,oBAAoB4I,EAC/B,IAOF/R,GAAmBmP,IAcnB,MAEM+C,GAAc,eAEdC,GAAe,OAAOD,KACtBE,GAAgB,QAAQF,KACxBG,GAAe,OAAOH,KACtBI,GAAiB,SAASJ,KAC1BK,GAAyB,QAAQL,cACjCM,GAAoB,OACpBC,GAAsB,WACtBC,GAAwB,aAExBC,GAA6B,WAAWF,OAAwBA,KAKhEG,GAAyB,8BACzBC,GAAY,CAChBvqB,OAAQ,KACRkjB,QAAQ,GAEJsH,GAAgB,CACpBxqB,OAAQ,iBACRkjB,OAAQ,WAOV,MAAMuH,WAAiBxK,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKmP,kBAAmB,EACxBnP,KAAKoP,cAAgB,GACrB,MAAMC,EAAaxJ,GAAe1T,KAAK4c,IACvC,IAAK,MAAMO,KAAQD,EAAY,CAC7B,MAAMtV,EAAW8L,GAAea,uBAAuB4I,GACjDC,EAAgB1J,GAAe1T,KAAK4H,GAAU5T,QAAOqpB,GAAgBA,IAAiBxP,KAAK4E,WAChF,OAAb7K,GAAqBwV,EAAc7e,QACrCsP,KAAKoP,cAAcxd,KAAK0d,EAE5B,CACAtP,KAAKyP,sBACAzP,KAAK6E,QAAQpgB,QAChBub,KAAK0P,0BAA0B1P,KAAKoP,cAAepP,KAAK2P,YAEtD3P,KAAK6E,QAAQ8C,QACf3H,KAAK2H,QAET,CAGA,kBAAWjE,GACT,OAAOsL,EACT,CACA,sBAAWrL,GACT,OAAOsL,EACT,CACA,eAAW1S,GACT,MA9DW,UA+Db,CAGA,MAAAoL,GACM3H,KAAK2P,WACP3P,KAAK4P,OAEL5P,KAAK6P,MAET,CACA,IAAAA,GACE,GAAI7P,KAAKmP,kBAAoBnP,KAAK2P,WAChC,OAEF,IAAIG,EAAiB,GAQrB,GALI9P,KAAK6E,QAAQpgB,SACfqrB,EAAiB9P,KAAK+P,uBAhEH,wCAgE4C5pB,QAAO5G,GAAWA,IAAYygB,KAAK4E,WAAU9hB,KAAIvD,GAAW2vB,GAAS5J,oBAAoB/lB,EAAS,CAC/JooB,QAAQ,OAGRmI,EAAepf,QAAUof,EAAe,GAAGX,iBAC7C,OAGF,GADmB5O,GAAaqB,QAAQ5B,KAAK4E,SAAU0J,IACxCtM,iBACb,OAEF,IAAK,MAAMgO,KAAkBF,EAC3BE,EAAeJ,OAEjB,MAAMK,EAAYjQ,KAAKkQ,gBACvBlQ,KAAK4E,SAASvJ,UAAU1B,OAAOiV,IAC/B5O,KAAK4E,SAASvJ,UAAU5E,IAAIoY,IAC5B7O,KAAK4E,SAAS7jB,MAAMkvB,GAAa,EACjCjQ,KAAK0P,0BAA0B1P,KAAKoP,eAAe,GACnDpP,KAAKmP,kBAAmB,EACxB,MAQMgB,EAAa,SADUF,EAAU,GAAGxL,cAAgBwL,EAAU7d,MAAM,KAE1E4N,KAAKmF,gBATY,KACfnF,KAAKmP,kBAAmB,EACxBnP,KAAK4E,SAASvJ,UAAU1B,OAAOkV,IAC/B7O,KAAK4E,SAASvJ,UAAU5E,IAAImY,GAAqBD,IACjD3O,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GACjC1P,GAAaqB,QAAQ5B,KAAK4E,SAAU2J,GAAc,GAItBvO,KAAK4E,UAAU,GAC7C5E,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GAAGjQ,KAAK4E,SAASuL,MACpD,CACA,IAAAP,GACE,GAAI5P,KAAKmP,mBAAqBnP,KAAK2P,WACjC,OAGF,GADmBpP,GAAaqB,QAAQ5B,KAAK4E,SAAU4J,IACxCxM,iBACb,OAEF,MAAMiO,EAAYjQ,KAAKkQ,gBACvBlQ,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GAAGjQ,KAAK4E,SAASthB,wBAAwB2sB,OAC1EpU,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIoY,IAC5B7O,KAAK4E,SAASvJ,UAAU1B,OAAOiV,GAAqBD,IACpD,IAAK,MAAM/M,KAAW5B,KAAKoP,cAAe,CACxC,MAAM7vB,EAAUsmB,GAAec,uBAAuB/E,GAClDriB,IAAYygB,KAAK2P,SAASpwB,IAC5BygB,KAAK0P,0BAA0B,CAAC9N,IAAU,EAE9C,CACA5B,KAAKmP,kBAAmB,EAOxBnP,KAAK4E,SAAS7jB,MAAMkvB,GAAa,GACjCjQ,KAAKmF,gBAPY,KACfnF,KAAKmP,kBAAmB,EACxBnP,KAAK4E,SAASvJ,UAAU1B,OAAOkV,IAC/B7O,KAAK4E,SAASvJ,UAAU5E,IAAImY,IAC5BrO,GAAaqB,QAAQ5B,KAAK4E,SAAU6J,GAAe,GAGvBzO,KAAK4E,UAAU,EAC/C,CACA,QAAA+K,CAASpwB,EAAUygB,KAAK4E,UACtB,OAAOrlB,EAAQ8b,UAAU7W,SAASmqB,GACpC,CAGA,iBAAA3K,CAAkBF,GAGhB,OAFAA,EAAO6D,OAAS7G,QAAQgD,EAAO6D,QAC/B7D,EAAOrf,OAASiW,GAAWoJ,EAAOrf,QAC3Bqf,CACT,CACA,aAAAoM,GACE,OAAOlQ,KAAK4E,SAASvJ,UAAU7W,SA3IL,uBAChB,QACC,QA0Ib,CACA,mBAAAirB,GACE,IAAKzP,KAAK6E,QAAQpgB,OAChB,OAEF,MAAMshB,EAAW/F,KAAK+P,uBAAuBhB,IAC7C,IAAK,MAAMxvB,KAAWwmB,EAAU,CAC9B,MAAMqK,EAAWvK,GAAec,uBAAuBpnB,GACnD6wB,GACFpQ,KAAK0P,0BAA0B,CAACnwB,GAAUygB,KAAK2P,SAASS,GAE5D,CACF,CACA,sBAAAL,CAAuBhW,GACrB,MAAMgM,EAAWF,GAAe1T,KAAK2c,GAA4B9O,KAAK6E,QAAQpgB,QAE9E,OAAOohB,GAAe1T,KAAK4H,EAAUiG,KAAK6E,QAAQpgB,QAAQ0B,QAAO5G,IAAYwmB,EAAS3E,SAAS7hB,IACjG,CACA,yBAAAmwB,CAA0BW,EAAcC,GACtC,GAAKD,EAAa3f,OAGlB,IAAK,MAAMnR,KAAW8wB,EACpB9wB,EAAQ8b,UAAUsM,OArKK,aAqKyB2I,GAChD/wB,EAAQ6B,aAAa,gBAAiBkvB,EAE1C,CAGA,sBAAO7T,CAAgBqH,GACrB,MAAMe,EAAU,CAAC,EAIjB,MAHsB,iBAAXf,GAAuB,YAAYzgB,KAAKygB,KACjDe,EAAQ8C,QAAS,GAEZ3H,KAAKwH,MAAK,WACf,MAAMnd,EAAO6kB,GAAS5J,oBAAoBtF,KAAM6E,GAChD,GAAsB,iBAAXf,EAAqB,CAC9B,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IACP,CACF,GACF,EAOFvD,GAAac,GAAGhc,SAAUqpB,GAAwBK,IAAwB,SAAU3P,IAErD,MAAzBA,EAAM7S,OAAO0a,SAAmB7H,EAAMW,gBAAmD,MAAjCX,EAAMW,eAAekH,UAC/E7H,EAAMkD,iBAER,IAAK,MAAM/iB,KAAWsmB,GAAee,gCAAgC5G,MACnEkP,GAAS5J,oBAAoB/lB,EAAS,CACpCooB,QAAQ,IACPA,QAEP,IAMAxL,GAAmB+S,IAcnB,MAAMqB,GAAS,WAETC,GAAc,eACdC,GAAiB,YAGjBC,GAAiB,UACjBC,GAAmB,YAGnBC,GAAe,OAAOJ,KACtBK,GAAiB,SAASL,KAC1BM,GAAe,OAAON,KACtBO,GAAgB,QAAQP,KACxBQ,GAAyB,QAAQR,KAAcC,KAC/CQ,GAAyB,UAAUT,KAAcC,KACjDS,GAAuB,QAAQV,KAAcC,KAC7CU,GAAoB,OAMpBC,GAAyB,4DACzBC,GAA6B,GAAGD,MAA0BD,KAC1DG,GAAgB,iBAIhBC,GAAgBtV,KAAU,UAAY,YACtCuV,GAAmBvV,KAAU,YAAc,UAC3CwV,GAAmBxV,KAAU,aAAe,eAC5CyV,GAAsBzV,KAAU,eAAiB,aACjD0V,GAAkB1V,KAAU,aAAe,cAC3C2V,GAAiB3V,KAAU,cAAgB,aAG3C4V,GAAY,CAChBC,WAAW,EACX7jB,SAAU,kBACV8jB,QAAS,UACT/pB,OAAQ,CAAC,EAAG,GACZgqB,aAAc,KACd1zB,UAAW,UAEP2zB,GAAgB,CACpBH,UAAW,mBACX7jB,SAAU,mBACV8jB,QAAS,SACT/pB,OAAQ,0BACRgqB,aAAc,yBACd1zB,UAAW,2BAOb,MAAM4zB,WAAiBxN,GACrB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKmS,QAAU,KACfnS,KAAKoS,QAAUpS,KAAK4E,SAAS7f,WAE7Bib,KAAKqS,MAAQxM,GAAehhB,KAAKmb,KAAK4E,SAAU0M,IAAe,IAAMzL,GAAeM,KAAKnG,KAAK4E,SAAU0M,IAAe,IAAMzL,GAAeC,QAAQwL,GAAetR,KAAKoS,SACxKpS,KAAKsS,UAAYtS,KAAKuS,eACxB,CAGA,kBAAW7O,GACT,OAAOmO,EACT,CACA,sBAAWlO,GACT,OAAOsO,EACT,CACA,eAAW1V,GACT,OAAOgU,EACT,CAGA,MAAA5I,GACE,OAAO3H,KAAK2P,WAAa3P,KAAK4P,OAAS5P,KAAK6P,MAC9C,CACA,IAAAA,GACE,GAAI3U,GAAW8E,KAAK4E,WAAa5E,KAAK2P,WACpC,OAEF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAK4E,UAGtB,IADkBrE,GAAaqB,QAAQ5B,KAAK4E,SAAUkM,GAAchR,GACtDkC,iBAAd,CASA,GANAhC,KAAKwS,gBAMD,iBAAkBntB,SAASC,kBAAoB0a,KAAKoS,QAAQpX,QAzExC,eA0EtB,IAAK,MAAMzb,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAac,GAAG9hB,EAAS,YAAaqc,IAG1CoE,KAAK4E,SAAS6N,QACdzS,KAAK4E,SAASxjB,aAAa,iBAAiB,GAC5C4e,KAAKqS,MAAMhX,UAAU5E,IAAI0a,IACzBnR,KAAK4E,SAASvJ,UAAU5E,IAAI0a,IAC5B5Q,GAAaqB,QAAQ5B,KAAK4E,SAAUmM,GAAejR,EAhBnD,CAiBF,CACA,IAAA8P,GACE,GAAI1U,GAAW8E,KAAK4E,YAAc5E,KAAK2P,WACrC,OAEF,MAAM7P,EAAgB,CACpBA,cAAeE,KAAK4E,UAEtB5E,KAAK0S,cAAc5S,EACrB,CACA,OAAAiF,GACM/E,KAAKmS,SACPnS,KAAKmS,QAAQnZ,UAEf2L,MAAMI,SACR,CACA,MAAAha,GACEiV,KAAKsS,UAAYtS,KAAKuS,gBAClBvS,KAAKmS,SACPnS,KAAKmS,QAAQpnB,QAEjB,CAGA,aAAA2nB,CAAc5S,GAEZ,IADkBS,GAAaqB,QAAQ5B,KAAK4E,SAAUgM,GAAc9Q,GACtDkC,iBAAd,CAMA,GAAI,iBAAkB3c,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAaC,IAAIjhB,EAAS,YAAaqc,IAGvCoE,KAAKmS,SACPnS,KAAKmS,QAAQnZ,UAEfgH,KAAKqS,MAAMhX,UAAU1B,OAAOwX,IAC5BnR,KAAK4E,SAASvJ,UAAU1B,OAAOwX,IAC/BnR,KAAK4E,SAASxjB,aAAa,gBAAiB,SAC5C4hB,GAAYE,oBAAoBlD,KAAKqS,MAAO,UAC5C9R,GAAaqB,QAAQ5B,KAAK4E,SAAUiM,GAAgB/Q,EAhBpD,CAiBF,CACA,UAAA+D,CAAWC,GAET,GAAgC,iBADhCA,EAASa,MAAMd,WAAWC,IACRxlB,YAA2B,GAAUwlB,EAAOxlB,YAAgE,mBAA3CwlB,EAAOxlB,UAAUgF,sBAElG,MAAM,IAAIkhB,UAAU,GAAG+L,GAAO9L,+GAEhC,OAAOX,CACT,CACA,aAAA0O,GACE,QAAsB,IAAX,EACT,MAAM,IAAIhO,UAAU,gEAEtB,IAAImO,EAAmB3S,KAAK4E,SACG,WAA3B5E,KAAK6E,QAAQvmB,UACfq0B,EAAmB3S,KAAKoS,QACf,GAAUpS,KAAK6E,QAAQvmB,WAChCq0B,EAAmBjY,GAAWsF,KAAK6E,QAAQvmB,WACA,iBAA3B0hB,KAAK6E,QAAQvmB,YAC7Bq0B,EAAmB3S,KAAK6E,QAAQvmB,WAElC,MAAM0zB,EAAehS,KAAK4S,mBAC1B5S,KAAKmS,QAAU,GAAoBQ,EAAkB3S,KAAKqS,MAAOL,EACnE,CACA,QAAArC,GACE,OAAO3P,KAAKqS,MAAMhX,UAAU7W,SAAS2sB,GACvC,CACA,aAAA0B,GACE,MAAMC,EAAiB9S,KAAKoS,QAC5B,GAAIU,EAAezX,UAAU7W,SArKN,WAsKrB,OAAOmtB,GAET,GAAImB,EAAezX,UAAU7W,SAvKJ,aAwKvB,OAAOotB,GAET,GAAIkB,EAAezX,UAAU7W,SAzKA,iBA0K3B,MA5JsB,MA8JxB,GAAIsuB,EAAezX,UAAU7W,SA3KE,mBA4K7B,MA9JyB,SAkK3B,MAAMuuB,EAAkF,QAA1E9tB,iBAAiB+a,KAAKqS,OAAOvX,iBAAiB,iBAAiB6K,OAC7E,OAAImN,EAAezX,UAAU7W,SArLP,UAsLbuuB,EAAQvB,GAAmBD,GAE7BwB,EAAQrB,GAAsBD,EACvC,CACA,aAAAc,GACE,OAAkD,OAA3CvS,KAAK4E,SAAS5J,QAnLD,UAoLtB,CACA,UAAAgY,GACE,MAAM,OACJhrB,GACEgY,KAAK6E,QACT,MAAsB,iBAAX7c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAAS4f,OAAOgQ,SAAS5vB,EAAO,MAEzC,mBAAXqK,EACFirB,GAAcjrB,EAAOirB,EAAYjT,KAAK4E,UAExC5c,CACT,CACA,gBAAA4qB,GACE,MAAMM,EAAwB,CAC5Bx0B,UAAWshB,KAAK6S,gBAChBzc,UAAW,CAAC,CACV9V,KAAM,kBACNmB,QAAS,CACPwM,SAAU+R,KAAK6E,QAAQ5W,WAExB,CACD3N,KAAM,SACNmB,QAAS,CACPuG,OAAQgY,KAAKgT,iBAanB,OAPIhT,KAAKsS,WAAsC,WAAzBtS,KAAK6E,QAAQkN,WACjC/O,GAAYC,iBAAiBjD,KAAKqS,MAAO,SAAU,UACnDa,EAAsB9c,UAAY,CAAC,CACjC9V,KAAM,cACNC,SAAS,KAGN,IACF2yB,KACArW,GAAQmD,KAAK6E,QAAQmN,aAAc,CAACkB,IAE3C,CACA,eAAAC,EAAgB,IACdr2B,EAAG,OACHyP,IAEA,MAAMggB,EAAQ1G,GAAe1T,KAhOF,8DAgO+B6N,KAAKqS,OAAOlsB,QAAO5G,GAAWob,GAAUpb,KAC7FgtB,EAAM7b,QAMXoN,GAAqByO,EAAOhgB,EAAQzP,IAAQ6zB,IAAmBpE,EAAMnL,SAAS7U,IAASkmB,OACzF,CAGA,sBAAOhW,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO6nB,GAAS5M,oBAAoBtF,KAAM8D,GAChD,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,CACA,iBAAOsP,CAAWhU,GAChB,GA5QuB,IA4QnBA,EAAMwI,QAAgD,UAAfxI,EAAMqB,MA/QnC,QA+QuDrB,EAAMtiB,IACzE,OAEF,MAAMu2B,EAAcxN,GAAe1T,KAAKkf,IACxC,IAAK,MAAM1J,KAAU0L,EAAa,CAChC,MAAMC,EAAUpB,GAAS7M,YAAYsC,GACrC,IAAK2L,IAAyC,IAA9BA,EAAQzO,QAAQiN,UAC9B,SAEF,MAAMyB,EAAenU,EAAMmU,eACrBC,EAAeD,EAAanS,SAASkS,EAAQjB,OACnD,GAAIkB,EAAanS,SAASkS,EAAQ1O,WAA2C,WAA9B0O,EAAQzO,QAAQiN,YAA2B0B,GAA8C,YAA9BF,EAAQzO,QAAQiN,WAA2B0B,EACnJ,SAIF,GAAIF,EAAQjB,MAAM7tB,SAAS4a,EAAM7S,UAA2B,UAAf6S,EAAMqB,MA/RvC,QA+R2DrB,EAAMtiB,KAAqB,qCAAqCuG,KAAK+b,EAAM7S,OAAO0a,UACvJ,SAEF,MAAMnH,EAAgB,CACpBA,cAAewT,EAAQ1O,UAEN,UAAfxF,EAAMqB,OACRX,EAAckH,WAAa5H,GAE7BkU,EAAQZ,cAAc5S,EACxB,CACF,CACA,4BAAO2T,CAAsBrU,GAI3B,MAAMsU,EAAU,kBAAkBrwB,KAAK+b,EAAM7S,OAAO0a,SAC9C0M,EAjTW,WAiTKvU,EAAMtiB,IACtB82B,EAAkB,CAAClD,GAAgBC,IAAkBvP,SAAShC,EAAMtiB,KAC1E,IAAK82B,IAAoBD,EACvB,OAEF,GAAID,IAAYC,EACd,OAEFvU,EAAMkD,iBAGN,MAAMuR,EAAkB7T,KAAKgG,QAAQoL,IAA0BpR,KAAO6F,GAAeM,KAAKnG,KAAMoR,IAAwB,IAAMvL,GAAehhB,KAAKmb,KAAMoR,IAAwB,IAAMvL,GAAeC,QAAQsL,GAAwBhS,EAAMW,eAAehb,YACpPwF,EAAW2nB,GAAS5M,oBAAoBuO,GAC9C,GAAID,EAIF,OAHAxU,EAAM0U,kBACNvpB,EAASslB,YACTtlB,EAAS4oB,gBAAgB/T,GAGvB7U,EAASolB,aAEXvQ,EAAM0U,kBACNvpB,EAASqlB,OACTiE,EAAgBpB,QAEpB,EAOFlS,GAAac,GAAGhc,SAAU4rB,GAAwBG,GAAwBc,GAASuB,uBACnFlT,GAAac,GAAGhc,SAAU4rB,GAAwBK,GAAeY,GAASuB,uBAC1ElT,GAAac,GAAGhc,SAAU2rB,GAAwBkB,GAASkB,YAC3D7S,GAAac,GAAGhc,SAAU6rB,GAAsBgB,GAASkB,YACzD7S,GAAac,GAAGhc,SAAU2rB,GAAwBI,IAAwB,SAAUhS,GAClFA,EAAMkD,iBACN4P,GAAS5M,oBAAoBtF,MAAM2H,QACrC,IAMAxL,GAAmB+V,IAcnB,MAAM6B,GAAS,WAETC,GAAoB,OACpBC,GAAkB,gBAAgBF,KAClCG,GAAY,CAChBC,UAAW,iBACXC,cAAe,KACfhP,YAAY,EACZzK,WAAW,EAEX0Z,YAAa,QAETC,GAAgB,CACpBH,UAAW,SACXC,cAAe,kBACfhP,WAAY,UACZzK,UAAW,UACX0Z,YAAa,oBAOf,MAAME,WAAiB9Q,GACrB,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAKwU,aAAc,EACnBxU,KAAK4E,SAAW,IAClB,CAGA,kBAAWlB,GACT,OAAOwQ,EACT,CACA,sBAAWvQ,GACT,OAAO2Q,EACT,CACA,eAAW/X,GACT,OAAOwX,EACT,CAGA,IAAAlE,CAAKxT,GACH,IAAK2D,KAAK6E,QAAQlK,UAEhB,YADAkC,GAAQR,GAGV2D,KAAKyU,UACL,MAAMl1B,EAAUygB,KAAK0U,cACjB1U,KAAK6E,QAAQO,YACfvJ,GAAOtc,GAETA,EAAQ8b,UAAU5E,IAAIud,IACtBhU,KAAK2U,mBAAkB,KACrB9X,GAAQR,EAAS,GAErB,CACA,IAAAuT,CAAKvT,GACE2D,KAAK6E,QAAQlK,WAIlBqF,KAAK0U,cAAcrZ,UAAU1B,OAAOqa,IACpChU,KAAK2U,mBAAkB,KACrB3U,KAAK+E,UACLlI,GAAQR,EAAS,KANjBQ,GAAQR,EAQZ,CACA,OAAA0I,GACO/E,KAAKwU,cAGVjU,GAAaC,IAAIR,KAAK4E,SAAUqP,IAChCjU,KAAK4E,SAASjL,SACdqG,KAAKwU,aAAc,EACrB,CAGA,WAAAE,GACE,IAAK1U,KAAK4E,SAAU,CAClB,MAAMgQ,EAAWvvB,SAASwvB,cAAc,OACxCD,EAAST,UAAYnU,KAAK6E,QAAQsP,UAC9BnU,KAAK6E,QAAQO,YACfwP,EAASvZ,UAAU5E,IApFD,QAsFpBuJ,KAAK4E,SAAWgQ,CAClB,CACA,OAAO5U,KAAK4E,QACd,CACA,iBAAAZ,CAAkBF,GAGhB,OADAA,EAAOuQ,YAAc3Z,GAAWoJ,EAAOuQ,aAChCvQ,CACT,CACA,OAAA2Q,GACE,GAAIzU,KAAKwU,YACP,OAEF,MAAMj1B,EAAUygB,KAAK0U,cACrB1U,KAAK6E,QAAQwP,YAAYS,OAAOv1B,GAChCghB,GAAac,GAAG9hB,EAAS00B,IAAiB,KACxCpX,GAAQmD,KAAK6E,QAAQuP,cAAc,IAErCpU,KAAKwU,aAAc,CACrB,CACA,iBAAAG,CAAkBtY,GAChBW,GAAuBX,EAAU2D,KAAK0U,cAAe1U,KAAK6E,QAAQO,WACpE,EAeF,MAEM2P,GAAc,gBACdC,GAAkB,UAAUD,KAC5BE,GAAoB,cAAcF,KAGlCG,GAAmB,WACnBC,GAAY,CAChBC,WAAW,EACXC,YAAa,MAETC,GAAgB,CACpBF,UAAW,UACXC,YAAa,WAOf,MAAME,WAAkB9R,GACtB,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,GAC/B9D,KAAKwV,WAAY,EACjBxV,KAAKyV,qBAAuB,IAC9B,CAGA,kBAAW/R,GACT,OAAOyR,EACT,CACA,sBAAWxR,GACT,OAAO2R,EACT,CACA,eAAW/Y,GACT,MArCW,WAsCb,CAGA,QAAAmZ,GACM1V,KAAKwV,YAGLxV,KAAK6E,QAAQuQ,WACfpV,KAAK6E,QAAQwQ,YAAY5C,QAE3BlS,GAAaC,IAAInb,SAAU0vB,IAC3BxU,GAAac,GAAGhc,SAAU2vB,IAAiB5V,GAASY,KAAK2V,eAAevW,KACxEmB,GAAac,GAAGhc,SAAU4vB,IAAmB7V,GAASY,KAAK4V,eAAexW,KAC1EY,KAAKwV,WAAY,EACnB,CACA,UAAAK,GACO7V,KAAKwV,YAGVxV,KAAKwV,WAAY,EACjBjV,GAAaC,IAAInb,SAAU0vB,IAC7B,CAGA,cAAAY,CAAevW,GACb,MAAM,YACJiW,GACErV,KAAK6E,QACT,GAAIzF,EAAM7S,SAAWlH,UAAY+Z,EAAM7S,SAAW8oB,GAAeA,EAAY7wB,SAAS4a,EAAM7S,QAC1F,OAEF,MAAM1L,EAAWglB,GAAeU,kBAAkB8O,GAC1B,IAApBx0B,EAAS6P,OACX2kB,EAAY5C,QACHzS,KAAKyV,uBAAyBP,GACvCr0B,EAASA,EAAS6P,OAAS,GAAG+hB,QAE9B5xB,EAAS,GAAG4xB,OAEhB,CACA,cAAAmD,CAAexW,GAzED,QA0ERA,EAAMtiB,MAGVkjB,KAAKyV,qBAAuBrW,EAAM0W,SAAWZ,GA5EzB,UA6EtB,EAeF,MAAMa,GAAyB,oDACzBC,GAA0B,cAC1BC,GAAmB,gBACnBC,GAAkB,eAMxB,MAAMC,GACJ,WAAAhS,GACEnE,KAAK4E,SAAWvf,SAAS6G,IAC3B,CAGA,QAAAkqB,GAEE,MAAMC,EAAgBhxB,SAASC,gBAAgBuC,YAC/C,OAAO1F,KAAKoC,IAAI3E,OAAO02B,WAAaD,EACtC,CACA,IAAAzG,GACE,MAAM/rB,EAAQmc,KAAKoW,WACnBpW,KAAKuW,mBAELvW,KAAKwW,sBAAsBxW,KAAK4E,SAAUqR,IAAkBQ,GAAmBA,EAAkB5yB,IAEjGmc,KAAKwW,sBAAsBT,GAAwBE,IAAkBQ,GAAmBA,EAAkB5yB,IAC1Gmc,KAAKwW,sBAAsBR,GAAyBE,IAAiBO,GAAmBA,EAAkB5yB,GAC5G,CACA,KAAAwO,GACE2N,KAAK0W,wBAAwB1W,KAAK4E,SAAU,YAC5C5E,KAAK0W,wBAAwB1W,KAAK4E,SAAUqR,IAC5CjW,KAAK0W,wBAAwBX,GAAwBE,IACrDjW,KAAK0W,wBAAwBV,GAAyBE,GACxD,CACA,aAAAS,GACE,OAAO3W,KAAKoW,WAAa,CAC3B,CAGA,gBAAAG,GACEvW,KAAK4W,sBAAsB5W,KAAK4E,SAAU,YAC1C5E,KAAK4E,SAAS7jB,MAAM+K,SAAW,QACjC,CACA,qBAAA0qB,CAAsBzc,EAAU8c,EAAexa,GAC7C,MAAMya,EAAiB9W,KAAKoW,WAS5BpW,KAAK+W,2BAA2Bhd,GARHxa,IAC3B,GAAIA,IAAYygB,KAAK4E,UAAYhlB,OAAO02B,WAAa/2B,EAAQsI,YAAcivB,EACzE,OAEF9W,KAAK4W,sBAAsBr3B,EAASs3B,GACpC,MAAMJ,EAAkB72B,OAAOqF,iBAAiB1F,GAASub,iBAAiB+b,GAC1Et3B,EAAQwB,MAAMi2B,YAAYH,EAAe,GAAGxa,EAASkB,OAAOC,WAAWiZ,QAAsB,GAGjG,CACA,qBAAAG,CAAsBr3B,EAASs3B,GAC7B,MAAMI,EAAc13B,EAAQwB,MAAM+Z,iBAAiB+b,GAC/CI,GACFjU,GAAYC,iBAAiB1jB,EAASs3B,EAAeI,EAEzD,CACA,uBAAAP,CAAwB3c,EAAU8c,GAWhC7W,KAAK+W,2BAA2Bhd,GAVHxa,IAC3B,MAAM5B,EAAQqlB,GAAYQ,iBAAiBjkB,EAASs3B,GAEtC,OAAVl5B,GAIJqlB,GAAYE,oBAAoB3jB,EAASs3B,GACzCt3B,EAAQwB,MAAMi2B,YAAYH,EAAel5B,IAJvC4B,EAAQwB,MAAMm2B,eAAeL,EAIgB,GAGnD,CACA,0BAAAE,CAA2Bhd,EAAUod,GACnC,GAAI,GAAUpd,GACZod,EAASpd,QAGX,IAAK,MAAM6L,KAAOC,GAAe1T,KAAK4H,EAAUiG,KAAK4E,UACnDuS,EAASvR,EAEb,EAeF,MAEMwR,GAAc,YAGdC,GAAe,OAAOD,KACtBE,GAAyB,gBAAgBF,KACzCG,GAAiB,SAASH,KAC1BI,GAAe,OAAOJ,KACtBK,GAAgB,QAAQL,KACxBM,GAAiB,SAASN,KAC1BO,GAAsB,gBAAgBP,KACtCQ,GAA0B,oBAAoBR,KAC9CS,GAA0B,kBAAkBT,KAC5CU,GAAyB,QAAQV,cACjCW,GAAkB,aAElBC,GAAoB,OACpBC,GAAoB,eAKpBC,GAAY,CAChBtD,UAAU,EACVnC,OAAO,EACPzH,UAAU,GAENmN,GAAgB,CACpBvD,SAAU,mBACVnC,MAAO,UACPzH,SAAU,WAOZ,MAAMoN,WAAc1T,GAClB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAKqY,QAAUxS,GAAeC,QArBV,gBAqBmC9F,KAAK4E,UAC5D5E,KAAKsY,UAAYtY,KAAKuY,sBACtBvY,KAAKwY,WAAaxY,KAAKyY,uBACvBzY,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK0Y,WAAa,IAAIvC,GACtBnW,KAAK6L,oBACP,CAGA,kBAAWnI,GACT,OAAOwU,EACT,CACA,sBAAWvU,GACT,OAAOwU,EACT,CACA,eAAW5b,GACT,MA1DW,OA2Db,CAGA,MAAAoL,CAAO7H,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CACA,IAAA+P,CAAK/P,GACCE,KAAK2P,UAAY3P,KAAKmP,kBAGR5O,GAAaqB,QAAQ5B,KAAK4E,SAAU4S,GAAc,CAClE1X,kBAEYkC,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAK0Y,WAAW9I,OAChBvqB,SAAS6G,KAAKmP,UAAU5E,IAAIshB,IAC5B/X,KAAK2Y,gBACL3Y,KAAKsY,UAAUzI,MAAK,IAAM7P,KAAK4Y,aAAa9Y,KAC9C,CACA,IAAA8P,GACO5P,KAAK2P,WAAY3P,KAAKmP,mBAGT5O,GAAaqB,QAAQ5B,KAAK4E,SAAUyS,IACxCrV,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKmP,kBAAmB,EACxBnP,KAAKwY,WAAW3C,aAChB7V,KAAK4E,SAASvJ,UAAU1B,OAAOqe,IAC/BhY,KAAKmF,gBAAe,IAAMnF,KAAK6Y,cAAc7Y,KAAK4E,SAAU5E,KAAKgO,gBACnE,CACA,OAAAjJ,GACExE,GAAaC,IAAI5gB,OAAQw3B,IACzB7W,GAAaC,IAAIR,KAAKqY,QAASjB,IAC/BpX,KAAKsY,UAAUvT,UACf/E,KAAKwY,WAAW3C,aAChBlR,MAAMI,SACR,CACA,YAAA+T,GACE9Y,KAAK2Y,eACP,CAGA,mBAAAJ,GACE,OAAO,IAAIhE,GAAS,CAClB5Z,UAAWmG,QAAQd,KAAK6E,QAAQ+P,UAEhCxP,WAAYpF,KAAKgO,eAErB,CACA,oBAAAyK,GACE,OAAO,IAAIlD,GAAU,CACnBF,YAAarV,KAAK4E,UAEtB,CACA,YAAAgU,CAAa9Y,GAENza,SAAS6G,KAAK1H,SAASwb,KAAK4E,WAC/Bvf,SAAS6G,KAAK4oB,OAAO9U,KAAK4E,UAE5B5E,KAAK4E,SAAS7jB,MAAMgxB,QAAU,QAC9B/R,KAAK4E,SAASzjB,gBAAgB,eAC9B6e,KAAK4E,SAASxjB,aAAa,cAAc,GACzC4e,KAAK4E,SAASxjB,aAAa,OAAQ,UACnC4e,KAAK4E,SAASnZ,UAAY,EAC1B,MAAMstB,EAAYlT,GAAeC,QA7GT,cA6GsC9F,KAAKqY,SAC/DU,IACFA,EAAUttB,UAAY,GAExBoQ,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIuhB,IAU5BhY,KAAKmF,gBATsB,KACrBnF,KAAK6E,QAAQ4N,OACfzS,KAAKwY,WAAW9C,WAElB1V,KAAKmP,kBAAmB,EACxB5O,GAAaqB,QAAQ5B,KAAK4E,SAAU6S,GAAe,CACjD3X,iBACA,GAEoCE,KAAKqY,QAASrY,KAAKgO,cAC7D,CACA,kBAAAnC,GACEtL,GAAac,GAAGrB,KAAK4E,SAAUiT,IAAyBzY,IAhJvC,WAiJXA,EAAMtiB,MAGNkjB,KAAK6E,QAAQmG,SACfhL,KAAK4P,OAGP5P,KAAKgZ,6BAA4B,IAEnCzY,GAAac,GAAGzhB,OAAQ83B,IAAgB,KAClC1X,KAAK2P,WAAa3P,KAAKmP,kBACzBnP,KAAK2Y,eACP,IAEFpY,GAAac,GAAGrB,KAAK4E,SAAUgT,IAAyBxY,IAEtDmB,GAAae,IAAItB,KAAK4E,SAAU+S,IAAqBsB,IAC/CjZ,KAAK4E,WAAaxF,EAAM7S,QAAUyT,KAAK4E,WAAaqU,EAAO1sB,SAGjC,WAA1ByT,KAAK6E,QAAQ+P,SAIb5U,KAAK6E,QAAQ+P,UACf5U,KAAK4P,OAJL5P,KAAKgZ,6BAKP,GACA,GAEN,CACA,UAAAH,GACE7Y,KAAK4E,SAAS7jB,MAAMgxB,QAAU,OAC9B/R,KAAK4E,SAASxjB,aAAa,eAAe,GAC1C4e,KAAK4E,SAASzjB,gBAAgB,cAC9B6e,KAAK4E,SAASzjB,gBAAgB,QAC9B6e,KAAKmP,kBAAmB,EACxBnP,KAAKsY,UAAU1I,MAAK,KAClBvqB,SAAS6G,KAAKmP,UAAU1B,OAAOoe,IAC/B/X,KAAKkZ,oBACLlZ,KAAK0Y,WAAWrmB,QAChBkO,GAAaqB,QAAQ5B,KAAK4E,SAAU2S,GAAe,GAEvD,CACA,WAAAvJ,GACE,OAAOhO,KAAK4E,SAASvJ,UAAU7W,SAjLT,OAkLxB,CACA,0BAAAw0B,GAEE,GADkBzY,GAAaqB,QAAQ5B,KAAK4E,SAAU0S,IACxCtV,iBACZ,OAEF,MAAMmX,EAAqBnZ,KAAK4E,SAASvX,aAAehI,SAASC,gBAAgBsC,aAC3EwxB,EAAmBpZ,KAAK4E,SAAS7jB,MAAMiL,UAEpB,WAArBotB,GAAiCpZ,KAAK4E,SAASvJ,UAAU7W,SAASyzB,MAGjEkB,IACHnZ,KAAK4E,SAAS7jB,MAAMiL,UAAY,UAElCgU,KAAK4E,SAASvJ,UAAU5E,IAAIwhB,IAC5BjY,KAAKmF,gBAAe,KAClBnF,KAAK4E,SAASvJ,UAAU1B,OAAOse,IAC/BjY,KAAKmF,gBAAe,KAClBnF,KAAK4E,SAAS7jB,MAAMiL,UAAYotB,CAAgB,GAC/CpZ,KAAKqY,QAAQ,GACfrY,KAAKqY,SACRrY,KAAK4E,SAAS6N,QAChB,CAMA,aAAAkG,GACE,MAAMQ,EAAqBnZ,KAAK4E,SAASvX,aAAehI,SAASC,gBAAgBsC,aAC3EkvB,EAAiB9W,KAAK0Y,WAAWtC,WACjCiD,EAAoBvC,EAAiB,EAC3C,GAAIuC,IAAsBF,EAAoB,CAC5C,MAAMr3B,EAAWma,KAAU,cAAgB,eAC3C+D,KAAK4E,SAAS7jB,MAAMe,GAAY,GAAGg1B,KACrC,CACA,IAAKuC,GAAqBF,EAAoB,CAC5C,MAAMr3B,EAAWma,KAAU,eAAiB,cAC5C+D,KAAK4E,SAAS7jB,MAAMe,GAAY,GAAGg1B,KACrC,CACF,CACA,iBAAAoC,GACElZ,KAAK4E,SAAS7jB,MAAMu4B,YAAc,GAClCtZ,KAAK4E,SAAS7jB,MAAMw4B,aAAe,EACrC,CAGA,sBAAO9c,CAAgBqH,EAAQhE,GAC7B,OAAOE,KAAKwH,MAAK,WACf,MAAMnd,EAAO+tB,GAAM9S,oBAAoBtF,KAAM8D,GAC7C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQhE,EAJb,CAKF,GACF,EAOFS,GAAac,GAAGhc,SAAUyyB,GA9OK,4BA8O2C,SAAU1Y,GAClF,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MACjD,CAAC,IAAK,QAAQoB,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAER/B,GAAae,IAAI/U,EAAQirB,IAAcgC,IACjCA,EAAUxX,kBAIdzB,GAAae,IAAI/U,EAAQgrB,IAAgB,KACnC5c,GAAUqF,OACZA,KAAKyS,OACP,GACA,IAIJ,MAAMgH,EAAc5T,GAAeC,QAnQb,eAoQlB2T,GACFrB,GAAM/S,YAAYoU,GAAa7J,OAEpBwI,GAAM9S,oBAAoB/Y,GAClCob,OAAO3H,KACd,IACA6G,GAAqBuR,IAMrBjc,GAAmBic,IAcnB,MAEMsB,GAAc,gBACdC,GAAiB,YACjBC,GAAwB,OAAOF,KAAcC,KAE7CE,GAAoB,OACpBC,GAAuB,UACvBC,GAAoB,SAEpBC,GAAgB,kBAChBC,GAAe,OAAOP,KACtBQ,GAAgB,QAAQR,KACxBS,GAAe,OAAOT,KACtBU,GAAuB,gBAAgBV,KACvCW,GAAiB,SAASX,KAC1BY,GAAe,SAASZ,KACxBa,GAAyB,QAAQb,KAAcC,KAC/Ca,GAAwB,kBAAkBd,KAE1Ce,GAAY,CAChB7F,UAAU,EACV5J,UAAU,EACVvgB,QAAQ,GAEJiwB,GAAgB,CACpB9F,SAAU,mBACV5J,SAAU,UACVvgB,OAAQ,WAOV,MAAMkwB,WAAkBjW,GACtB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAK2P,UAAW,EAChB3P,KAAKsY,UAAYtY,KAAKuY,sBACtBvY,KAAKwY,WAAaxY,KAAKyY,uBACvBzY,KAAK6L,oBACP,CAGA,kBAAWnI,GACT,OAAO+W,EACT,CACA,sBAAW9W,GACT,OAAO+W,EACT,CACA,eAAWne,GACT,MApDW,WAqDb,CAGA,MAAAoL,CAAO7H,GACL,OAAOE,KAAK2P,SAAW3P,KAAK4P,OAAS5P,KAAK6P,KAAK/P,EACjD,CACA,IAAA+P,CAAK/P,GACCE,KAAK2P,UAGSpP,GAAaqB,QAAQ5B,KAAK4E,SAAUqV,GAAc,CAClEna,kBAEYkC,mBAGdhC,KAAK2P,UAAW,EAChB3P,KAAKsY,UAAUzI,OACV7P,KAAK6E,QAAQpa,SAChB,IAAI0rB,IAAkBvG,OAExB5P,KAAK4E,SAASxjB,aAAa,cAAc,GACzC4e,KAAK4E,SAASxjB,aAAa,OAAQ,UACnC4e,KAAK4E,SAASvJ,UAAU5E,IAAIqjB,IAW5B9Z,KAAKmF,gBAVoB,KAClBnF,KAAK6E,QAAQpa,SAAUuV,KAAK6E,QAAQ+P,UACvC5U,KAAKwY,WAAW9C,WAElB1V,KAAK4E,SAASvJ,UAAU5E,IAAIojB,IAC5B7Z,KAAK4E,SAASvJ,UAAU1B,OAAOmgB,IAC/BvZ,GAAaqB,QAAQ5B,KAAK4E,SAAUsV,GAAe,CACjDpa,iBACA,GAEkCE,KAAK4E,UAAU,GACvD,CACA,IAAAgL,GACO5P,KAAK2P,WAGQpP,GAAaqB,QAAQ5B,KAAK4E,SAAUuV,IACxCnY,mBAGdhC,KAAKwY,WAAW3C,aAChB7V,KAAK4E,SAASgW,OACd5a,KAAK2P,UAAW,EAChB3P,KAAK4E,SAASvJ,UAAU5E,IAAIsjB,IAC5B/Z,KAAKsY,UAAU1I,OAUf5P,KAAKmF,gBAToB,KACvBnF,KAAK4E,SAASvJ,UAAU1B,OAAOkgB,GAAmBE,IAClD/Z,KAAK4E,SAASzjB,gBAAgB,cAC9B6e,KAAK4E,SAASzjB,gBAAgB,QACzB6e,KAAK6E,QAAQpa,SAChB,IAAI0rB,IAAkB9jB,QAExBkO,GAAaqB,QAAQ5B,KAAK4E,SAAUyV,GAAe,GAEfra,KAAK4E,UAAU,IACvD,CACA,OAAAG,GACE/E,KAAKsY,UAAUvT,UACf/E,KAAKwY,WAAW3C,aAChBlR,MAAMI,SACR,CAGA,mBAAAwT,GACE,MASM5d,EAAYmG,QAAQd,KAAK6E,QAAQ+P,UACvC,OAAO,IAAIL,GAAS,CAClBJ,UA3HsB,qBA4HtBxZ,YACAyK,YAAY,EACZiP,YAAarU,KAAK4E,SAAS7f,WAC3BqvB,cAAezZ,EAfK,KACU,WAA1BqF,KAAK6E,QAAQ+P,SAIjB5U,KAAK4P,OAHHrP,GAAaqB,QAAQ5B,KAAK4E,SAAUwV,GAG3B,EAUgC,MAE/C,CACA,oBAAA3B,GACE,OAAO,IAAIlD,GAAU,CACnBF,YAAarV,KAAK4E,UAEtB,CACA,kBAAAiH,GACEtL,GAAac,GAAGrB,KAAK4E,SAAU4V,IAAuBpb,IA5IvC,WA6ITA,EAAMtiB,MAGNkjB,KAAK6E,QAAQmG,SACfhL,KAAK4P,OAGPrP,GAAaqB,QAAQ5B,KAAK4E,SAAUwV,IAAqB,GAE7D,CAGA,sBAAO3d,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOswB,GAAUrV,oBAAoBtF,KAAM8D,GACjD,GAAsB,iBAAXA,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KAJb,CAKF,GACF,EAOFO,GAAac,GAAGhc,SAAUk1B,GA7JK,gCA6J2C,SAAUnb,GAClF,MAAM7S,EAASsZ,GAAec,uBAAuB3G,MAIrD,GAHI,CAAC,IAAK,QAAQoB,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,MACb,OAEFO,GAAae,IAAI/U,EAAQ8tB,IAAgB,KAEnC1f,GAAUqF,OACZA,KAAKyS,OACP,IAIF,MAAMgH,EAAc5T,GAAeC,QAAQkU,IACvCP,GAAeA,IAAgBltB,GACjCouB,GAAUtV,YAAYoU,GAAa7J,OAExB+K,GAAUrV,oBAAoB/Y,GACtCob,OAAO3H,KACd,IACAO,GAAac,GAAGzhB,OAAQg6B,IAAuB,KAC7C,IAAK,MAAM7f,KAAY8L,GAAe1T,KAAK6nB,IACzCW,GAAUrV,oBAAoBvL,GAAU8V,MAC1C,IAEFtP,GAAac,GAAGzhB,OAAQ06B,IAAc,KACpC,IAAK,MAAM/6B,KAAWsmB,GAAe1T,KAAK,gDACG,UAAvClN,iBAAiB1F,GAASiC,UAC5Bm5B,GAAUrV,oBAAoB/lB,GAASqwB,MAE3C,IAEF/I,GAAqB8T,IAMrBxe,GAAmBwe,IAUnB,MACME,GAAmB,CAEvB,IAAK,CAAC,QAAS,MAAO,KAAM,OAAQ,OAHP,kBAI7BhqB,EAAG,CAAC,SAAU,OAAQ,QAAS,OAC/BiqB,KAAM,GACNhqB,EAAG,GACHiqB,GAAI,GACJC,IAAK,GACLC,KAAM,GACNC,GAAI,GACJC,IAAK,GACLC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJC,GAAI,GACJxqB,EAAG,GACH0b,IAAK,CAAC,MAAO,SAAU,MAAO,QAAS,QAAS,UAChD+O,GAAI,GACJC,GAAI,GACJC,EAAG,GACHC,IAAK,GACLC,EAAG,GACHC,MAAO,GACPC,KAAM,GACNC,IAAK,GACLC,IAAK,GACLC,OAAQ,GACRC,EAAG,GACHC,GAAI,IAIAC,GAAgB,IAAIpmB,IAAI,CAAC,aAAc,OAAQ,OAAQ,WAAY,WAAY,SAAU,MAAO,eAShGqmB,GAAmB,0DACnBC,GAAmB,CAAC76B,EAAW86B,KACnC,MAAMC,EAAgB/6B,EAAUvC,SAASC,cACzC,OAAIo9B,EAAqBzb,SAAS0b,IAC5BJ,GAAc/lB,IAAImmB,IACbhc,QAAQ6b,GAAiBt5B,KAAKtB,EAAUg7B,YAM5CF,EAAqB12B,QAAO62B,GAAkBA,aAA0BzY,SAAQ9R,MAAKwqB,GAASA,EAAM55B,KAAKy5B,IAAe,EA0C3HI,GAAY,CAChBC,UAAWtC,GACXuC,QAAS,CAAC,EAEVC,WAAY,GACZxwB,MAAM,EACNywB,UAAU,EACVC,WAAY,KACZC,SAAU,eAENC,GAAgB,CACpBN,UAAW,SACXC,QAAS,SACTC,WAAY,oBACZxwB,KAAM,UACNywB,SAAU,UACVC,WAAY,kBACZC,SAAU,UAENE,GAAqB,CACzBC,MAAO,iCACP5jB,SAAU,oBAOZ,MAAM6jB,WAAwBna,GAC5B,WAAAU,CAAYL,GACVa,QACA3E,KAAK6E,QAAU7E,KAAK6D,WAAWC,EACjC,CAGA,kBAAWJ,GACT,OAAOwZ,EACT,CACA,sBAAWvZ,GACT,OAAO8Z,EACT,CACA,eAAWlhB,GACT,MA3CW,iBA4Cb,CAGA,UAAAshB,GACE,OAAO7gC,OAAOmiB,OAAOa,KAAK6E,QAAQuY,SAASt6B,KAAIghB,GAAU9D,KAAK8d,yBAAyBha,KAAS3d,OAAO2a,QACzG,CACA,UAAAid,GACE,OAAO/d,KAAK6d,aAAantB,OAAS,CACpC,CACA,aAAAstB,CAAcZ,GAMZ,OALApd,KAAKie,cAAcb,GACnBpd,KAAK6E,QAAQuY,QAAU,IAClBpd,KAAK6E,QAAQuY,WACbA,GAEEpd,IACT,CACA,MAAAke,GACE,MAAMC,EAAkB94B,SAASwvB,cAAc,OAC/CsJ,EAAgBC,UAAYpe,KAAKqe,eAAere,KAAK6E,QAAQ2Y,UAC7D,IAAK,MAAOzjB,EAAUukB,KAASthC,OAAOmkB,QAAQnB,KAAK6E,QAAQuY,SACzDpd,KAAKue,YAAYJ,EAAiBG,EAAMvkB,GAE1C,MAAMyjB,EAAWW,EAAgBpY,SAAS,GACpCsX,EAAard,KAAK8d,yBAAyB9d,KAAK6E,QAAQwY,YAI9D,OAHIA,GACFG,EAASniB,UAAU5E,OAAO4mB,EAAWn7B,MAAM,MAEtCs7B,CACT,CAGA,gBAAAvZ,CAAiBH,GACfa,MAAMV,iBAAiBH,GACvB9D,KAAKie,cAAcna,EAAOsZ,QAC5B,CACA,aAAAa,CAAcO,GACZ,IAAK,MAAOzkB,EAAUqjB,KAAYpgC,OAAOmkB,QAAQqd,GAC/C7Z,MAAMV,iBAAiB,CACrBlK,WACA4jB,MAAOP,GACNM,GAEP,CACA,WAAAa,CAAYf,EAAUJ,EAASrjB,GAC7B,MAAM0kB,EAAkB5Y,GAAeC,QAAQ/L,EAAUyjB,GACpDiB,KAGLrB,EAAUpd,KAAK8d,yBAAyBV,IAKpC,GAAUA,GACZpd,KAAK0e,sBAAsBhkB,GAAW0iB,GAAUqB,GAG9Cze,KAAK6E,QAAQhY,KACf4xB,EAAgBL,UAAYpe,KAAKqe,eAAejB,GAGlDqB,EAAgBE,YAAcvB,EAX5BqB,EAAgB9kB,SAYpB,CACA,cAAA0kB,CAAeG,GACb,OAAOxe,KAAK6E,QAAQyY,SApJxB,SAAsBsB,EAAYzB,EAAW0B,GAC3C,IAAKD,EAAWluB,OACd,OAAOkuB,EAET,GAAIC,GAAgD,mBAArBA,EAC7B,OAAOA,EAAiBD,GAE1B,MACME,GADY,IAAIl/B,OAAOm/B,WACKC,gBAAgBJ,EAAY,aACxD/9B,EAAW,GAAGlC,UAAUmgC,EAAgB5yB,KAAKkU,iBAAiB,MACpE,IAAK,MAAM7gB,KAAWsB,EAAU,CAC9B,MAAMo+B,EAAc1/B,EAAQC,SAASC,cACrC,IAAKzC,OAAO4D,KAAKu8B,GAAW/b,SAAS6d,GAAc,CACjD1/B,EAAQoa,SACR,QACF,CACA,MAAMulB,EAAgB,GAAGvgC,UAAUY,EAAQ0B,YACrCk+B,EAAoB,GAAGxgC,OAAOw+B,EAAU,MAAQ,GAAIA,EAAU8B,IAAgB,IACpF,IAAK,MAAMl9B,KAAam9B,EACjBtC,GAAiB76B,EAAWo9B,IAC/B5/B,EAAQ4B,gBAAgBY,EAAUvC,SAGxC,CACA,OAAOs/B,EAAgB5yB,KAAKkyB,SAC9B,CA2HmCgB,CAAaZ,EAAKxe,KAAK6E,QAAQsY,UAAWnd,KAAK6E,QAAQ0Y,YAAciB,CACtG,CACA,wBAAAV,CAAyBU,GACvB,OAAO3hB,GAAQ2hB,EAAK,CAACxe,MACvB,CACA,qBAAA0e,CAAsBn/B,EAASk/B,GAC7B,GAAIze,KAAK6E,QAAQhY,KAGf,OAFA4xB,EAAgBL,UAAY,QAC5BK,EAAgB3J,OAAOv1B,GAGzBk/B,EAAgBE,YAAcp/B,EAAQo/B,WACxC,EAeF,MACMU,GAAwB,IAAI/oB,IAAI,CAAC,WAAY,YAAa,eAC1DgpB,GAAoB,OAEpBC,GAAoB,OACpBC,GAAyB,iBACzBC,GAAiB,SACjBC,GAAmB,gBACnBC,GAAgB,QAChBC,GAAgB,QAahBC,GAAgB,CACpBC,KAAM,OACNC,IAAK,MACLC,MAAO/jB,KAAU,OAAS,QAC1BgkB,OAAQ,SACRC,KAAMjkB,KAAU,QAAU,QAEtBkkB,GAAY,CAChBhD,UAAWtC,GACXuF,WAAW,EACXnyB,SAAU,kBACVoyB,WAAW,EACXC,YAAa,GACbC,MAAO,EACPvwB,mBAAoB,CAAC,MAAO,QAAS,SAAU,QAC/CnD,MAAM,EACN7E,OAAQ,CAAC,EAAG,GACZtJ,UAAW,MACXszB,aAAc,KACdsL,UAAU,EACVC,WAAY,KACZxjB,UAAU,EACVyjB,SAAU,+GACVgD,MAAO,GACP5e,QAAS,eAEL6e,GAAgB,CACpBtD,UAAW,SACXiD,UAAW,UACXnyB,SAAU,mBACVoyB,UAAW,2BACXC,YAAa,oBACbC,MAAO,kBACPvwB,mBAAoB,QACpBnD,KAAM,UACN7E,OAAQ,0BACRtJ,UAAW,oBACXszB,aAAc,yBACdsL,SAAU,UACVC,WAAY,kBACZxjB,SAAU,mBACVyjB,SAAU,SACVgD,MAAO,4BACP5e,QAAS,UAOX,MAAM8e,WAAgBhc,GACpB,WAAAP,CAAY5kB,EAASukB,GACnB,QAAsB,IAAX,EACT,MAAM,IAAIU,UAAU,+DAEtBG,MAAMplB,EAASukB,GAGf9D,KAAK2gB,YAAa,EAClB3gB,KAAK4gB,SAAW,EAChB5gB,KAAK6gB,WAAa,KAClB7gB,KAAK8gB,eAAiB,CAAC,EACvB9gB,KAAKmS,QAAU,KACfnS,KAAK+gB,iBAAmB,KACxB/gB,KAAKghB,YAAc,KAGnBhhB,KAAKihB,IAAM,KACXjhB,KAAKkhB,gBACAlhB,KAAK6E,QAAQ9K,UAChBiG,KAAKmhB,WAET,CAGA,kBAAWzd,GACT,OAAOyc,EACT,CACA,sBAAWxc,GACT,OAAO8c,EACT,CACA,eAAWlkB,GACT,MAxGW,SAyGb,CAGA,MAAA6kB,GACEphB,KAAK2gB,YAAa,CACpB,CACA,OAAAU,GACErhB,KAAK2gB,YAAa,CACpB,CACA,aAAAW,GACEthB,KAAK2gB,YAAc3gB,KAAK2gB,UAC1B,CACA,MAAAhZ,GACO3H,KAAK2gB,aAGV3gB,KAAK8gB,eAAeS,OAASvhB,KAAK8gB,eAAeS,MAC7CvhB,KAAK2P,WACP3P,KAAKwhB,SAGPxhB,KAAKyhB,SACP,CACA,OAAA1c,GACEmI,aAAalN,KAAK4gB,UAClBrgB,GAAaC,IAAIR,KAAK4E,SAAS5J,QAAQykB,IAAiBC,GAAkB1f,KAAK0hB,mBAC3E1hB,KAAK4E,SAASpJ,aAAa,2BAC7BwE,KAAK4E,SAASxjB,aAAa,QAAS4e,KAAK4E,SAASpJ,aAAa,2BAEjEwE,KAAK2hB,iBACLhd,MAAMI,SACR,CACA,IAAA8K,GACE,GAAoC,SAAhC7P,KAAK4E,SAAS7jB,MAAMgxB,QACtB,MAAM,IAAInO,MAAM,uCAElB,IAAM5D,KAAK4hB,mBAAoB5hB,KAAK2gB,WAClC,OAEF,MAAMnH,EAAYjZ,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAlItD,SAoIXqc,GADapmB,GAAeuE,KAAK4E,WACL5E,KAAK4E,SAAS9kB,cAAcwF,iBAAiBd,SAASwb,KAAK4E,UAC7F,GAAI4U,EAAUxX,mBAAqB6f,EACjC,OAIF7hB,KAAK2hB,iBACL,MAAMV,EAAMjhB,KAAK8hB,iBACjB9hB,KAAK4E,SAASxjB,aAAa,mBAAoB6/B,EAAIzlB,aAAa,OAChE,MAAM,UACJ6kB,GACErgB,KAAK6E,QAYT,GAXK7E,KAAK4E,SAAS9kB,cAAcwF,gBAAgBd,SAASwb,KAAKihB,OAC7DZ,EAAUvL,OAAOmM,GACjB1gB,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAhJpC,cAkJnBxF,KAAKmS,QAAUnS,KAAKwS,cAAcyO,GAClCA,EAAI5lB,UAAU5E,IAAI8oB,IAMd,iBAAkBl6B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAac,GAAG9hB,EAAS,YAAaqc,IAU1CoE,KAAKmF,gBAPY,KACf5E,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAhKrC,WAiKQ,IAApBxF,KAAK6gB,YACP7gB,KAAKwhB,SAEPxhB,KAAK6gB,YAAa,CAAK,GAEK7gB,KAAKihB,IAAKjhB,KAAKgO,cAC/C,CACA,IAAA4B,GACE,GAAK5P,KAAK2P,aAGQpP,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UA/KtD,SAgLHxD,iBAAd,CAQA,GALYhC,KAAK8hB,iBACbzmB,UAAU1B,OAAO4lB,IAIjB,iBAAkBl6B,SAASC,gBAC7B,IAAK,MAAM/F,IAAW,GAAGZ,UAAU0G,SAAS6G,KAAK6Z,UAC/CxF,GAAaC,IAAIjhB,EAAS,YAAaqc,IAG3CoE,KAAK8gB,eAA4B,OAAI,EACrC9gB,KAAK8gB,eAAelB,KAAiB,EACrC5f,KAAK8gB,eAAenB,KAAiB,EACrC3f,KAAK6gB,WAAa,KAYlB7gB,KAAKmF,gBAVY,KACXnF,KAAK+hB,yBAGJ/hB,KAAK6gB,YACR7gB,KAAK2hB,iBAEP3hB,KAAK4E,SAASzjB,gBAAgB,oBAC9Bof,GAAaqB,QAAQ5B,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAzMpC,WAyM8D,GAEnDxF,KAAKihB,IAAKjhB,KAAKgO,cA1B7C,CA2BF,CACA,MAAAjjB,GACMiV,KAAKmS,SACPnS,KAAKmS,QAAQpnB,QAEjB,CAGA,cAAA62B,GACE,OAAO9gB,QAAQd,KAAKgiB,YACtB,CACA,cAAAF,GAIE,OAHK9hB,KAAKihB,MACRjhB,KAAKihB,IAAMjhB,KAAKiiB,kBAAkBjiB,KAAKghB,aAAehhB,KAAKkiB,2BAEtDliB,KAAKihB,GACd,CACA,iBAAAgB,CAAkB7E,GAChB,MAAM6D,EAAMjhB,KAAKmiB,oBAAoB/E,GAASc,SAG9C,IAAK+C,EACH,OAAO,KAETA,EAAI5lB,UAAU1B,OAAO2lB,GAAmBC,IAExC0B,EAAI5lB,UAAU5E,IAAI,MAAMuJ,KAAKmE,YAAY5H,aACzC,MAAM6lB,EAvuGKC,KACb,GACEA,GAAUlgC,KAAKmgC,MA/BH,IA+BSngC,KAAKogC,gBACnBl9B,SAASm9B,eAAeH,IACjC,OAAOA,CAAM,EAmuGGI,CAAOziB,KAAKmE,YAAY5H,MAAM1c,WAK5C,OAJAohC,EAAI7/B,aAAa,KAAMghC,GACnBpiB,KAAKgO,eACPiT,EAAI5lB,UAAU5E,IAAI6oB,IAEb2B,CACT,CACA,UAAAyB,CAAWtF,GACTpd,KAAKghB,YAAc5D,EACfpd,KAAK2P,aACP3P,KAAK2hB,iBACL3hB,KAAK6P,OAET,CACA,mBAAAsS,CAAoB/E,GAYlB,OAXIpd,KAAK+gB,iBACP/gB,KAAK+gB,iBAAiB/C,cAAcZ,GAEpCpd,KAAK+gB,iBAAmB,IAAInD,GAAgB,IACvC5d,KAAK6E,QAGRuY,UACAC,WAAYrd,KAAK8d,yBAAyB9d,KAAK6E,QAAQyb,eAGpDtgB,KAAK+gB,gBACd,CACA,sBAAAmB,GACE,MAAO,CACL,CAAC1C,IAAyBxf,KAAKgiB,YAEnC,CACA,SAAAA,GACE,OAAOhiB,KAAK8d,yBAAyB9d,KAAK6E,QAAQ2b,QAAUxgB,KAAK4E,SAASpJ,aAAa,yBACzF,CAGA,4BAAAmnB,CAA6BvjB,GAC3B,OAAOY,KAAKmE,YAAYmB,oBAAoBlG,EAAMW,eAAgBC,KAAK4iB,qBACzE,CACA,WAAA5U,GACE,OAAOhO,KAAK6E,QAAQub,WAAapgB,KAAKihB,KAAOjhB,KAAKihB,IAAI5lB,UAAU7W,SAAS86B,GAC3E,CACA,QAAA3P,GACE,OAAO3P,KAAKihB,KAAOjhB,KAAKihB,IAAI5lB,UAAU7W,SAAS+6B,GACjD,CACA,aAAA/M,CAAcyO,GACZ,MAAMviC,EAAYme,GAAQmD,KAAK6E,QAAQnmB,UAAW,CAACshB,KAAMihB,EAAKjhB,KAAK4E,WAC7Die,EAAahD,GAAcnhC,EAAU+lB,eAC3C,OAAO,GAAoBzE,KAAK4E,SAAUqc,EAAKjhB,KAAK4S,iBAAiBiQ,GACvE,CACA,UAAA7P,GACE,MAAM,OACJhrB,GACEgY,KAAK6E,QACT,MAAsB,iBAAX7c,EACFA,EAAO9F,MAAM,KAAKY,KAAInF,GAAS4f,OAAOgQ,SAAS5vB,EAAO,MAEzC,mBAAXqK,EACFirB,GAAcjrB,EAAOirB,EAAYjT,KAAK4E,UAExC5c,CACT,CACA,wBAAA81B,CAAyBU,GACvB,OAAO3hB,GAAQ2hB,EAAK,CAACxe,KAAK4E,UAC5B,CACA,gBAAAgO,CAAiBiQ,GACf,MAAM3P,EAAwB,CAC5Bx0B,UAAWmkC,EACXzsB,UAAW,CAAC,CACV9V,KAAM,OACNmB,QAAS,CACPuO,mBAAoBgQ,KAAK6E,QAAQ7U,qBAElC,CACD1P,KAAM,SACNmB,QAAS,CACPuG,OAAQgY,KAAKgT,eAEd,CACD1yB,KAAM,kBACNmB,QAAS,CACPwM,SAAU+R,KAAK6E,QAAQ5W,WAExB,CACD3N,KAAM,QACNmB,QAAS,CACPlC,QAAS,IAAIygB,KAAKmE,YAAY5H,eAE/B,CACDjc,KAAM,kBACNC,SAAS,EACTC,MAAO,aACPC,GAAI4J,IAGF2V,KAAK8hB,iBAAiB1gC,aAAa,wBAAyBiJ,EAAK1J,MAAMjC,UAAU,KAIvF,MAAO,IACFw0B,KACArW,GAAQmD,KAAK6E,QAAQmN,aAAc,CAACkB,IAE3C,CACA,aAAAgO,GACE,MAAM4B,EAAW9iB,KAAK6E,QAAQjD,QAAQ1f,MAAM,KAC5C,IAAK,MAAM0f,KAAWkhB,EACpB,GAAgB,UAAZlhB,EACFrB,GAAac,GAAGrB,KAAK4E,SAAU5E,KAAKmE,YAAYqB,UAjVlC,SAiV4DxF,KAAK6E,QAAQ9K,UAAUqF,IAC/EY,KAAK2iB,6BAA6BvjB,GAC1CuI,QAAQ,SAEb,GA3VU,WA2VN/F,EAA4B,CACrC,MAAMmhB,EAAUnhB,IAAY+d,GAAgB3f,KAAKmE,YAAYqB,UAnV5C,cAmV0ExF,KAAKmE,YAAYqB,UArV5F,WAsVVwd,EAAWphB,IAAY+d,GAAgB3f,KAAKmE,YAAYqB,UAnV7C,cAmV2ExF,KAAKmE,YAAYqB,UArV5F,YAsVjBjF,GAAac,GAAGrB,KAAK4E,SAAUme,EAAS/iB,KAAK6E,QAAQ9K,UAAUqF,IAC7D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAClDkU,EAAQwN,eAA8B,YAAf1hB,EAAMqB,KAAqBmf,GAAgBD,KAAiB,EACnFrM,EAAQmO,QAAQ,IAElBlhB,GAAac,GAAGrB,KAAK4E,SAAUoe,EAAUhjB,KAAK6E,QAAQ9K,UAAUqF,IAC9D,MAAMkU,EAAUtT,KAAK2iB,6BAA6BvjB,GAClDkU,EAAQwN,eAA8B,aAAf1hB,EAAMqB,KAAsBmf,GAAgBD,IAAiBrM,EAAQ1O,SAASpgB,SAAS4a,EAAMU,eACpHwT,EAAQkO,QAAQ,GAEpB,CAEFxhB,KAAK0hB,kBAAoB,KACnB1hB,KAAK4E,UACP5E,KAAK4P,MACP,EAEFrP,GAAac,GAAGrB,KAAK4E,SAAS5J,QAAQykB,IAAiBC,GAAkB1f,KAAK0hB,kBAChF,CACA,SAAAP,GACE,MAAMX,EAAQxgB,KAAK4E,SAASpJ,aAAa,SACpCglB,IAGAxgB,KAAK4E,SAASpJ,aAAa,eAAkBwE,KAAK4E,SAAS+Z,YAAYhZ,QAC1E3F,KAAK4E,SAASxjB,aAAa,aAAco/B,GAE3CxgB,KAAK4E,SAASxjB,aAAa,yBAA0Bo/B,GACrDxgB,KAAK4E,SAASzjB,gBAAgB,SAChC,CACA,MAAAsgC,GACMzhB,KAAK2P,YAAc3P,KAAK6gB,WAC1B7gB,KAAK6gB,YAAa,GAGpB7gB,KAAK6gB,YAAa,EAClB7gB,KAAKijB,aAAY,KACXjjB,KAAK6gB,YACP7gB,KAAK6P,MACP,GACC7P,KAAK6E,QAAQ0b,MAAM1Q,MACxB,CACA,MAAA2R,GACMxhB,KAAK+hB,yBAGT/hB,KAAK6gB,YAAa,EAClB7gB,KAAKijB,aAAY,KACVjjB,KAAK6gB,YACR7gB,KAAK4P,MACP,GACC5P,KAAK6E,QAAQ0b,MAAM3Q,MACxB,CACA,WAAAqT,CAAYrlB,EAASslB,GACnBhW,aAAalN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW/iB,WAAWD,EAASslB,EACtC,CACA,oBAAAnB,GACE,OAAO/kC,OAAOmiB,OAAOa,KAAK8gB,gBAAgB1f,UAAS,EACrD,CACA,UAAAyC,CAAWC,GACT,MAAMqf,EAAiBngB,GAAYG,kBAAkBnD,KAAK4E,UAC1D,IAAK,MAAMwe,KAAiBpmC,OAAO4D,KAAKuiC,GAClC9D,GAAsB1oB,IAAIysB,WACrBD,EAAeC,GAU1B,OAPAtf,EAAS,IACJqf,KACmB,iBAAXrf,GAAuBA,EAASA,EAAS,CAAC,GAEvDA,EAAS9D,KAAK+D,gBAAgBD,GAC9BA,EAAS9D,KAAKgE,kBAAkBF,GAChC9D,KAAKiE,iBAAiBH,GACfA,CACT,CACA,iBAAAE,CAAkBF,GAchB,OAbAA,EAAOuc,WAAiC,IAArBvc,EAAOuc,UAAsBh7B,SAAS6G,KAAOwO,GAAWoJ,EAAOuc,WACtD,iBAAjBvc,EAAOyc,QAChBzc,EAAOyc,MAAQ,CACb1Q,KAAM/L,EAAOyc,MACb3Q,KAAM9L,EAAOyc,QAGW,iBAAjBzc,EAAO0c,QAChB1c,EAAO0c,MAAQ1c,EAAO0c,MAAM3gC,YAEA,iBAAnBikB,EAAOsZ,UAChBtZ,EAAOsZ,QAAUtZ,EAAOsZ,QAAQv9B,YAE3BikB,CACT,CACA,kBAAA8e,GACE,MAAM9e,EAAS,CAAC,EAChB,IAAK,MAAOhnB,EAAKa,KAAUX,OAAOmkB,QAAQnB,KAAK6E,SACzC7E,KAAKmE,YAAYT,QAAQ5mB,KAASa,IACpCmmB,EAAOhnB,GAAOa,GASlB,OANAmmB,EAAO/J,UAAW,EAClB+J,EAAOlC,QAAU,SAKVkC,CACT,CACA,cAAA6d,GACM3hB,KAAKmS,UACPnS,KAAKmS,QAAQnZ,UACbgH,KAAKmS,QAAU,MAEbnS,KAAKihB,MACPjhB,KAAKihB,IAAItnB,SACTqG,KAAKihB,IAAM,KAEf,CAGA,sBAAOxkB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOq2B,GAAQpb,oBAAoBtF,KAAM8D,GAC/C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOF3H,GAAmBukB,IAcnB,MACM2C,GAAiB,kBACjBC,GAAmB,gBACnBC,GAAY,IACb7C,GAAQhd,QACX0Z,QAAS,GACTp1B,OAAQ,CAAC,EAAG,GACZtJ,UAAW,QACX8+B,SAAU,8IACV5b,QAAS,SAEL4hB,GAAgB,IACjB9C,GAAQ/c,YACXyZ,QAAS,kCAOX,MAAMqG,WAAgB/C,GAEpB,kBAAWhd,GACT,OAAO6f,EACT,CACA,sBAAW5f,GACT,OAAO6f,EACT,CACA,eAAWjnB,GACT,MA7BW,SA8Bb,CAGA,cAAAqlB,GACE,OAAO5hB,KAAKgiB,aAAehiB,KAAK0jB,aAClC,CAGA,sBAAAxB,GACE,MAAO,CACL,CAACmB,IAAiBrjB,KAAKgiB,YACvB,CAACsB,IAAmBtjB,KAAK0jB,cAE7B,CACA,WAAAA,GACE,OAAO1jB,KAAK8d,yBAAyB9d,KAAK6E,QAAQuY,QACpD,CAGA,sBAAO3gB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOo5B,GAAQne,oBAAoBtF,KAAM8D,GAC/C,GAAsB,iBAAXA,EAAX,CAGA,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOF3H,GAAmBsnB,IAcnB,MAEME,GAAc,gBAEdC,GAAiB,WAAWD,KAC5BE,GAAc,QAAQF,KACtBG,GAAwB,OAAOH,cAE/BI,GAAsB,SAEtBC,GAAwB,SAExBC,GAAqB,YAGrBC,GAAsB,GAAGD,mBAA+CA,uBAGxEE,GAAY,CAChBn8B,OAAQ,KAERo8B,WAAY,eACZC,cAAc,EACd93B,OAAQ,KACR+3B,UAAW,CAAC,GAAK,GAAK,IAElBC,GAAgB,CACpBv8B,OAAQ,gBAERo8B,WAAY,SACZC,aAAc,UACd93B,OAAQ,UACR+3B,UAAW,SAOb,MAAME,WAAkB9f,GACtB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GAGf9D,KAAKykB,aAAe,IAAIvzB,IACxB8O,KAAK0kB,oBAAsB,IAAIxzB,IAC/B8O,KAAK2kB,aAA6D,YAA9C1/B,iBAAiB+a,KAAK4E,UAAU5Y,UAA0B,KAAOgU,KAAK4E,SAC1F5E,KAAK4kB,cAAgB,KACrB5kB,KAAK6kB,UAAY,KACjB7kB,KAAK8kB,oBAAsB,CACzBC,gBAAiB,EACjBC,gBAAiB,GAEnBhlB,KAAKilB,SACP,CAGA,kBAAWvhB,GACT,OAAOygB,EACT,CACA,sBAAWxgB,GACT,OAAO4gB,EACT,CACA,eAAWhoB,GACT,MAhEW,WAiEb,CAGA,OAAA0oB,GACEjlB,KAAKklB,mCACLllB,KAAKmlB,2BACDnlB,KAAK6kB,UACP7kB,KAAK6kB,UAAUO,aAEfplB,KAAK6kB,UAAY7kB,KAAKqlB,kBAExB,IAAK,MAAMC,KAAWtlB,KAAK0kB,oBAAoBvlB,SAC7Ca,KAAK6kB,UAAUU,QAAQD,EAE3B,CACA,OAAAvgB,GACE/E,KAAK6kB,UAAUO,aACfzgB,MAAMI,SACR,CAGA,iBAAAf,CAAkBF,GAShB,OAPAA,EAAOvX,OAASmO,GAAWoJ,EAAOvX,SAAWlH,SAAS6G,KAGtD4X,EAAOsgB,WAAatgB,EAAO9b,OAAS,GAAG8b,EAAO9b,oBAAsB8b,EAAOsgB,WAC3C,iBAArBtgB,EAAOwgB,YAChBxgB,EAAOwgB,UAAYxgB,EAAOwgB,UAAUpiC,MAAM,KAAKY,KAAInF,GAAS4f,OAAOC,WAAW7f,MAEzEmmB,CACT,CACA,wBAAAqhB,GACOnlB,KAAK6E,QAAQwf,eAKlB9jB,GAAaC,IAAIR,KAAK6E,QAAQtY,OAAQs3B,IACtCtjB,GAAac,GAAGrB,KAAK6E,QAAQtY,OAAQs3B,GAAaG,IAAuB5kB,IACvE,MAAMomB,EAAoBxlB,KAAK0kB,oBAAoBvnC,IAAIiiB,EAAM7S,OAAOtB,MACpE,GAAIu6B,EAAmB,CACrBpmB,EAAMkD,iBACN,MAAM3G,EAAOqE,KAAK2kB,cAAgB/kC,OAC5BmE,EAASyhC,EAAkBnhC,UAAY2b,KAAK4E,SAASvgB,UAC3D,GAAIsX,EAAK8pB,SAKP,YAJA9pB,EAAK8pB,SAAS,CACZ9jC,IAAKoC,EACL2hC,SAAU,WAMd/pB,EAAKlQ,UAAY1H,CACnB,KAEJ,CACA,eAAAshC,GACE,MAAM5jC,EAAU,CACdka,KAAMqE,KAAK2kB,aACXL,UAAWtkB,KAAK6E,QAAQyf,UACxBF,WAAYpkB,KAAK6E,QAAQuf,YAE3B,OAAO,IAAIuB,sBAAqBxkB,GAAWnB,KAAK4lB,kBAAkBzkB,IAAU1f,EAC9E,CAGA,iBAAAmkC,CAAkBzkB,GAChB,MAAM0kB,EAAgBlI,GAAS3d,KAAKykB,aAAatnC,IAAI,IAAIwgC,EAAMpxB,OAAO4N,MAChEub,EAAWiI,IACf3d,KAAK8kB,oBAAoBC,gBAAkBpH,EAAMpxB,OAAOlI,UACxD2b,KAAK8lB,SAASD,EAAclI,GAAO,EAE/BqH,GAAmBhlB,KAAK2kB,cAAgBt/B,SAASC,iBAAiBmG,UAClEs6B,EAAkBf,GAAmBhlB,KAAK8kB,oBAAoBE,gBACpEhlB,KAAK8kB,oBAAoBE,gBAAkBA,EAC3C,IAAK,MAAMrH,KAASxc,EAAS,CAC3B,IAAKwc,EAAMqI,eAAgB,CACzBhmB,KAAK4kB,cAAgB,KACrB5kB,KAAKimB,kBAAkBJ,EAAclI,IACrC,QACF,CACA,MAAMuI,EAA2BvI,EAAMpxB,OAAOlI,WAAa2b,KAAK8kB,oBAAoBC,gBAEpF,GAAIgB,GAAmBG,GAGrB,GAFAxQ,EAASiI,IAEJqH,EACH,YAMCe,GAAoBG,GACvBxQ,EAASiI,EAEb,CACF,CACA,gCAAAuH,GACEllB,KAAKykB,aAAe,IAAIvzB,IACxB8O,KAAK0kB,oBAAsB,IAAIxzB,IAC/B,MAAMi1B,EAActgB,GAAe1T,KAAK6xB,GAAuBhkB,KAAK6E,QAAQtY,QAC5E,IAAK,MAAM65B,KAAUD,EAAa,CAEhC,IAAKC,EAAOn7B,MAAQiQ,GAAWkrB,GAC7B,SAEF,MAAMZ,EAAoB3f,GAAeC,QAAQugB,UAAUD,EAAOn7B,MAAO+U,KAAK4E,UAG1EjK,GAAU6qB,KACZxlB,KAAKykB,aAAa1yB,IAAIs0B,UAAUD,EAAOn7B,MAAOm7B,GAC9CpmB,KAAK0kB,oBAAoB3yB,IAAIq0B,EAAOn7B,KAAMu6B,GAE9C,CACF,CACA,QAAAM,CAASv5B,GACHyT,KAAK4kB,gBAAkBr4B,IAG3ByT,KAAKimB,kBAAkBjmB,KAAK6E,QAAQtY,QACpCyT,KAAK4kB,cAAgBr4B,EACrBA,EAAO8O,UAAU5E,IAAIstB,IACrB/jB,KAAKsmB,iBAAiB/5B,GACtBgU,GAAaqB,QAAQ5B,KAAK4E,SAAUgf,GAAgB,CAClD9jB,cAAevT,IAEnB,CACA,gBAAA+5B,CAAiB/5B,GAEf,GAAIA,EAAO8O,UAAU7W,SA9LQ,iBA+L3BqhB,GAAeC,QArLc,mBAqLsBvZ,EAAOyO,QAtLtC,cAsLkEK,UAAU5E,IAAIstB,SAGtG,IAAK,MAAMwC,KAAa1gB,GAAeI,QAAQ1Z,EA9LnB,qBAiM1B,IAAK,MAAMxJ,KAAQ8iB,GAAeM,KAAKogB,EAAWrC,IAChDnhC,EAAKsY,UAAU5E,IAAIstB,GAGzB,CACA,iBAAAkC,CAAkBxhC,GAChBA,EAAO4W,UAAU1B,OAAOoqB,IACxB,MAAMyC,EAAc3gB,GAAe1T,KAAK,GAAG6xB,MAAyBD,KAAuBt/B,GAC3F,IAAK,MAAM9E,KAAQ6mC,EACjB7mC,EAAK0b,UAAU1B,OAAOoqB,GAE1B,CAGA,sBAAOtnB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAOm6B,GAAUlf,oBAAoBtF,KAAM8D,GACjD,GAAsB,iBAAXA,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOFvD,GAAac,GAAGzhB,OAAQkkC,IAAuB,KAC7C,IAAK,MAAM2C,KAAO5gB,GAAe1T,KApOT,0BAqOtBqyB,GAAUlf,oBAAoBmhB,EAChC,IAOFtqB,GAAmBqoB,IAcnB,MAEMkC,GAAc,UACdC,GAAe,OAAOD,KACtBE,GAAiB,SAASF,KAC1BG,GAAe,OAAOH,KACtBI,GAAgB,QAAQJ,KACxBK,GAAuB,QAAQL,KAC/BM,GAAgB,UAAUN,KAC1BO,GAAsB,OAAOP,KAC7BQ,GAAiB,YACjBC,GAAkB,aAClBC,GAAe,UACfC,GAAiB,YACjBC,GAAW,OACXC,GAAU,MACVC,GAAoB,SACpBC,GAAoB,OACpBC,GAAoB,OAEpBC,GAA2B,mBAE3BC,GAA+B,QAAQD,MAIvCE,GAAuB,2EACvBC,GAAsB,YAFOF,uBAAiDA,mBAA6CA,OAE/EC,KAC5CE,GAA8B,IAAIP,8BAA6CA,+BAA8CA,4BAMnI,MAAMQ,WAAYtjB,GAChB,WAAAP,CAAY5kB,GACVolB,MAAMplB,GACNygB,KAAKoS,QAAUpS,KAAK4E,SAAS5J,QAdN,uCAelBgF,KAAKoS,UAOVpS,KAAKioB,sBAAsBjoB,KAAKoS,QAASpS,KAAKkoB,gBAC9C3nB,GAAac,GAAGrB,KAAK4E,SAAUoiB,IAAe5nB,GAASY,KAAK6M,SAASzN,KACvE,CAGA,eAAW7C,GACT,MAnDW,KAoDb,CAGA,IAAAsT,GAEE,MAAMsY,EAAYnoB,KAAK4E,SACvB,GAAI5E,KAAKooB,cAAcD,GACrB,OAIF,MAAME,EAASroB,KAAKsoB,iBACdC,EAAYF,EAAS9nB,GAAaqB,QAAQymB,EAAQ1B,GAAc,CACpE7mB,cAAeqoB,IACZ,KACa5nB,GAAaqB,QAAQumB,EAAWtB,GAAc,CAC9D/mB,cAAeuoB,IAEHrmB,kBAAoBumB,GAAaA,EAAUvmB,mBAGzDhC,KAAKwoB,YAAYH,EAAQF,GACzBnoB,KAAKyoB,UAAUN,EAAWE,GAC5B,CAGA,SAAAI,CAAUlpC,EAASmpC,GACZnpC,IAGLA,EAAQ8b,UAAU5E,IAAI+wB,IACtBxnB,KAAKyoB,UAAU5iB,GAAec,uBAAuBpnB,IAcrDygB,KAAKmF,gBAZY,KACsB,QAAjC5lB,EAAQic,aAAa,SAIzBjc,EAAQ4B,gBAAgB,YACxB5B,EAAQ6B,aAAa,iBAAiB,GACtC4e,KAAK2oB,gBAAgBppC,GAAS,GAC9BghB,GAAaqB,QAAQriB,EAASunC,GAAe,CAC3ChnB,cAAe4oB,KAPfnpC,EAAQ8b,UAAU5E,IAAIixB,GAQtB,GAE0BnoC,EAASA,EAAQ8b,UAAU7W,SAASijC,KACpE,CACA,WAAAe,CAAYjpC,EAASmpC,GACdnpC,IAGLA,EAAQ8b,UAAU1B,OAAO6tB,IACzBjoC,EAAQq7B,OACR5a,KAAKwoB,YAAY3iB,GAAec,uBAAuBpnB,IAcvDygB,KAAKmF,gBAZY,KACsB,QAAjC5lB,EAAQic,aAAa,SAIzBjc,EAAQ6B,aAAa,iBAAiB,GACtC7B,EAAQ6B,aAAa,WAAY,MACjC4e,KAAK2oB,gBAAgBppC,GAAS,GAC9BghB,GAAaqB,QAAQriB,EAASqnC,GAAgB,CAC5C9mB,cAAe4oB,KAPfnpC,EAAQ8b,UAAU1B,OAAO+tB,GAQzB,GAE0BnoC,EAASA,EAAQ8b,UAAU7W,SAASijC,KACpE,CACA,QAAA5a,CAASzN,GACP,IAAK,CAAC8nB,GAAgBC,GAAiBC,GAAcC,GAAgBC,GAAUC,IAASnmB,SAAShC,EAAMtiB,KACrG,OAEFsiB,EAAM0U,kBACN1U,EAAMkD,iBACN,MAAMyD,EAAW/F,KAAKkoB,eAAe/hC,QAAO5G,IAAY2b,GAAW3b,KACnE,IAAIqpC,EACJ,GAAI,CAACtB,GAAUC,IAASnmB,SAAShC,EAAMtiB,KACrC8rC,EAAoB7iB,EAAS3G,EAAMtiB,MAAQwqC,GAAW,EAAIvhB,EAASrV,OAAS,OACvE,CACL,MAAM8c,EAAS,CAAC2Z,GAAiBE,IAAgBjmB,SAAShC,EAAMtiB,KAChE8rC,EAAoB9qB,GAAqBiI,EAAU3G,EAAM7S,OAAQihB,GAAQ,EAC3E,CACIob,IACFA,EAAkBnW,MAAM,CACtBoW,eAAe,IAEjBb,GAAI1iB,oBAAoBsjB,GAAmB/Y,OAE/C,CACA,YAAAqY,GAEE,OAAOriB,GAAe1T,KAAK21B,GAAqB9nB,KAAKoS,QACvD,CACA,cAAAkW,GACE,OAAOtoB,KAAKkoB,eAAe/1B,MAAKzN,GAASsb,KAAKooB,cAAc1jC,MAAW,IACzE,CACA,qBAAAujC,CAAsBxjC,EAAQshB,GAC5B/F,KAAK8oB,yBAAyBrkC,EAAQ,OAAQ,WAC9C,IAAK,MAAMC,KAASqhB,EAClB/F,KAAK+oB,6BAA6BrkC,EAEtC,CACA,4BAAAqkC,CAA6BrkC,GAC3BA,EAAQsb,KAAKgpB,iBAAiBtkC,GAC9B,MAAMukC,EAAWjpB,KAAKooB,cAAc1jC,GAC9BwkC,EAAYlpB,KAAKmpB,iBAAiBzkC,GACxCA,EAAMtD,aAAa,gBAAiB6nC,GAChCC,IAAcxkC,GAChBsb,KAAK8oB,yBAAyBI,EAAW,OAAQ,gBAE9CD,GACHvkC,EAAMtD,aAAa,WAAY,MAEjC4e,KAAK8oB,yBAAyBpkC,EAAO,OAAQ,OAG7Csb,KAAKopB,mCAAmC1kC,EAC1C,CACA,kCAAA0kC,CAAmC1kC,GACjC,MAAM6H,EAASsZ,GAAec,uBAAuBjiB,GAChD6H,IAGLyT,KAAK8oB,yBAAyBv8B,EAAQ,OAAQ,YAC1C7H,EAAMyV,IACR6F,KAAK8oB,yBAAyBv8B,EAAQ,kBAAmB,GAAG7H,EAAMyV,MAEtE,CACA,eAAAwuB,CAAgBppC,EAAS8pC,GACvB,MAAMH,EAAYlpB,KAAKmpB,iBAAiB5pC,GACxC,IAAK2pC,EAAU7tB,UAAU7W,SApKN,YAqKjB,OAEF,MAAMmjB,EAAS,CAAC5N,EAAUoa,KACxB,MAAM50B,EAAUsmB,GAAeC,QAAQ/L,EAAUmvB,GAC7C3pC,GACFA,EAAQ8b,UAAUsM,OAAOwM,EAAWkV,EACtC,EAEF1hB,EAAOggB,GAA0BH,IACjC7f,EA5K2B,iBA4KI+f,IAC/BwB,EAAU9nC,aAAa,gBAAiBioC,EAC1C,CACA,wBAAAP,CAAyBvpC,EAASwC,EAAWpE,GACtC4B,EAAQgc,aAAaxZ,IACxBxC,EAAQ6B,aAAaW,EAAWpE,EAEpC,CACA,aAAAyqC,CAAc9Y,GACZ,OAAOA,EAAKjU,UAAU7W,SAASgjC,GACjC,CAGA,gBAAAwB,CAAiB1Z,GACf,OAAOA,EAAKtJ,QAAQ8hB,IAAuBxY,EAAOzJ,GAAeC,QAAQgiB,GAAqBxY,EAChG,CAGA,gBAAA6Z,CAAiB7Z,GACf,OAAOA,EAAKtU,QA5LO,gCA4LoBsU,CACzC,CAGA,sBAAO7S,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO29B,GAAI1iB,oBAAoBtF,MACrC,GAAsB,iBAAX8D,EAAX,CAGA,QAAqB/K,IAAjB1O,EAAKyZ,IAAyBA,EAAOrC,WAAW,MAAmB,gBAAXqC,EAC1D,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,IAJL,CAKF,GACF,EAOFvD,GAAac,GAAGhc,SAAU0hC,GAAsBc,IAAsB,SAAUzoB,GAC1E,CAAC,IAAK,QAAQgC,SAASpB,KAAKiH,UAC9B7H,EAAMkD,iBAEJpH,GAAW8E,OAGfgoB,GAAI1iB,oBAAoBtF,MAAM6P,MAChC,IAKAtP,GAAac,GAAGzhB,OAAQqnC,IAAqB,KAC3C,IAAK,MAAM1nC,KAAWsmB,GAAe1T,KAAK41B,IACxCC,GAAI1iB,oBAAoB/lB,EAC1B,IAMF4c,GAAmB6rB,IAcnB,MAEMhjB,GAAY,YACZskB,GAAkB,YAAYtkB,KAC9BukB,GAAiB,WAAWvkB,KAC5BwkB,GAAgB,UAAUxkB,KAC1BykB,GAAiB,WAAWzkB,KAC5B0kB,GAAa,OAAO1kB,KACpB2kB,GAAe,SAAS3kB,KACxB4kB,GAAa,OAAO5kB,KACpB6kB,GAAc,QAAQ7kB,KAEtB8kB,GAAkB,OAClBC,GAAkB,OAClBC,GAAqB,UACrBrmB,GAAc,CAClByc,UAAW,UACX6J,SAAU,UACV1J,MAAO,UAEH7c,GAAU,CACd0c,WAAW,EACX6J,UAAU,EACV1J,MAAO,KAOT,MAAM2J,WAAcxlB,GAClB,WAAAP,CAAY5kB,EAASukB,GACnBa,MAAMplB,EAASukB,GACf9D,KAAK4gB,SAAW,KAChB5gB,KAAKmqB,sBAAuB,EAC5BnqB,KAAKoqB,yBAA0B,EAC/BpqB,KAAKkhB,eACP,CAGA,kBAAWxd,GACT,OAAOA,EACT,CACA,sBAAWC,GACT,OAAOA,EACT,CACA,eAAWpH,GACT,MA/CS,OAgDX,CAGA,IAAAsT,GACoBtP,GAAaqB,QAAQ5B,KAAK4E,SAAUglB,IACxC5nB,mBAGdhC,KAAKqqB,gBACDrqB,KAAK6E,QAAQub,WACfpgB,KAAK4E,SAASvJ,UAAU5E,IA/CN,QAsDpBuJ,KAAK4E,SAASvJ,UAAU1B,OAAOmwB,IAC/BjuB,GAAOmE,KAAK4E,UACZ5E,KAAK4E,SAASvJ,UAAU5E,IAAIszB,GAAiBC,IAC7ChqB,KAAKmF,gBARY,KACfnF,KAAK4E,SAASvJ,UAAU1B,OAAOqwB,IAC/BzpB,GAAaqB,QAAQ5B,KAAK4E,SAAUilB,IACpC7pB,KAAKsqB,oBAAoB,GAKGtqB,KAAK4E,SAAU5E,KAAK6E,QAAQub,WAC5D,CACA,IAAAxQ,GACO5P,KAAKuqB,YAGQhqB,GAAaqB,QAAQ5B,KAAK4E,SAAU8kB,IACxC1nB,mBAQdhC,KAAK4E,SAASvJ,UAAU5E,IAAIuzB,IAC5BhqB,KAAKmF,gBANY,KACfnF,KAAK4E,SAASvJ,UAAU5E,IAAIqzB,IAC5B9pB,KAAK4E,SAASvJ,UAAU1B,OAAOqwB,GAAoBD,IACnDxpB,GAAaqB,QAAQ5B,KAAK4E,SAAU+kB,GAAa,GAGrB3pB,KAAK4E,SAAU5E,KAAK6E,QAAQub,YAC5D,CACA,OAAArb,GACE/E,KAAKqqB,gBACDrqB,KAAKuqB,WACPvqB,KAAK4E,SAASvJ,UAAU1B,OAAOowB,IAEjCplB,MAAMI,SACR,CACA,OAAAwlB,GACE,OAAOvqB,KAAK4E,SAASvJ,UAAU7W,SAASulC,GAC1C,CAIA,kBAAAO,GACOtqB,KAAK6E,QAAQolB,WAGdjqB,KAAKmqB,sBAAwBnqB,KAAKoqB,0BAGtCpqB,KAAK4gB,SAAW/iB,YAAW,KACzBmC,KAAK4P,MAAM,GACV5P,KAAK6E,QAAQ0b,QAClB,CACA,cAAAiK,CAAeprB,EAAOqrB,GACpB,OAAQrrB,EAAMqB,MACZ,IAAK,YACL,IAAK,WAEDT,KAAKmqB,qBAAuBM,EAC5B,MAEJ,IAAK,UACL,IAAK,WAEDzqB,KAAKoqB,wBAA0BK,EAIrC,GAAIA,EAEF,YADAzqB,KAAKqqB,gBAGP,MAAM5c,EAAcrO,EAAMU,cACtBE,KAAK4E,WAAa6I,GAAezN,KAAK4E,SAASpgB,SAASipB,IAG5DzN,KAAKsqB,oBACP,CACA,aAAApJ,GACE3gB,GAAac,GAAGrB,KAAK4E,SAAU0kB,IAAiBlqB,GAASY,KAAKwqB,eAAeprB,GAAO,KACpFmB,GAAac,GAAGrB,KAAK4E,SAAU2kB,IAAgBnqB,GAASY,KAAKwqB,eAAeprB,GAAO,KACnFmB,GAAac,GAAGrB,KAAK4E,SAAU4kB,IAAepqB,GAASY,KAAKwqB,eAAeprB,GAAO,KAClFmB,GAAac,GAAGrB,KAAK4E,SAAU6kB,IAAgBrqB,GAASY,KAAKwqB,eAAeprB,GAAO,IACrF,CACA,aAAAirB,GACEnd,aAAalN,KAAK4gB,UAClB5gB,KAAK4gB,SAAW,IAClB,CAGA,sBAAOnkB,CAAgBqH,GACrB,OAAO9D,KAAKwH,MAAK,WACf,MAAMnd,EAAO6/B,GAAM5kB,oBAAoBtF,KAAM8D,GAC7C,GAAsB,iBAAXA,EAAqB,CAC9B,QAA4B,IAAjBzZ,EAAKyZ,GACd,MAAM,IAAIU,UAAU,oBAAoBV,MAE1CzZ,EAAKyZ,GAAQ9D,KACf,CACF,GACF,ECr0IK,SAAS0qB,GAAcruB,GACD,WAAvBhX,SAASuX,WAAyBP,IACjChX,SAASyF,iBAAiB,mBAAoBuR,EACrD,CDy0IAwK,GAAqBqjB,IAMrB/tB,GAAmB+tB,IEpyInBQ,IAzCA,WAC2B,GAAGt4B,MAAM5U,KAChC6H,SAAS+a,iBAAiB,+BAETtd,KAAI,SAAU6nC,GAC/B,OAAO,IAAI,GAAkBA,EAAkB,CAC7CpK,MAAO,CAAE1Q,KAAM,IAAKD,KAAM,MAE9B,GACF,IAiCA8a,IA5BA,WACYrlC,SAASm9B,eAAe,mBAC9B13B,iBAAiB,SAAS,WAC5BzF,SAAS6G,KAAKT,UAAY,EAC1BpG,SAASC,gBAAgBmG,UAAY,CACvC,GACF,IAuBAi/B,IArBA,WACE,IAAIE,EAAMvlC,SAASm9B,eAAe,mBAC9BqI,EAASxlC,SACVylC,uBAAuB,aAAa,GACpCxnC,wBACH1D,OAAOkL,iBAAiB,UAAU,WAC5BkV,KAAK+qB,UAAY/qB,KAAKgrB,SAAWhrB,KAAKgrB,QAAUH,EAAOjtC,OACzDgtC,EAAI7pC,MAAMgxB,QAAU,QAEpB6Y,EAAI7pC,MAAMgxB,QAAU,OAEtB/R,KAAK+qB,UAAY/qB,KAAKgrB,OACxB,GACF,IAUAprC,OAAOqrC,UAAY","sources":["webpack://pydata_sphinx_theme/webpack/bootstrap","webpack://pydata_sphinx_theme/webpack/runtime/define property getters","webpack://pydata_sphinx_theme/webpack/runtime/hasOwnProperty shorthand","webpack://pydata_sphinx_theme/webpack/runtime/make namespace object","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/enums.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/instanceOf.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/applyStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getBasePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/math.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/userAgent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isLayoutViewport.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getBoundingClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getLayoutRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/contains.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getComputedStyle.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isTableElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentElement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getParentNode.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getOffsetParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getMainAxisFromPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/within.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergePaddingObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getFreshSideObject.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/expandToHashMap.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/arrow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getVariation.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/computeStyles.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/eventListeners.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositePlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getOppositeVariationPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getWindowScrollBarX.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/isScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getScrollParent.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/listScrollParents.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/rectToClientRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getClippingRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getViewportRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getDocumentRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/detectOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/flip.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/computeAutoPlacement.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/hide.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/offset.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/popperOffsets.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/modifiers/preventOverflow.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/getAltAxis.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getCompositeRect.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getNodeScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/dom-utils/getHTMLElementScroll.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/orderModifiers.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/createPopper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/debounce.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/utils/mergeByName.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper.js","webpack://pydata_sphinx_theme/./node_modules/@popperjs/core/lib/popper-lite.js","webpack://pydata_sphinx_theme/./node_modules/bootstrap/dist/js/bootstrap.esm.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/mixin.js","webpack://pydata_sphinx_theme/./src/pydata_sphinx_theme/assets/scripts/bootstrap.js"],"sourcesContent":["// The require scope\nvar __webpack_require__ = {};\n\n","// define getter functions for harmony exports\n__webpack_require__.d = (exports, definition) => {\n\tfor(var key in definition) {\n\t\tif(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {\n\t\t\tObject.defineProperty(exports, key, { enumerable: true, get: definition[key] });\n\t\t}\n\t}\n};","__webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))","// define __esModule on exports\n__webpack_require__.r = (exports) => {\n\tif(typeof Symbol !== 'undefined' && Symbol.toStringTag) {\n\t\tObject.defineProperty(exports, Symbol.toStringTag, { value: 'Module' });\n\t}\n\tObject.defineProperty(exports, '__esModule', { value: true });\n};","export var top = 'top';\nexport var bottom = 'bottom';\nexport var right = 'right';\nexport var left = 'left';\nexport var auto = 'auto';\nexport var basePlacements = [top, bottom, right, left];\nexport var start = 'start';\nexport var end = 'end';\nexport var clippingParents = 'clippingParents';\nexport var viewport = 'viewport';\nexport var popper = 'popper';\nexport var reference = 'reference';\nexport var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {\n return acc.concat([placement + \"-\" + start, placement + \"-\" + end]);\n}, []);\nexport var placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {\n return acc.concat([placement, placement + \"-\" + start, placement + \"-\" + end]);\n}, []); // modifiers that need to read the DOM\n\nexport var beforeRead = 'beforeRead';\nexport var read = 'read';\nexport var afterRead = 'afterRead'; // pure-logic modifiers\n\nexport var beforeMain = 'beforeMain';\nexport var main = 'main';\nexport var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)\n\nexport var beforeWrite = 'beforeWrite';\nexport var write = 'write';\nexport var afterWrite = 'afterWrite';\nexport var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];","export default function getNodeName(element) {\n return element ? (element.nodeName || '').toLowerCase() : null;\n}","export default function getWindow(node) {\n if (node == null) {\n return window;\n }\n\n if (node.toString() !== '[object Window]') {\n var ownerDocument = node.ownerDocument;\n return ownerDocument ? ownerDocument.defaultView || window : window;\n }\n\n return node;\n}","import getWindow from \"./getWindow.js\";\n\nfunction isElement(node) {\n var OwnElement = getWindow(node).Element;\n return node instanceof OwnElement || node instanceof Element;\n}\n\nfunction isHTMLElement(node) {\n var OwnElement = getWindow(node).HTMLElement;\n return node instanceof OwnElement || node instanceof HTMLElement;\n}\n\nfunction isShadowRoot(node) {\n // IE 11 has no ShadowRoot\n if (typeof ShadowRoot === 'undefined') {\n return false;\n }\n\n var OwnElement = getWindow(node).ShadowRoot;\n return node instanceof OwnElement || node instanceof ShadowRoot;\n}\n\nexport { isElement, isHTMLElement, isShadowRoot };","import getNodeName from \"../dom-utils/getNodeName.js\";\nimport { isHTMLElement } from \"../dom-utils/instanceOf.js\"; // This modifier takes the styles prepared by the `computeStyles` modifier\n// and applies them to the HTMLElements such as popper and arrow\n\nfunction applyStyles(_ref) {\n var state = _ref.state;\n Object.keys(state.elements).forEach(function (name) {\n var style = state.styles[name] || {};\n var attributes = state.attributes[name] || {};\n var element = state.elements[name]; // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n } // Flow doesn't support to extend this property, but it's the most\n // effective way to apply styles to an HTMLElement\n // $FlowFixMe[cannot-write]\n\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (name) {\n var value = attributes[name];\n\n if (value === false) {\n element.removeAttribute(name);\n } else {\n element.setAttribute(name, value === true ? '' : value);\n }\n });\n });\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state;\n var initialStyles = {\n popper: {\n position: state.options.strategy,\n left: '0',\n top: '0',\n margin: '0'\n },\n arrow: {\n position: 'absolute'\n },\n reference: {}\n };\n Object.assign(state.elements.popper.style, initialStyles.popper);\n state.styles = initialStyles;\n\n if (state.elements.arrow) {\n Object.assign(state.elements.arrow.style, initialStyles.arrow);\n }\n\n return function () {\n Object.keys(state.elements).forEach(function (name) {\n var element = state.elements[name];\n var attributes = state.attributes[name] || {};\n var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them\n\n var style = styleProperties.reduce(function (style, property) {\n style[property] = '';\n return style;\n }, {}); // arrow is optional + virtual elements\n\n if (!isHTMLElement(element) || !getNodeName(element)) {\n return;\n }\n\n Object.assign(element.style, style);\n Object.keys(attributes).forEach(function (attribute) {\n element.removeAttribute(attribute);\n });\n });\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'applyStyles',\n enabled: true,\n phase: 'write',\n fn: applyStyles,\n effect: effect,\n requires: ['computeStyles']\n};","import { auto } from \"../enums.js\";\nexport default function getBasePlacement(placement) {\n return placement.split('-')[0];\n}","export var max = Math.max;\nexport var min = Math.min;\nexport var round = Math.round;","export default function getUAString() {\n var uaData = navigator.userAgentData;\n\n if (uaData != null && uaData.brands && Array.isArray(uaData.brands)) {\n return uaData.brands.map(function (item) {\n return item.brand + \"/\" + item.version;\n }).join(' ');\n }\n\n return navigator.userAgent;\n}","import getUAString from \"../utils/userAgent.js\";\nexport default function isLayoutViewport() {\n return !/^((?!chrome|android).)*safari/i.test(getUAString());\n}","import { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport { round } from \"../utils/math.js\";\nimport getWindow from \"./getWindow.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getBoundingClientRect(element, includeScale, isFixedStrategy) {\n if (includeScale === void 0) {\n includeScale = false;\n }\n\n if (isFixedStrategy === void 0) {\n isFixedStrategy = false;\n }\n\n var clientRect = element.getBoundingClientRect();\n var scaleX = 1;\n var scaleY = 1;\n\n if (includeScale && isHTMLElement(element)) {\n scaleX = element.offsetWidth > 0 ? round(clientRect.width) / element.offsetWidth || 1 : 1;\n scaleY = element.offsetHeight > 0 ? round(clientRect.height) / element.offsetHeight || 1 : 1;\n }\n\n var _ref = isElement(element) ? getWindow(element) : window,\n visualViewport = _ref.visualViewport;\n\n var addVisualOffsets = !isLayoutViewport() && isFixedStrategy;\n var x = (clientRect.left + (addVisualOffsets && visualViewport ? visualViewport.offsetLeft : 0)) / scaleX;\n var y = (clientRect.top + (addVisualOffsets && visualViewport ? visualViewport.offsetTop : 0)) / scaleY;\n var width = clientRect.width / scaleX;\n var height = clientRect.height / scaleY;\n return {\n width: width,\n height: height,\n top: y,\n right: x + width,\n bottom: y + height,\n left: x,\n x: x,\n y: y\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\"; // Returns the layout rect of an element relative to its offsetParent. Layout\n// means it doesn't take into account transforms.\n\nexport default function getLayoutRect(element) {\n var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.\n // Fixes https://github.com/popperjs/popper-core/issues/1223\n\n var width = element.offsetWidth;\n var height = element.offsetHeight;\n\n if (Math.abs(clientRect.width - width) <= 1) {\n width = clientRect.width;\n }\n\n if (Math.abs(clientRect.height - height) <= 1) {\n height = clientRect.height;\n }\n\n return {\n x: element.offsetLeft,\n y: element.offsetTop,\n width: width,\n height: height\n };\n}","import { isShadowRoot } from \"./instanceOf.js\";\nexport default function contains(parent, child) {\n var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method\n\n if (parent.contains(child)) {\n return true;\n } // then fallback to custom implementation with Shadow DOM support\n else if (rootNode && isShadowRoot(rootNode)) {\n var next = child;\n\n do {\n if (next && parent.isSameNode(next)) {\n return true;\n } // $FlowFixMe[prop-missing]: need a better way to handle this...\n\n\n next = next.parentNode || next.host;\n } while (next);\n } // Give up, the result is false\n\n\n return false;\n}","import getWindow from \"./getWindow.js\";\nexport default function getComputedStyle(element) {\n return getWindow(element).getComputedStyle(element);\n}","import getNodeName from \"./getNodeName.js\";\nexport default function isTableElement(element) {\n return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;\n}","import { isElement } from \"./instanceOf.js\";\nexport default function getDocumentElement(element) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]\n element.document) || window.document).documentElement;\n}","import getNodeName from \"./getNodeName.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport { isShadowRoot } from \"./instanceOf.js\";\nexport default function getParentNode(element) {\n if (getNodeName(element) === 'html') {\n return element;\n }\n\n return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle\n // $FlowFixMe[incompatible-return]\n // $FlowFixMe[prop-missing]\n element.assignedSlot || // step into the shadow DOM of the parent of a slotted node\n element.parentNode || ( // DOM Element detected\n isShadowRoot(element) ? element.host : null) || // ShadowRoot detected\n // $FlowFixMe[incompatible-call]: HTMLElement is a Node\n getDocumentElement(element) // fallback\n\n );\n}","import getWindow from \"./getWindow.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isHTMLElement, isShadowRoot } from \"./instanceOf.js\";\nimport isTableElement from \"./isTableElement.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getUAString from \"../utils/userAgent.js\";\n\nfunction getTrueOffsetParent(element) {\n if (!isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837\n getComputedStyle(element).position === 'fixed') {\n return null;\n }\n\n return element.offsetParent;\n} // `.offsetParent` reports `null` for fixed elements, while absolute elements\n// return the containing block\n\n\nfunction getContainingBlock(element) {\n var isFirefox = /firefox/i.test(getUAString());\n var isIE = /Trident/i.test(getUAString());\n\n if (isIE && isHTMLElement(element)) {\n // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport\n var elementCss = getComputedStyle(element);\n\n if (elementCss.position === 'fixed') {\n return null;\n }\n }\n\n var currentNode = getParentNode(element);\n\n if (isShadowRoot(currentNode)) {\n currentNode = currentNode.host;\n }\n\n while (isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {\n var css = getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that\n // create a containing block.\n // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block\n\n if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {\n return currentNode;\n } else {\n currentNode = currentNode.parentNode;\n }\n }\n\n return null;\n} // Gets the closest ancestor positioned element. Handles some edge cases,\n// such as table ancestors and cross browser bugs.\n\n\nexport default function getOffsetParent(element) {\n var window = getWindow(element);\n var offsetParent = getTrueOffsetParent(element);\n\n while (offsetParent && isTableElement(offsetParent) && getComputedStyle(offsetParent).position === 'static') {\n offsetParent = getTrueOffsetParent(offsetParent);\n }\n\n if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle(offsetParent).position === 'static')) {\n return window;\n }\n\n return offsetParent || getContainingBlock(element) || window;\n}","export default function getMainAxisFromPlacement(placement) {\n return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';\n}","import { max as mathMax, min as mathMin } from \"./math.js\";\nexport function within(min, value, max) {\n return mathMax(min, mathMin(value, max));\n}\nexport function withinMaxClamp(min, value, max) {\n var v = within(min, value, max);\n return v > max ? max : v;\n}","import getFreshSideObject from \"./getFreshSideObject.js\";\nexport default function mergePaddingObject(paddingObject) {\n return Object.assign({}, getFreshSideObject(), paddingObject);\n}","export default function getFreshSideObject() {\n return {\n top: 0,\n right: 0,\n bottom: 0,\n left: 0\n };\n}","export default function expandToHashMap(value, keys) {\n return keys.reduce(function (hashMap, key) {\n hashMap[key] = value;\n return hashMap;\n }, {});\n}","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport contains from \"../dom-utils/contains.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport { within } from \"../utils/within.js\";\nimport mergePaddingObject from \"../utils/mergePaddingObject.js\";\nimport expandToHashMap from \"../utils/expandToHashMap.js\";\nimport { left, right, basePlacements, top, bottom } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar toPaddingObject = function toPaddingObject(padding, state) {\n padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {\n placement: state.placement\n })) : padding;\n return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n};\n\nfunction arrow(_ref) {\n var _state$modifiersData$;\n\n var state = _ref.state,\n name = _ref.name,\n options = _ref.options;\n var arrowElement = state.elements.arrow;\n var popperOffsets = state.modifiersData.popperOffsets;\n var basePlacement = getBasePlacement(state.placement);\n var axis = getMainAxisFromPlacement(basePlacement);\n var isVertical = [left, right].indexOf(basePlacement) >= 0;\n var len = isVertical ? 'height' : 'width';\n\n if (!arrowElement || !popperOffsets) {\n return;\n }\n\n var paddingObject = toPaddingObject(options.padding, state);\n var arrowRect = getLayoutRect(arrowElement);\n var minProp = axis === 'y' ? top : left;\n var maxProp = axis === 'y' ? bottom : right;\n var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];\n var startDiff = popperOffsets[axis] - state.rects.reference[axis];\n var arrowOffsetParent = getOffsetParent(arrowElement);\n var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;\n var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is\n // outside of the popper bounds\n\n var min = paddingObject[minProp];\n var max = clientSize - arrowRect[len] - paddingObject[maxProp];\n var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;\n var offset = within(min, center, max); // Prevents breaking syntax highlighting...\n\n var axisProp = axis;\n state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);\n}\n\nfunction effect(_ref2) {\n var state = _ref2.state,\n options = _ref2.options;\n var _options$element = options.element,\n arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;\n\n if (arrowElement == null) {\n return;\n } // CSS selector\n\n\n if (typeof arrowElement === 'string') {\n arrowElement = state.elements.popper.querySelector(arrowElement);\n\n if (!arrowElement) {\n return;\n }\n }\n\n if (!contains(state.elements.popper, arrowElement)) {\n return;\n }\n\n state.elements.arrow = arrowElement;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'arrow',\n enabled: true,\n phase: 'main',\n fn: arrow,\n effect: effect,\n requires: ['popperOffsets'],\n requiresIfExists: ['preventOverflow']\n};","export default function getVariation(placement) {\n return placement.split('-')[1];\n}","import { top, left, right, bottom, end } from \"../enums.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport getWindow from \"../dom-utils/getWindow.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getComputedStyle from \"../dom-utils/getComputedStyle.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport { round } from \"../utils/math.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar unsetSides = {\n top: 'auto',\n right: 'auto',\n bottom: 'auto',\n left: 'auto'\n}; // Round the offsets to the nearest suitable subpixel based on the DPR.\n// Zooming can change the DPR, but it seems to report a value that will\n// cleanly divide the values into the appropriate subpixels.\n\nfunction roundOffsetsByDPR(_ref, win) {\n var x = _ref.x,\n y = _ref.y;\n var dpr = win.devicePixelRatio || 1;\n return {\n x: round(x * dpr) / dpr || 0,\n y: round(y * dpr) / dpr || 0\n };\n}\n\nexport function mapToStyles(_ref2) {\n var _Object$assign2;\n\n var popper = _ref2.popper,\n popperRect = _ref2.popperRect,\n placement = _ref2.placement,\n variation = _ref2.variation,\n offsets = _ref2.offsets,\n position = _ref2.position,\n gpuAcceleration = _ref2.gpuAcceleration,\n adaptive = _ref2.adaptive,\n roundOffsets = _ref2.roundOffsets,\n isFixed = _ref2.isFixed;\n var _offsets$x = offsets.x,\n x = _offsets$x === void 0 ? 0 : _offsets$x,\n _offsets$y = offsets.y,\n y = _offsets$y === void 0 ? 0 : _offsets$y;\n\n var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({\n x: x,\n y: y\n }) : {\n x: x,\n y: y\n };\n\n x = _ref3.x;\n y = _ref3.y;\n var hasX = offsets.hasOwnProperty('x');\n var hasY = offsets.hasOwnProperty('y');\n var sideX = left;\n var sideY = top;\n var win = window;\n\n if (adaptive) {\n var offsetParent = getOffsetParent(popper);\n var heightProp = 'clientHeight';\n var widthProp = 'clientWidth';\n\n if (offsetParent === getWindow(popper)) {\n offsetParent = getDocumentElement(popper);\n\n if (getComputedStyle(offsetParent).position !== 'static' && position === 'absolute') {\n heightProp = 'scrollHeight';\n widthProp = 'scrollWidth';\n }\n } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it\n\n\n offsetParent = offsetParent;\n\n if (placement === top || (placement === left || placement === right) && variation === end) {\n sideY = bottom;\n var offsetY = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]\n offsetParent[heightProp];\n y -= offsetY - popperRect.height;\n y *= gpuAcceleration ? 1 : -1;\n }\n\n if (placement === left || (placement === top || placement === bottom) && variation === end) {\n sideX = right;\n var offsetX = isFixed && offsetParent === win && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]\n offsetParent[widthProp];\n x -= offsetX - popperRect.width;\n x *= gpuAcceleration ? 1 : -1;\n }\n }\n\n var commonStyles = Object.assign({\n position: position\n }, adaptive && unsetSides);\n\n var _ref4 = roundOffsets === true ? roundOffsetsByDPR({\n x: x,\n y: y\n }, getWindow(popper)) : {\n x: x,\n y: y\n };\n\n x = _ref4.x;\n y = _ref4.y;\n\n if (gpuAcceleration) {\n var _Object$assign;\n\n return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? \"translate(\" + x + \"px, \" + y + \"px)\" : \"translate3d(\" + x + \"px, \" + y + \"px, 0)\", _Object$assign));\n }\n\n return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + \"px\" : '', _Object$assign2[sideX] = hasX ? x + \"px\" : '', _Object$assign2.transform = '', _Object$assign2));\n}\n\nfunction computeStyles(_ref5) {\n var state = _ref5.state,\n options = _ref5.options;\n var _options$gpuAccelerat = options.gpuAcceleration,\n gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,\n _options$adaptive = options.adaptive,\n adaptive = _options$adaptive === void 0 ? true : _options$adaptive,\n _options$roundOffsets = options.roundOffsets,\n roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;\n var commonStyles = {\n placement: getBasePlacement(state.placement),\n variation: getVariation(state.placement),\n popper: state.elements.popper,\n popperRect: state.rects.popper,\n gpuAcceleration: gpuAcceleration,\n isFixed: state.options.strategy === 'fixed'\n };\n\n if (state.modifiersData.popperOffsets != null) {\n state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.popperOffsets,\n position: state.options.strategy,\n adaptive: adaptive,\n roundOffsets: roundOffsets\n })));\n }\n\n if (state.modifiersData.arrow != null) {\n state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {\n offsets: state.modifiersData.arrow,\n position: 'absolute',\n adaptive: false,\n roundOffsets: roundOffsets\n })));\n }\n\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-placement': state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'computeStyles',\n enabled: true,\n phase: 'beforeWrite',\n fn: computeStyles,\n data: {}\n};","import getWindow from \"../dom-utils/getWindow.js\"; // eslint-disable-next-line import/no-unused-modules\n\nvar passive = {\n passive: true\n};\n\nfunction effect(_ref) {\n var state = _ref.state,\n instance = _ref.instance,\n options = _ref.options;\n var _options$scroll = options.scroll,\n scroll = _options$scroll === void 0 ? true : _options$scroll,\n _options$resize = options.resize,\n resize = _options$resize === void 0 ? true : _options$resize;\n var window = getWindow(state.elements.popper);\n var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);\n\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.addEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.addEventListener('resize', instance.update, passive);\n }\n\n return function () {\n if (scroll) {\n scrollParents.forEach(function (scrollParent) {\n scrollParent.removeEventListener('scroll', instance.update, passive);\n });\n }\n\n if (resize) {\n window.removeEventListener('resize', instance.update, passive);\n }\n };\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'eventListeners',\n enabled: true,\n phase: 'write',\n fn: function fn() {},\n effect: effect,\n data: {}\n};","var hash = {\n left: 'right',\n right: 'left',\n bottom: 'top',\n top: 'bottom'\n};\nexport default function getOppositePlacement(placement) {\n return placement.replace(/left|right|bottom|top/g, function (matched) {\n return hash[matched];\n });\n}","var hash = {\n start: 'end',\n end: 'start'\n};\nexport default function getOppositeVariationPlacement(placement) {\n return placement.replace(/start|end/g, function (matched) {\n return hash[matched];\n });\n}","import getWindow from \"./getWindow.js\";\nexport default function getWindowScroll(node) {\n var win = getWindow(node);\n var scrollLeft = win.pageXOffset;\n var scrollTop = win.pageYOffset;\n return {\n scrollLeft: scrollLeft,\n scrollTop: scrollTop\n };\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nexport default function getWindowScrollBarX(element) {\n // If has a CSS width greater than the viewport, then this will be\n // incorrect for RTL.\n // Popper 1 is broken in this case and never had a bug report so let's assume\n // it's not an issue. I don't think anyone ever specifies width on \n // anyway.\n // Browsers where the left scrollbar doesn't cause an issue report `0` for\n // this (e.g. Edge 2019, IE11, Safari)\n return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;\n}","import getComputedStyle from \"./getComputedStyle.js\";\nexport default function isScrollParent(element) {\n // Firefox wants us to check `-x` and `-y` variations as well\n var _getComputedStyle = getComputedStyle(element),\n overflow = _getComputedStyle.overflow,\n overflowX = _getComputedStyle.overflowX,\n overflowY = _getComputedStyle.overflowY;\n\n return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);\n}","import getParentNode from \"./getParentNode.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nexport default function getScrollParent(node) {\n if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {\n // $FlowFixMe[incompatible-return]: assume body is always available\n return node.ownerDocument.body;\n }\n\n if (isHTMLElement(node) && isScrollParent(node)) {\n return node;\n }\n\n return getScrollParent(getParentNode(node));\n}","import getScrollParent from \"./getScrollParent.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport getWindow from \"./getWindow.js\";\nimport isScrollParent from \"./isScrollParent.js\";\n/*\ngiven a DOM element, return the list of all scroll parents, up the list of ancesors\nuntil we get to the top window object. This list is what we attach scroll listeners\nto, because if any of these parent elements scroll, we'll need to re-calculate the\nreference element's position.\n*/\n\nexport default function listScrollParents(element, list) {\n var _element$ownerDocumen;\n\n if (list === void 0) {\n list = [];\n }\n\n var scrollParent = getScrollParent(element);\n var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);\n var win = getWindow(scrollParent);\n var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;\n var updatedList = list.concat(target);\n return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here\n updatedList.concat(listScrollParents(getParentNode(target)));\n}","export default function rectToClientRect(rect) {\n return Object.assign({}, rect, {\n left: rect.x,\n top: rect.y,\n right: rect.x + rect.width,\n bottom: rect.y + rect.height\n });\n}","import { viewport } from \"../enums.js\";\nimport getViewportRect from \"./getViewportRect.js\";\nimport getDocumentRect from \"./getDocumentRect.js\";\nimport listScrollParents from \"./listScrollParents.js\";\nimport getOffsetParent from \"./getOffsetParent.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport { isElement, isHTMLElement } from \"./instanceOf.js\";\nimport getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getParentNode from \"./getParentNode.js\";\nimport contains from \"./contains.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport rectToClientRect from \"../utils/rectToClientRect.js\";\nimport { max, min } from \"../utils/math.js\";\n\nfunction getInnerBoundingClientRect(element, strategy) {\n var rect = getBoundingClientRect(element, false, strategy === 'fixed');\n rect.top = rect.top + element.clientTop;\n rect.left = rect.left + element.clientLeft;\n rect.bottom = rect.top + element.clientHeight;\n rect.right = rect.left + element.clientWidth;\n rect.width = element.clientWidth;\n rect.height = element.clientHeight;\n rect.x = rect.left;\n rect.y = rect.top;\n return rect;\n}\n\nfunction getClientRectFromMixedType(element, clippingParent, strategy) {\n return clippingParent === viewport ? rectToClientRect(getViewportRect(element, strategy)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent, strategy) : rectToClientRect(getDocumentRect(getDocumentElement(element)));\n} // A \"clipping parent\" is an overflowable container with the characteristic of\n// clipping (or hiding) overflowing elements with a position different from\n// `initial`\n\n\nfunction getClippingParents(element) {\n var clippingParents = listScrollParents(getParentNode(element));\n var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle(element).position) >= 0;\n var clipperElement = canEscapeClipping && isHTMLElement(element) ? getOffsetParent(element) : element;\n\n if (!isElement(clipperElement)) {\n return [];\n } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414\n\n\n return clippingParents.filter(function (clippingParent) {\n return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';\n });\n} // Gets the maximum area that the element is visible in due to any number of\n// clipping parents\n\n\nexport default function getClippingRect(element, boundary, rootBoundary, strategy) {\n var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);\n var clippingParents = [].concat(mainClippingParents, [rootBoundary]);\n var firstClippingParent = clippingParents[0];\n var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {\n var rect = getClientRectFromMixedType(element, clippingParent, strategy);\n accRect.top = max(rect.top, accRect.top);\n accRect.right = min(rect.right, accRect.right);\n accRect.bottom = min(rect.bottom, accRect.bottom);\n accRect.left = max(rect.left, accRect.left);\n return accRect;\n }, getClientRectFromMixedType(element, firstClippingParent, strategy));\n clippingRect.width = clippingRect.right - clippingRect.left;\n clippingRect.height = clippingRect.bottom - clippingRect.top;\n clippingRect.x = clippingRect.left;\n clippingRect.y = clippingRect.top;\n return clippingRect;\n}","import getWindow from \"./getWindow.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport isLayoutViewport from \"./isLayoutViewport.js\";\nexport default function getViewportRect(element, strategy) {\n var win = getWindow(element);\n var html = getDocumentElement(element);\n var visualViewport = win.visualViewport;\n var width = html.clientWidth;\n var height = html.clientHeight;\n var x = 0;\n var y = 0;\n\n if (visualViewport) {\n width = visualViewport.width;\n height = visualViewport.height;\n var layoutViewport = isLayoutViewport();\n\n if (layoutViewport || !layoutViewport && strategy === 'fixed') {\n x = visualViewport.offsetLeft;\n y = visualViewport.offsetTop;\n }\n }\n\n return {\n width: width,\n height: height,\n x: x + getWindowScrollBarX(element),\n y: y\n };\n}","import getDocumentElement from \"./getDocumentElement.js\";\nimport getComputedStyle from \"./getComputedStyle.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getWindowScroll from \"./getWindowScroll.js\";\nimport { max } from \"../utils/math.js\"; // Gets the entire size of the scrollable document area, even extending outside\n// of the `` and `` rect bounds if horizontally scrollable\n\nexport default function getDocumentRect(element) {\n var _element$ownerDocumen;\n\n var html = getDocumentElement(element);\n var winScroll = getWindowScroll(element);\n var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;\n var width = max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);\n var height = max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);\n var x = -winScroll.scrollLeft + getWindowScrollBarX(element);\n var y = -winScroll.scrollTop;\n\n if (getComputedStyle(body || html).direction === 'rtl') {\n x += max(html.clientWidth, body ? body.clientWidth : 0) - width;\n }\n\n return {\n width: width,\n height: height,\n x: x,\n y: y\n };\n}","import getBasePlacement from \"./getBasePlacement.js\";\nimport getVariation from \"./getVariation.js\";\nimport getMainAxisFromPlacement from \"./getMainAxisFromPlacement.js\";\nimport { top, right, bottom, left, start, end } from \"../enums.js\";\nexport default function computeOffsets(_ref) {\n var reference = _ref.reference,\n element = _ref.element,\n placement = _ref.placement;\n var basePlacement = placement ? getBasePlacement(placement) : null;\n var variation = placement ? getVariation(placement) : null;\n var commonX = reference.x + reference.width / 2 - element.width / 2;\n var commonY = reference.y + reference.height / 2 - element.height / 2;\n var offsets;\n\n switch (basePlacement) {\n case top:\n offsets = {\n x: commonX,\n y: reference.y - element.height\n };\n break;\n\n case bottom:\n offsets = {\n x: commonX,\n y: reference.y + reference.height\n };\n break;\n\n case right:\n offsets = {\n x: reference.x + reference.width,\n y: commonY\n };\n break;\n\n case left:\n offsets = {\n x: reference.x - element.width,\n y: commonY\n };\n break;\n\n default:\n offsets = {\n x: reference.x,\n y: reference.y\n };\n }\n\n var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;\n\n if (mainAxis != null) {\n var len = mainAxis === 'y' ? 'height' : 'width';\n\n switch (variation) {\n case start:\n offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);\n break;\n\n case end:\n offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);\n break;\n\n default:\n }\n }\n\n return offsets;\n}","import getClippingRect from \"../dom-utils/getClippingRect.js\";\nimport getDocumentElement from \"../dom-utils/getDocumentElement.js\";\nimport getBoundingClientRect from \"../dom-utils/getBoundingClientRect.js\";\nimport computeOffsets from \"./computeOffsets.js\";\nimport rectToClientRect from \"./rectToClientRect.js\";\nimport { clippingParents, reference, popper, bottom, top, right, basePlacements, viewport } from \"../enums.js\";\nimport { isElement } from \"../dom-utils/instanceOf.js\";\nimport mergePaddingObject from \"./mergePaddingObject.js\";\nimport expandToHashMap from \"./expandToHashMap.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport default function detectOverflow(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n _options$placement = _options.placement,\n placement = _options$placement === void 0 ? state.placement : _options$placement,\n _options$strategy = _options.strategy,\n strategy = _options$strategy === void 0 ? state.strategy : _options$strategy,\n _options$boundary = _options.boundary,\n boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,\n _options$rootBoundary = _options.rootBoundary,\n rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,\n _options$elementConte = _options.elementContext,\n elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,\n _options$altBoundary = _options.altBoundary,\n altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,\n _options$padding = _options.padding,\n padding = _options$padding === void 0 ? 0 : _options$padding;\n var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));\n var altContext = elementContext === popper ? reference : popper;\n var popperRect = state.rects.popper;\n var element = state.elements[altBoundary ? altContext : elementContext];\n var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary, strategy);\n var referenceClientRect = getBoundingClientRect(state.elements.reference);\n var popperOffsets = computeOffsets({\n reference: referenceClientRect,\n element: popperRect,\n strategy: 'absolute',\n placement: placement\n });\n var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));\n var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect\n // 0 or negative = within the clipping rect\n\n var overflowOffsets = {\n top: clippingClientRect.top - elementClientRect.top + paddingObject.top,\n bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,\n left: clippingClientRect.left - elementClientRect.left + paddingObject.left,\n right: elementClientRect.right - clippingClientRect.right + paddingObject.right\n };\n var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element\n\n if (elementContext === popper && offsetData) {\n var offset = offsetData[placement];\n Object.keys(overflowOffsets).forEach(function (key) {\n var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;\n var axis = [top, bottom].indexOf(key) >= 0 ? 'y' : 'x';\n overflowOffsets[key] += offset[axis] * multiply;\n });\n }\n\n return overflowOffsets;\n}","import getOppositePlacement from \"../utils/getOppositePlacement.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getOppositeVariationPlacement from \"../utils/getOppositeVariationPlacement.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport computeAutoPlacement from \"../utils/computeAutoPlacement.js\";\nimport { bottom, top, start, right, left, auto } from \"../enums.js\";\nimport getVariation from \"../utils/getVariation.js\"; // eslint-disable-next-line import/no-unused-modules\n\nfunction getExpandedFallbackPlacements(placement) {\n if (getBasePlacement(placement) === auto) {\n return [];\n }\n\n var oppositePlacement = getOppositePlacement(placement);\n return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];\n}\n\nfunction flip(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n\n if (state.modifiersData[name]._skip) {\n return;\n }\n\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,\n specifiedFallbackPlacements = options.fallbackPlacements,\n padding = options.padding,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n _options$flipVariatio = options.flipVariations,\n flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,\n allowedAutoPlacements = options.allowedAutoPlacements;\n var preferredPlacement = state.options.placement;\n var basePlacement = getBasePlacement(preferredPlacement);\n var isBasePlacement = basePlacement === preferredPlacement;\n var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));\n var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {\n return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n flipVariations: flipVariations,\n allowedAutoPlacements: allowedAutoPlacements\n }) : placement);\n }, []);\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var checksMap = new Map();\n var makeFallbackChecks = true;\n var firstFittingPlacement = placements[0];\n\n for (var i = 0; i < placements.length; i++) {\n var placement = placements[i];\n\n var _basePlacement = getBasePlacement(placement);\n\n var isStartVariation = getVariation(placement) === start;\n var isVertical = [top, bottom].indexOf(_basePlacement) >= 0;\n var len = isVertical ? 'width' : 'height';\n var overflow = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n altBoundary: altBoundary,\n padding: padding\n });\n var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : top;\n\n if (referenceRect[len] > popperRect[len]) {\n mainVariationSide = getOppositePlacement(mainVariationSide);\n }\n\n var altVariationSide = getOppositePlacement(mainVariationSide);\n var checks = [];\n\n if (checkMainAxis) {\n checks.push(overflow[_basePlacement] <= 0);\n }\n\n if (checkAltAxis) {\n checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);\n }\n\n if (checks.every(function (check) {\n return check;\n })) {\n firstFittingPlacement = placement;\n makeFallbackChecks = false;\n break;\n }\n\n checksMap.set(placement, checks);\n }\n\n if (makeFallbackChecks) {\n // `2` may be desired in some cases – research later\n var numberOfChecks = flipVariations ? 3 : 1;\n\n var _loop = function _loop(_i) {\n var fittingPlacement = placements.find(function (placement) {\n var checks = checksMap.get(placement);\n\n if (checks) {\n return checks.slice(0, _i).every(function (check) {\n return check;\n });\n }\n });\n\n if (fittingPlacement) {\n firstFittingPlacement = fittingPlacement;\n return \"break\";\n }\n };\n\n for (var _i = numberOfChecks; _i > 0; _i--) {\n var _ret = _loop(_i);\n\n if (_ret === \"break\") break;\n }\n }\n\n if (state.placement !== firstFittingPlacement) {\n state.modifiersData[name]._skip = true;\n state.placement = firstFittingPlacement;\n state.reset = true;\n }\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'flip',\n enabled: true,\n phase: 'main',\n fn: flip,\n requiresIfExists: ['offset'],\n data: {\n _skip: false\n }\n};","import getVariation from \"./getVariation.js\";\nimport { variationPlacements, basePlacements, placements as allPlacements } from \"../enums.js\";\nimport detectOverflow from \"./detectOverflow.js\";\nimport getBasePlacement from \"./getBasePlacement.js\";\nexport default function computeAutoPlacement(state, options) {\n if (options === void 0) {\n options = {};\n }\n\n var _options = options,\n placement = _options.placement,\n boundary = _options.boundary,\n rootBoundary = _options.rootBoundary,\n padding = _options.padding,\n flipVariations = _options.flipVariations,\n _options$allowedAutoP = _options.allowedAutoPlacements,\n allowedAutoPlacements = _options$allowedAutoP === void 0 ? allPlacements : _options$allowedAutoP;\n var variation = getVariation(placement);\n var placements = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {\n return getVariation(placement) === variation;\n }) : basePlacements;\n var allowedPlacements = placements.filter(function (placement) {\n return allowedAutoPlacements.indexOf(placement) >= 0;\n });\n\n if (allowedPlacements.length === 0) {\n allowedPlacements = placements;\n } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...\n\n\n var overflows = allowedPlacements.reduce(function (acc, placement) {\n acc[placement] = detectOverflow(state, {\n placement: placement,\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding\n })[getBasePlacement(placement)];\n return acc;\n }, {});\n return Object.keys(overflows).sort(function (a, b) {\n return overflows[a] - overflows[b];\n });\n}","import { top, bottom, left, right } from \"../enums.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\n\nfunction getSideOffsets(overflow, rect, preventedOffsets) {\n if (preventedOffsets === void 0) {\n preventedOffsets = {\n x: 0,\n y: 0\n };\n }\n\n return {\n top: overflow.top - rect.height - preventedOffsets.y,\n right: overflow.right - rect.width + preventedOffsets.x,\n bottom: overflow.bottom - rect.height + preventedOffsets.y,\n left: overflow.left - rect.width - preventedOffsets.x\n };\n}\n\nfunction isAnySideFullyClipped(overflow) {\n return [top, right, bottom, left].some(function (side) {\n return overflow[side] >= 0;\n });\n}\n\nfunction hide(_ref) {\n var state = _ref.state,\n name = _ref.name;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var preventedOffsets = state.modifiersData.preventOverflow;\n var referenceOverflow = detectOverflow(state, {\n elementContext: 'reference'\n });\n var popperAltOverflow = detectOverflow(state, {\n altBoundary: true\n });\n var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);\n var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);\n var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);\n var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);\n state.modifiersData[name] = {\n referenceClippingOffsets: referenceClippingOffsets,\n popperEscapeOffsets: popperEscapeOffsets,\n isReferenceHidden: isReferenceHidden,\n hasPopperEscaped: hasPopperEscaped\n };\n state.attributes.popper = Object.assign({}, state.attributes.popper, {\n 'data-popper-reference-hidden': isReferenceHidden,\n 'data-popper-escaped': hasPopperEscaped\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'hide',\n enabled: true,\n phase: 'main',\n requiresIfExists: ['preventOverflow'],\n fn: hide\n};","import getBasePlacement from \"../utils/getBasePlacement.js\";\nimport { top, left, right, placements } from \"../enums.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport function distanceAndSkiddingToXY(placement, rects, offset) {\n var basePlacement = getBasePlacement(placement);\n var invertDistance = [left, top].indexOf(basePlacement) >= 0 ? -1 : 1;\n\n var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {\n placement: placement\n })) : offset,\n skidding = _ref[0],\n distance = _ref[1];\n\n skidding = skidding || 0;\n distance = (distance || 0) * invertDistance;\n return [left, right].indexOf(basePlacement) >= 0 ? {\n x: distance,\n y: skidding\n } : {\n x: skidding,\n y: distance\n };\n}\n\nfunction offset(_ref2) {\n var state = _ref2.state,\n options = _ref2.options,\n name = _ref2.name;\n var _options$offset = options.offset,\n offset = _options$offset === void 0 ? [0, 0] : _options$offset;\n var data = placements.reduce(function (acc, placement) {\n acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);\n return acc;\n }, {});\n var _data$state$placement = data[state.placement],\n x = _data$state$placement.x,\n y = _data$state$placement.y;\n\n if (state.modifiersData.popperOffsets != null) {\n state.modifiersData.popperOffsets.x += x;\n state.modifiersData.popperOffsets.y += y;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'offset',\n enabled: true,\n phase: 'main',\n requires: ['popperOffsets'],\n fn: offset\n};","import computeOffsets from \"../utils/computeOffsets.js\";\n\nfunction popperOffsets(_ref) {\n var state = _ref.state,\n name = _ref.name;\n // Offsets are the actual position the popper needs to have to be\n // properly positioned near its reference element\n // This is the most basic placement, and will be adjusted by\n // the modifiers in the next step\n state.modifiersData[name] = computeOffsets({\n reference: state.rects.reference,\n element: state.rects.popper,\n strategy: 'absolute',\n placement: state.placement\n });\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'popperOffsets',\n enabled: true,\n phase: 'read',\n fn: popperOffsets,\n data: {}\n};","import { top, left, right, bottom, start } from \"../enums.js\";\nimport getBasePlacement from \"../utils/getBasePlacement.js\";\nimport getMainAxisFromPlacement from \"../utils/getMainAxisFromPlacement.js\";\nimport getAltAxis from \"../utils/getAltAxis.js\";\nimport { within, withinMaxClamp } from \"../utils/within.js\";\nimport getLayoutRect from \"../dom-utils/getLayoutRect.js\";\nimport getOffsetParent from \"../dom-utils/getOffsetParent.js\";\nimport detectOverflow from \"../utils/detectOverflow.js\";\nimport getVariation from \"../utils/getVariation.js\";\nimport getFreshSideObject from \"../utils/getFreshSideObject.js\";\nimport { min as mathMin, max as mathMax } from \"../utils/math.js\";\n\nfunction preventOverflow(_ref) {\n var state = _ref.state,\n options = _ref.options,\n name = _ref.name;\n var _options$mainAxis = options.mainAxis,\n checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,\n _options$altAxis = options.altAxis,\n checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,\n boundary = options.boundary,\n rootBoundary = options.rootBoundary,\n altBoundary = options.altBoundary,\n padding = options.padding,\n _options$tether = options.tether,\n tether = _options$tether === void 0 ? true : _options$tether,\n _options$tetherOffset = options.tetherOffset,\n tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;\n var overflow = detectOverflow(state, {\n boundary: boundary,\n rootBoundary: rootBoundary,\n padding: padding,\n altBoundary: altBoundary\n });\n var basePlacement = getBasePlacement(state.placement);\n var variation = getVariation(state.placement);\n var isBasePlacement = !variation;\n var mainAxis = getMainAxisFromPlacement(basePlacement);\n var altAxis = getAltAxis(mainAxis);\n var popperOffsets = state.modifiersData.popperOffsets;\n var referenceRect = state.rects.reference;\n var popperRect = state.rects.popper;\n var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {\n placement: state.placement\n })) : tetherOffset;\n var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {\n mainAxis: tetherOffsetValue,\n altAxis: tetherOffsetValue\n } : Object.assign({\n mainAxis: 0,\n altAxis: 0\n }, tetherOffsetValue);\n var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;\n var data = {\n x: 0,\n y: 0\n };\n\n if (!popperOffsets) {\n return;\n }\n\n if (checkMainAxis) {\n var _offsetModifierState$;\n\n var mainSide = mainAxis === 'y' ? top : left;\n var altSide = mainAxis === 'y' ? bottom : right;\n var len = mainAxis === 'y' ? 'height' : 'width';\n var offset = popperOffsets[mainAxis];\n var min = offset + overflow[mainSide];\n var max = offset - overflow[altSide];\n var additive = tether ? -popperRect[len] / 2 : 0;\n var minLen = variation === start ? referenceRect[len] : popperRect[len];\n var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go\n // outside the reference bounds\n\n var arrowElement = state.elements.arrow;\n var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {\n width: 0,\n height: 0\n };\n var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();\n var arrowPaddingMin = arrowPaddingObject[mainSide];\n var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want\n // to include its full size in the calculation. If the reference is small\n // and near the edge of a boundary, the popper can overflow even if the\n // reference is not overflowing as well (e.g. virtual elements with no\n // width or height)\n\n var arrowLen = within(0, referenceRect[len], arrowRect[len]);\n var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;\n var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;\n var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);\n var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;\n var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;\n var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;\n var tetherMax = offset + maxOffset - offsetModifierValue;\n var preventedOffset = within(tether ? mathMin(min, tetherMin) : min, offset, tether ? mathMax(max, tetherMax) : max);\n popperOffsets[mainAxis] = preventedOffset;\n data[mainAxis] = preventedOffset - offset;\n }\n\n if (checkAltAxis) {\n var _offsetModifierState$2;\n\n var _mainSide = mainAxis === 'x' ? top : left;\n\n var _altSide = mainAxis === 'x' ? bottom : right;\n\n var _offset = popperOffsets[altAxis];\n\n var _len = altAxis === 'y' ? 'height' : 'width';\n\n var _min = _offset + overflow[_mainSide];\n\n var _max = _offset - overflow[_altSide];\n\n var isOriginSide = [top, left].indexOf(basePlacement) !== -1;\n\n var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;\n\n var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;\n\n var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;\n\n var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);\n\n popperOffsets[altAxis] = _preventedOffset;\n data[altAxis] = _preventedOffset - _offset;\n }\n\n state.modifiersData[name] = data;\n} // eslint-disable-next-line import/no-unused-modules\n\n\nexport default {\n name: 'preventOverflow',\n enabled: true,\n phase: 'main',\n fn: preventOverflow,\n requiresIfExists: ['offset']\n};","export default function getAltAxis(axis) {\n return axis === 'x' ? 'y' : 'x';\n}","import getBoundingClientRect from \"./getBoundingClientRect.js\";\nimport getNodeScroll from \"./getNodeScroll.js\";\nimport getNodeName from \"./getNodeName.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getWindowScrollBarX from \"./getWindowScrollBarX.js\";\nimport getDocumentElement from \"./getDocumentElement.js\";\nimport isScrollParent from \"./isScrollParent.js\";\nimport { round } from \"../utils/math.js\";\n\nfunction isElementScaled(element) {\n var rect = element.getBoundingClientRect();\n var scaleX = round(rect.width) / element.offsetWidth || 1;\n var scaleY = round(rect.height) / element.offsetHeight || 1;\n return scaleX !== 1 || scaleY !== 1;\n} // Returns the composite rect of an element relative to its offsetParent.\n// Composite means it takes into account transforms as well as layout.\n\n\nexport default function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {\n if (isFixed === void 0) {\n isFixed = false;\n }\n\n var isOffsetParentAnElement = isHTMLElement(offsetParent);\n var offsetParentIsScaled = isHTMLElement(offsetParent) && isElementScaled(offsetParent);\n var documentElement = getDocumentElement(offsetParent);\n var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled, isFixed);\n var scroll = {\n scrollLeft: 0,\n scrollTop: 0\n };\n var offsets = {\n x: 0,\n y: 0\n };\n\n if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {\n if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078\n isScrollParent(documentElement)) {\n scroll = getNodeScroll(offsetParent);\n }\n\n if (isHTMLElement(offsetParent)) {\n offsets = getBoundingClientRect(offsetParent, true);\n offsets.x += offsetParent.clientLeft;\n offsets.y += offsetParent.clientTop;\n } else if (documentElement) {\n offsets.x = getWindowScrollBarX(documentElement);\n }\n }\n\n return {\n x: rect.left + scroll.scrollLeft - offsets.x,\n y: rect.top + scroll.scrollTop - offsets.y,\n width: rect.width,\n height: rect.height\n };\n}","import getWindowScroll from \"./getWindowScroll.js\";\nimport getWindow from \"./getWindow.js\";\nimport { isHTMLElement } from \"./instanceOf.js\";\nimport getHTMLElementScroll from \"./getHTMLElementScroll.js\";\nexport default function getNodeScroll(node) {\n if (node === getWindow(node) || !isHTMLElement(node)) {\n return getWindowScroll(node);\n } else {\n return getHTMLElementScroll(node);\n }\n}","export default function getHTMLElementScroll(element) {\n return {\n scrollLeft: element.scrollLeft,\n scrollTop: element.scrollTop\n };\n}","import { modifierPhases } from \"../enums.js\"; // source: https://stackoverflow.com/questions/49875255\n\nfunction order(modifiers) {\n var map = new Map();\n var visited = new Set();\n var result = [];\n modifiers.forEach(function (modifier) {\n map.set(modifier.name, modifier);\n }); // On visiting object, check for its dependencies and visit them recursively\n\n function sort(modifier) {\n visited.add(modifier.name);\n var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);\n requires.forEach(function (dep) {\n if (!visited.has(dep)) {\n var depModifier = map.get(dep);\n\n if (depModifier) {\n sort(depModifier);\n }\n }\n });\n result.push(modifier);\n }\n\n modifiers.forEach(function (modifier) {\n if (!visited.has(modifier.name)) {\n // check for visited object\n sort(modifier);\n }\n });\n return result;\n}\n\nexport default function orderModifiers(modifiers) {\n // order based on dependencies\n var orderedModifiers = order(modifiers); // order based on phase\n\n return modifierPhases.reduce(function (acc, phase) {\n return acc.concat(orderedModifiers.filter(function (modifier) {\n return modifier.phase === phase;\n }));\n }, []);\n}","import getCompositeRect from \"./dom-utils/getCompositeRect.js\";\nimport getLayoutRect from \"./dom-utils/getLayoutRect.js\";\nimport listScrollParents from \"./dom-utils/listScrollParents.js\";\nimport getOffsetParent from \"./dom-utils/getOffsetParent.js\";\nimport orderModifiers from \"./utils/orderModifiers.js\";\nimport debounce from \"./utils/debounce.js\";\nimport mergeByName from \"./utils/mergeByName.js\";\nimport detectOverflow from \"./utils/detectOverflow.js\";\nimport { isElement } from \"./dom-utils/instanceOf.js\";\nvar DEFAULT_OPTIONS = {\n placement: 'bottom',\n modifiers: [],\n strategy: 'absolute'\n};\n\nfunction areValidElements() {\n for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {\n args[_key] = arguments[_key];\n }\n\n return !args.some(function (element) {\n return !(element && typeof element.getBoundingClientRect === 'function');\n });\n}\n\nexport function popperGenerator(generatorOptions) {\n if (generatorOptions === void 0) {\n generatorOptions = {};\n }\n\n var _generatorOptions = generatorOptions,\n _generatorOptions$def = _generatorOptions.defaultModifiers,\n defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,\n _generatorOptions$def2 = _generatorOptions.defaultOptions,\n defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;\n return function createPopper(reference, popper, options) {\n if (options === void 0) {\n options = defaultOptions;\n }\n\n var state = {\n placement: 'bottom',\n orderedModifiers: [],\n options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),\n modifiersData: {},\n elements: {\n reference: reference,\n popper: popper\n },\n attributes: {},\n styles: {}\n };\n var effectCleanupFns = [];\n var isDestroyed = false;\n var instance = {\n state: state,\n setOptions: function setOptions(setOptionsAction) {\n var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;\n cleanupModifierEffects();\n state.options = Object.assign({}, defaultOptions, state.options, options);\n state.scrollParents = {\n reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],\n popper: listScrollParents(popper)\n }; // Orders the modifiers based on their dependencies and `phase`\n // properties\n\n var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers\n\n state.orderedModifiers = orderedModifiers.filter(function (m) {\n return m.enabled;\n });\n runModifierEffects();\n return instance.update();\n },\n // Sync update – it will always be executed, even if not necessary. This\n // is useful for low frequency updates where sync behavior simplifies the\n // logic.\n // For high frequency updates (e.g. `resize` and `scroll` events), always\n // prefer the async Popper#update method\n forceUpdate: function forceUpdate() {\n if (isDestroyed) {\n return;\n }\n\n var _state$elements = state.elements,\n reference = _state$elements.reference,\n popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements\n // anymore\n\n if (!areValidElements(reference, popper)) {\n return;\n } // Store the reference and popper rects to be read by modifiers\n\n\n state.rects = {\n reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),\n popper: getLayoutRect(popper)\n }; // Modifiers have the ability to reset the current update cycle. The\n // most common use case for this is the `flip` modifier changing the\n // placement, which then needs to re-run all the modifiers, because the\n // logic was previously ran for the previous placement and is therefore\n // stale/incorrect\n\n state.reset = false;\n state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier\n // is filled with the initial data specified by the modifier. This means\n // it doesn't persist and is fresh on each update.\n // To ensure persistent data, use `${name}#persistent`\n\n state.orderedModifiers.forEach(function (modifier) {\n return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);\n });\n\n for (var index = 0; index < state.orderedModifiers.length; index++) {\n if (state.reset === true) {\n state.reset = false;\n index = -1;\n continue;\n }\n\n var _state$orderedModifie = state.orderedModifiers[index],\n fn = _state$orderedModifie.fn,\n _state$orderedModifie2 = _state$orderedModifie.options,\n _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,\n name = _state$orderedModifie.name;\n\n if (typeof fn === 'function') {\n state = fn({\n state: state,\n options: _options,\n name: name,\n instance: instance\n }) || state;\n }\n }\n },\n // Async and optimistically optimized update – it will not be executed if\n // not necessary (debounced to run at most once-per-tick)\n update: debounce(function () {\n return new Promise(function (resolve) {\n instance.forceUpdate();\n resolve(state);\n });\n }),\n destroy: function destroy() {\n cleanupModifierEffects();\n isDestroyed = true;\n }\n };\n\n if (!areValidElements(reference, popper)) {\n return instance;\n }\n\n instance.setOptions(options).then(function (state) {\n if (!isDestroyed && options.onFirstUpdate) {\n options.onFirstUpdate(state);\n }\n }); // Modifiers have the ability to execute arbitrary code before the first\n // update cycle runs. They will be executed in the same order as the update\n // cycle. This is useful when a modifier adds some persistent data that\n // other modifiers need to use, but the modifier is run after the dependent\n // one.\n\n function runModifierEffects() {\n state.orderedModifiers.forEach(function (_ref) {\n var name = _ref.name,\n _ref$options = _ref.options,\n options = _ref$options === void 0 ? {} : _ref$options,\n effect = _ref.effect;\n\n if (typeof effect === 'function') {\n var cleanupFn = effect({\n state: state,\n name: name,\n instance: instance,\n options: options\n });\n\n var noopFn = function noopFn() {};\n\n effectCleanupFns.push(cleanupFn || noopFn);\n }\n });\n }\n\n function cleanupModifierEffects() {\n effectCleanupFns.forEach(function (fn) {\n return fn();\n });\n effectCleanupFns = [];\n }\n\n return instance;\n };\n}\nexport var createPopper = /*#__PURE__*/popperGenerator(); // eslint-disable-next-line import/no-unused-modules\n\nexport { detectOverflow };","export default function debounce(fn) {\n var pending;\n return function () {\n if (!pending) {\n pending = new Promise(function (resolve) {\n Promise.resolve().then(function () {\n pending = undefined;\n resolve(fn());\n });\n });\n }\n\n return pending;\n };\n}","export default function mergeByName(modifiers) {\n var merged = modifiers.reduce(function (merged, current) {\n var existing = merged[current.name];\n merged[current.name] = existing ? Object.assign({}, existing, current, {\n options: Object.assign({}, existing.options, current.options),\n data: Object.assign({}, existing.data, current.data)\n }) : current;\n return merged;\n }, {}); // IE11 does not support Object.values\n\n return Object.keys(merged).map(function (key) {\n return merged[key];\n });\n}","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nimport offset from \"./modifiers/offset.js\";\nimport flip from \"./modifiers/flip.js\";\nimport preventOverflow from \"./modifiers/preventOverflow.js\";\nimport arrow from \"./modifiers/arrow.js\";\nimport hide from \"./modifiers/hide.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles, offset, flip, preventOverflow, arrow, hide];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow }; // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper as createPopperLite } from \"./popper-lite.js\"; // eslint-disable-next-line import/no-unused-modules\n\nexport * from \"./modifiers/index.js\";","import { popperGenerator, detectOverflow } from \"./createPopper.js\";\nimport eventListeners from \"./modifiers/eventListeners.js\";\nimport popperOffsets from \"./modifiers/popperOffsets.js\";\nimport computeStyles from \"./modifiers/computeStyles.js\";\nimport applyStyles from \"./modifiers/applyStyles.js\";\nvar defaultModifiers = [eventListeners, popperOffsets, computeStyles, applyStyles];\nvar createPopper = /*#__PURE__*/popperGenerator({\n defaultModifiers: defaultModifiers\n}); // eslint-disable-next-line import/no-unused-modules\n\nexport { createPopper, popperGenerator, defaultModifiers, detectOverflow };","/*!\n * Bootstrap v5.3.3 (https://getbootstrap.com/)\n * Copyright 2011-2024 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors)\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n */\nimport * as Popper from '@popperjs/core';\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/data.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n/**\n * Constants\n */\n\nconst elementMap = new Map();\nconst Data = {\n set(element, key, instance) {\n if (!elementMap.has(element)) {\n elementMap.set(element, new Map());\n }\n const instanceMap = elementMap.get(element);\n\n // make it clear we only want one instance per element\n // can be removed later when multiple key/instances are fine to be used\n if (!instanceMap.has(key) && instanceMap.size !== 0) {\n // eslint-disable-next-line no-console\n console.error(`Bootstrap doesn't allow more than one instance per element. Bound instance: ${Array.from(instanceMap.keys())[0]}.`);\n return;\n }\n instanceMap.set(key, instance);\n },\n get(element, key) {\n if (elementMap.has(element)) {\n return elementMap.get(element).get(key) || null;\n }\n return null;\n },\n remove(element, key) {\n if (!elementMap.has(element)) {\n return;\n }\n const instanceMap = elementMap.get(element);\n instanceMap.delete(key);\n\n // free up element references if there are no instances left for an element\n if (instanceMap.size === 0) {\n elementMap.delete(element);\n }\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/index.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst MAX_UID = 1000000;\nconst MILLISECONDS_MULTIPLIER = 1000;\nconst TRANSITION_END = 'transitionend';\n\n/**\n * Properly escape IDs selectors to handle weird IDs\n * @param {string} selector\n * @returns {string}\n */\nconst parseSelector = selector => {\n if (selector && window.CSS && window.CSS.escape) {\n // document.querySelector needs escaping to handle IDs (html5+) containing for instance /\n selector = selector.replace(/#([^\\s\"#']+)/g, (match, id) => `#${CSS.escape(id)}`);\n }\n return selector;\n};\n\n// Shout-out Angus Croll (https://goo.gl/pxwQGp)\nconst toType = object => {\n if (object === null || object === undefined) {\n return `${object}`;\n }\n return Object.prototype.toString.call(object).match(/\\s([a-z]+)/i)[1].toLowerCase();\n};\n\n/**\n * Public Util API\n */\n\nconst getUID = prefix => {\n do {\n prefix += Math.floor(Math.random() * MAX_UID);\n } while (document.getElementById(prefix));\n return prefix;\n};\nconst getTransitionDurationFromElement = element => {\n if (!element) {\n return 0;\n }\n\n // Get transition-duration of the element\n let {\n transitionDuration,\n transitionDelay\n } = window.getComputedStyle(element);\n const floatTransitionDuration = Number.parseFloat(transitionDuration);\n const floatTransitionDelay = Number.parseFloat(transitionDelay);\n\n // Return 0 if element or transition duration is not found\n if (!floatTransitionDuration && !floatTransitionDelay) {\n return 0;\n }\n\n // If multiple durations are defined, take the first\n transitionDuration = transitionDuration.split(',')[0];\n transitionDelay = transitionDelay.split(',')[0];\n return (Number.parseFloat(transitionDuration) + Number.parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER;\n};\nconst triggerTransitionEnd = element => {\n element.dispatchEvent(new Event(TRANSITION_END));\n};\nconst isElement = object => {\n if (!object || typeof object !== 'object') {\n return false;\n }\n if (typeof object.jquery !== 'undefined') {\n object = object[0];\n }\n return typeof object.nodeType !== 'undefined';\n};\nconst getElement = object => {\n // it's a jQuery object or a node element\n if (isElement(object)) {\n return object.jquery ? object[0] : object;\n }\n if (typeof object === 'string' && object.length > 0) {\n return document.querySelector(parseSelector(object));\n }\n return null;\n};\nconst isVisible = element => {\n if (!isElement(element) || element.getClientRects().length === 0) {\n return false;\n }\n const elementIsVisible = getComputedStyle(element).getPropertyValue('visibility') === 'visible';\n // Handle `details` element as its content may falsie appear visible when it is closed\n const closedDetails = element.closest('details:not([open])');\n if (!closedDetails) {\n return elementIsVisible;\n }\n if (closedDetails !== element) {\n const summary = element.closest('summary');\n if (summary && summary.parentNode !== closedDetails) {\n return false;\n }\n if (summary === null) {\n return false;\n }\n }\n return elementIsVisible;\n};\nconst isDisabled = element => {\n if (!element || element.nodeType !== Node.ELEMENT_NODE) {\n return true;\n }\n if (element.classList.contains('disabled')) {\n return true;\n }\n if (typeof element.disabled !== 'undefined') {\n return element.disabled;\n }\n return element.hasAttribute('disabled') && element.getAttribute('disabled') !== 'false';\n};\nconst findShadowRoot = element => {\n if (!document.documentElement.attachShadow) {\n return null;\n }\n\n // Can find the shadow root otherwise it'll return the document\n if (typeof element.getRootNode === 'function') {\n const root = element.getRootNode();\n return root instanceof ShadowRoot ? root : null;\n }\n if (element instanceof ShadowRoot) {\n return element;\n }\n\n // when we don't find a shadow root\n if (!element.parentNode) {\n return null;\n }\n return findShadowRoot(element.parentNode);\n};\nconst noop = () => {};\n\n/**\n * Trick to restart an element's animation\n *\n * @param {HTMLElement} element\n * @return void\n *\n * @see https://www.charistheo.io/blog/2021/02/restart-a-css-animation-with-javascript/#restarting-a-css-animation\n */\nconst reflow = element => {\n element.offsetHeight; // eslint-disable-line no-unused-expressions\n};\nconst getjQuery = () => {\n if (window.jQuery && !document.body.hasAttribute('data-bs-no-jquery')) {\n return window.jQuery;\n }\n return null;\n};\nconst DOMContentLoadedCallbacks = [];\nconst onDOMContentLoaded = callback => {\n if (document.readyState === 'loading') {\n // add listener on the first call when the document is in loading state\n if (!DOMContentLoadedCallbacks.length) {\n document.addEventListener('DOMContentLoaded', () => {\n for (const callback of DOMContentLoadedCallbacks) {\n callback();\n }\n });\n }\n DOMContentLoadedCallbacks.push(callback);\n } else {\n callback();\n }\n};\nconst isRTL = () => document.documentElement.dir === 'rtl';\nconst defineJQueryPlugin = plugin => {\n onDOMContentLoaded(() => {\n const $ = getjQuery();\n /* istanbul ignore if */\n if ($) {\n const name = plugin.NAME;\n const JQUERY_NO_CONFLICT = $.fn[name];\n $.fn[name] = plugin.jQueryInterface;\n $.fn[name].Constructor = plugin;\n $.fn[name].noConflict = () => {\n $.fn[name] = JQUERY_NO_CONFLICT;\n return plugin.jQueryInterface;\n };\n }\n });\n};\nconst execute = (possibleCallback, args = [], defaultValue = possibleCallback) => {\n return typeof possibleCallback === 'function' ? possibleCallback(...args) : defaultValue;\n};\nconst executeAfterTransition = (callback, transitionElement, waitForTransition = true) => {\n if (!waitForTransition) {\n execute(callback);\n return;\n }\n const durationPadding = 5;\n const emulatedDuration = getTransitionDurationFromElement(transitionElement) + durationPadding;\n let called = false;\n const handler = ({\n target\n }) => {\n if (target !== transitionElement) {\n return;\n }\n called = true;\n transitionElement.removeEventListener(TRANSITION_END, handler);\n execute(callback);\n };\n transitionElement.addEventListener(TRANSITION_END, handler);\n setTimeout(() => {\n if (!called) {\n triggerTransitionEnd(transitionElement);\n }\n }, emulatedDuration);\n};\n\n/**\n * Return the previous/next element of a list.\n *\n * @param {array} list The list of elements\n * @param activeElement The active element\n * @param shouldGetNext Choose to get next or previous element\n * @param isCycleAllowed\n * @return {Element|elem} The proper element\n */\nconst getNextActiveElement = (list, activeElement, shouldGetNext, isCycleAllowed) => {\n const listLength = list.length;\n let index = list.indexOf(activeElement);\n\n // if the element does not exist in the list return an element\n // depending on the direction and if cycle is allowed\n if (index === -1) {\n return !shouldGetNext && isCycleAllowed ? list[listLength - 1] : list[0];\n }\n index += shouldGetNext ? 1 : -1;\n if (isCycleAllowed) {\n index = (index + listLength) % listLength;\n }\n return list[Math.max(0, Math.min(index, listLength - 1))];\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/event-handler.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst namespaceRegex = /[^.]*(?=\\..*)\\.|.*/;\nconst stripNameRegex = /\\..*/;\nconst stripUidRegex = /::\\d+$/;\nconst eventRegistry = {}; // Events storage\nlet uidEvent = 1;\nconst customEvents = {\n mouseenter: 'mouseover',\n mouseleave: 'mouseout'\n};\nconst nativeEvents = new Set(['click', 'dblclick', 'mouseup', 'mousedown', 'contextmenu', 'mousewheel', 'DOMMouseScroll', 'mouseover', 'mouseout', 'mousemove', 'selectstart', 'selectend', 'keydown', 'keypress', 'keyup', 'orientationchange', 'touchstart', 'touchmove', 'touchend', 'touchcancel', 'pointerdown', 'pointermove', 'pointerup', 'pointerleave', 'pointercancel', 'gesturestart', 'gesturechange', 'gestureend', 'focus', 'blur', 'change', 'reset', 'select', 'submit', 'focusin', 'focusout', 'load', 'unload', 'beforeunload', 'resize', 'move', 'DOMContentLoaded', 'readystatechange', 'error', 'abort', 'scroll']);\n\n/**\n * Private methods\n */\n\nfunction makeEventUid(element, uid) {\n return uid && `${uid}::${uidEvent++}` || element.uidEvent || uidEvent++;\n}\nfunction getElementEvents(element) {\n const uid = makeEventUid(element);\n element.uidEvent = uid;\n eventRegistry[uid] = eventRegistry[uid] || {};\n return eventRegistry[uid];\n}\nfunction bootstrapHandler(element, fn) {\n return function handler(event) {\n hydrateObj(event, {\n delegateTarget: element\n });\n if (handler.oneOff) {\n EventHandler.off(element, event.type, fn);\n }\n return fn.apply(element, [event]);\n };\n}\nfunction bootstrapDelegationHandler(element, selector, fn) {\n return function handler(event) {\n const domElements = element.querySelectorAll(selector);\n for (let {\n target\n } = event; target && target !== this; target = target.parentNode) {\n for (const domElement of domElements) {\n if (domElement !== target) {\n continue;\n }\n hydrateObj(event, {\n delegateTarget: target\n });\n if (handler.oneOff) {\n EventHandler.off(element, event.type, selector, fn);\n }\n return fn.apply(target, [event]);\n }\n }\n };\n}\nfunction findHandler(events, callable, delegationSelector = null) {\n return Object.values(events).find(event => event.callable === callable && event.delegationSelector === delegationSelector);\n}\nfunction normalizeParameters(originalTypeEvent, handler, delegationFunction) {\n const isDelegated = typeof handler === 'string';\n // TODO: tooltip passes `false` instead of selector, so we need to check\n const callable = isDelegated ? delegationFunction : handler || delegationFunction;\n let typeEvent = getTypeEvent(originalTypeEvent);\n if (!nativeEvents.has(typeEvent)) {\n typeEvent = originalTypeEvent;\n }\n return [isDelegated, callable, typeEvent];\n}\nfunction addHandler(element, originalTypeEvent, handler, delegationFunction, oneOff) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n let [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n\n // in case of mouseenter or mouseleave wrap the handler within a function that checks for its DOM position\n // this prevents the handler from being dispatched the same way as mouseover or mouseout does\n if (originalTypeEvent in customEvents) {\n const wrapFunction = fn => {\n return function (event) {\n if (!event.relatedTarget || event.relatedTarget !== event.delegateTarget && !event.delegateTarget.contains(event.relatedTarget)) {\n return fn.call(this, event);\n }\n };\n };\n callable = wrapFunction(callable);\n }\n const events = getElementEvents(element);\n const handlers = events[typeEvent] || (events[typeEvent] = {});\n const previousFunction = findHandler(handlers, callable, isDelegated ? handler : null);\n if (previousFunction) {\n previousFunction.oneOff = previousFunction.oneOff && oneOff;\n return;\n }\n const uid = makeEventUid(callable, originalTypeEvent.replace(namespaceRegex, ''));\n const fn = isDelegated ? bootstrapDelegationHandler(element, handler, callable) : bootstrapHandler(element, callable);\n fn.delegationSelector = isDelegated ? handler : null;\n fn.callable = callable;\n fn.oneOff = oneOff;\n fn.uidEvent = uid;\n handlers[uid] = fn;\n element.addEventListener(typeEvent, fn, isDelegated);\n}\nfunction removeHandler(element, events, typeEvent, handler, delegationSelector) {\n const fn = findHandler(events[typeEvent], handler, delegationSelector);\n if (!fn) {\n return;\n }\n element.removeEventListener(typeEvent, fn, Boolean(delegationSelector));\n delete events[typeEvent][fn.uidEvent];\n}\nfunction removeNamespacedHandlers(element, events, typeEvent, namespace) {\n const storeElementEvent = events[typeEvent] || {};\n for (const [handlerKey, event] of Object.entries(storeElementEvent)) {\n if (handlerKey.includes(namespace)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n}\nfunction getTypeEvent(event) {\n // allow to get the native events from namespaced events ('click.bs.button' --> 'click')\n event = event.replace(stripNameRegex, '');\n return customEvents[event] || event;\n}\nconst EventHandler = {\n on(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, false);\n },\n one(element, event, handler, delegationFunction) {\n addHandler(element, event, handler, delegationFunction, true);\n },\n off(element, originalTypeEvent, handler, delegationFunction) {\n if (typeof originalTypeEvent !== 'string' || !element) {\n return;\n }\n const [isDelegated, callable, typeEvent] = normalizeParameters(originalTypeEvent, handler, delegationFunction);\n const inNamespace = typeEvent !== originalTypeEvent;\n const events = getElementEvents(element);\n const storeElementEvent = events[typeEvent] || {};\n const isNamespace = originalTypeEvent.startsWith('.');\n if (typeof callable !== 'undefined') {\n // Simplest case: handler is passed, remove that listener ONLY.\n if (!Object.keys(storeElementEvent).length) {\n return;\n }\n removeHandler(element, events, typeEvent, callable, isDelegated ? handler : null);\n return;\n }\n if (isNamespace) {\n for (const elementEvent of Object.keys(events)) {\n removeNamespacedHandlers(element, events, elementEvent, originalTypeEvent.slice(1));\n }\n }\n for (const [keyHandlers, event] of Object.entries(storeElementEvent)) {\n const handlerKey = keyHandlers.replace(stripUidRegex, '');\n if (!inNamespace || originalTypeEvent.includes(handlerKey)) {\n removeHandler(element, events, typeEvent, event.callable, event.delegationSelector);\n }\n }\n },\n trigger(element, event, args) {\n if (typeof event !== 'string' || !element) {\n return null;\n }\n const $ = getjQuery();\n const typeEvent = getTypeEvent(event);\n const inNamespace = event !== typeEvent;\n let jQueryEvent = null;\n let bubbles = true;\n let nativeDispatch = true;\n let defaultPrevented = false;\n if (inNamespace && $) {\n jQueryEvent = $.Event(event, args);\n $(element).trigger(jQueryEvent);\n bubbles = !jQueryEvent.isPropagationStopped();\n nativeDispatch = !jQueryEvent.isImmediatePropagationStopped();\n defaultPrevented = jQueryEvent.isDefaultPrevented();\n }\n const evt = hydrateObj(new Event(event, {\n bubbles,\n cancelable: true\n }), args);\n if (defaultPrevented) {\n evt.preventDefault();\n }\n if (nativeDispatch) {\n element.dispatchEvent(evt);\n }\n if (evt.defaultPrevented && jQueryEvent) {\n jQueryEvent.preventDefault();\n }\n return evt;\n }\n};\nfunction hydrateObj(obj, meta = {}) {\n for (const [key, value] of Object.entries(meta)) {\n try {\n obj[key] = value;\n } catch (_unused) {\n Object.defineProperty(obj, key, {\n configurable: true,\n get() {\n return value;\n }\n });\n }\n }\n return obj;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/manipulator.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nfunction normalizeData(value) {\n if (value === 'true') {\n return true;\n }\n if (value === 'false') {\n return false;\n }\n if (value === Number(value).toString()) {\n return Number(value);\n }\n if (value === '' || value === 'null') {\n return null;\n }\n if (typeof value !== 'string') {\n return value;\n }\n try {\n return JSON.parse(decodeURIComponent(value));\n } catch (_unused) {\n return value;\n }\n}\nfunction normalizeDataKey(key) {\n return key.replace(/[A-Z]/g, chr => `-${chr.toLowerCase()}`);\n}\nconst Manipulator = {\n setDataAttribute(element, key, value) {\n element.setAttribute(`data-bs-${normalizeDataKey(key)}`, value);\n },\n removeDataAttribute(element, key) {\n element.removeAttribute(`data-bs-${normalizeDataKey(key)}`);\n },\n getDataAttributes(element) {\n if (!element) {\n return {};\n }\n const attributes = {};\n const bsKeys = Object.keys(element.dataset).filter(key => key.startsWith('bs') && !key.startsWith('bsConfig'));\n for (const key of bsKeys) {\n let pureKey = key.replace(/^bs/, '');\n pureKey = pureKey.charAt(0).toLowerCase() + pureKey.slice(1, pureKey.length);\n attributes[pureKey] = normalizeData(element.dataset[key]);\n }\n return attributes;\n },\n getDataAttribute(element, key) {\n return normalizeData(element.getAttribute(`data-bs-${normalizeDataKey(key)}`));\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/config.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Class definition\n */\n\nclass Config {\n // Getters\n static get Default() {\n return {};\n }\n static get DefaultType() {\n return {};\n }\n static get NAME() {\n throw new Error('You have to implement the static method \"NAME\", for each component!');\n }\n _getConfig(config) {\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n _configAfterMerge(config) {\n return config;\n }\n _mergeConfigObj(config, element) {\n const jsonConfig = isElement(element) ? Manipulator.getDataAttribute(element, 'config') : {}; // try to parse\n\n return {\n ...this.constructor.Default,\n ...(typeof jsonConfig === 'object' ? jsonConfig : {}),\n ...(isElement(element) ? Manipulator.getDataAttributes(element) : {}),\n ...(typeof config === 'object' ? config : {})\n };\n }\n _typeCheckConfig(config, configTypes = this.constructor.DefaultType) {\n for (const [property, expectedTypes] of Object.entries(configTypes)) {\n const value = config[property];\n const valueType = isElement(value) ? 'element' : toType(value);\n if (!new RegExp(expectedTypes).test(valueType)) {\n throw new TypeError(`${this.constructor.NAME.toUpperCase()}: Option \"${property}\" provided type \"${valueType}\" but expected type \"${expectedTypes}\".`);\n }\n }\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap base-component.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst VERSION = '5.3.3';\n\n/**\n * Class definition\n */\n\nclass BaseComponent extends Config {\n constructor(element, config) {\n super();\n element = getElement(element);\n if (!element) {\n return;\n }\n this._element = element;\n this._config = this._getConfig(config);\n Data.set(this._element, this.constructor.DATA_KEY, this);\n }\n\n // Public\n dispose() {\n Data.remove(this._element, this.constructor.DATA_KEY);\n EventHandler.off(this._element, this.constructor.EVENT_KEY);\n for (const propertyName of Object.getOwnPropertyNames(this)) {\n this[propertyName] = null;\n }\n }\n _queueCallback(callback, element, isAnimated = true) {\n executeAfterTransition(callback, element, isAnimated);\n }\n _getConfig(config) {\n config = this._mergeConfigObj(config, this._element);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n\n // Static\n static getInstance(element) {\n return Data.get(getElement(element), this.DATA_KEY);\n }\n static getOrCreateInstance(element, config = {}) {\n return this.getInstance(element) || new this(element, typeof config === 'object' ? config : null);\n }\n static get VERSION() {\n return VERSION;\n }\n static get DATA_KEY() {\n return `bs.${this.NAME}`;\n }\n static get EVENT_KEY() {\n return `.${this.DATA_KEY}`;\n }\n static eventName(name) {\n return `${name}${this.EVENT_KEY}`;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dom/selector-engine.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst getSelector = element => {\n let selector = element.getAttribute('data-bs-target');\n if (!selector || selector === '#') {\n let hrefAttribute = element.getAttribute('href');\n\n // The only valid content that could double as a selector are IDs or classes,\n // so everything starting with `#` or `.`. If a \"real\" URL is used as the selector,\n // `document.querySelector` will rightfully complain it is invalid.\n // See https://github.com/twbs/bootstrap/issues/32273\n if (!hrefAttribute || !hrefAttribute.includes('#') && !hrefAttribute.startsWith('.')) {\n return null;\n }\n\n // Just in case some CMS puts out a full URL with the anchor appended\n if (hrefAttribute.includes('#') && !hrefAttribute.startsWith('#')) {\n hrefAttribute = `#${hrefAttribute.split('#')[1]}`;\n }\n selector = hrefAttribute && hrefAttribute !== '#' ? hrefAttribute.trim() : null;\n }\n return selector ? selector.split(',').map(sel => parseSelector(sel)).join(',') : null;\n};\nconst SelectorEngine = {\n find(selector, element = document.documentElement) {\n return [].concat(...Element.prototype.querySelectorAll.call(element, selector));\n },\n findOne(selector, element = document.documentElement) {\n return Element.prototype.querySelector.call(element, selector);\n },\n children(element, selector) {\n return [].concat(...element.children).filter(child => child.matches(selector));\n },\n parents(element, selector) {\n const parents = [];\n let ancestor = element.parentNode.closest(selector);\n while (ancestor) {\n parents.push(ancestor);\n ancestor = ancestor.parentNode.closest(selector);\n }\n return parents;\n },\n prev(element, selector) {\n let previous = element.previousElementSibling;\n while (previous) {\n if (previous.matches(selector)) {\n return [previous];\n }\n previous = previous.previousElementSibling;\n }\n return [];\n },\n // TODO: this is now unused; remove later along with prev()\n next(element, selector) {\n let next = element.nextElementSibling;\n while (next) {\n if (next.matches(selector)) {\n return [next];\n }\n next = next.nextElementSibling;\n }\n return [];\n },\n focusableChildren(element) {\n const focusables = ['a', 'button', 'input', 'textarea', 'select', 'details', '[tabindex]', '[contenteditable=\"true\"]'].map(selector => `${selector}:not([tabindex^=\"-\"])`).join(',');\n return this.find(focusables, element).filter(el => !isDisabled(el) && isVisible(el));\n },\n getSelectorFromElement(element) {\n const selector = getSelector(element);\n if (selector) {\n return SelectorEngine.findOne(selector) ? selector : null;\n }\n return null;\n },\n getElementFromSelector(element) {\n const selector = getSelector(element);\n return selector ? SelectorEngine.findOne(selector) : null;\n },\n getMultipleElementsFromSelector(element) {\n const selector = getSelector(element);\n return selector ? SelectorEngine.find(selector) : [];\n }\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/component-functions.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\nconst enableDismissTrigger = (component, method = 'hide') => {\n const clickEvent = `click.dismiss${component.EVENT_KEY}`;\n const name = component.NAME;\n EventHandler.on(document, clickEvent, `[data-bs-dismiss=\"${name}\"]`, function (event) {\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n if (isDisabled(this)) {\n return;\n }\n const target = SelectorEngine.getElementFromSelector(this) || this.closest(`.${name}`);\n const instance = component.getOrCreateInstance(target);\n\n // Method argument is left, for Alert and only, as it doesn't implement the 'hide' method\n instance[method]();\n });\n};\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap alert.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$f = 'alert';\nconst DATA_KEY$a = 'bs.alert';\nconst EVENT_KEY$b = `.${DATA_KEY$a}`;\nconst EVENT_CLOSE = `close${EVENT_KEY$b}`;\nconst EVENT_CLOSED = `closed${EVENT_KEY$b}`;\nconst CLASS_NAME_FADE$5 = 'fade';\nconst CLASS_NAME_SHOW$8 = 'show';\n\n/**\n * Class definition\n */\n\nclass Alert extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$f;\n }\n\n // Public\n close() {\n const closeEvent = EventHandler.trigger(this._element, EVENT_CLOSE);\n if (closeEvent.defaultPrevented) {\n return;\n }\n this._element.classList.remove(CLASS_NAME_SHOW$8);\n const isAnimated = this._element.classList.contains(CLASS_NAME_FADE$5);\n this._queueCallback(() => this._destroyElement(), this._element, isAnimated);\n }\n\n // Private\n _destroyElement() {\n this._element.remove();\n EventHandler.trigger(this._element, EVENT_CLOSED);\n this.dispose();\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Alert.getOrCreateInstance(this);\n if (typeof config !== 'string') {\n return;\n }\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](this);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nenableDismissTrigger(Alert, 'close');\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Alert);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap button.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$e = 'button';\nconst DATA_KEY$9 = 'bs.button';\nconst EVENT_KEY$a = `.${DATA_KEY$9}`;\nconst DATA_API_KEY$6 = '.data-api';\nconst CLASS_NAME_ACTIVE$3 = 'active';\nconst SELECTOR_DATA_TOGGLE$5 = '[data-bs-toggle=\"button\"]';\nconst EVENT_CLICK_DATA_API$6 = `click${EVENT_KEY$a}${DATA_API_KEY$6}`;\n\n/**\n * Class definition\n */\n\nclass Button extends BaseComponent {\n // Getters\n static get NAME() {\n return NAME$e;\n }\n\n // Public\n toggle() {\n // Toggle class and sync the `aria-pressed` attribute with the return value of the `.toggle()` method\n this._element.setAttribute('aria-pressed', this._element.classList.toggle(CLASS_NAME_ACTIVE$3));\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Button.getOrCreateInstance(this);\n if (config === 'toggle') {\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$6, SELECTOR_DATA_TOGGLE$5, event => {\n event.preventDefault();\n const button = event.target.closest(SELECTOR_DATA_TOGGLE$5);\n const data = Button.getOrCreateInstance(button);\n data.toggle();\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Button);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/swipe.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$d = 'swipe';\nconst EVENT_KEY$9 = '.bs.swipe';\nconst EVENT_TOUCHSTART = `touchstart${EVENT_KEY$9}`;\nconst EVENT_TOUCHMOVE = `touchmove${EVENT_KEY$9}`;\nconst EVENT_TOUCHEND = `touchend${EVENT_KEY$9}`;\nconst EVENT_POINTERDOWN = `pointerdown${EVENT_KEY$9}`;\nconst EVENT_POINTERUP = `pointerup${EVENT_KEY$9}`;\nconst POINTER_TYPE_TOUCH = 'touch';\nconst POINTER_TYPE_PEN = 'pen';\nconst CLASS_NAME_POINTER_EVENT = 'pointer-event';\nconst SWIPE_THRESHOLD = 40;\nconst Default$c = {\n endCallback: null,\n leftCallback: null,\n rightCallback: null\n};\nconst DefaultType$c = {\n endCallback: '(function|null)',\n leftCallback: '(function|null)',\n rightCallback: '(function|null)'\n};\n\n/**\n * Class definition\n */\n\nclass Swipe extends Config {\n constructor(element, config) {\n super();\n this._element = element;\n if (!element || !Swipe.isSupported()) {\n return;\n }\n this._config = this._getConfig(config);\n this._deltaX = 0;\n this._supportPointerEvents = Boolean(window.PointerEvent);\n this._initEvents();\n }\n\n // Getters\n static get Default() {\n return Default$c;\n }\n static get DefaultType() {\n return DefaultType$c;\n }\n static get NAME() {\n return NAME$d;\n }\n\n // Public\n dispose() {\n EventHandler.off(this._element, EVENT_KEY$9);\n }\n\n // Private\n _start(event) {\n if (!this._supportPointerEvents) {\n this._deltaX = event.touches[0].clientX;\n return;\n }\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX;\n }\n }\n _end(event) {\n if (this._eventIsPointerPenTouch(event)) {\n this._deltaX = event.clientX - this._deltaX;\n }\n this._handleSwipe();\n execute(this._config.endCallback);\n }\n _move(event) {\n this._deltaX = event.touches && event.touches.length > 1 ? 0 : event.touches[0].clientX - this._deltaX;\n }\n _handleSwipe() {\n const absDeltaX = Math.abs(this._deltaX);\n if (absDeltaX <= SWIPE_THRESHOLD) {\n return;\n }\n const direction = absDeltaX / this._deltaX;\n this._deltaX = 0;\n if (!direction) {\n return;\n }\n execute(direction > 0 ? this._config.rightCallback : this._config.leftCallback);\n }\n _initEvents() {\n if (this._supportPointerEvents) {\n EventHandler.on(this._element, EVENT_POINTERDOWN, event => this._start(event));\n EventHandler.on(this._element, EVENT_POINTERUP, event => this._end(event));\n this._element.classList.add(CLASS_NAME_POINTER_EVENT);\n } else {\n EventHandler.on(this._element, EVENT_TOUCHSTART, event => this._start(event));\n EventHandler.on(this._element, EVENT_TOUCHMOVE, event => this._move(event));\n EventHandler.on(this._element, EVENT_TOUCHEND, event => this._end(event));\n }\n }\n _eventIsPointerPenTouch(event) {\n return this._supportPointerEvents && (event.pointerType === POINTER_TYPE_PEN || event.pointerType === POINTER_TYPE_TOUCH);\n }\n\n // Static\n static isSupported() {\n return 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap carousel.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$c = 'carousel';\nconst DATA_KEY$8 = 'bs.carousel';\nconst EVENT_KEY$8 = `.${DATA_KEY$8}`;\nconst DATA_API_KEY$5 = '.data-api';\nconst ARROW_LEFT_KEY$1 = 'ArrowLeft';\nconst ARROW_RIGHT_KEY$1 = 'ArrowRight';\nconst TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch\n\nconst ORDER_NEXT = 'next';\nconst ORDER_PREV = 'prev';\nconst DIRECTION_LEFT = 'left';\nconst DIRECTION_RIGHT = 'right';\nconst EVENT_SLIDE = `slide${EVENT_KEY$8}`;\nconst EVENT_SLID = `slid${EVENT_KEY$8}`;\nconst EVENT_KEYDOWN$1 = `keydown${EVENT_KEY$8}`;\nconst EVENT_MOUSEENTER$1 = `mouseenter${EVENT_KEY$8}`;\nconst EVENT_MOUSELEAVE$1 = `mouseleave${EVENT_KEY$8}`;\nconst EVENT_DRAG_START = `dragstart${EVENT_KEY$8}`;\nconst EVENT_LOAD_DATA_API$3 = `load${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst EVENT_CLICK_DATA_API$5 = `click${EVENT_KEY$8}${DATA_API_KEY$5}`;\nconst CLASS_NAME_CAROUSEL = 'carousel';\nconst CLASS_NAME_ACTIVE$2 = 'active';\nconst CLASS_NAME_SLIDE = 'slide';\nconst CLASS_NAME_END = 'carousel-item-end';\nconst CLASS_NAME_START = 'carousel-item-start';\nconst CLASS_NAME_NEXT = 'carousel-item-next';\nconst CLASS_NAME_PREV = 'carousel-item-prev';\nconst SELECTOR_ACTIVE = '.active';\nconst SELECTOR_ITEM = '.carousel-item';\nconst SELECTOR_ACTIVE_ITEM = SELECTOR_ACTIVE + SELECTOR_ITEM;\nconst SELECTOR_ITEM_IMG = '.carousel-item img';\nconst SELECTOR_INDICATORS = '.carousel-indicators';\nconst SELECTOR_DATA_SLIDE = '[data-bs-slide], [data-bs-slide-to]';\nconst SELECTOR_DATA_RIDE = '[data-bs-ride=\"carousel\"]';\nconst KEY_TO_DIRECTION = {\n [ARROW_LEFT_KEY$1]: DIRECTION_RIGHT,\n [ARROW_RIGHT_KEY$1]: DIRECTION_LEFT\n};\nconst Default$b = {\n interval: 5000,\n keyboard: true,\n pause: 'hover',\n ride: false,\n touch: true,\n wrap: true\n};\nconst DefaultType$b = {\n interval: '(number|boolean)',\n // TODO:v6 remove boolean support\n keyboard: 'boolean',\n pause: '(string|boolean)',\n ride: '(boolean|string)',\n touch: 'boolean',\n wrap: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Carousel extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._interval = null;\n this._activeElement = null;\n this._isSliding = false;\n this.touchTimeout = null;\n this._swipeHelper = null;\n this._indicatorsElement = SelectorEngine.findOne(SELECTOR_INDICATORS, this._element);\n this._addEventListeners();\n if (this._config.ride === CLASS_NAME_CAROUSEL) {\n this.cycle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$b;\n }\n static get DefaultType() {\n return DefaultType$b;\n }\n static get NAME() {\n return NAME$c;\n }\n\n // Public\n next() {\n this._slide(ORDER_NEXT);\n }\n nextWhenVisible() {\n // FIXME TODO use `document.visibilityState`\n // Don't call next when the page isn't visible\n // or the carousel or its parent isn't visible\n if (!document.hidden && isVisible(this._element)) {\n this.next();\n }\n }\n prev() {\n this._slide(ORDER_PREV);\n }\n pause() {\n if (this._isSliding) {\n triggerTransitionEnd(this._element);\n }\n this._clearInterval();\n }\n cycle() {\n this._clearInterval();\n this._updateInterval();\n this._interval = setInterval(() => this.nextWhenVisible(), this._config.interval);\n }\n _maybeEnableCycle() {\n if (!this._config.ride) {\n return;\n }\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.cycle());\n return;\n }\n this.cycle();\n }\n to(index) {\n const items = this._getItems();\n if (index > items.length - 1 || index < 0) {\n return;\n }\n if (this._isSliding) {\n EventHandler.one(this._element, EVENT_SLID, () => this.to(index));\n return;\n }\n const activeIndex = this._getItemIndex(this._getActive());\n if (activeIndex === index) {\n return;\n }\n const order = index > activeIndex ? ORDER_NEXT : ORDER_PREV;\n this._slide(order, items[index]);\n }\n dispose() {\n if (this._swipeHelper) {\n this._swipeHelper.dispose();\n }\n super.dispose();\n }\n\n // Private\n _configAfterMerge(config) {\n config.defaultInterval = config.interval;\n return config;\n }\n _addEventListeners() {\n if (this._config.keyboard) {\n EventHandler.on(this._element, EVENT_KEYDOWN$1, event => this._keydown(event));\n }\n if (this._config.pause === 'hover') {\n EventHandler.on(this._element, EVENT_MOUSEENTER$1, () => this.pause());\n EventHandler.on(this._element, EVENT_MOUSELEAVE$1, () => this._maybeEnableCycle());\n }\n if (this._config.touch && Swipe.isSupported()) {\n this._addTouchEventListeners();\n }\n }\n _addTouchEventListeners() {\n for (const img of SelectorEngine.find(SELECTOR_ITEM_IMG, this._element)) {\n EventHandler.on(img, EVENT_DRAG_START, event => event.preventDefault());\n }\n const endCallBack = () => {\n if (this._config.pause !== 'hover') {\n return;\n }\n\n // If it's a touch-enabled device, mouseenter/leave are fired as\n // part of the mouse compatibility events on first tap - the carousel\n // would stop cycling until user tapped out of it;\n // here, we listen for touchend, explicitly pause the carousel\n // (as if it's the second time we tap on it, mouseenter compat event\n // is NOT fired) and after a timeout (to allow for mouse compatibility\n // events to fire) we explicitly restart cycling\n\n this.pause();\n if (this.touchTimeout) {\n clearTimeout(this.touchTimeout);\n }\n this.touchTimeout = setTimeout(() => this._maybeEnableCycle(), TOUCHEVENT_COMPAT_WAIT + this._config.interval);\n };\n const swipeConfig = {\n leftCallback: () => this._slide(this._directionToOrder(DIRECTION_LEFT)),\n rightCallback: () => this._slide(this._directionToOrder(DIRECTION_RIGHT)),\n endCallback: endCallBack\n };\n this._swipeHelper = new Swipe(this._element, swipeConfig);\n }\n _keydown(event) {\n if (/input|textarea/i.test(event.target.tagName)) {\n return;\n }\n const direction = KEY_TO_DIRECTION[event.key];\n if (direction) {\n event.preventDefault();\n this._slide(this._directionToOrder(direction));\n }\n }\n _getItemIndex(element) {\n return this._getItems().indexOf(element);\n }\n _setActiveIndicatorElement(index) {\n if (!this._indicatorsElement) {\n return;\n }\n const activeIndicator = SelectorEngine.findOne(SELECTOR_ACTIVE, this._indicatorsElement);\n activeIndicator.classList.remove(CLASS_NAME_ACTIVE$2);\n activeIndicator.removeAttribute('aria-current');\n const newActiveIndicator = SelectorEngine.findOne(`[data-bs-slide-to=\"${index}\"]`, this._indicatorsElement);\n if (newActiveIndicator) {\n newActiveIndicator.classList.add(CLASS_NAME_ACTIVE$2);\n newActiveIndicator.setAttribute('aria-current', 'true');\n }\n }\n _updateInterval() {\n const element = this._activeElement || this._getActive();\n if (!element) {\n return;\n }\n const elementInterval = Number.parseInt(element.getAttribute('data-bs-interval'), 10);\n this._config.interval = elementInterval || this._config.defaultInterval;\n }\n _slide(order, element = null) {\n if (this._isSliding) {\n return;\n }\n const activeElement = this._getActive();\n const isNext = order === ORDER_NEXT;\n const nextElement = element || getNextActiveElement(this._getItems(), activeElement, isNext, this._config.wrap);\n if (nextElement === activeElement) {\n return;\n }\n const nextElementIndex = this._getItemIndex(nextElement);\n const triggerEvent = eventName => {\n return EventHandler.trigger(this._element, eventName, {\n relatedTarget: nextElement,\n direction: this._orderToDirection(order),\n from: this._getItemIndex(activeElement),\n to: nextElementIndex\n });\n };\n const slideEvent = triggerEvent(EVENT_SLIDE);\n if (slideEvent.defaultPrevented) {\n return;\n }\n if (!activeElement || !nextElement) {\n // Some weirdness is happening, so we bail\n // TODO: change tests that use empty divs to avoid this check\n return;\n }\n const isCycling = Boolean(this._interval);\n this.pause();\n this._isSliding = true;\n this._setActiveIndicatorElement(nextElementIndex);\n this._activeElement = nextElement;\n const directionalClassName = isNext ? CLASS_NAME_START : CLASS_NAME_END;\n const orderClassName = isNext ? CLASS_NAME_NEXT : CLASS_NAME_PREV;\n nextElement.classList.add(orderClassName);\n reflow(nextElement);\n activeElement.classList.add(directionalClassName);\n nextElement.classList.add(directionalClassName);\n const completeCallBack = () => {\n nextElement.classList.remove(directionalClassName, orderClassName);\n nextElement.classList.add(CLASS_NAME_ACTIVE$2);\n activeElement.classList.remove(CLASS_NAME_ACTIVE$2, orderClassName, directionalClassName);\n this._isSliding = false;\n triggerEvent(EVENT_SLID);\n };\n this._queueCallback(completeCallBack, activeElement, this._isAnimated());\n if (isCycling) {\n this.cycle();\n }\n }\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_SLIDE);\n }\n _getActive() {\n return SelectorEngine.findOne(SELECTOR_ACTIVE_ITEM, this._element);\n }\n _getItems() {\n return SelectorEngine.find(SELECTOR_ITEM, this._element);\n }\n _clearInterval() {\n if (this._interval) {\n clearInterval(this._interval);\n this._interval = null;\n }\n }\n _directionToOrder(direction) {\n if (isRTL()) {\n return direction === DIRECTION_LEFT ? ORDER_PREV : ORDER_NEXT;\n }\n return direction === DIRECTION_LEFT ? ORDER_NEXT : ORDER_PREV;\n }\n _orderToDirection(order) {\n if (isRTL()) {\n return order === ORDER_PREV ? DIRECTION_LEFT : DIRECTION_RIGHT;\n }\n return order === ORDER_PREV ? DIRECTION_RIGHT : DIRECTION_LEFT;\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Carousel.getOrCreateInstance(this, config);\n if (typeof config === 'number') {\n data.to(config);\n return;\n }\n if (typeof config === 'string') {\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$5, SELECTOR_DATA_SLIDE, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (!target || !target.classList.contains(CLASS_NAME_CAROUSEL)) {\n return;\n }\n event.preventDefault();\n const carousel = Carousel.getOrCreateInstance(target);\n const slideIndex = this.getAttribute('data-bs-slide-to');\n if (slideIndex) {\n carousel.to(slideIndex);\n carousel._maybeEnableCycle();\n return;\n }\n if (Manipulator.getDataAttribute(this, 'slide') === 'next') {\n carousel.next();\n carousel._maybeEnableCycle();\n return;\n }\n carousel.prev();\n carousel._maybeEnableCycle();\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$3, () => {\n const carousels = SelectorEngine.find(SELECTOR_DATA_RIDE);\n for (const carousel of carousels) {\n Carousel.getOrCreateInstance(carousel);\n }\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Carousel);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap collapse.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$b = 'collapse';\nconst DATA_KEY$7 = 'bs.collapse';\nconst EVENT_KEY$7 = `.${DATA_KEY$7}`;\nconst DATA_API_KEY$4 = '.data-api';\nconst EVENT_SHOW$6 = `show${EVENT_KEY$7}`;\nconst EVENT_SHOWN$6 = `shown${EVENT_KEY$7}`;\nconst EVENT_HIDE$6 = `hide${EVENT_KEY$7}`;\nconst EVENT_HIDDEN$6 = `hidden${EVENT_KEY$7}`;\nconst EVENT_CLICK_DATA_API$4 = `click${EVENT_KEY$7}${DATA_API_KEY$4}`;\nconst CLASS_NAME_SHOW$7 = 'show';\nconst CLASS_NAME_COLLAPSE = 'collapse';\nconst CLASS_NAME_COLLAPSING = 'collapsing';\nconst CLASS_NAME_COLLAPSED = 'collapsed';\nconst CLASS_NAME_DEEPER_CHILDREN = `:scope .${CLASS_NAME_COLLAPSE} .${CLASS_NAME_COLLAPSE}`;\nconst CLASS_NAME_HORIZONTAL = 'collapse-horizontal';\nconst WIDTH = 'width';\nconst HEIGHT = 'height';\nconst SELECTOR_ACTIVES = '.collapse.show, .collapse.collapsing';\nconst SELECTOR_DATA_TOGGLE$4 = '[data-bs-toggle=\"collapse\"]';\nconst Default$a = {\n parent: null,\n toggle: true\n};\nconst DefaultType$a = {\n parent: '(null|element)',\n toggle: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Collapse extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isTransitioning = false;\n this._triggerArray = [];\n const toggleList = SelectorEngine.find(SELECTOR_DATA_TOGGLE$4);\n for (const elem of toggleList) {\n const selector = SelectorEngine.getSelectorFromElement(elem);\n const filterElement = SelectorEngine.find(selector).filter(foundElement => foundElement === this._element);\n if (selector !== null && filterElement.length) {\n this._triggerArray.push(elem);\n }\n }\n this._initializeChildren();\n if (!this._config.parent) {\n this._addAriaAndCollapsedClass(this._triggerArray, this._isShown());\n }\n if (this._config.toggle) {\n this.toggle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$a;\n }\n static get DefaultType() {\n return DefaultType$a;\n }\n static get NAME() {\n return NAME$b;\n }\n\n // Public\n toggle() {\n if (this._isShown()) {\n this.hide();\n } else {\n this.show();\n }\n }\n show() {\n if (this._isTransitioning || this._isShown()) {\n return;\n }\n let activeChildren = [];\n\n // find active children\n if (this._config.parent) {\n activeChildren = this._getFirstLevelChildren(SELECTOR_ACTIVES).filter(element => element !== this._element).map(element => Collapse.getOrCreateInstance(element, {\n toggle: false\n }));\n }\n if (activeChildren.length && activeChildren[0]._isTransitioning) {\n return;\n }\n const startEvent = EventHandler.trigger(this._element, EVENT_SHOW$6);\n if (startEvent.defaultPrevented) {\n return;\n }\n for (const activeInstance of activeChildren) {\n activeInstance.hide();\n }\n const dimension = this._getDimension();\n this._element.classList.remove(CLASS_NAME_COLLAPSE);\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n this._element.style[dimension] = 0;\n this._addAriaAndCollapsedClass(this._triggerArray, true);\n this._isTransitioning = true;\n const complete = () => {\n this._isTransitioning = false;\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n this._element.classList.add(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n this._element.style[dimension] = '';\n EventHandler.trigger(this._element, EVENT_SHOWN$6);\n };\n const capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1);\n const scrollSize = `scroll${capitalizedDimension}`;\n this._queueCallback(complete, this._element, true);\n this._element.style[dimension] = `${this._element[scrollSize]}px`;\n }\n hide() {\n if (this._isTransitioning || !this._isShown()) {\n return;\n }\n const startEvent = EventHandler.trigger(this._element, EVENT_HIDE$6);\n if (startEvent.defaultPrevented) {\n return;\n }\n const dimension = this._getDimension();\n this._element.style[dimension] = `${this._element.getBoundingClientRect()[dimension]}px`;\n reflow(this._element);\n this._element.classList.add(CLASS_NAME_COLLAPSING);\n this._element.classList.remove(CLASS_NAME_COLLAPSE, CLASS_NAME_SHOW$7);\n for (const trigger of this._triggerArray) {\n const element = SelectorEngine.getElementFromSelector(trigger);\n if (element && !this._isShown(element)) {\n this._addAriaAndCollapsedClass([trigger], false);\n }\n }\n this._isTransitioning = true;\n const complete = () => {\n this._isTransitioning = false;\n this._element.classList.remove(CLASS_NAME_COLLAPSING);\n this._element.classList.add(CLASS_NAME_COLLAPSE);\n EventHandler.trigger(this._element, EVENT_HIDDEN$6);\n };\n this._element.style[dimension] = '';\n this._queueCallback(complete, this._element, true);\n }\n _isShown(element = this._element) {\n return element.classList.contains(CLASS_NAME_SHOW$7);\n }\n\n // Private\n _configAfterMerge(config) {\n config.toggle = Boolean(config.toggle); // Coerce string values\n config.parent = getElement(config.parent);\n return config;\n }\n _getDimension() {\n return this._element.classList.contains(CLASS_NAME_HORIZONTAL) ? WIDTH : HEIGHT;\n }\n _initializeChildren() {\n if (!this._config.parent) {\n return;\n }\n const children = this._getFirstLevelChildren(SELECTOR_DATA_TOGGLE$4);\n for (const element of children) {\n const selected = SelectorEngine.getElementFromSelector(element);\n if (selected) {\n this._addAriaAndCollapsedClass([element], this._isShown(selected));\n }\n }\n }\n _getFirstLevelChildren(selector) {\n const children = SelectorEngine.find(CLASS_NAME_DEEPER_CHILDREN, this._config.parent);\n // remove children if greater depth\n return SelectorEngine.find(selector, this._config.parent).filter(element => !children.includes(element));\n }\n _addAriaAndCollapsedClass(triggerArray, isOpen) {\n if (!triggerArray.length) {\n return;\n }\n for (const element of triggerArray) {\n element.classList.toggle(CLASS_NAME_COLLAPSED, !isOpen);\n element.setAttribute('aria-expanded', isOpen);\n }\n }\n\n // Static\n static jQueryInterface(config) {\n const _config = {};\n if (typeof config === 'string' && /show|hide/.test(config)) {\n _config.toggle = false;\n }\n return this.each(function () {\n const data = Collapse.getOrCreateInstance(this, _config);\n if (typeof config === 'string') {\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n }\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$4, SELECTOR_DATA_TOGGLE$4, function (event) {\n // preventDefault only for elements (which change the URL) not inside the collapsible element\n if (event.target.tagName === 'A' || event.delegateTarget && event.delegateTarget.tagName === 'A') {\n event.preventDefault();\n }\n for (const element of SelectorEngine.getMultipleElementsFromSelector(this)) {\n Collapse.getOrCreateInstance(element, {\n toggle: false\n }).toggle();\n }\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Collapse);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap dropdown.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$a = 'dropdown';\nconst DATA_KEY$6 = 'bs.dropdown';\nconst EVENT_KEY$6 = `.${DATA_KEY$6}`;\nconst DATA_API_KEY$3 = '.data-api';\nconst ESCAPE_KEY$2 = 'Escape';\nconst TAB_KEY$1 = 'Tab';\nconst ARROW_UP_KEY$1 = 'ArrowUp';\nconst ARROW_DOWN_KEY$1 = 'ArrowDown';\nconst RIGHT_MOUSE_BUTTON = 2; // MouseEvent.button value for the secondary button, usually the right button\n\nconst EVENT_HIDE$5 = `hide${EVENT_KEY$6}`;\nconst EVENT_HIDDEN$5 = `hidden${EVENT_KEY$6}`;\nconst EVENT_SHOW$5 = `show${EVENT_KEY$6}`;\nconst EVENT_SHOWN$5 = `shown${EVENT_KEY$6}`;\nconst EVENT_CLICK_DATA_API$3 = `click${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYDOWN_DATA_API = `keydown${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst EVENT_KEYUP_DATA_API = `keyup${EVENT_KEY$6}${DATA_API_KEY$3}`;\nconst CLASS_NAME_SHOW$6 = 'show';\nconst CLASS_NAME_DROPUP = 'dropup';\nconst CLASS_NAME_DROPEND = 'dropend';\nconst CLASS_NAME_DROPSTART = 'dropstart';\nconst CLASS_NAME_DROPUP_CENTER = 'dropup-center';\nconst CLASS_NAME_DROPDOWN_CENTER = 'dropdown-center';\nconst SELECTOR_DATA_TOGGLE$3 = '[data-bs-toggle=\"dropdown\"]:not(.disabled):not(:disabled)';\nconst SELECTOR_DATA_TOGGLE_SHOWN = `${SELECTOR_DATA_TOGGLE$3}.${CLASS_NAME_SHOW$6}`;\nconst SELECTOR_MENU = '.dropdown-menu';\nconst SELECTOR_NAVBAR = '.navbar';\nconst SELECTOR_NAVBAR_NAV = '.navbar-nav';\nconst SELECTOR_VISIBLE_ITEMS = '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)';\nconst PLACEMENT_TOP = isRTL() ? 'top-end' : 'top-start';\nconst PLACEMENT_TOPEND = isRTL() ? 'top-start' : 'top-end';\nconst PLACEMENT_BOTTOM = isRTL() ? 'bottom-end' : 'bottom-start';\nconst PLACEMENT_BOTTOMEND = isRTL() ? 'bottom-start' : 'bottom-end';\nconst PLACEMENT_RIGHT = isRTL() ? 'left-start' : 'right-start';\nconst PLACEMENT_LEFT = isRTL() ? 'right-start' : 'left-start';\nconst PLACEMENT_TOPCENTER = 'top';\nconst PLACEMENT_BOTTOMCENTER = 'bottom';\nconst Default$9 = {\n autoClose: true,\n boundary: 'clippingParents',\n display: 'dynamic',\n offset: [0, 2],\n popperConfig: null,\n reference: 'toggle'\n};\nconst DefaultType$9 = {\n autoClose: '(boolean|string)',\n boundary: '(string|element)',\n display: 'string',\n offset: '(array|string|function)',\n popperConfig: '(null|object|function)',\n reference: '(string|element|object)'\n};\n\n/**\n * Class definition\n */\n\nclass Dropdown extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._popper = null;\n this._parent = this._element.parentNode; // dropdown wrapper\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n this._menu = SelectorEngine.next(this._element, SELECTOR_MENU)[0] || SelectorEngine.prev(this._element, SELECTOR_MENU)[0] || SelectorEngine.findOne(SELECTOR_MENU, this._parent);\n this._inNavbar = this._detectNavbar();\n }\n\n // Getters\n static get Default() {\n return Default$9;\n }\n static get DefaultType() {\n return DefaultType$9;\n }\n static get NAME() {\n return NAME$a;\n }\n\n // Public\n toggle() {\n return this._isShown() ? this.hide() : this.show();\n }\n show() {\n if (isDisabled(this._element) || this._isShown()) {\n return;\n }\n const relatedTarget = {\n relatedTarget: this._element\n };\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$5, relatedTarget);\n if (showEvent.defaultPrevented) {\n return;\n }\n this._createPopper();\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement && !this._parent.closest(SELECTOR_NAVBAR_NAV)) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n this._element.focus();\n this._element.setAttribute('aria-expanded', true);\n this._menu.classList.add(CLASS_NAME_SHOW$6);\n this._element.classList.add(CLASS_NAME_SHOW$6);\n EventHandler.trigger(this._element, EVENT_SHOWN$5, relatedTarget);\n }\n hide() {\n if (isDisabled(this._element) || !this._isShown()) {\n return;\n }\n const relatedTarget = {\n relatedTarget: this._element\n };\n this._completeHide(relatedTarget);\n }\n dispose() {\n if (this._popper) {\n this._popper.destroy();\n }\n super.dispose();\n }\n update() {\n this._inNavbar = this._detectNavbar();\n if (this._popper) {\n this._popper.update();\n }\n }\n\n // Private\n _completeHide(relatedTarget) {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$5, relatedTarget);\n if (hideEvent.defaultPrevented) {\n return;\n }\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n if (this._popper) {\n this._popper.destroy();\n }\n this._menu.classList.remove(CLASS_NAME_SHOW$6);\n this._element.classList.remove(CLASS_NAME_SHOW$6);\n this._element.setAttribute('aria-expanded', 'false');\n Manipulator.removeDataAttribute(this._menu, 'popper');\n EventHandler.trigger(this._element, EVENT_HIDDEN$5, relatedTarget);\n }\n _getConfig(config) {\n config = super._getConfig(config);\n if (typeof config.reference === 'object' && !isElement(config.reference) && typeof config.reference.getBoundingClientRect !== 'function') {\n // Popper virtual elements require a getBoundingClientRect method\n throw new TypeError(`${NAME$a.toUpperCase()}: Option \"reference\" provided type \"object\" without a required \"getBoundingClientRect\" method.`);\n }\n return config;\n }\n _createPopper() {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s dropdowns require Popper (https://popper.js.org)');\n }\n let referenceElement = this._element;\n if (this._config.reference === 'parent') {\n referenceElement = this._parent;\n } else if (isElement(this._config.reference)) {\n referenceElement = getElement(this._config.reference);\n } else if (typeof this._config.reference === 'object') {\n referenceElement = this._config.reference;\n }\n const popperConfig = this._getPopperConfig();\n this._popper = Popper.createPopper(referenceElement, this._menu, popperConfig);\n }\n _isShown() {\n return this._menu.classList.contains(CLASS_NAME_SHOW$6);\n }\n _getPlacement() {\n const parentDropdown = this._parent;\n if (parentDropdown.classList.contains(CLASS_NAME_DROPEND)) {\n return PLACEMENT_RIGHT;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPSTART)) {\n return PLACEMENT_LEFT;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP_CENTER)) {\n return PLACEMENT_TOPCENTER;\n }\n if (parentDropdown.classList.contains(CLASS_NAME_DROPDOWN_CENTER)) {\n return PLACEMENT_BOTTOMCENTER;\n }\n\n // We need to trim the value because custom properties can also include spaces\n const isEnd = getComputedStyle(this._menu).getPropertyValue('--bs-position').trim() === 'end';\n if (parentDropdown.classList.contains(CLASS_NAME_DROPUP)) {\n return isEnd ? PLACEMENT_TOPEND : PLACEMENT_TOP;\n }\n return isEnd ? PLACEMENT_BOTTOMEND : PLACEMENT_BOTTOM;\n }\n _detectNavbar() {\n return this._element.closest(SELECTOR_NAVBAR) !== null;\n }\n _getOffset() {\n const {\n offset\n } = this._config;\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n return offset;\n }\n _getPopperConfig() {\n const defaultBsPopperConfig = {\n placement: this._getPlacement(),\n modifiers: [{\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }]\n };\n\n // Disable Popper if we have a static display or Dropdown is in Navbar\n if (this._inNavbar || this._config.display === 'static') {\n Manipulator.setDataAttribute(this._menu, 'popper', 'static'); // TODO: v6 remove\n defaultBsPopperConfig.modifiers = [{\n name: 'applyStyles',\n enabled: false\n }];\n }\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n };\n }\n _selectMenuItem({\n key,\n target\n }) {\n const items = SelectorEngine.find(SELECTOR_VISIBLE_ITEMS, this._menu).filter(element => isVisible(element));\n if (!items.length) {\n return;\n }\n\n // if target isn't included in items (e.g. when expanding the dropdown)\n // allow cycling to get the last item in case key equals ARROW_UP_KEY\n getNextActiveElement(items, target, key === ARROW_DOWN_KEY$1, !items.includes(target)).focus();\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Dropdown.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n static clearMenus(event) {\n if (event.button === RIGHT_MOUSE_BUTTON || event.type === 'keyup' && event.key !== TAB_KEY$1) {\n return;\n }\n const openToggles = SelectorEngine.find(SELECTOR_DATA_TOGGLE_SHOWN);\n for (const toggle of openToggles) {\n const context = Dropdown.getInstance(toggle);\n if (!context || context._config.autoClose === false) {\n continue;\n }\n const composedPath = event.composedPath();\n const isMenuTarget = composedPath.includes(context._menu);\n if (composedPath.includes(context._element) || context._config.autoClose === 'inside' && !isMenuTarget || context._config.autoClose === 'outside' && isMenuTarget) {\n continue;\n }\n\n // Tab navigation through the dropdown menu or events from contained inputs shouldn't close the menu\n if (context._menu.contains(event.target) && (event.type === 'keyup' && event.key === TAB_KEY$1 || /input|select|option|textarea|form/i.test(event.target.tagName))) {\n continue;\n }\n const relatedTarget = {\n relatedTarget: context._element\n };\n if (event.type === 'click') {\n relatedTarget.clickEvent = event;\n }\n context._completeHide(relatedTarget);\n }\n }\n static dataApiKeydownHandler(event) {\n // If not an UP | DOWN | ESCAPE key => not a dropdown command\n // If input/textarea && if key is other than ESCAPE => not a dropdown command\n\n const isInput = /input|textarea/i.test(event.target.tagName);\n const isEscapeEvent = event.key === ESCAPE_KEY$2;\n const isUpOrDownEvent = [ARROW_UP_KEY$1, ARROW_DOWN_KEY$1].includes(event.key);\n if (!isUpOrDownEvent && !isEscapeEvent) {\n return;\n }\n if (isInput && !isEscapeEvent) {\n return;\n }\n event.preventDefault();\n\n // TODO: v6 revert #37011 & change markup https://getbootstrap.com/docs/5.3/forms/input-group/\n const getToggleButton = this.matches(SELECTOR_DATA_TOGGLE$3) ? this : SelectorEngine.prev(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.next(this, SELECTOR_DATA_TOGGLE$3)[0] || SelectorEngine.findOne(SELECTOR_DATA_TOGGLE$3, event.delegateTarget.parentNode);\n const instance = Dropdown.getOrCreateInstance(getToggleButton);\n if (isUpOrDownEvent) {\n event.stopPropagation();\n instance.show();\n instance._selectMenuItem(event);\n return;\n }\n if (instance._isShown()) {\n // else is escape and we check if it is shown\n event.stopPropagation();\n instance.hide();\n getToggleButton.focus();\n }\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_DATA_TOGGLE$3, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_KEYDOWN_DATA_API, SELECTOR_MENU, Dropdown.dataApiKeydownHandler);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_KEYUP_DATA_API, Dropdown.clearMenus);\nEventHandler.on(document, EVENT_CLICK_DATA_API$3, SELECTOR_DATA_TOGGLE$3, function (event) {\n event.preventDefault();\n Dropdown.getOrCreateInstance(this).toggle();\n});\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Dropdown);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/backdrop.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$9 = 'backdrop';\nconst CLASS_NAME_FADE$4 = 'fade';\nconst CLASS_NAME_SHOW$5 = 'show';\nconst EVENT_MOUSEDOWN = `mousedown.bs.${NAME$9}`;\nconst Default$8 = {\n className: 'modal-backdrop',\n clickCallback: null,\n isAnimated: false,\n isVisible: true,\n // if false, we use the backdrop helper without adding any element to the dom\n rootElement: 'body' // give the choice to place backdrop under different elements\n};\nconst DefaultType$8 = {\n className: 'string',\n clickCallback: '(function|null)',\n isAnimated: 'boolean',\n isVisible: 'boolean',\n rootElement: '(element|string)'\n};\n\n/**\n * Class definition\n */\n\nclass Backdrop extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isAppended = false;\n this._element = null;\n }\n\n // Getters\n static get Default() {\n return Default$8;\n }\n static get DefaultType() {\n return DefaultType$8;\n }\n static get NAME() {\n return NAME$9;\n }\n\n // Public\n show(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n this._append();\n const element = this._getElement();\n if (this._config.isAnimated) {\n reflow(element);\n }\n element.classList.add(CLASS_NAME_SHOW$5);\n this._emulateAnimation(() => {\n execute(callback);\n });\n }\n hide(callback) {\n if (!this._config.isVisible) {\n execute(callback);\n return;\n }\n this._getElement().classList.remove(CLASS_NAME_SHOW$5);\n this._emulateAnimation(() => {\n this.dispose();\n execute(callback);\n });\n }\n dispose() {\n if (!this._isAppended) {\n return;\n }\n EventHandler.off(this._element, EVENT_MOUSEDOWN);\n this._element.remove();\n this._isAppended = false;\n }\n\n // Private\n _getElement() {\n if (!this._element) {\n const backdrop = document.createElement('div');\n backdrop.className = this._config.className;\n if (this._config.isAnimated) {\n backdrop.classList.add(CLASS_NAME_FADE$4);\n }\n this._element = backdrop;\n }\n return this._element;\n }\n _configAfterMerge(config) {\n // use getElement() with the default \"body\" to get a fresh Element on each instantiation\n config.rootElement = getElement(config.rootElement);\n return config;\n }\n _append() {\n if (this._isAppended) {\n return;\n }\n const element = this._getElement();\n this._config.rootElement.append(element);\n EventHandler.on(element, EVENT_MOUSEDOWN, () => {\n execute(this._config.clickCallback);\n });\n this._isAppended = true;\n }\n _emulateAnimation(callback) {\n executeAfterTransition(callback, this._getElement(), this._config.isAnimated);\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/focustrap.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$8 = 'focustrap';\nconst DATA_KEY$5 = 'bs.focustrap';\nconst EVENT_KEY$5 = `.${DATA_KEY$5}`;\nconst EVENT_FOCUSIN$2 = `focusin${EVENT_KEY$5}`;\nconst EVENT_KEYDOWN_TAB = `keydown.tab${EVENT_KEY$5}`;\nconst TAB_KEY = 'Tab';\nconst TAB_NAV_FORWARD = 'forward';\nconst TAB_NAV_BACKWARD = 'backward';\nconst Default$7 = {\n autofocus: true,\n trapElement: null // The element to trap focus inside of\n};\nconst DefaultType$7 = {\n autofocus: 'boolean',\n trapElement: 'element'\n};\n\n/**\n * Class definition\n */\n\nclass FocusTrap extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n this._isActive = false;\n this._lastTabNavDirection = null;\n }\n\n // Getters\n static get Default() {\n return Default$7;\n }\n static get DefaultType() {\n return DefaultType$7;\n }\n static get NAME() {\n return NAME$8;\n }\n\n // Public\n activate() {\n if (this._isActive) {\n return;\n }\n if (this._config.autofocus) {\n this._config.trapElement.focus();\n }\n EventHandler.off(document, EVENT_KEY$5); // guard against infinite focus loop\n EventHandler.on(document, EVENT_FOCUSIN$2, event => this._handleFocusin(event));\n EventHandler.on(document, EVENT_KEYDOWN_TAB, event => this._handleKeydown(event));\n this._isActive = true;\n }\n deactivate() {\n if (!this._isActive) {\n return;\n }\n this._isActive = false;\n EventHandler.off(document, EVENT_KEY$5);\n }\n\n // Private\n _handleFocusin(event) {\n const {\n trapElement\n } = this._config;\n if (event.target === document || event.target === trapElement || trapElement.contains(event.target)) {\n return;\n }\n const elements = SelectorEngine.focusableChildren(trapElement);\n if (elements.length === 0) {\n trapElement.focus();\n } else if (this._lastTabNavDirection === TAB_NAV_BACKWARD) {\n elements[elements.length - 1].focus();\n } else {\n elements[0].focus();\n }\n }\n _handleKeydown(event) {\n if (event.key !== TAB_KEY) {\n return;\n }\n this._lastTabNavDirection = event.shiftKey ? TAB_NAV_BACKWARD : TAB_NAV_FORWARD;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/scrollBar.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst SELECTOR_FIXED_CONTENT = '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top';\nconst SELECTOR_STICKY_CONTENT = '.sticky-top';\nconst PROPERTY_PADDING = 'padding-right';\nconst PROPERTY_MARGIN = 'margin-right';\n\n/**\n * Class definition\n */\n\nclass ScrollBarHelper {\n constructor() {\n this._element = document.body;\n }\n\n // Public\n getWidth() {\n // https://developer.mozilla.org/en-US/docs/Web/API/Window/innerWidth#usage_notes\n const documentWidth = document.documentElement.clientWidth;\n return Math.abs(window.innerWidth - documentWidth);\n }\n hide() {\n const width = this.getWidth();\n this._disableOverFlow();\n // give padding to element to balance the hidden scrollbar width\n this._setElementAttributes(this._element, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n // trick: We adjust positive paddingRight and negative marginRight to sticky-top elements to keep showing fullwidth\n this._setElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING, calculatedValue => calculatedValue + width);\n this._setElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN, calculatedValue => calculatedValue - width);\n }\n reset() {\n this._resetElementAttributes(this._element, 'overflow');\n this._resetElementAttributes(this._element, PROPERTY_PADDING);\n this._resetElementAttributes(SELECTOR_FIXED_CONTENT, PROPERTY_PADDING);\n this._resetElementAttributes(SELECTOR_STICKY_CONTENT, PROPERTY_MARGIN);\n }\n isOverflowing() {\n return this.getWidth() > 0;\n }\n\n // Private\n _disableOverFlow() {\n this._saveInitialAttribute(this._element, 'overflow');\n this._element.style.overflow = 'hidden';\n }\n _setElementAttributes(selector, styleProperty, callback) {\n const scrollbarWidth = this.getWidth();\n const manipulationCallBack = element => {\n if (element !== this._element && window.innerWidth > element.clientWidth + scrollbarWidth) {\n return;\n }\n this._saveInitialAttribute(element, styleProperty);\n const calculatedValue = window.getComputedStyle(element).getPropertyValue(styleProperty);\n element.style.setProperty(styleProperty, `${callback(Number.parseFloat(calculatedValue))}px`);\n };\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n _saveInitialAttribute(element, styleProperty) {\n const actualValue = element.style.getPropertyValue(styleProperty);\n if (actualValue) {\n Manipulator.setDataAttribute(element, styleProperty, actualValue);\n }\n }\n _resetElementAttributes(selector, styleProperty) {\n const manipulationCallBack = element => {\n const value = Manipulator.getDataAttribute(element, styleProperty);\n // We only want to remove the property if the value is `null`; the value can also be zero\n if (value === null) {\n element.style.removeProperty(styleProperty);\n return;\n }\n Manipulator.removeDataAttribute(element, styleProperty);\n element.style.setProperty(styleProperty, value);\n };\n this._applyManipulationCallback(selector, manipulationCallBack);\n }\n _applyManipulationCallback(selector, callBack) {\n if (isElement(selector)) {\n callBack(selector);\n return;\n }\n for (const sel of SelectorEngine.find(selector, this._element)) {\n callBack(sel);\n }\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap modal.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$7 = 'modal';\nconst DATA_KEY$4 = 'bs.modal';\nconst EVENT_KEY$4 = `.${DATA_KEY$4}`;\nconst DATA_API_KEY$2 = '.data-api';\nconst ESCAPE_KEY$1 = 'Escape';\nconst EVENT_HIDE$4 = `hide${EVENT_KEY$4}`;\nconst EVENT_HIDE_PREVENTED$1 = `hidePrevented${EVENT_KEY$4}`;\nconst EVENT_HIDDEN$4 = `hidden${EVENT_KEY$4}`;\nconst EVENT_SHOW$4 = `show${EVENT_KEY$4}`;\nconst EVENT_SHOWN$4 = `shown${EVENT_KEY$4}`;\nconst EVENT_RESIZE$1 = `resize${EVENT_KEY$4}`;\nconst EVENT_CLICK_DISMISS = `click.dismiss${EVENT_KEY$4}`;\nconst EVENT_MOUSEDOWN_DISMISS = `mousedown.dismiss${EVENT_KEY$4}`;\nconst EVENT_KEYDOWN_DISMISS$1 = `keydown.dismiss${EVENT_KEY$4}`;\nconst EVENT_CLICK_DATA_API$2 = `click${EVENT_KEY$4}${DATA_API_KEY$2}`;\nconst CLASS_NAME_OPEN = 'modal-open';\nconst CLASS_NAME_FADE$3 = 'fade';\nconst CLASS_NAME_SHOW$4 = 'show';\nconst CLASS_NAME_STATIC = 'modal-static';\nconst OPEN_SELECTOR$1 = '.modal.show';\nconst SELECTOR_DIALOG = '.modal-dialog';\nconst SELECTOR_MODAL_BODY = '.modal-body';\nconst SELECTOR_DATA_TOGGLE$2 = '[data-bs-toggle=\"modal\"]';\nconst Default$6 = {\n backdrop: true,\n focus: true,\n keyboard: true\n};\nconst DefaultType$6 = {\n backdrop: '(boolean|string)',\n focus: 'boolean',\n keyboard: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Modal extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._dialog = SelectorEngine.findOne(SELECTOR_DIALOG, this._element);\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._isShown = false;\n this._isTransitioning = false;\n this._scrollBar = new ScrollBarHelper();\n this._addEventListeners();\n }\n\n // Getters\n static get Default() {\n return Default$6;\n }\n static get DefaultType() {\n return DefaultType$6;\n }\n static get NAME() {\n return NAME$7;\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n show(relatedTarget) {\n if (this._isShown || this._isTransitioning) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$4, {\n relatedTarget\n });\n if (showEvent.defaultPrevented) {\n return;\n }\n this._isShown = true;\n this._isTransitioning = true;\n this._scrollBar.hide();\n document.body.classList.add(CLASS_NAME_OPEN);\n this._adjustDialog();\n this._backdrop.show(() => this._showElement(relatedTarget));\n }\n hide() {\n if (!this._isShown || this._isTransitioning) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$4);\n if (hideEvent.defaultPrevented) {\n return;\n }\n this._isShown = false;\n this._isTransitioning = true;\n this._focustrap.deactivate();\n this._element.classList.remove(CLASS_NAME_SHOW$4);\n this._queueCallback(() => this._hideModal(), this._element, this._isAnimated());\n }\n dispose() {\n EventHandler.off(window, EVENT_KEY$4);\n EventHandler.off(this._dialog, EVENT_KEY$4);\n this._backdrop.dispose();\n this._focustrap.deactivate();\n super.dispose();\n }\n handleUpdate() {\n this._adjustDialog();\n }\n\n // Private\n _initializeBackDrop() {\n return new Backdrop({\n isVisible: Boolean(this._config.backdrop),\n // 'static' option will be translated to true, and booleans will keep their value,\n isAnimated: this._isAnimated()\n });\n }\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n _showElement(relatedTarget) {\n // try to append dynamic modal\n if (!document.body.contains(this._element)) {\n document.body.append(this._element);\n }\n this._element.style.display = 'block';\n this._element.removeAttribute('aria-hidden');\n this._element.setAttribute('aria-modal', true);\n this._element.setAttribute('role', 'dialog');\n this._element.scrollTop = 0;\n const modalBody = SelectorEngine.findOne(SELECTOR_MODAL_BODY, this._dialog);\n if (modalBody) {\n modalBody.scrollTop = 0;\n }\n reflow(this._element);\n this._element.classList.add(CLASS_NAME_SHOW$4);\n const transitionComplete = () => {\n if (this._config.focus) {\n this._focustrap.activate();\n }\n this._isTransitioning = false;\n EventHandler.trigger(this._element, EVENT_SHOWN$4, {\n relatedTarget\n });\n };\n this._queueCallback(transitionComplete, this._dialog, this._isAnimated());\n }\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS$1, event => {\n if (event.key !== ESCAPE_KEY$1) {\n return;\n }\n if (this._config.keyboard) {\n this.hide();\n return;\n }\n this._triggerBackdropTransition();\n });\n EventHandler.on(window, EVENT_RESIZE$1, () => {\n if (this._isShown && !this._isTransitioning) {\n this._adjustDialog();\n }\n });\n EventHandler.on(this._element, EVENT_MOUSEDOWN_DISMISS, event => {\n // a bad trick to segregate clicks that may start inside dialog but end outside, and avoid listen to scrollbar clicks\n EventHandler.one(this._element, EVENT_CLICK_DISMISS, event2 => {\n if (this._element !== event.target || this._element !== event2.target) {\n return;\n }\n if (this._config.backdrop === 'static') {\n this._triggerBackdropTransition();\n return;\n }\n if (this._config.backdrop) {\n this.hide();\n }\n });\n });\n }\n _hideModal() {\n this._element.style.display = 'none';\n this._element.setAttribute('aria-hidden', true);\n this._element.removeAttribute('aria-modal');\n this._element.removeAttribute('role');\n this._isTransitioning = false;\n this._backdrop.hide(() => {\n document.body.classList.remove(CLASS_NAME_OPEN);\n this._resetAdjustments();\n this._scrollBar.reset();\n EventHandler.trigger(this._element, EVENT_HIDDEN$4);\n });\n }\n _isAnimated() {\n return this._element.classList.contains(CLASS_NAME_FADE$3);\n }\n _triggerBackdropTransition() {\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED$1);\n if (hideEvent.defaultPrevented) {\n return;\n }\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const initialOverflowY = this._element.style.overflowY;\n // return if the following background transition hasn't yet completed\n if (initialOverflowY === 'hidden' || this._element.classList.contains(CLASS_NAME_STATIC)) {\n return;\n }\n if (!isModalOverflowing) {\n this._element.style.overflowY = 'hidden';\n }\n this._element.classList.add(CLASS_NAME_STATIC);\n this._queueCallback(() => {\n this._element.classList.remove(CLASS_NAME_STATIC);\n this._queueCallback(() => {\n this._element.style.overflowY = initialOverflowY;\n }, this._dialog);\n }, this._dialog);\n this._element.focus();\n }\n\n /**\n * The following methods are used to handle overflowing modals\n */\n\n _adjustDialog() {\n const isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight;\n const scrollbarWidth = this._scrollBar.getWidth();\n const isBodyOverflowing = scrollbarWidth > 0;\n if (isBodyOverflowing && !isModalOverflowing) {\n const property = isRTL() ? 'paddingLeft' : 'paddingRight';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n if (!isBodyOverflowing && isModalOverflowing) {\n const property = isRTL() ? 'paddingRight' : 'paddingLeft';\n this._element.style[property] = `${scrollbarWidth}px`;\n }\n }\n _resetAdjustments() {\n this._element.style.paddingLeft = '';\n this._element.style.paddingRight = '';\n }\n\n // Static\n static jQueryInterface(config, relatedTarget) {\n return this.each(function () {\n const data = Modal.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](relatedTarget);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$2, SELECTOR_DATA_TOGGLE$2, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n EventHandler.one(target, EVENT_SHOW$4, showEvent => {\n if (showEvent.defaultPrevented) {\n // only register focus restorer if modal will actually get shown\n return;\n }\n EventHandler.one(target, EVENT_HIDDEN$4, () => {\n if (isVisible(this)) {\n this.focus();\n }\n });\n });\n\n // avoid conflict when clicking modal toggler while another one is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR$1);\n if (alreadyOpen) {\n Modal.getInstance(alreadyOpen).hide();\n }\n const data = Modal.getOrCreateInstance(target);\n data.toggle(this);\n});\nenableDismissTrigger(Modal);\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Modal);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap offcanvas.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$6 = 'offcanvas';\nconst DATA_KEY$3 = 'bs.offcanvas';\nconst EVENT_KEY$3 = `.${DATA_KEY$3}`;\nconst DATA_API_KEY$1 = '.data-api';\nconst EVENT_LOAD_DATA_API$2 = `load${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst ESCAPE_KEY = 'Escape';\nconst CLASS_NAME_SHOW$3 = 'show';\nconst CLASS_NAME_SHOWING$1 = 'showing';\nconst CLASS_NAME_HIDING = 'hiding';\nconst CLASS_NAME_BACKDROP = 'offcanvas-backdrop';\nconst OPEN_SELECTOR = '.offcanvas.show';\nconst EVENT_SHOW$3 = `show${EVENT_KEY$3}`;\nconst EVENT_SHOWN$3 = `shown${EVENT_KEY$3}`;\nconst EVENT_HIDE$3 = `hide${EVENT_KEY$3}`;\nconst EVENT_HIDE_PREVENTED = `hidePrevented${EVENT_KEY$3}`;\nconst EVENT_HIDDEN$3 = `hidden${EVENT_KEY$3}`;\nconst EVENT_RESIZE = `resize${EVENT_KEY$3}`;\nconst EVENT_CLICK_DATA_API$1 = `click${EVENT_KEY$3}${DATA_API_KEY$1}`;\nconst EVENT_KEYDOWN_DISMISS = `keydown.dismiss${EVENT_KEY$3}`;\nconst SELECTOR_DATA_TOGGLE$1 = '[data-bs-toggle=\"offcanvas\"]';\nconst Default$5 = {\n backdrop: true,\n keyboard: true,\n scroll: false\n};\nconst DefaultType$5 = {\n backdrop: '(boolean|string)',\n keyboard: 'boolean',\n scroll: 'boolean'\n};\n\n/**\n * Class definition\n */\n\nclass Offcanvas extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n this._isShown = false;\n this._backdrop = this._initializeBackDrop();\n this._focustrap = this._initializeFocusTrap();\n this._addEventListeners();\n }\n\n // Getters\n static get Default() {\n return Default$5;\n }\n static get DefaultType() {\n return DefaultType$5;\n }\n static get NAME() {\n return NAME$6;\n }\n\n // Public\n toggle(relatedTarget) {\n return this._isShown ? this.hide() : this.show(relatedTarget);\n }\n show(relatedTarget) {\n if (this._isShown) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, EVENT_SHOW$3, {\n relatedTarget\n });\n if (showEvent.defaultPrevented) {\n return;\n }\n this._isShown = true;\n this._backdrop.show();\n if (!this._config.scroll) {\n new ScrollBarHelper().hide();\n }\n this._element.setAttribute('aria-modal', true);\n this._element.setAttribute('role', 'dialog');\n this._element.classList.add(CLASS_NAME_SHOWING$1);\n const completeCallBack = () => {\n if (!this._config.scroll || this._config.backdrop) {\n this._focustrap.activate();\n }\n this._element.classList.add(CLASS_NAME_SHOW$3);\n this._element.classList.remove(CLASS_NAME_SHOWING$1);\n EventHandler.trigger(this._element, EVENT_SHOWN$3, {\n relatedTarget\n });\n };\n this._queueCallback(completeCallBack, this._element, true);\n }\n hide() {\n if (!this._isShown) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, EVENT_HIDE$3);\n if (hideEvent.defaultPrevented) {\n return;\n }\n this._focustrap.deactivate();\n this._element.blur();\n this._isShown = false;\n this._element.classList.add(CLASS_NAME_HIDING);\n this._backdrop.hide();\n const completeCallback = () => {\n this._element.classList.remove(CLASS_NAME_SHOW$3, CLASS_NAME_HIDING);\n this._element.removeAttribute('aria-modal');\n this._element.removeAttribute('role');\n if (!this._config.scroll) {\n new ScrollBarHelper().reset();\n }\n EventHandler.trigger(this._element, EVENT_HIDDEN$3);\n };\n this._queueCallback(completeCallback, this._element, true);\n }\n dispose() {\n this._backdrop.dispose();\n this._focustrap.deactivate();\n super.dispose();\n }\n\n // Private\n _initializeBackDrop() {\n const clickCallback = () => {\n if (this._config.backdrop === 'static') {\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n return;\n }\n this.hide();\n };\n\n // 'static' option will be translated to true, and booleans will keep their value\n const isVisible = Boolean(this._config.backdrop);\n return new Backdrop({\n className: CLASS_NAME_BACKDROP,\n isVisible,\n isAnimated: true,\n rootElement: this._element.parentNode,\n clickCallback: isVisible ? clickCallback : null\n });\n }\n _initializeFocusTrap() {\n return new FocusTrap({\n trapElement: this._element\n });\n }\n _addEventListeners() {\n EventHandler.on(this._element, EVENT_KEYDOWN_DISMISS, event => {\n if (event.key !== ESCAPE_KEY) {\n return;\n }\n if (this._config.keyboard) {\n this.hide();\n return;\n }\n EventHandler.trigger(this._element, EVENT_HIDE_PREVENTED);\n });\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Offcanvas.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (data[config] === undefined || config.startsWith('_') || config === 'constructor') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config](this);\n });\n }\n}\n\n/**\n * Data API implementation\n */\n\nEventHandler.on(document, EVENT_CLICK_DATA_API$1, SELECTOR_DATA_TOGGLE$1, function (event) {\n const target = SelectorEngine.getElementFromSelector(this);\n if (['A', 'AREA'].includes(this.tagName)) {\n event.preventDefault();\n }\n if (isDisabled(this)) {\n return;\n }\n EventHandler.one(target, EVENT_HIDDEN$3, () => {\n // focus on trigger when it is closed\n if (isVisible(this)) {\n this.focus();\n }\n });\n\n // avoid conflict when clicking a toggler of an offcanvas, while another is open\n const alreadyOpen = SelectorEngine.findOne(OPEN_SELECTOR);\n if (alreadyOpen && alreadyOpen !== target) {\n Offcanvas.getInstance(alreadyOpen).hide();\n }\n const data = Offcanvas.getOrCreateInstance(target);\n data.toggle(this);\n});\nEventHandler.on(window, EVENT_LOAD_DATA_API$2, () => {\n for (const selector of SelectorEngine.find(OPEN_SELECTOR)) {\n Offcanvas.getOrCreateInstance(selector).show();\n }\n});\nEventHandler.on(window, EVENT_RESIZE, () => {\n for (const element of SelectorEngine.find('[aria-modal][class*=show][class*=offcanvas-]')) {\n if (getComputedStyle(element).position !== 'fixed') {\n Offcanvas.getOrCreateInstance(element).hide();\n }\n }\n});\nenableDismissTrigger(Offcanvas);\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Offcanvas);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/sanitizer.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n// js-docs-start allow-list\nconst ARIA_ATTRIBUTE_PATTERN = /^aria-[\\w-]*$/i;\nconst DefaultAllowlist = {\n // Global attributes allowed on any supplied element below.\n '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN],\n a: ['target', 'href', 'title', 'rel'],\n area: [],\n b: [],\n br: [],\n col: [],\n code: [],\n dd: [],\n div: [],\n dl: [],\n dt: [],\n em: [],\n hr: [],\n h1: [],\n h2: [],\n h3: [],\n h4: [],\n h5: [],\n h6: [],\n i: [],\n img: ['src', 'srcset', 'alt', 'title', 'width', 'height'],\n li: [],\n ol: [],\n p: [],\n pre: [],\n s: [],\n small: [],\n span: [],\n sub: [],\n sup: [],\n strong: [],\n u: [],\n ul: []\n};\n// js-docs-end allow-list\n\nconst uriAttributes = new Set(['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']);\n\n/**\n * A pattern that recognizes URLs that are safe wrt. XSS in URL navigation\n * contexts.\n *\n * Shout-out to Angular https://github.com/angular/angular/blob/15.2.8/packages/core/src/sanitization/url_sanitizer.ts#L38\n */\n// eslint-disable-next-line unicorn/better-regex\nconst SAFE_URL_PATTERN = /^(?!javascript:)(?:[a-z0-9+.-]+:|[^&:/?#]*(?:[/?#]|$))/i;\nconst allowedAttribute = (attribute, allowedAttributeList) => {\n const attributeName = attribute.nodeName.toLowerCase();\n if (allowedAttributeList.includes(attributeName)) {\n if (uriAttributes.has(attributeName)) {\n return Boolean(SAFE_URL_PATTERN.test(attribute.nodeValue));\n }\n return true;\n }\n\n // Check if a regular expression validates the attribute.\n return allowedAttributeList.filter(attributeRegex => attributeRegex instanceof RegExp).some(regex => regex.test(attributeName));\n};\nfunction sanitizeHtml(unsafeHtml, allowList, sanitizeFunction) {\n if (!unsafeHtml.length) {\n return unsafeHtml;\n }\n if (sanitizeFunction && typeof sanitizeFunction === 'function') {\n return sanitizeFunction(unsafeHtml);\n }\n const domParser = new window.DOMParser();\n const createdDocument = domParser.parseFromString(unsafeHtml, 'text/html');\n const elements = [].concat(...createdDocument.body.querySelectorAll('*'));\n for (const element of elements) {\n const elementName = element.nodeName.toLowerCase();\n if (!Object.keys(allowList).includes(elementName)) {\n element.remove();\n continue;\n }\n const attributeList = [].concat(...element.attributes);\n const allowedAttributes = [].concat(allowList['*'] || [], allowList[elementName] || []);\n for (const attribute of attributeList) {\n if (!allowedAttribute(attribute, allowedAttributes)) {\n element.removeAttribute(attribute.nodeName);\n }\n }\n }\n return createdDocument.body.innerHTML;\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap util/template-factory.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$5 = 'TemplateFactory';\nconst Default$4 = {\n allowList: DefaultAllowlist,\n content: {},\n // { selector : text , selector2 : text2 , }\n extraClass: '',\n html: false,\n sanitize: true,\n sanitizeFn: null,\n template: '
'\n};\nconst DefaultType$4 = {\n allowList: 'object',\n content: 'object',\n extraClass: '(string|function)',\n html: 'boolean',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n template: 'string'\n};\nconst DefaultContentType = {\n entry: '(string|element|function|null)',\n selector: '(string|element)'\n};\n\n/**\n * Class definition\n */\n\nclass TemplateFactory extends Config {\n constructor(config) {\n super();\n this._config = this._getConfig(config);\n }\n\n // Getters\n static get Default() {\n return Default$4;\n }\n static get DefaultType() {\n return DefaultType$4;\n }\n static get NAME() {\n return NAME$5;\n }\n\n // Public\n getContent() {\n return Object.values(this._config.content).map(config => this._resolvePossibleFunction(config)).filter(Boolean);\n }\n hasContent() {\n return this.getContent().length > 0;\n }\n changeContent(content) {\n this._checkContent(content);\n this._config.content = {\n ...this._config.content,\n ...content\n };\n return this;\n }\n toHtml() {\n const templateWrapper = document.createElement('div');\n templateWrapper.innerHTML = this._maybeSanitize(this._config.template);\n for (const [selector, text] of Object.entries(this._config.content)) {\n this._setContent(templateWrapper, text, selector);\n }\n const template = templateWrapper.children[0];\n const extraClass = this._resolvePossibleFunction(this._config.extraClass);\n if (extraClass) {\n template.classList.add(...extraClass.split(' '));\n }\n return template;\n }\n\n // Private\n _typeCheckConfig(config) {\n super._typeCheckConfig(config);\n this._checkContent(config.content);\n }\n _checkContent(arg) {\n for (const [selector, content] of Object.entries(arg)) {\n super._typeCheckConfig({\n selector,\n entry: content\n }, DefaultContentType);\n }\n }\n _setContent(template, content, selector) {\n const templateElement = SelectorEngine.findOne(selector, template);\n if (!templateElement) {\n return;\n }\n content = this._resolvePossibleFunction(content);\n if (!content) {\n templateElement.remove();\n return;\n }\n if (isElement(content)) {\n this._putElementInTemplate(getElement(content), templateElement);\n return;\n }\n if (this._config.html) {\n templateElement.innerHTML = this._maybeSanitize(content);\n return;\n }\n templateElement.textContent = content;\n }\n _maybeSanitize(arg) {\n return this._config.sanitize ? sanitizeHtml(arg, this._config.allowList, this._config.sanitizeFn) : arg;\n }\n _resolvePossibleFunction(arg) {\n return execute(arg, [this]);\n }\n _putElementInTemplate(element, templateElement) {\n if (this._config.html) {\n templateElement.innerHTML = '';\n templateElement.append(element);\n return;\n }\n templateElement.textContent = element.textContent;\n }\n}\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap tooltip.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$4 = 'tooltip';\nconst DISALLOWED_ATTRIBUTES = new Set(['sanitize', 'allowList', 'sanitizeFn']);\nconst CLASS_NAME_FADE$2 = 'fade';\nconst CLASS_NAME_MODAL = 'modal';\nconst CLASS_NAME_SHOW$2 = 'show';\nconst SELECTOR_TOOLTIP_INNER = '.tooltip-inner';\nconst SELECTOR_MODAL = `.${CLASS_NAME_MODAL}`;\nconst EVENT_MODAL_HIDE = 'hide.bs.modal';\nconst TRIGGER_HOVER = 'hover';\nconst TRIGGER_FOCUS = 'focus';\nconst TRIGGER_CLICK = 'click';\nconst TRIGGER_MANUAL = 'manual';\nconst EVENT_HIDE$2 = 'hide';\nconst EVENT_HIDDEN$2 = 'hidden';\nconst EVENT_SHOW$2 = 'show';\nconst EVENT_SHOWN$2 = 'shown';\nconst EVENT_INSERTED = 'inserted';\nconst EVENT_CLICK$1 = 'click';\nconst EVENT_FOCUSIN$1 = 'focusin';\nconst EVENT_FOCUSOUT$1 = 'focusout';\nconst EVENT_MOUSEENTER = 'mouseenter';\nconst EVENT_MOUSELEAVE = 'mouseleave';\nconst AttachmentMap = {\n AUTO: 'auto',\n TOP: 'top',\n RIGHT: isRTL() ? 'left' : 'right',\n BOTTOM: 'bottom',\n LEFT: isRTL() ? 'right' : 'left'\n};\nconst Default$3 = {\n allowList: DefaultAllowlist,\n animation: true,\n boundary: 'clippingParents',\n container: false,\n customClass: '',\n delay: 0,\n fallbackPlacements: ['top', 'right', 'bottom', 'left'],\n html: false,\n offset: [0, 6],\n placement: 'top',\n popperConfig: null,\n sanitize: true,\n sanitizeFn: null,\n selector: false,\n template: '
' + '
' + '
' + '
',\n title: '',\n trigger: 'hover focus'\n};\nconst DefaultType$3 = {\n allowList: 'object',\n animation: 'boolean',\n boundary: '(string|element)',\n container: '(string|element|boolean)',\n customClass: '(string|function)',\n delay: '(number|object)',\n fallbackPlacements: 'array',\n html: 'boolean',\n offset: '(array|string|function)',\n placement: '(string|function)',\n popperConfig: '(null|object|function)',\n sanitize: 'boolean',\n sanitizeFn: '(null|function)',\n selector: '(string|boolean)',\n template: 'string',\n title: '(string|element|function)',\n trigger: 'string'\n};\n\n/**\n * Class definition\n */\n\nclass Tooltip extends BaseComponent {\n constructor(element, config) {\n if (typeof Popper === 'undefined') {\n throw new TypeError('Bootstrap\\'s tooltips require Popper (https://popper.js.org)');\n }\n super(element, config);\n\n // Private\n this._isEnabled = true;\n this._timeout = 0;\n this._isHovered = null;\n this._activeTrigger = {};\n this._popper = null;\n this._templateFactory = null;\n this._newContent = null;\n\n // Protected\n this.tip = null;\n this._setListeners();\n if (!this._config.selector) {\n this._fixTitle();\n }\n }\n\n // Getters\n static get Default() {\n return Default$3;\n }\n static get DefaultType() {\n return DefaultType$3;\n }\n static get NAME() {\n return NAME$4;\n }\n\n // Public\n enable() {\n this._isEnabled = true;\n }\n disable() {\n this._isEnabled = false;\n }\n toggleEnabled() {\n this._isEnabled = !this._isEnabled;\n }\n toggle() {\n if (!this._isEnabled) {\n return;\n }\n this._activeTrigger.click = !this._activeTrigger.click;\n if (this._isShown()) {\n this._leave();\n return;\n }\n this._enter();\n }\n dispose() {\n clearTimeout(this._timeout);\n EventHandler.off(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n if (this._element.getAttribute('data-bs-original-title')) {\n this._element.setAttribute('title', this._element.getAttribute('data-bs-original-title'));\n }\n this._disposePopper();\n super.dispose();\n }\n show() {\n if (this._element.style.display === 'none') {\n throw new Error('Please use show on visible elements');\n }\n if (!(this._isWithContent() && this._isEnabled)) {\n return;\n }\n const showEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOW$2));\n const shadowRoot = findShadowRoot(this._element);\n const isInTheDom = (shadowRoot || this._element.ownerDocument.documentElement).contains(this._element);\n if (showEvent.defaultPrevented || !isInTheDom) {\n return;\n }\n\n // TODO: v6 remove this or make it optional\n this._disposePopper();\n const tip = this._getTipElement();\n this._element.setAttribute('aria-describedby', tip.getAttribute('id'));\n const {\n container\n } = this._config;\n if (!this._element.ownerDocument.documentElement.contains(this.tip)) {\n container.append(tip);\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_INSERTED));\n }\n this._popper = this._createPopper(tip);\n tip.classList.add(CLASS_NAME_SHOW$2);\n\n // If this is a touch-enabled device we add extra\n // empty mouseover listeners to the body's immediate children;\n // only needed because of broken event delegation on iOS\n // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.on(element, 'mouseover', noop);\n }\n }\n const complete = () => {\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_SHOWN$2));\n if (this._isHovered === false) {\n this._leave();\n }\n this._isHovered = false;\n };\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n hide() {\n if (!this._isShown()) {\n return;\n }\n const hideEvent = EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDE$2));\n if (hideEvent.defaultPrevented) {\n return;\n }\n const tip = this._getTipElement();\n tip.classList.remove(CLASS_NAME_SHOW$2);\n\n // If this is a touch-enabled device we remove the extra\n // empty mouseover listeners we added for iOS support\n if ('ontouchstart' in document.documentElement) {\n for (const element of [].concat(...document.body.children)) {\n EventHandler.off(element, 'mouseover', noop);\n }\n }\n this._activeTrigger[TRIGGER_CLICK] = false;\n this._activeTrigger[TRIGGER_FOCUS] = false;\n this._activeTrigger[TRIGGER_HOVER] = false;\n this._isHovered = null; // it is a trick to support manual triggering\n\n const complete = () => {\n if (this._isWithActiveTrigger()) {\n return;\n }\n if (!this._isHovered) {\n this._disposePopper();\n }\n this._element.removeAttribute('aria-describedby');\n EventHandler.trigger(this._element, this.constructor.eventName(EVENT_HIDDEN$2));\n };\n this._queueCallback(complete, this.tip, this._isAnimated());\n }\n update() {\n if (this._popper) {\n this._popper.update();\n }\n }\n\n // Protected\n _isWithContent() {\n return Boolean(this._getTitle());\n }\n _getTipElement() {\n if (!this.tip) {\n this.tip = this._createTipElement(this._newContent || this._getContentForTemplate());\n }\n return this.tip;\n }\n _createTipElement(content) {\n const tip = this._getTemplateFactory(content).toHtml();\n\n // TODO: remove this check in v6\n if (!tip) {\n return null;\n }\n tip.classList.remove(CLASS_NAME_FADE$2, CLASS_NAME_SHOW$2);\n // TODO: v6 the following can be achieved with CSS only\n tip.classList.add(`bs-${this.constructor.NAME}-auto`);\n const tipId = getUID(this.constructor.NAME).toString();\n tip.setAttribute('id', tipId);\n if (this._isAnimated()) {\n tip.classList.add(CLASS_NAME_FADE$2);\n }\n return tip;\n }\n setContent(content) {\n this._newContent = content;\n if (this._isShown()) {\n this._disposePopper();\n this.show();\n }\n }\n _getTemplateFactory(content) {\n if (this._templateFactory) {\n this._templateFactory.changeContent(content);\n } else {\n this._templateFactory = new TemplateFactory({\n ...this._config,\n // the `content` var has to be after `this._config`\n // to override config.content in case of popover\n content,\n extraClass: this._resolvePossibleFunction(this._config.customClass)\n });\n }\n return this._templateFactory;\n }\n _getContentForTemplate() {\n return {\n [SELECTOR_TOOLTIP_INNER]: this._getTitle()\n };\n }\n _getTitle() {\n return this._resolvePossibleFunction(this._config.title) || this._element.getAttribute('data-bs-original-title');\n }\n\n // Private\n _initializeOnDelegatedTarget(event) {\n return this.constructor.getOrCreateInstance(event.delegateTarget, this._getDelegateConfig());\n }\n _isAnimated() {\n return this._config.animation || this.tip && this.tip.classList.contains(CLASS_NAME_FADE$2);\n }\n _isShown() {\n return this.tip && this.tip.classList.contains(CLASS_NAME_SHOW$2);\n }\n _createPopper(tip) {\n const placement = execute(this._config.placement, [this, tip, this._element]);\n const attachment = AttachmentMap[placement.toUpperCase()];\n return Popper.createPopper(this._element, tip, this._getPopperConfig(attachment));\n }\n _getOffset() {\n const {\n offset\n } = this._config;\n if (typeof offset === 'string') {\n return offset.split(',').map(value => Number.parseInt(value, 10));\n }\n if (typeof offset === 'function') {\n return popperData => offset(popperData, this._element);\n }\n return offset;\n }\n _resolvePossibleFunction(arg) {\n return execute(arg, [this._element]);\n }\n _getPopperConfig(attachment) {\n const defaultBsPopperConfig = {\n placement: attachment,\n modifiers: [{\n name: 'flip',\n options: {\n fallbackPlacements: this._config.fallbackPlacements\n }\n }, {\n name: 'offset',\n options: {\n offset: this._getOffset()\n }\n }, {\n name: 'preventOverflow',\n options: {\n boundary: this._config.boundary\n }\n }, {\n name: 'arrow',\n options: {\n element: `.${this.constructor.NAME}-arrow`\n }\n }, {\n name: 'preSetPlacement',\n enabled: true,\n phase: 'beforeMain',\n fn: data => {\n // Pre-set Popper's placement attribute in order to read the arrow sizes properly.\n // Otherwise, Popper mixes up the width and height dimensions since the initial arrow style is for top placement\n this._getTipElement().setAttribute('data-popper-placement', data.state.placement);\n }\n }]\n };\n return {\n ...defaultBsPopperConfig,\n ...execute(this._config.popperConfig, [defaultBsPopperConfig])\n };\n }\n _setListeners() {\n const triggers = this._config.trigger.split(' ');\n for (const trigger of triggers) {\n if (trigger === 'click') {\n EventHandler.on(this._element, this.constructor.eventName(EVENT_CLICK$1), this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context.toggle();\n });\n } else if (trigger !== TRIGGER_MANUAL) {\n const eventIn = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSEENTER) : this.constructor.eventName(EVENT_FOCUSIN$1);\n const eventOut = trigger === TRIGGER_HOVER ? this.constructor.eventName(EVENT_MOUSELEAVE) : this.constructor.eventName(EVENT_FOCUSOUT$1);\n EventHandler.on(this._element, eventIn, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context._activeTrigger[event.type === 'focusin' ? TRIGGER_FOCUS : TRIGGER_HOVER] = true;\n context._enter();\n });\n EventHandler.on(this._element, eventOut, this._config.selector, event => {\n const context = this._initializeOnDelegatedTarget(event);\n context._activeTrigger[event.type === 'focusout' ? TRIGGER_FOCUS : TRIGGER_HOVER] = context._element.contains(event.relatedTarget);\n context._leave();\n });\n }\n }\n this._hideModalHandler = () => {\n if (this._element) {\n this.hide();\n }\n };\n EventHandler.on(this._element.closest(SELECTOR_MODAL), EVENT_MODAL_HIDE, this._hideModalHandler);\n }\n _fixTitle() {\n const title = this._element.getAttribute('title');\n if (!title) {\n return;\n }\n if (!this._element.getAttribute('aria-label') && !this._element.textContent.trim()) {\n this._element.setAttribute('aria-label', title);\n }\n this._element.setAttribute('data-bs-original-title', title); // DO NOT USE IT. Is only for backwards compatibility\n this._element.removeAttribute('title');\n }\n _enter() {\n if (this._isShown() || this._isHovered) {\n this._isHovered = true;\n return;\n }\n this._isHovered = true;\n this._setTimeout(() => {\n if (this._isHovered) {\n this.show();\n }\n }, this._config.delay.show);\n }\n _leave() {\n if (this._isWithActiveTrigger()) {\n return;\n }\n this._isHovered = false;\n this._setTimeout(() => {\n if (!this._isHovered) {\n this.hide();\n }\n }, this._config.delay.hide);\n }\n _setTimeout(handler, timeout) {\n clearTimeout(this._timeout);\n this._timeout = setTimeout(handler, timeout);\n }\n _isWithActiveTrigger() {\n return Object.values(this._activeTrigger).includes(true);\n }\n _getConfig(config) {\n const dataAttributes = Manipulator.getDataAttributes(this._element);\n for (const dataAttribute of Object.keys(dataAttributes)) {\n if (DISALLOWED_ATTRIBUTES.has(dataAttribute)) {\n delete dataAttributes[dataAttribute];\n }\n }\n config = {\n ...dataAttributes,\n ...(typeof config === 'object' && config ? config : {})\n };\n config = this._mergeConfigObj(config);\n config = this._configAfterMerge(config);\n this._typeCheckConfig(config);\n return config;\n }\n _configAfterMerge(config) {\n config.container = config.container === false ? document.body : getElement(config.container);\n if (typeof config.delay === 'number') {\n config.delay = {\n show: config.delay,\n hide: config.delay\n };\n }\n if (typeof config.title === 'number') {\n config.title = config.title.toString();\n }\n if (typeof config.content === 'number') {\n config.content = config.content.toString();\n }\n return config;\n }\n _getDelegateConfig() {\n const config = {};\n for (const [key, value] of Object.entries(this._config)) {\n if (this.constructor.Default[key] !== value) {\n config[key] = value;\n }\n }\n config.selector = false;\n config.trigger = 'manual';\n\n // In the future can be replaced with:\n // const keysWithDifferentValues = Object.entries(this._config).filter(entry => this.constructor.Default[entry[0]] !== this._config[entry[0]])\n // `Object.fromEntries(keysWithDifferentValues)`\n return config;\n }\n _disposePopper() {\n if (this._popper) {\n this._popper.destroy();\n this._popper = null;\n }\n if (this.tip) {\n this.tip.remove();\n this.tip = null;\n }\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Tooltip.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Tooltip);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap popover.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$3 = 'popover';\nconst SELECTOR_TITLE = '.popover-header';\nconst SELECTOR_CONTENT = '.popover-body';\nconst Default$2 = {\n ...Tooltip.Default,\n content: '',\n offset: [0, 8],\n placement: 'right',\n template: '
' + '
' + '

' + '
' + '
',\n trigger: 'click'\n};\nconst DefaultType$2 = {\n ...Tooltip.DefaultType,\n content: '(null|string|element|function)'\n};\n\n/**\n * Class definition\n */\n\nclass Popover extends Tooltip {\n // Getters\n static get Default() {\n return Default$2;\n }\n static get DefaultType() {\n return DefaultType$2;\n }\n static get NAME() {\n return NAME$3;\n }\n\n // Overrides\n _isWithContent() {\n return this._getTitle() || this._getContent();\n }\n\n // Private\n _getContentForTemplate() {\n return {\n [SELECTOR_TITLE]: this._getTitle(),\n [SELECTOR_CONTENT]: this._getContent()\n };\n }\n _getContent() {\n return this._resolvePossibleFunction(this._config.content);\n }\n\n // Static\n static jQueryInterface(config) {\n return this.each(function () {\n const data = Popover.getOrCreateInstance(this, config);\n if (typeof config !== 'string') {\n return;\n }\n if (typeof data[config] === 'undefined') {\n throw new TypeError(`No method named \"${config}\"`);\n }\n data[config]();\n });\n }\n}\n\n/**\n * jQuery\n */\n\ndefineJQueryPlugin(Popover);\n\n/**\n * --------------------------------------------------------------------------\n * Bootstrap scrollspy.js\n * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)\n * --------------------------------------------------------------------------\n */\n\n\n/**\n * Constants\n */\n\nconst NAME$2 = 'scrollspy';\nconst DATA_KEY$2 = 'bs.scrollspy';\nconst EVENT_KEY$2 = `.${DATA_KEY$2}`;\nconst DATA_API_KEY = '.data-api';\nconst EVENT_ACTIVATE = `activate${EVENT_KEY$2}`;\nconst EVENT_CLICK = `click${EVENT_KEY$2}`;\nconst EVENT_LOAD_DATA_API$1 = `load${EVENT_KEY$2}${DATA_API_KEY}`;\nconst CLASS_NAME_DROPDOWN_ITEM = 'dropdown-item';\nconst CLASS_NAME_ACTIVE$1 = 'active';\nconst SELECTOR_DATA_SPY = '[data-bs-spy=\"scroll\"]';\nconst SELECTOR_TARGET_LINKS = '[href]';\nconst SELECTOR_NAV_LIST_GROUP = '.nav, .list-group';\nconst SELECTOR_NAV_LINKS = '.nav-link';\nconst SELECTOR_NAV_ITEMS = '.nav-item';\nconst SELECTOR_LIST_ITEMS = '.list-group-item';\nconst SELECTOR_LINK_ITEMS = `${SELECTOR_NAV_LINKS}, ${SELECTOR_NAV_ITEMS} > ${SELECTOR_NAV_LINKS}, ${SELECTOR_LIST_ITEMS}`;\nconst SELECTOR_DROPDOWN = '.dropdown';\nconst SELECTOR_DROPDOWN_TOGGLE$1 = '.dropdown-toggle';\nconst Default$1 = {\n offset: null,\n // TODO: v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: '0px 0px -25%',\n smoothScroll: false,\n target: null,\n threshold: [0.1, 0.5, 1]\n};\nconst DefaultType$1 = {\n offset: '(number|null)',\n // TODO v6 @deprecated, keep it for backwards compatibility reasons\n rootMargin: 'string',\n smoothScroll: 'boolean',\n target: 'element',\n threshold: 'array'\n};\n\n/**\n * Class definition\n */\n\nclass ScrollSpy extends BaseComponent {\n constructor(element, config) {\n super(element, config);\n\n // this._element is the observablesContainer and config.target the menu links wrapper\n this._targetLinks = new Map();\n this._observableSections = new Map();\n this._rootElement = getComputedStyle(this._element).overflowY === 'visible' ? null : this._element;\n this._activeTarget = null;\n this._observer = null;\n this._previousScrollData = {\n visibleEntryTop: 0,\n parentScrollTop: 0\n };\n this.refresh(); // initialize\n }\n\n // Getters\n static get Default() {\n return Default$1;\n }\n static get DefaultType() {\n return DefaultType$1;\n }\n static get NAME() {\n return NAME$2;\n }\n\n // Public\n refresh() {\n this._initializeTargetsAndObservables();\n this._maybeEnableSmoothScroll();\n if (this._observer) {\n this._observer.disconnect();\n } else {\n this._observer = this._getNewObserver();\n }\n for (const section of this._observableSections.values()) {\n this._observer.observe(section);\n }\n }\n dispose() {\n this._observer.disconnect();\n super.dispose();\n }\n\n // Private\n _configAfterMerge(config) {\n // TODO: on v6 target should be given explicitly & remove the {target: 'ss-target'} case\n config.target = getElement(config.target) || document.body;\n\n // TODO: v6 Only for backwards compatibility reasons. Use rootMargin only\n config.rootMargin = config.offset ? `${config.offset}px 0px -30%` : config.rootMargin;\n if (typeof config.threshold === 'string') {\n config.threshold = config.threshold.split(',').map(value => Number.parseFloat(value));\n }\n return config;\n }\n _maybeEnableSmoothScroll() {\n if (!this._config.smoothScroll) {\n return;\n }\n\n // unregister any previous listeners\n EventHandler.off(this._config.target, EVENT_CLICK);\n EventHandler.on(this._config.target, EVENT_CLICK, SELECTOR_TARGET_LINKS, event => {\n const observableSection = this._observableSections.get(event.target.hash);\n if (observableSection) {\n event.preventDefault();\n const root = this._rootElement || window;\n const height = observableSection.offsetTop - this._element.offsetTop;\n if (root.scrollTo) {\n root.scrollTo({\n top: height,\n behavior: 'smooth'\n });\n return;\n }\n\n // Chrome 60 doesn't support `scrollTo`\n root.scrollTop = height;\n }\n });\n }\n _getNewObserver() {\n const options = {\n root: this._rootElement,\n threshold: this._config.threshold,\n rootMargin: this._config.rootMargin\n };\n return new IntersectionObserver(entries => this._observerCallback(entries), options);\n }\n\n // The logic of selection\n _observerCallback(entries) {\n const targetElement = entry => this._targetLinks.get(`#${entry.target.id}`);\n const activate = entry => {\n this._previousScrollData.visibleEntryTop = entry.target.offsetTop;\n this._process(targetElement(entry));\n };\n const parentScrollTop = (this._rootElement || document.documentElement).scrollTop;\n const userScrollsDown = parentScrollTop >= this._previousScrollData.parentScrollTop;\n this._previousScrollData.parentScrollTop = parentScrollTop;\n for (const entry of entries) {\n if (!entry.isIntersecting) {\n this._activeTarget = null;\n this._clearActiveClass(targetElement(entry));\n continue;\n }\n const entryIsLowerThanPrevious = entry.target.offsetTop >= this._previousScrollData.visibleEntryTop;\n // if we are scrolling down, pick the bigger offsetTop\n if (userScrollsDown && entryIsLowerThanPrevious) {\n activate(entry);\n // if parent isn't scrolled, let's keep the first visible item, breaking the iteration\n if (!parentScrollTop) {\n return;\n }\n continue;\n }\n\n // if we are scrolling up, pick the smallest offsetTop\n if (!userScrollsDown && !entryIsLowerThanPrevious) {\n activate(entry);\n }\n }\n }\n _initializeTargetsAndObservables() {\n this._targetLinks = new Map();\n this._observableSections = new Map();\n const targetLinks = SelectorEngine.find(SELECTOR_TARGET_LINKS, this._config.target);\n for (const anchor of targetLinks) {\n // ensure that the anchor has an id and is not disabled\n if (!anchor.hash || isDisabled(anchor)) {\n continue;\n }\n const observableSection = SelectorEngine.findOne(decodeURI(anchor.hash), this._element);\n\n // ensure that the observableSection exists & is visible\n if (isVisible(observableSection)) {\n this._targetLinks.set(decodeURI(anchor.hash), anchor);\n this._observableSections.set(anchor.hash, observableSection);\n }\n }\n }\n _process(target) {\n if (this._activeTarget === target) {\n return;\n }\n this._clearActiveClass(this._config.target);\n this._activeTarget = target;\n target.classList.add(CLASS_NAME_ACTIVE$1);\n this._activateParents(target);\n EventHandler.trigger(this._element, EVENT_ACTIVATE, {\n relatedTarget: target\n });\n }\n _activateParents(target) {\n // Activate dropdown parents\n if (target.classList.contains(CLASS_NAME_DROPDOWN_ITEM)) {\n SelectorEngine.findOne(SELECTOR_DROPDOWN_TOGGLE$1, target.closest(SELECTOR_DROPDOWN)).classList.add(CLASS_NAME_ACTIVE$1);\n return;\n }\n for (const listGroup of SelectorEngine.parents(target, SELECTOR_NAV_LIST_GROUP)) {\n // Set triggered links parents as active\n // With both